1. Calculate the % H₂O for each of the following hydrated metal salts?
1. Molecular formula: CaSO4 * 2 H₂O, % water: ???
2. Molecular formula: CoCl2 * 6 H₂O, % water: ???
3. Molecular formula: CuSO4* 5 H2O, % water: ???
4. Molecular formula: MgSO4 * 7 H₂O, % water: ???

2. Based on your Experimental Calculations from the Data Sheet, what is the identity of
your unknown. (Choose from one of the four choices above).

3. What is the % error? (Use only one of your trials for your calculation.)

Answers

Answer 1

The percentage composition of the water of hydration for each compound is shown below.

Percentage of water of hydration

The percentage of water of hydration, also known as percent water of crystallization, is a measure of the amount of water that is chemically bound to a salt or other compound as part of its crystal structure.

1) For CaSO4 * 2 H₂O

36/172 * 100/1

= 21%


For CoCl2 * 6 H₂O

108/238 * 100/1

= 45%

For CuSO4* 5 H2O

90/250 * 100/1

= 36%

For MgSO4 * 7 H₂O

126/246 * 100/1

= 51%

Learn more about hydration :https://brainly.com/question/14229407

#SPJ1


Related Questions

Question 10 (1 point)
What mass of iron (III) nitrate, Fe (NO3)3, is needed to prepare a 125 mL solution of
0.250 M?
7.56 grams
60.5 grams
2.68 grams
30.2 grams

Answers

The mass of iron (III) nitrate needed to prepare a 125 mL solution of 0.250 M is approximately 7.56 grams.

To calculate the mass of iron (III) nitrate needed to prepare a 125 mL solution of 0.250 M, we can use the formula:

mass (in grams) = volume (in liters) x concentration (in moles/liter) x molar mass (in grams/mole)

First, let's convert the volume from milliliters (mL) to liters (L):

125 mL = 0.125 L

Next, we can use the given concentration of 0.250 M to calculate the number of moles of Fe(NO3)3 needed:

moles = concentration x volume

moles = 0.250 mol/L x 0.125 L

moles = 0.03125 mol

Finally, we can use the molar mass of Fe(NO3)3 to convert from moles to grams:

mass = moles x molar mass

mass = 0.03125 mol x 241.86 g/mol

mass ≈ 7.56 g

Learn more about moles, here:

https://brainly.com/question/20486415

#SPJ1

How many moles do 235.5 liters of carbon dioxide

Answers

Gas legislation

PV = nRT

where P is atmospheric pressure

Volume (measured in litres)

The number of moles is n.

R = gas constant (0.0821 L atm/(mol K))

Temperature (in Kelvin) equals T.

We need to rearrange the ideal gas law to solve for n:

n = PV / RT

To use this equation, we need to know the pressure, temperature, and volume of the carbon dioxide.

0.002355 moles of carbon dioxide are equal to 235.5 litres of the petrol. As a result, 0.002355 moles of carbon dioxide are equivalent to 0.053 litres.

This is because 1 mole of carbon dioxide is equal to 22.4 litres. This indicates that there are 0.002355 moles of carbon dioxide for every 0.053 litres of carbon dioxide.

Therefore, there are 0.002355 moles of carbon dioxide in 235.5 litres of carbon dioxide.

Learn more about carbon dioxide at:

https://brainly.com/question/3049557

#SPJ1

A solution of KNO3 is prepared by dissolving 80 g KNO3 in 100 g water at 60oC. The solution is

Group of answer choices

dilute

saturated

unsaturated

supersaturated

Answers

To determine whether the solution is dilute, saturated, unsaturated, or supersaturated, we need to compare the amount of KNO3 that is dissolved in the solution at 60°C to the maximum amount of KNO3 that can be dissolved in water at 60°C.

The solubility of KNO3 in water at 60°C is 110 g per 100 g of water. Since only 80 g of KNO3 was dissolved in 100 g of water, the solution is unsaturated.

Therefore, the answer is unsaturated.

Determine the mass of carbon dioxide that should be produced in the reaction between 3.74g of carbon and excess oxygen what is the maximum recent yield if 11.34g of CO2 is recovers

Answers

13.71g is the mass of carbon dioxide that should be produced in the reaction between 3.74g of carbon and excess oxygen. 83% is the percent yield.

Percent yield in chemistry is the percentage of the product's weight to its theoretical yield. In order to quantify the outcome in percent, we divide the experimental yield with the theoretical yield then multiply the result by 100. Chemists employ an equation called percent yield after a reaction to determine how much material they should have theoretically extracted against how much they actually acquired.

C+ O[tex]_2[/tex] → CO[tex]_2[/tex]

moles of carbon =  3.74/ 12=0.31moles

mass of CO[tex]_2[/tex] =0.31×44=13.71g

% yield =  (11.34/13.71)×  100=83%

To know more about Percent yield, here:

https://brainly.com/question/17042787

#SPJ1

Which type of symbiotic relationship best describes the relationship between cotton plants and wasps?

a: parasitic - the cotton plants are helped, but the wasps are harmed
b: commensal - the cotton plants are helped and the wasps are unaffected
c:mutualistic - both the cotton plants and the wasps are helped

Answers

Answer:

The answer is c. ( mutualistic ).

Explanation:

The relationship between cotton plants and wasps is an example of mutualism. The cotton plants provide a food source in the form of nectar for the wasps, and in return, the wasps serve as pollinators for the cotton plants, which helps the plants reproduce. This is a mutually beneficial relationship, as both species benefit from the interaction. Therefore, the answer is (c) mutualistic.

If this helps, please mark my answer as brainliest so I can get better rank:) thank you

A bag of frozen broccoli weighs 306.0 grams. You microwave it and notice a lot is steam so you weigh after microwaving and it is 275.0 grams. What happened to the percent mass of water? Show your work

Answers

There are different methods to calculate the concentration of a solution. Mass percentage is one among them. Mass percentage is mainly used to calculate the concentration of a binary solution. Here mass percent of water is 10.13.

Mass percentage of a particular component in a solution is equal to mass in grams of that component present per 100 g of the solution. For example, a 5% aqueous solution of urea means 5g of urea in 100 g of its aqueous solution.

Mass percentage = Mass of the component / Total mass of solution × 100

Mass of water = 306.0 - 275.0 = 31

% Mass = 31 / 306.0 × 100 = 10.13%

To know more about mass percentage, visit;

https://brainly.com/question/14990953

#SPJ1

Physicians tend to use units of calories ,in part because that is what their patients use and understand .Food “Calories “ are actually calories. How many calories are in a calorie?
A.10,000
B.1,000
C.100
D.10
E.1

Please help me what is the answer.

Answers

The answer is E. 1.

Determine the pH of a solution that is 0.00501 M HCl and 0.0378 M HClO2. The a of HClO2 is 1.1×10−2
.

Answers

The acidity or alkalinity of a solution depends on the hydronium ion and hydroxide ion concentration. The pH scale is introduced by the scientist Sorensen. The pH of the solution is -1.90.

The pH of a solution is defined as the negative logarithm to the base 10 of the value of the hydronium ion concentration in moles per litre. The pH of the solution is given as:

pH = -log [H₃O⁺]

Dissociation of HCl is:

HCl + H₂O → H₃O⁺ + Cl⁻

Kₐ = [H₃O⁺][Cl⁻] / [HCl]

1.3 × 10⁶ = x × x / 0.00501

x² = 0.00501 × 1.3 × 10⁶ = 6513

x = √6513 = 80.7 M

HClO₂ + H₂O → H₃O⁺ + ClO⁻

Kₐ = [H₃O⁺][ClO⁻] / [HClO₂]

1.1×10⁻² = x² / 0.0378

x² = 0.0378 × 1.1×10⁻² = 0. 00041

x = 0.020 M

Thus the total concentration now is :

x = [H₃O⁺] = 0.020 +  80.7 = 80.72 M

pH = -log [H₃O⁺]

-log[80.72 ] = -1.90

To know more about pH, visit;

https://brainly.com/question/17751847

#SPJ1

How should the Key change for a weak base?

Answers

Weak bases partially ionize in water to produce hydroxide ions. Because the ionization is not complete, the concentration of OH⁻ in a weak base solution is typically much less than the initial base concentration.

NEED HELP FIGURING HOW MANY MOL!! PLEASE QUICK!!THANK YOU SO MUCH

Answers

The number of moles of the gas by the ideal gas law is 0.18 moles.

What is the ideal gas law?

The behavior of an ideal gas, a hypothetical gas made up of randomly moving particles with little volume and no intermolecular interactions, is described by the ideal gas law.

Although intermolecular interactions and non-zero particle volume prevent gases from always behaving in an ideal manner, the ideal gas law is nevertheless a good approximation for many gases under some circumstances.

We know that;

PV = nRT

We have ;

P = 1.2 atm

V = 3.4 L

T = 10 + 273 = 283 K

n = ?

n = PV/RT

n = 1.2 * 3.4/0.082 * 283

n =4.08 /23.2

n = 0.18 moles

Learn more about the ideal gas law:https://brainly.com/question/30458409

#SPJ1

Hi i need help figuring how many mol… please if you can hurry! Thank you

Answers

The number of moles is 0.001734 moles

The Ideal gas law is the equation of state of a hypothetical ideal gas. It is a good approximation to the behaviour of many gases under many conditions, although it has several limitations. The ideal gas equation can be written as

                                    PV = nRT

where,

P = Pressure

V = Volume

T = Temperature

n = number of moles

Given,

Volume = 3.4L

Pressure = 1.2 atm

Temperature = 283K

PV = nRT

1.2 × 3.4 = n × 8.314 × 283

n = 0.001734 moles

Learn more about Ideal Gas law, here:

brainly.com/question/28257995

#SPJ1

pls tysm it is due today

Answers

The reaction that is shown by the option D is a balanced reaction equation.

What is a balanced reaction equation?

We can say that a reaction equation as we have it balanced number of each of the atoms that we have on the left hand side of the reaction equation is the same as the number of the atoms of the elements that we have on the right hand side of the reaction equation.

A reaction equation is a representation of a chemical reaction using chemical formulas and symbols. It shows the reactants on the left-hand side and the products on the right-hand side of the equation, separated by an arrow.

Learn more about reaction equation:https://brainly.com/question/3588292

#SPJ1

Calculate the percentage composition of elements in the following compounds:
a. Water: H₂O
b. Glucose: C6H12O6
c. Calcium nitrate: Ca(NO3)2
d. Aluminum sulfate: Al2(SO4)3
e. Magnesium phosphate: Mg3(PO4)2​

Answers

The percentage composition of Hydrogen (H) in water (H₂O) is 11.1%

Breakdown of How Percentage Composition is Calculated

Percentage composition is finding the amount of individual elements that made up a compound.

To calculate, we use the formula:

% composition = [tex]\frac{Atomic Mass}{Molar Mass} x 100[/tex]

(a) Water: H₂O

To calculate the percentage composition of elements in water, we need to find the molar mass of water, which is:

Molar mass of H₂O = (2 × atomic mass of H) + (1 × atomic mass of O)

Molar mass of H₂O = (2 × 1.0 g/mol) + (1 × 16.00 g/mol)

Molar mass of H₂O = 18.0 g/mol

%Hydrogen = 2/18 x100 = 11.11

%Oxygen: 16/18 x 100 = 88.89%

b. Glucose: C₆H₁₂O₆

Molar mass of C₆H₁₂O₆ =  6 (12) + 12(1) + 6(16)

                                       = 72 + 12 + 96

                                       = 180g/mol

Now, we can calculate the percentage composition of elements in glucose:

% Carbon: 72/180 = 40%

% Hydrogen: 12/180 = 7%

Percentage composition of oxygen: (6 × atomic mass of O) / molar mass of C6H12O6 × 100%

Percentage composition of oxygen: (6 × 16.00 g/mol) / 180.18 g/mol × 100%

Percentage composition of oxygen: 53.29%

Therefore, the percentage composition of elements in glucose is 39.99% carbon, 6.72% hydrogen, and 53.29% oxygen.

c. Calcium nitrate: Ca(NO3)2

To calculate the percentage composition of elements in calcium nitrate, we need to find the molar mass of calcium nitrate, which is:

Molar mass of Ca(NO3)2 = atomic mass of Ca + (2 × atomic mass of N) + (6 × atomic mass of O)

Molar mass of Ca(NO3)2 = 40.08 g/mol + (2 × 14.01 g/mol) + (6 × 16.00 g/mol)

Molar mass of Ca(NO3)2 = 164.09 g/mol

Learn more about chemical composition here:

https://brainly.com/question/1194814

#SPJ1

The heat of fusion of water is 79.9 cal/g. If a 7.2 g piece of ice melts in 105 g of water at 34.3 deg C in an insulated bottle, what is the final temperature of the water?

The heat of fusion of water is 79.9 cal/g. If a 7.2 g piece of ice melts in 105 g of water at 34.3 deg C in an insulated bottle, what is the final temperature of the water?

Type your answer...

Answers

The heat of fusion of water is 79.9 cal/g. If a 7.2 g piece of ice melts in 105 g of water at 34.3 deg C in an insulated bottle, 35071.6 °C is the  final temperature of the water.

The physical concept of temperature indicates in numerical form how hot or cold something is. A thermometer is used to determine temperature. Thermometers are calibrated using a variety of temperature scales, which historically defined distinct reference points or thermometric substances.

The most popular scales were the Celsius scale, sometimes known as centigrade, with the unit symbol °C, the scale of Fahrenheit (°F), or the Kelvin scale (K), with the latter being mostly used for scientific purposes.

Δ T = T(initial) - T(final)

T(final)= m × c × q - T(initial)

T(final)= 79.9 x 4.184 x 105 - 30.0

T(final)= 35071.6 °C

To know more about temperature, here:

https://brainly.com/question/11464844

#SPJ1

How many moles of oxygen are in 2.71 x 1025 molecules of carbon dioxide (CO2)?

Answers

Answer:

There are 4.52 moles of oxygen in 2.71 x 10^25 molecules of carbon dioxide (CO2).

Explanation:

A student used 0.17 grams of Alka Seltzer for their experiment. What's the mass of sodium bicarbonate (NaHCO3) in their sample?

Answers

Answer:

To find the mass of sodium bicarbonate (NaHCO3) in a sample of Alka Seltzer that weighs 0.17 grams, we need to know the percentage of NaHCO3 in Alka Seltzer. This information is usually provided on the label of the product. Once we know the percentage of NaHCO3, we can use the following formula to calculate the mass of NaHCO3 in the sample:

mass of NaHCO3 = sample mass (in grams) x % NaHCO3 / 100

For example, if the percentage of NaHCO3 in Alka Seltzer is 50%, then the mass of NaHCO3 in a 0.17 gram sample would be:

mass of NaHCO3 = 0.17 x 50 / 100 = 0.085 grams

Therefore, the mass of sodium bicarbonate in the student's 0.17 gram sample of Alka Seltzer depends on the percentage of NaHCO3 in the Alka Seltzer, which should be provided on the product label.

Explanation:

)A mixture of 0.220 molesCO, 0.350 molesF2and 0.640 molesHehas a total pressure of 2.95 atm.What is the partial pressure ofCO?

Answers

The partial pressure of a component gas in a mixture is the pressure that gas would exert if present alone in the vessel at the same temperature as that of the mixture. Here the partial pressure of CO is

The pressure exerted by a mixture of two or more non-reacting gases enclosed in a definite volume is equal to the sum of the partial pressures of the component gases. This is sated by Dalton.

Here partial pressure is:

partial pressure = Mole fraction × Total pressure

Mole fraction of CO = Number of moles of CO / Total moles

n(CO) = 0.220 / 1.21 = 0.181 moles

partial pressure = 2.95 × 0.181  = 0.533 atm

To know more about partial pressure, visit;

https://brainly.com/question/13199169

#SPJ1

Calculate volume of 0.3 mole of hydrogen chloride

Answers

6.72L is the volume occupied by 0.3 mole of hydrogen chloride. A measurement of three-dimensional space is volume.

A measurement of three-dimensional space is volume. It is frequently expressed quantitatively using SI-derived units, like the cubic foot and litre, or different imperial or US-standard units, including the gallon, quart and cubic inch. Volume and length (cubed) have a symbiotic relationship. A container's capacity is typically thought of as being represented by its volume.

Volume = 0.3×22.4

            =6.72L

To know more about volume, here:

https://brainly.com/question/31606882

#SPJ1

in general, which of the following statements about electron-pair geometries is true? question 14 options: a) they maximize the space between valence electrons to minimize the repulsion between them. b) they maximize the polarity of valence electrons to minimize the attraction between them. c) they maximize the space between

Answers

They maximise the distance between valence electrons to reduce the repulsion between them, which is option an in the correct response. This is so because the idea behind electron-pair geometries is to reduce valence electron repulsion.

By increasing the distance between them, which decreases the repelling power of the interactions between electrons, this is accomplished.

Because they reduce electron repulsion and enable molecules to adopt their most stable form, electron-pair geometries are used to anticipate the structure of molecules.

Learn more about  electron repulsion  at:

https://brainly.com/question/29093352

#SPJ1

Sometimes a fossil is formed as a result of the movement of an organism in soft sediment. Which of these are two kinds of trace fossils?
*
1 point
shells and bones
tracks and burrows
a bee and a beetle in amber
petrified and mummified fossils

Answers

Answer:The two kinds of trace fossils mentioned in the options are:

tracks

burrowsTracks and burrows are both examples of trace fossils, which are fossils thatprovide evidence of an organism's activity, rather than the organism itself.Tracks are impressions left by an organism's feet or other body parts as itmoved across soft sediment, while burrows are tunnels or other structurescreated by an organism as it burrowed into the sediment. Both types of tracefossils can provide valuable information about an organism's behavior, habitat, and interactions with other organisms.

Given the reaction:


If there are initially 14.2 moles of iron (III) nitrate nonahydrate, how many moles of steam (water vapor) will be produced?

Answer in mol.

Answers

Total, 127.8 moles of the steam (water vapor) will be produced.

Iron(III) nitrate nonahydrate, or Fe(NO₃)₃·9H₂O, is a compound that contains iron (III) cations (Fe³⁺) and nitrate anions (NO₃⁻) combined with nine water molecules (H₂O) per formula unit. The nine water molecules are referred to as "nonahydrate," which indicates that there are nine water molecules associated with each formula unit of Fe(NO₃)₃. This compound is also commonly known as ferric nitrate nonahydrate.

Balanced equation for the given reaction is;

Fe(NO₃)₃·9H₂O(s) → Fe(NO₃)₃(s) + 9H₂O(g)

According to the equation, one mole of Fe(NO₃)₃·9H₂O produces 9 moles of water vapor (H₂O) when it undergoes the reaction. Therefore, if there are initially 14.2 moles of Fe(NO₃)₃·9H₂O, the number of moles of water vapor (H₂O) produced will be;

14.2 moles of Fe(NO₃)₃·9H₂O × 9 moles of H₂O per 1 mole of Fe(NO₃)₃·9H₂O = 127.8 moles of H₂O

Therefore, 127.8 moles of water vapor will be produced.

To know more about moles of water vapor here

https://brainly.com/question/19784124

#SPJ1

A soft drink contains 33g of sugar in 349g of H2O. What is the concentration of sugar in the soft drink in mass precent?

Answers

The concentration of the sugar in the soft drink in mass percent is 8.64%

How do i determine the concentration in mass percent?

First, we shall determine the mass of the solution. Details below:

Mass of sugar = 33 gramsMass of water = 349 gramsMass of solution =?

Mass of solution = Mass of sugar + mass of water

Mass of solution = 33 + 349

Mass of solution = 382 grams

Finally, we shall determine the mass percent of the sugar in the solution. Details below:

Mass of sugar = 33 gramsMass of solution = 382 gramsPercentage of sugar =?

Percentage = (mass of sugar / mass of solution) × 100

Percentage of sugar = (33 / 382) × 100

Percentage of sugar = 8.64%

Thus, we can conclude that the mass percent of the sugar is 8.64%

Learn more about percentage composition:

https://brainly.com/question/11952337

#SPJ1

PLEASE HELP WITH CONVERSIONS

Answers

The grams of pigment needed is 9.20 grams

The grams of water needed is 0.199 grams.

The final molarity of the binder in the paint mixture is 20.04 M.

What are the masses of substances required?

The masses of substances required are reived from the mole ratios given.

The grams of pigment needed:

mole ratios of CaCO3 and Cr2O3 is 1 : 1.52

Using the conversion factors:

molar mass of CaCO3 = 100.1 g

molar mass of Cr2O3 = 151.99 g

grams of pigment needed = (0.400 g CaCO3 x 1 mol CaCO3/100.1 g CaCO3) x (1.52 mol Cr2O3/1 mol CaCO3) x (151.99 g Cr2O3/1 mol Cr2O3) grams of pigment needed = 9.20 g Cr2O3

the grams of water needed:

mole ratio of CaCO3 and H2O is 1 : 27.5

molar mass of H2O = 18.0 g

the grams of water needed = 0.400 g CaCO3 x (1 mol CaCO3/100.1 g CaCO3) x (27.5 mol H2O/1 mol CaCO3) x (18.0 g H2O/1 mol H2O)

the grams of water needed = 0.199 g H2O

From the density of water, the volume of water needed is 0.199 mL of water.

Molarity = moles of solute/volume of solution in liters

Volume of solution = 0.000199 L

Number of moles of CaCO3 = 0.400/100.1 g

Number of moles of CaCO3 = 0.003998 mol

Molarity = 0.003998/0.000199

Molarity = 20.04 M

Learn more about molarity at: https://brainly.com/question/30404105

#SPJ1

How many mL of hydrogen chloride gas will be produced from 25.0 g of BaCl2 at STP? BaCl2(s) + H2SO4(aq) → BaSO4(aq) + 2HCl(g)

Answers

5380 mL of hydrogen chloride gas will produce 25.0 g of  BaCl₂ at STP.

To solve this problem, we need to use stoichiometry to determine the amount of hydrogen chloride gas produced from the given amount of BaCl₂.

First, we need to balance the chemical equation:

BaCl₂(s) + H₂SO₄(aq) → BaSO₄(aq) + 2HCl(g)

According to the balanced equation, 1 mole of BaCl₂ produces 2 moles of HCl.

The molar mass of BaCl₂ is 208.23 g/mol.

So, the number of moles of BaCl₂ in 25.0 g is:

n(BaCl₂) = mass ÷ molar mass = 25.0 g ÷ 208.23 g/mol = 0.120 mol

From the balanced equation, 1 mole of BaCl₂ produces 2 moles of HCl. Therefore, the number of moles of HCl produced is:

n(HCl) = 2 × n(BaCl₂) = 2 × 0.120 mol = 0.240 mol

At STP (standard temperature and pressure), 1 mole of any gas occupies 22.4 L.

Therefore, the volume of HCl gas produced at STP is:

V(HCl) = n(HCl) × 22.4 L/mol = 0.240 mol × 22.4 L/mol = 5.38 L

However, the question asks for the volume of hydrogen chloride gas in mL, so we need to convert the answer to mL:

1 L = 1000 mL

Therefore, V(HCl) = 5.38 L × 1000 mL/L = 5380 mL

So, 25.0 g of BaCl₂ at STP will produce 5380 mL of hydrogen chloride gas.

To learn more about BaCl₂ to HCl mL visit:

brainly.com/question/31081420

What happens to a buffered solution
when a small amount of base is
added?

Answers

Answer: When you add small quantities of an acid or alkali (base) to it, its pH does not change significantly. In other words, the buffer solution stops the acid and base from neutralizing each other.

Answer:

 the result is a decrease in the amount of conjugate base present and an increase in the amount of the weak acid.

Explanation:

Units 1 and 2 1 Choose the correct option. a) An example of a chemical change is: A melting chocolate B leaving an iron nail to rust C dissolving salt in water D allowing solid air freshener to sublimate b) Which is not a property of physical change? A Atoms and molecules are conserved. B Atoms and molecules are rearranged. C The changes are permanent. D The changes are reversible. c) Which is not a property of chemical change? A A chemical reaction takes place. B There are large changes in energy. C The products have different properties from the reactants. D They are examples of phase changes. d) Which is a wrong statement? A To prove the Law of Constant Composition you add all the atomic masses of atoms in a compound. B The Law of Constant Composition states that all samples of a chemical compound have the same elemental composition. During a chemical reaction the atoms are conserved. C D During a chemical reaction, the sum of the formula masses of the products must equal the sum of the formula masses of the reactants​

Answers

Chemistry and Physics are both great topics

We would like to find RDS using Tapel slope. Provide Tafel slope when we assume each step is RDS, alpha a=0.5 * Target Reaction : Cu oxidation [mV]

Mechanism1 Cu-> Cu2+ +2e-
Mechanism2 Cu-> Cu+ +e-
Cu+->Cu2+ +e-​

Answers

The Tafel slope for Mechanism 2 is the sum of the slopes of both steps, presuming that each step in Mechanism 2 is RCS::

b2 = b2_1 + b2_2 = 0.1184 + 0.1184 = 0.2368 V

How to solve

To identify the rate-controlling step (RCS) utilizing the Tafel slope, we initially need to calculate the Tafel slope for each suggested mechanism when the electron transfer coefficient (alpha, α) equals 0.5.

The target reaction involves Cu oxidation.

Mechanism 1:

Cu -> Cu²⁺ + 2e⁻

Mechanism 2:

Cu -> Cu⁺ + e⁻

Cu⁺ -> Cu²⁺ + e⁻

The Tafel slope (b) can be computed with the following formula:

b = (2.303 * R * T) / (α * n * F)

Where:

R signifies the gas constant (8.314 J/mol K)

T represents the temperature in Kelvin (let's assume 298 K, standard room temperature)

α denotes the electron transfer coefficient (0.5)

n is the number of electrons exchanged in the RCS

F is the Faraday constant (96,485 C/mol)

For Mechanism 1, n = 2 (since 2 electrons are exchanged in the rate-controlling step):

b1 = (2.303 * 8.314 * 298) / (0.5 * 2 * 96,485) = 0.0592 V

For Mechanism 2, we must examine both steps. Let's initially evaluate the Tafel slope for each step.

Step 1 (n = 1):

b2_1 = (2.303 * 8.314 * 298) / (0.5 * 1 * 96,485) = 0.1184 V

Step 2 (n = 1):

b2_2 = (2.303 * 8.314 * 298) / (0.5 * 1 * 96,485) = 0.1184 V

The Tafel slope for Mechanism 2 is the sum of the slopes of both steps, presuming that each step in Mechanism 2 is RCS::

b2 = b2_1 + b2_2 = 0.1184 + 0.1184 = 0.2368 V

Having obtained the Tafel slopes for both mechanisms, we can now compare them to the experimental Tafel slope to ascertain which mechanism is more likely the RCS.

Read more about oxidation here:

https://brainly.com/question/27239694

#SPJ1

CO, (9) +2NH_(9) - CO(NH,) (s) +H, O(1)
a. What is the maximum mass of urea, CO(NH), that can be manufactured from the reaction of 2.20 moles of CO2 with sufficient amount of ammonia.

Answers

The mass of the ammonia that is required is  258 g.

What is the stoichiometry of the reaction?

The quantitative correlations between the reactants and products in a chemical reaction are the focus of the chemistry subfield known as stoichiometry.

We have to know that;

1 mole of CO2 produces 1 mole of urea

2.2 moles of CO2 produces 2.2 urea

Given that the number of moles of urea = 455 g/60 g/mol

= 7.58 moles

Now;

2 moles of NH3 produces 1 mole of urea

x moles of NH3 produces 7.58 moles of urea

x = 7.58 * 2/1

= 15.16 moles

Mass of the ammonia =  15.16 moles * 17 g/mol

= 258 g

Learn more about stoichiometry:https://brainly.com/question/29019892

#SPJ1

How many years passed between the first man on the Moon and the first US woman in space?

Answers

It took 14 years between the first man on the Moon and the first US woman in space.

What is space exploration?

The use of astronomy and space technology to explore outer space is known as space exploration. While astronomers use telescopes to explore space, physical exploration is carried out by both uncrewed robotic space probes and human spaceflight.

Understanding gravity, the magnetosphere, the atmosphere, fluid dynamics, and the geological evolution of other planets, for example, has come from studying the solar system.

Learn more about space exploration here:

https://brainly.com/question/27325845

#SPJ1

Determine the number of moles in 100,0 g S

Answers

The number of moles in 100g of Sulphur is 3.13 moles.

How to calculate number of moles?

The number of moles in a substance can be calculated by dividing the mass of the substance by its molar mass as follows:

moles = mass ÷ molar mass

According to this question, there are 100g of Sulphur. Sulphur has an atomic mass of 32g/mol. The moles of this element can be calculated as follows;

moles = 100g ÷ 32g/mol

moles = 3.13moles

Learn more about moles at: https://brainly.com/question/31597231

#SPJ1

Other Questions
Roe manufactures and sells cloth facial masks. Per unit direct material and direct labor costs are $1 and $2 respectively. Other than these costs, Roe pays $1,000 for rent $1,500 for the floor manager's salary, and recognizes $300 depreciation on the equipment every month. Roe sells each mask at $10. If Roe sells 500 masks, what would be Roe's total revenue and total costs? O Total revenue: 5,000: Total costs: 1,500 Total revenue: 3,500: Total costs: 1.500 Total revenue: 3,500: Total costs: 2.800 Total revenue: 5,000; Total costs: 4,300 Problem - 11. Hodge Co. exchanged Building 24 which has an appraised value of $6,400,000, a cost of $10,120,000, and accumulated depreciation of $4,800,000 for Building M belonging to Fine Co. Building M has an appraised value of $6,016,000, a cost of $12,040,000, and accumulated depreciation of $6,336,000. The correct amount of cash was also paid. Assume depreciation has already been updated. Instructions Prepare the entries on both companies' books assuming the exchange had no commercial substance. Show a check of the amount recorded for Building M on Hodge's books. (Round to the nearest dollar.) imagine that grade 11 pupils of your school have organized an exhibition: Evolution of Man.Write a notice informing all the pupols,teacherand parents of the exhibition. Mention the date,venue and the important of the exhibition jean wants to sequence a gene which she has amplified by polymerase chain reaction. you first run a sequencing reaction with a portion of ddatp in the mix. when you run your reaction out on a gel, you find bands at 5, 7, 15, and 20 nucleotide positions after the end of your primer. the next reaction you run is with ddctp. you find bands at the 3, 9, 10, 11, and 17 nucleotide positions. the next reaction with ddgtp results in bands at the 1, 4, 13, 14, and 19 nucleotide positions. the final reaction with ddttp shows bands at the 2, 6, 8, 12, 16, and 18 nucleotide positions. what is the dna sequence inferred from the gel? please choose the correct answer from the following choices, and then select the submit answer button. answer choices 3'-agtctaggtccctatagctg-5' 3'-gtcgatatccctggatctga-5' 3'-actagcgctttcaagctcaa-5' 3'-gtccctatcggaggatcga-5' What is digestibility in animals? CH3COCl + AlCl3 = CH3C+O + AlCl4-. (True or False) If you plan to take money out of the bank frequently, what type of account should you get? A. A savings account B. A checking account C. An interest account D. An investment account Please select the best answer from the choices provided A B C D Mark this and return True or false: A set is considered closed if for any members in the set, the result of an operation is also in the set title:The Effects of working students in college theory/ author/ date/ citation of theoretical framework about working students How dose startek info help mercedes benz technians (7, 1) and (-2, 3)Slope = List the 6 red flags for osteonecrosis of the femoral head. According to 1 Corinthians 15:14-17, if Christ has not been raised from the dead...(Hint: You should choose four answers)- God is misrepresented.- Jesus never existed.- Jesus didn't die on the cross.- Christians still have hope.- Christians are still in their sins.- Faith in Christ is in vain.- Preaching about Christ is in vain. What is the basic naming guideline followed by all commercial products?Sub Brand + Model Name + Form FactorFaster data read/write speedsLess prone to physical failuresSilent operation Prove that for all real numbers r > 0,8 >0 and all vectors a, b, c in a normed vector space V.a. Br() Bs(b)Br(+2c)Bs(b+2c)b.Br() Bs(b)Br(+1/2c)Bs(b+1/2c) Which of these factors may significantly influence atmospheric temperature changes?A. concentration of greenhouse gases,B. variations in solar radiance, C. amount of aerosis in the atmosphere, E. Earth's orbital and tilt variations If r = 6 and the measure of the central angle 2pi/3, what is the length of the intercepted arc ng and managing a company and QUESTION 24 You have the opportunity to buy your aunt's jewelry store. Before making your decision and tells you to look after company's accounting information What should you keep the accounting function in bussines? The half-life of radium is 1620 year what fraction of the radium sample will remain after 3240 years Figure A is dilated with scale factor r=3 to create figure A .