a plant is already 44 cm tall, and will grow one cm every month. let H be height in cm and M months. write and equation relating H to M . then use equation to find plants height after 32 months

Answers

Answer 1

H = height in cm

M = months

The plant is already 44 cm tall

GRowth every month = 1 cm

Equation:

H (m) = 44 + m

The height after m months, will be equal to the initial height (44) plus the number of months.

For 32 months, replace m by 32 and solve:

H (32) = 44+32

H (32) = 76 cm

After 32 months, the plant will be 76 cm tall


Related Questions

9. If L 1 equals 120 then what is the measure of its supplement <2=

Answers

Supplementary angles are angles whose addition sums up to 180 degrees.

Therefore, if angle 1 measures 120, then its supplement which is angle 2, must mean both add up to 180.

Hence, you have

Angle 1 + Angle 2 = 180

120 + Angle 2 = 180

Subtract 120 from both sides of the equation

Angle 2 = 180 - 120

Angle 2 = 60 degrees

By definiton, two angles are complimentary angles if they both add up to 90 degrees. Hence if angle L5 equals 50 degrees, then its compliment would be derived as 90 - 50 which equals 40. The compliment of angle L5 which is 50 degrees, equals 40 degrees.

On a 7 question multiple-choice test, where each question has 2 answers, what would be the probability of getting at least one question wrong?Give your answer as a fraction

Answers

Solution

- This is a Binomial probability question. The formula for Binomial probability is:

[tex]\begin{gathered} P(r)=\sum\text{ }^nC_rp^rq^{n-r} \\ where, \\ n=The\text{ total number of trials} \\ r=\text{ The number of successful trials\lparen where answer is correct\rparen} \\ p=\text{ The probability of success \lparen The probability of getting a question } \\ right) \end{gathered}[/tex]

- We have been given:

[tex]\begin{gathered} n=7 \\ \text{ since there can only be two answers, it means that the} \\ \text{ probability of getting a question correct is:} \\ p=\frac{1}{2} \\ q=1-p=\frac{1}{2} \\ \\ \text{ The probability of getting at least 1 question wrong means the } \\ probability\text{ of getting 1, 2, 3, 4, 5, 6, or 7 question wrong.} \\ \\ \text{ Instead of calculating all these probabilities, we can simply say} \\ P(1)+P(2)+P(3)+P(4)+P(5)+P(6)+P(7)=1-P(0) \end{gathered}[/tex]

- Thus, we have:

[tex]\begin{gathered} P(0)=^7C_0(\frac{1}{2})^0(\frac{1}{2})^7 \\ P(0)=\frac{1}{128} \\ \\ 1-P(0)=1-\frac{1}{128}=\frac{127}{128} \end{gathered}[/tex]

Final Answer

The answer is

[tex]\frac{127}{128}[/tex]

Which phrase represents this expression?

5 + 4 ÷ 2

Responses

the product of 5 and the quotient of 4 and 2
the product of 5 and the quotient of 4 and 2

the product of 5 and 4 is divided by 2
the product of 5 and 4 is divided by 2

the sum of 5 and 4 is divided by 2
the sum of 5 and 4 is divided by 2

the sum of 5 and the quotient of 4 and 2

Answers

Answer is the last one, the sun of 5 and the quotient of 4 and 2

Reason

According to the PEMDAS rule, we multiply and divide before add and subtract

So we find the “quotient” or divide 4 by 2 first. Then we add 5 to the quotient which is a “sum” of 5 and quotient

6) Write the equation of the line, in point-slope form, that passes through the point (-2,5) and has a slopeof 3.

Answers

Write the equation of the line, in point-slope form, that passes through the point (-2,5) and has a slope

of 3

___________________________________________________

The point-slope form

y-y1 = m (x-x1)

The slope (m)= 3

The point (x1, y1) = (-2,5)

____________

Replacing

y-5 =3 (x- (-2))

_______________

Answer

(y-5) =3 (x +2)

Do you have any questions regarding the solution?

use and show all conversion factors to convert 352 inches per second to miles per hour. 352 inches divided by 1 second

Answers

Okay, here we have this:

We need to convert 352 inches per second to miles per hour. So we obtain the following:

[tex]\begin{gathered} \frac{352in}{1sc}\cdot\frac{1mile}{63360in}\cdot\frac{3600sc}{1h} \\ =\frac{20\text{miles}}{h} \end{gathered}[/tex]

Finally we obtain that 352 inches per second 20 are miles per hour.

A train travels at 100 mph any equation can be written that compares the time with the distance to find the domain and range

Answers

ok

speed = distance / time

time = distance/speed

[tex]\text{ time = }\frac{dis\tan ce\text{ }}{speed}[/tex][tex]\text{ time = }\frac{dis\tan ce\text{ }}{100}[/tex]

or

[tex]\text{ distance = 100 x time}[/tex]

HELP PLEASEEEEE!!!!!!

Answers

The solutions of the indices are;

1)  2^7

2) 3^-4

3) 3^4

4) 2^4

What is the power?

We know that in this case, we would have to apply the laws of indices and the particular law that we are to apply in each case is dependent on the nature of the problem that have been posed. Let us recall that we are asked to ensure that we express the answer or the solution to the problem as a single power.

1) 64 * 256/128

2^6 * 2^8/2^7

2^6 + 8 - 7 = 2^7

2) 3^4/3^3 * 3^5

3^4 - (3 + 5) = 3^-4

3) 3^9/ (3^4)^1/2 * 3^3

3^9/ 3^2 * 3^3

3^9 - (2 + 3)

3^4

4) (2^3)^4 * 2^4 ÷ 32/ 2 * 64

2^12 * 2^4 ÷ 2^5/2^1 * 2^6

2^12 + 4 -5/2^1 + 6

2^16 -5/2^7

2^11/2^7

2^11 - 7

2^4

Learn more about laws of indices:https://brainly.com/question/27432311

#SPJ1

Solve each equation for the variable. h/2 + 3.5 = 7.1

Answers

To answer this question, we can proceed as follows:

[tex]\frac{h}{2}+3.5=7.1[/tex]

1. Subtract 3.5 to both sides of the equation:

[tex]\frac{h}{2}+3.5-3.5=7.1-3.5\Rightarrow\frac{h}{2}+0=3.6[/tex]

2. Multiply by 2 to both sides of the equation:

[tex]2\cdot\frac{h}{2}=2\cdot3.6\Rightarrow h=7.2[/tex]

We can check this result as follows:

[tex]\frac{7.2}{2}+3.5=3.6+3.5=7.1\Rightarrow7.1=7.1[/tex]

This result is TRUE. Then, the value for h = 7.2.

1. what is the area of the board shown on the scale drawing? explain how you found the area.2. how can Adam use the scale factor to find the area of the actual electronics board? remember, he uses a different method than Jason.3. what is the area of the actual electronics board?

Answers

Answer:

1. 1800 square cm.

2. See below

3. 45000 square cm.

Explanation:

Part 1

The dimensions of the drawing are 36cm by 50cm.

[tex]\begin{gathered} \text{The area of the board}=36\times50 \\ =1800\operatorname{cm}^2 \end{gathered}[/tex]

Part 2

Given a scale factor, k

If the area of the scale drawing is A; then we can find the area of the actual board by multiplying the area of the scale drawing by the square of k.

Part 3

[tex]\begin{gathered} \text{Area of the scale drawing}=1800\operatorname{cm}^2 \\ \text{Scale Factor,k=5} \end{gathered}[/tex]

Therefore, the area of the actual drawing will be:

[tex]\begin{gathered} 1800\times5^2 \\ =45,000\operatorname{cm}^2 \end{gathered}[/tex]

The height of a pole is 15 feet. A line with banners is connected to the top of the poleto a point that is 8 feet from the base of the pole on the ground. How long would theline with banners need to be in order for the pole to be at a 90° angle with the ground?Explain your reasoning.

Answers

In order to have a 90º angle (right angle) the length of the line with banners needs to fullfit the Pythagorean theorem: In a right triangle the squared hypotenuse is equal to the sum of the legs squared:

[tex]h^2=l^2+l^2[/tex]

In the given situation the hypotenusa is the line with banners, and the legs are the pole and the 8ft ground from the base of the pole to the end of the line with banners:

h= x

l= 15ft

l= 8ft

[tex]x^2=(15ft)^2+(8ft)^2[/tex]

Solve the equation to find the value of x:

[tex]\begin{gathered} x^2=225ft^2+64ft^2 \\ x^2=289ft^2 \\ x=\sqrt[]{289ft^2} \\ x=17ft \end{gathered}[/tex]Then, to make a right triangle the length of the line witg banners need to be 17ft

Explain how you know 437,160 is greater than 43,716.4 grade student

Answers

437,160 is read as four hundred thirty-seven thousand one hundred sixty and 43,716 is read as fourty-three thousand seven hundred sixteen.

The first number has hundreds of thousand and the second one only has tens of thousand. It means that the first number is greater than the second one.

Another way to know this is because of the number of figures before the decimal point. The first number has 6 figures before the decimal point and the second one only has 5.

That way, we know that 437,160 is greater than 43,716.

he multiplication table below can be used to find equivalent ratios.

A multiplication table.

Which ratio is equivalent to the ratio 18:24?
15:20
20:15
30:36
36:30

Answers

Answer:

15:20

Step-by-step explanation:

18:24 can be written [tex]\frac{18}{24}[/tex]  if I simplify this by dividing the top and bottom by 6, I get [tex]\frac{3}{4}[/tex]

I am looking for what other ration will reduce to [tex]\frac{3}{4}[/tex]

[tex]\frac{15}{20}[/tex]  Divide the top and bottom by 5 and you will get [tex]\frac{3}{4}[/tex]

Is (6, –21) a solution to the equation y = –5x − –9?

Answers

Answer:

Explanation:

Given the equation:

[tex]y=-5x-(-9)[/tex]

When x=6:

helppppppppppppppppppppppppppp

Answers

Step-by-step explanation:

make the fractions decimals and put them on the plot

what does this mean i dont get it please help me thanks, :)

Answers

It means that you are supposed to group The like terms together and simplify them

you will find that 2t is the liketerm with -5t and -u is a like term with -6u

As a results we have

[tex] = 2t - 5t - u - 6u \\ = - 3t - 7u[/tex]

as indicated I have shown you the answer .

good luck

Complete the table for y=-3x + 5 and graph the resulting line. -

Answers

We fill the table as follows:

*We assign values for x and solve for y, that is:

*x = 0:

[tex]y=-3(0)+5\Rightarrow y=5[/tex]

So, the value of y when x = 0 is 5.

*x = 1:

[tex]y=-3(1)+5\Rightarrow y=2[/tex]

So, the value of y when x = 1 is 2.

*x = 2:

[tex]y=-3(2)+5\Rightarrow y=-1[/tex]

So, the value of y when x = 2 is -1.

*x = 3:

[tex]y=-3(3)+5\Rightarrow y=-4[/tex]

So, the value of y when x = 3 is -4.

***The table should look like this:

x | y

0 | 5

1 | 2

2 | -1

3 | -4

***The graph is:

What is the measure of ?ХvO A. 46°42°42"38°NуvO B. 42°O C. 40°O D. 38°

Answers

The value Z is denoted as the center of the circle. Therefore, arc UV and arc XY should be the same .

[tex]undefined[/tex]

Answer: A. 42°

Step-by-step explanation:

Hope this helps :)

X+87°2x⁰ i have to solve for x it’s a 180 angle HELP ME!!!!!!!!!

Answers

X+87°+2x°=180°(Angles on a straight line )
Collect Like terms
X+2x°=180°-87°
3x=93°
Divide both sides by 3 to eliminate the coefficient of “x”
3x/3=93°/3
X=31°

A toy car that is 0.5 ft long is used to model the actions of an actual car that is 15 ft long. Which ratio shows the relationship between the sizes of the model and the actual car? A. 2:5 B. 5:2 C. 30:1 D. 1:30

Answers

A toy car that is 0.5 ft long is used to model the actions of an actual car that is 15 ft long. Which ratio shows the relationship between the sizes of the model and the actual car?



A. 2:5



B. 5:2



C. 30:1



D. 1:30

_____________________

0.5 ft the toy car: 15 the actual car

0.5*2 =1

15 *2 = 30

1: 30

_____________________________________

The ratio1:30​ shows the relationship between the sizes of the model and the actual car

____________

Do you have any questions regarding the solution?

Figure RSTU has coordinates R = (3,4), S = (7.2), T = (5, 10), and U = (12,8). The figure is dilated from the origin by a scale factor r . Select the correct coordinates of R. A R' = (3,2) B R' = (1.5, 4) C R' = (3.5, 4.5) D R' = (1.5, 2) * Select the correct answer. 1 point Ο Α OB D

Answers

Answer

Option D is correct.

R' (1.5, 2)

Explanation

A dilation means the size is increased or decreased. If the scale factor is less than 1, then the size is decreased, but if the scale factor is more than 1, it means the figure is enlarged.

Dilating about the origin just multiplies the coordinates by the scale factor. So, dilating (x, y) about the origin by a scale factor k, gives new coordinates (kx, ky).

For this question, we need to dilate R (3, 4) by a scale factor, r = ½

R' = [½(3), ½(4)] = (1.5, 2)

Hope this Helps!!!

Marcy baked 132 cookies . She is packaging boxes of eight cookies to give as a gift to he friends how many boxes will she make .

Answers

She will make 16 boxes.

To answer this question we simply have to divide the number of cookies (132) by the number of cookies that each box can contain.

Mathematically speaking:

[tex]132/8\text{ }[/tex][tex]16.5[/tex]

Since we can´t have half boxes, we have to round the number to 16.

16 boxes.

b. Write
√x
as a single radical in simplest form.
5√x

Answers

Answer:

(tenth root of x to the third power)

see image

Step-by-step explanation:

To do this problem you need to know how to convert radicals to an expression with a fraction exponent(and back to radicals again), ALSO exponent rules for division ALSO subtracting fractions.

Square root x can be written as x^ 1/2

fifth root x can be written as x^ 1/5

When you are dividing expressions with the same base, exponent rules say to SUBTRACT the exponents.

1/2 - 1/5 change to common denominator

5/10 - 2/10

= 3/10

x^1/2 / x^1/5 =

x^ (1/2 - 1/5) =

x^ (5/10-2/10) =

x^ 3/10

Then change back to a radical. Remember "down and out" or "roots are down" and "up, up, up" or "exponents are up"

the number down below goes out (outside) the radical. And the number up top is up and exponents are up, up, up

see image.

x^3/10 =

tenth root (x^3)

see image.

A 33-inch piece of steel is cut into three pieces so that the second piece is twiceas long as the first piece, and the third piece is one inch more than five times thelength of the first piece. What is the length of the first piece?

Answers

Let;

x = the length of the first piece

y=the length of the second piece

z=the length of the third piece

From the question;

"the second piece is twice as long as the first piece" can be written in equation as:

y = 2x

"the third piece is one inch more than five times the length of the first piece"

can be written as :

z= 5x+ 1

Total length of the 3 pieces = 33

This implies:

x + y + z =33

substitute y=2x and z=5x+1 into the above

x + 2x + 5x+1 = 33

8x + 1 = 33

subtract 1 from both-side of the equation

8x = 33 -1

8x = 32

divide both-side of the equation by 8

x= 32/8

x= 4

The length of the first piece is 4-inches

omg i lost my tutor in the middle of math i need another one btw in fith grade not in middle school yet

Answers

[tex]\frac{6}{10}\text{/}\frac{1}{5}[/tex]

by definition the division of fractions can be found by

[tex]\frac{\frac{a}{b}}{\frac{c}{d}}=\frac{b\cdot c}{a\cdot d}[/tex]

According to this

[tex]\frac{\frac{6}{10}}{\frac{1}{5}}=\frac{6\cdot5}{10\cdot1}=\frac{30}{10}=3[/tex]

how many pennies are in a dollar

Answers

Answer: 100

Step-by-step explanation:

$1 =100 pennies

Function g is a transformation of the parent function exponential function. Which statements are true about function g?

Answers

For the given function, The following are true statements:

Four units separate function g from function f.There is a y-intercept for function g. (0,4)Function g has a range of (3,∞ ).Over the range (-, ∞), function g is positive.

It may be seen from the graph below that

The g function's graph is 4 units higher than the parent exponential function's graph.

All of the input values for which the function is defined are referred to as the function's domain. The domain of the function is (-, ∞ ) according to the graph of function g.

The location where a function's graph crosses the y-axis is known as the y-intercept. G's graph crosses the y-axis at (0, 4). As a result, the Function g's y-intercept is (0,4).

growing function g across the range (- ∞, 0).

Function output values are referred to as the function's range. It can be seen from the graph that the range of function g is (3, ∞ ).

To learn more about functions, https://brainly.com/question/21145944

#SPJ9

how can you use the vertical line test and the horizontal line test to determine whether a graph represents a function and whether the graph is invertible?

Answers

In this case, we'll have to carry out several steps to find the solution.

Step 01:

Data

vertical line test = ?

horizontal line test = ?

Step 02:

vertical line test ===> function

any vertical line intersect the graph at only one point

horizontal line test ===> invertible

any horizontal line intersect the graph at only one point

graph:

horizontal line test = red

vertical line test = brown

That is the full solution.

Hi, can you help me to solve this problem please!

Answers

We have the following function

[tex]f(x)=7+6x[/tex]

Now, we must replace the variable x by the given value, that is,

[tex]f(10)=7+6(10)[/tex]

which gives

[tex]\begin{gathered} f(10)=7+60 \\ f(10)=67 \end{gathered}[/tex]

Therefore, the answer is f(10)=67

A 14 m long ladder is placed against a tree. The top of the ladder reaches a point
13 m up the tree.

How far away is the base of the ladder from the base of the tree?

Give your answer in metres (m) to 1 d.p.

Answers

Answer:

Approximately 5.2 meters

Step-by-step explanation:

This formation will make a right triangle. The ground to the point in the tree is one of the legs. The base of the tree to the base of ladder is another leg and the length of the ladder is the hypotenuse. In this case, we already have the hypotenuse and one of the legs, so we need to find the value of another leg.

We can do so by using the Pythagorean Theorem which is [tex]a^2+b^2=c^2\\[/tex].

a and b represent the values of the two legs, and c is the hypotenuse. Since we already have the hypotenuse, we can change this equation a bit to find the other leg.

Let's assign the missing value, b in the theorem.

The new equation will be [tex]b^2=c^2-a^2[/tex].

We can insert the values for c and a and solve for b.

The new equation will be [tex]b^2 = 14^2-13^2[/tex].

[tex]b^2=196-169[/tex]

[tex]b^2=27[/tex]

[tex]\sqrt{b^2} =\sqrt{27}[/tex]

The square root of [tex]b^2[/tex] cancels out.

The approximate square root of 27 is 5.19 which we can round to 5.2.

find the x value (6x+9)° (4x-19)°

Answers

In this problem m and n are parallel lines, and the first angle is an exteriar angle an the secon is a interior angle.

this two condition give us that the two angles are complementary anlges so the sum of them should be 180 so:

[tex]6x+9+4x-19=180[/tex]

and we can solve for x so:

[tex]\begin{gathered} 10x-10=180 \\ 10x=180+10 \\ x=\frac{190}{10} \\ x=19 \end{gathered}[/tex]

Other Questions
Find the measure of the indicated angle to the nearest degreeQuestion 15 Identify the algebraic expression for the following word phrase: 5 less than twice a number y. question given below slove the following equations for r4al x and y . havermill company establishes a $290 petty cash fund on september 1. on september 30, the fund is replenished. the accumulated receipts on that date represent $77 for repairs expense, $145 for merchandise inventory, and $26 for miscellaneous expenses. the fund has a balance of $42. on october 1, the accountant determines that the fund should be increased by $58. the journal entry to record the reimbursement of the fund on september 30 includes a: real estate brokers serve as intermediaries by bringing buyers and sellers together in the real estate market. for this service, brokers are paid what is commonly referred to as a: Ligament hold A. Bone to boneB. Bone to muscles C. Tendons to bonesD. Cartilage to tendons Directions: Identify the slope and y-intercept of the line on the graph. Then, write the equation of the line in slope-intercept form. please give me these answer I will make him or her brainlist A truck carries 4 chairs and tables. The table weighs 35 pounds. The total weight of the chairs and tables is 63 pounds. How much does each chair weigh? example of man vs man conflict in the short story all the king's horses? How does President Carter's diction help establish hisperspective about the necessity of citizens and governmentworking together toward common goals?President Carter establishes this perspective by using thecollective pronouns "we" and "us" throughout the speech.President Carter establishes this perspective by using theO proper nouns "Nation" and "Government" throughout te What is 175% of 48? Show work. Which statement about the location of 7 on a number line is true? how does a catalyst increase the rate of a reaction? Why do you think the U.S. might intervene (get involved, interfere) in other countries? 7, -28, 112, -448, ..... as a formula Name:A. Discover:The Articles of Confederation (1777)1. Who wrote the Articles of Confederation?2. Was the government created by the Articles intended to be weak or strong? *Why?Jako3. The Articles created a confederation form of government. How is the confederation different from thetype of government we have today?version of the Articles The largest aquarium in the u. S. Was a gift from home depot co-founder bernard marcus to which u. S. City?. which leadership approach asserts that leadership behavior varies across a wide number of leadership styles, ranging from take-no-responsibility leadership to transformational leadership? What is the output value for the following function if the input value is 5?y = 4x - 34223172