As seen in the diagram below, Austin is building a walkway with a width of x feet to go around a swimming pool that measures 8 feet by 10 feet. If the total area of the pool and the walkway will be 360 square feet, how wide should the walkway be?

As Seen In The Diagram Below, Austin Is Building A Walkway With A Width Of X Feet To Go Around A Swimming

Answers

Answer 1

Using the total area of the rectangular pool we know that the required width of the pathway is 3.6 ft respectively.

What is a rectangle?

In the Euclidean plane, a rectangle is a quadrilateral with four right angles.

A parallelogram with a right angle or an equiangular quadrilateral, where equiangular means that all of its angles are equal, are other ways to define it.

A rectangle with four equal-length sides is a square.

Squares are not always rectangles, but rectangles are always squares.

So, the pool and walkway together have a 360 square foot total space.

Assume that the walkway is w feet in width.

Since the pool has an additional w feet of width on both sides, the total area's measurements can be expressed as (8 + 2w) by (10 + 2w).

Thus, we can construct the following equation:

(8 + 2w) x (10 + 2w) = 360

By enlarging and condensing the left side, we obtain:

4w² + 36w - 80 = 0

Using the quadratic formula, we can find w:

w = (-b ± √(b² - 4ac)) / 2a

Here, an equals 4, b equals 36, and c equals -80. When these values are added to the formula, we obtain:

w = (-36 ± √(36² - 4(4)(-80))) / 8

w = (-36 ± √(1872)) / 8

w ≈ -5.6 or w ≈ 3.6

We can ignore the first option because the width cannot be negative. Consequently, the pathway should be around 3.6 feet wide.

Therefore, using the total area of the rectangular pool we know that the required width of the pathway is 3.6 ft respectively.

Know more about rectangles here:

https://brainly.com/question/25292087

#SPJ1


Related Questions

Suppose that the functions fand g are defined as follows.
f(x)=2x-1
g(x)=√3x-5

Answers

The composite functions (f/g)(x) and (f-g)(x) are (2x-1)/√(3x-5) and (2x-1) -√(3x-5)

Calculating the composite functions (f/g)(x) and (f-g)(x)

To calculate (f/g)(x), we need to divide f(x) by g(x):

(f/g)(x) = f(x)/g(x) = (2x-1)/√(3x-5)

The domain of (f/g)(x) is the set of all x-values for which the denominator √(3x-5) is not equal to zero and non-negative

3x-5 ≥ 0, or x ≥ 5/3

Therefore, the domain of (f/g)(x) is x ≥ 5/3.

To calculate (f-g)(x), we need to subtract g(x) from f(x):

(f-g)(x) = f(x) - g(x) = (2x-1) - √(3x-5)

The domain of (f-g)(x) is the set of all x-values for which the expression inside the square root is non-negative:

3x-5 ≥ 0, or x ≥ 5/3

Therefore, the domain of (f-g)(x) is x ≥ 5/3.

Read more about composite function at

https://brainly.com/question/10687170

#SPJ1

An economy is operating with output $400 billion above its natural level, and fiscal policymakers want to close this expansionary gap. The central bank agrees to adjust the money supply to hold the interest rate constant, so there is no crowding out. The marginal propensity to consume is 3/4, and the price level is completely fixed in the short run.

to close the expansionary gap, the government would need to increase or decrease spending by $ billion.

Answers

Hence, to close the expansionary gap, the government would need to decrease spending by $100 billion.

To close the expansionary gap, the government would need to decrease spending by $100 billion.

The formula to calculate the change in equilibrium output due to a change in government spending is:

∆Y = (∆G / (1 - MPC))

Where:

∆Y = change in equilibrium output

∆G = change in government spending

MPC = marginal propensity to consume

Here, the output is $400 billion above its natural level, and the central bank agrees to adjust the money supply to hold the interest rate constant, so there is no crowding out. Therefore, we can assume that the change in government spending (∆G) would have a one-to-one effect on the equilibrium output (∆Y).

Given that MPC = 3/4, we can plug in the values into the formula:

400 = (∆G / (1 - 3/4))

∆G = (1 - 3/4) * 400

∆G = (1/4) * 400

∆G = 100

Hence, to close the expansionary gap, the government would need to decrease spending by $100 billion.

To know more about interest rate visit:

https://brainly.com/question/14445709

#SPJ1

Write 80cm to 2km as rate

Answers

One per 2,500 can be used to represent the rate of 80cm to 2km.

Writing measures as a rate.

To write 80cm to 2km as a rate, we need to convert the units to the same system. We can convert 80cm to kilometers by dividing by 100,000 (since there are 100,000 centimeters in a kilometer):

80 cm/100,000 = 0.0008 km

Now we can express the rate as:

0.0008 km per 2 km

Or we can simplify it by dividing both the numerator and denominator by 0.0008:

1 per 2,500

Therefore, 80cm to 2km can be expressed as a rate of 1 per 2,500.

Learn more on rate of measurement here: https://brainly.com/question/26668346

#SPJ1

Help Please...
You have 67 coins consisting of half-dollars and quarters. The number of quarters is 7 more than three times the number of half-dollars.
How many quarters do you have?
How many half -dollars do you have?

Answers

There are 52 quarters and 15 half-dollars

To solve this problem

Let's represent the number of half-dollars as "x" and the number of quarters as "y".

From the problem statement, we know that:

x + y = 67 (because there are a total of 67 coins)

y = 3x + 7 (because the number of quarters is 7 more than three times the number of half-dollars)

We can use substitution to solve for x:

x + (3x + 7) = 67

4x + 7 = 67

4x = 60

x = 15

So there are 15 half-dollars. We can use this to find the number of quarters:

y = 3x + 7

y = 3(15) + 7

y = 52

So there are 52 quarters.

Therefore, there are 52 quarters and 15 half-dollars.

Learn more about substitution here : brainly.com/question/26094713

#SPJ1

In art class students are mixing blue and red paint to make purple paint. Deondra
mixes 6 cups of blue paint and 7 cups of red paint. Arun mixes 2 cups of blue paint
and 3 cups of red paint. Use Deondra and Arun's percent of red paint to determine
whose purple paint will be redder.
Deondra percent of red paint (to nearest whole number) =
Arun percent of red paint (to nearest whole number) =
O Deondra's purple paint will be redder.
O Arun's purple paint will be redder.
o The two purple paints will be equally red.
Submit Answer
%
%
attempt 1 out of 2

Answers

Arun's purple paint will be redder.

Define percentage

Percentage is a way of expressing a proportion or a fraction as a number out of 100. It is represented by the symbol "%". For example, if you say that 20% of students in a class scored an A grade in a test, it means that 20 out of every 100 students received an A grade.

Deondra mixed 6 cups of blue paint and 7 cups of red paint, so the percent of red paint in her mixture is:

7 / (6 + 7) × 100% = 53.8%, which rounds to 54%.

Arun mixed 2 cups of blue paint and 3 cups of red paint, so the percent of red paint in his mixture is:

3 / (2 + 3) × 100% = 60%.

Since Arun's mixture has a higher percentage of red paint, his purple paint will be redder than Deondra's.

Therefore, the answer is Arun's purple paint will be redder.

To know more about fraction, visit:

https://brainly.com/question/10354322

#SPJ1

What is the range of the relation whose graph is shown?

Answers

The range of the relation whose graph is shown include the following: C. -1 ≤ y ≤ 1.

What is a domain?

In Mathematics and Geometry, a domain is the set of all real numbers for which a particular function is defined.

Additionally, the vertical extent of any graph of a function represents all range values and they are always read and written from smaller to larger numerical values, and from the bottom of the graph to the top.

By critically observing the graph shown in the image attached above, we can reasonably and logically deduce the following domain and range:

Domain = {-4, 4} or -4 ≤ x ≤ 4.

Range = {-1, 1} or -1 ≤ y ≤ 1.

Read more on domain here: brainly.com/question/17440903

#SPJ1

Help corrections due in 3 hours! giving 25 points and brainlist

Answers

The value of GH in the right angle triangle, given FH and Angle FHG is 22.46 inches.

How to find the value of GH ?

Since we have the adjacent side (FH) and want to find the hypotenuse (GH), we can use the cosine function.

cos(35°) = adjacent side (FH) / hypotenuse (GH)

We know that FH = 18.4 in. So, we can write the equation as:

cos(35°) = 18.4 / GH

GH = 18.4 / cos(35°)

GH = 18.4 / 0.81915

=  22.46 inches

So, the length of GH, the hypotenuse, is approximately 22.46 inches.

Find out more on right - angle triangles at https://brainly.com/question/16606910

#SPJ1

Prove: DC = 6 units
A
6 units
D
Statements
AD || BC
ZDAC ZBCA
C
?
DC BA
DC = BA
given
alternate interior angles theorem
AC AC
reflexive property of congruence
ZDCA ZBAC alternate interior angles theorem
DC = 6 units
Which step is missing?
B
O A. ADAC
OB. ADCA
O C. ADCA
Reasons
?
CPCTC
definition of congruent sides
substitution property of equality
ABCA by SAS
ABCA by ASA
ABCA by SAS

Answers

The missing step in the proof is: D. ADCA

What is the missing step and reason of the proof?

In the statements, we are given that AD || BC and ZDAC = ZBCA (alternate interior angles theorem), so we can conclude that triangle ADCA is similar to triangle BCA (by AA similarity criterion).

Therefore, we have the following proportional sides:

DC/AC = AC/BC

Given that DC = BA (given statement), we can substitute BA for DC in the proportion:

BA/AC = AC/BC

Now, we can cross-multiply to get:

BA * BC = AC²

Using the given statement that AC = AC (reflexive property of congruence), we can substitute AC for AC in the equation:

BA * BC = AC * AC

Use the definition of congruent sides to replace BA with DC:

DC * BC = AC * AC

And finally, use the substitution property of equality to replace BC with 6 units (given statement):

DC * 6 = AC * AC

From this equation, we can see that DC = 6 units, which completes the proof. Therefore, the missing step is statement D. ADCA.

Learn more about proof at brainly.com/question/30113873

#SPJ1

) Rewrite as an exponential equation.
log8 1/64 =2

(b) Rewrite as a logarithmic equation.
3 0=1

Answers

a) the exponential equation equivalent to log8 1/64 = 2 is 1/64 = [tex]8^{(-2)}[/tex]

b)  the logarithmic equation equivalent to 3^0 = 1 is log3 1 = 0.

What is exponential equation?

An exponential equation is one in which the exponent contains a variable.

(a) We can rewrite the logarithmic equation as an exponential equation by using the definition of logarithms. The logarithmic equation

log8 1/64 = 2

means that 8 raised to the power of 2 is equal to 1/64:

[tex]8^2 = 1/64[/tex]

Thus, we can write the exponential equation as:

[tex]1/64 = 8^{(-2)}[/tex]

Therefore, the exponential equation equivalent to log8 1/64 = 2 is 1/64 = [tex]8^{(-2)}.[/tex]

(b) We can rewrite the exponential equation as a logarithmic equation by using the definition of logarithms. The exponential equation

[tex]3^0 = 1[/tex]

means that the logarithm of 1 to the base 3 is equal to 0:

log3 1 = 0

Therefore, the logarithmic equation equivalent to 3^0 = 1 is log3 1 = 0.

To know more about exponential equation visit,

https://brainly.com/question/2456547

#SPJ1

Find the equation of the linear function
represented by the table below in slope-intercept
form.
X: -3,1,5,9
y: -8,0,8,16

Answers

By answering the presented question, we may conclude that As a result, the linear function denoted by the table is y = 2x - 2.

what is slope?

A line's slope shows how steep it is. A mathematical equation for the gradient is referred to as "gradient overflow" (the change in y divided by the change in x). The slope is defined as the ratio of vertical change (rise) to horizontal change between two points (run). The slope-intercept form of an equation is used to represent the equation of a straight line, which is written as y = mx + b. The y-intercept is located where the line's slope is m, b is b, and (0, b). The slope and y-intercept of the equation y = 3x - 7 are two examples (0, 7). The line's slope is m. b is b at the y-intercept, and (0, b).

To obtain the slope and y-intercept of a linear function in slope-intercept form, we must first establish the slope and y-intercept.

With two locations on the line, we can first determine the slope. Let us start with the first and last points in the table:

slope = (y change) / (change in x)

slope = (16 - (-8)) / (9 - (-3))

slope = 24 / 12

slope = 2

We can now use the slope and one of the points to get the y-intercept. Let's take the point (1, 0) as an example:

y = mx + b 0 + b b = 2(1) + b b = -2

Hence the linear function's slope-intercept equation is:

y = 2x - 2

As a result, the linear function denoted by the table is y = 2x - 2.

To know more about slope visit:

https://brainly.com/question/3605446

#SPJ1

ii) The door is 0.9 m wide and 2.1 m high. Each of the four windows is 1.5 m wide and 1.2 m high work out the toral area of the door and the four windows ​

Answers

Answer: The area of the door can be calculated as:

Area of door = width x height

= 0.9 m x 2.1 m

= 1.89 square meters

The area of one window can be calculated as:

Area of window = width x height

= 1.5 m x 1.2 m

= 1.8 square meters

Since there are four windows, the total area of the four windows is:

Total area of four windows = 4 x Area of window

= 4 x 1.8 square meters

= 7.2 square meters

Therefore, the total area of the door and the four windows is:

Total area = Area of door + Total area of four windows

= 1.89 square meters + 7.2 square meters

= 9.09 square meters

Hence, the total area of the door and the four windows is 9.09 square meters.

Step-by-step explanation:

Which of the numbers 0, 1, 2, 3 or 4 make the equation 8/y2 + 2 true?

Answers

None of the given numbers make the equation 8/y² + 2 true.

What is algebra?

Algebra is a branch of mathematics that deals with mathematical operations and symbols used to represent numbers and quantities in equations and formulas.

To solve this problem, we can substitute each of the given numbers (0, 1, 2, 3, 4) for y in the equation 8/y² + 2 and see if the equation is true.

Substituting y=0 would make the denominator of the fraction zero, which is undefined, so y=0 is not a valid choice.

Substituting y=1 would give us:

8/1² + 2 = 8 + 2 = 10

So, 1 is not the answer.

Substituting y=2 would give us:

8/2² + 2 = 8/4 + 2 = 2 + 2 = 4

So, 2 is not the answer.

Substituting y=3 would give us:

8/3² + 2 = 8/9 + 2 = 0.888 + 2 = 2.888

So, 3 is not the answer.

Substituting y=4 would give us:

8/4² + 2 = 8/16 + 2 = 0.5 + 2 = 2.5

So, 4 is not the answer.

Therefore, none of the given numbers make the equation 8/y² + 2 true.

To learn more about algebra from the given link:

https://brainly.com/question/24875240

#SPJ1

Find the compound interest on Rs. 3,500 for 2 years at the rate of 8% per annum.​

Answers

Answer: The formula for compound interest is:

A = P(1 + R/100)^t

where A is the amount after t years, P is the principal amount, R is the rate of interest per annum, and t is the time period in years.

Here, P = Rs. 3,500, R = 8%, and t = 2 years.

So, the amount after 2 years will be:

A = 3,500(1 + 8/100)^2

= 3,500(1.08)^2

= 3,892.32

Therefore, the compound interest for 2 years will be:

CI = A - P

= 3,892.32 - 3,500

= 392.32

Hence, the compound interest on Rs. 3,500 for 2 years at the rate of 8% per annum is Rs. 392.32.

Step-by-step explanation:

if you dilate triangle ABC by a scale factor of 3 and (0,0) is the center, what will be the length of AB?

Answers

the new length of AB after a dilation by a scale factor of 3 with (0,0) as the center would be 3 times the original length of AB.

How to solve the question?

To find the new length of AB after a dilation by a scale factor of 3 with (0,0) as the center, we can use the following formula:

AB' = AB x 3

where AB' is the length of AB after the dilation, and AB is the original length of AB.

However, we need to first determine the length of AB in the original right triangle ABC. To do this, we can use the Pythagorean theorem, which states that in a right triangle, the square of the hypotenuse (the longest side) is equal to the sum of the squares of the other two sides.

Let's assume that AB is the hypotenuse of the right triangle ABC, and that AC and BC are the other two sides. Then we have:

AB²= AC²+ BC²

Without more information about the lengths of AC and BC, we cannot determine the value of AB. However, once we have determined the length of AB, we can use the formula above to find the new length of AB after dilation.

Assuming we know the length of AB in the original right triangle ABC, we can now use the formula for dilation to find the new length of AB:

AB' = AB x 3

For example, if AB is 5 units long in the original triangle, then after dilation, AB' would be:

AB' = 5 x 3 = 15 units

Therefore, the new length of AB after a dilation by a scale factor of 3 with (0,0) as the center would be 3 times the original length of AB.

To know more about Pythagoras theorem visit,:-

https://brainly.com/question/343682

#SPJ1

Find an equation of the osculating plane and an equation of the normal
plane of the curve x = sin 2t, y = t, z = cos 2t at the point (0, π, 1).

Answers

The equation of the normal plane is 4y = 4π, or equivalently, y = π.

What is osculating plane?

The word osculate comes from the Latin osculatus, which is a past participle of the verb osculari, which means "to kiss." Thus, an osculating plane is one that "kisses" a submanifold.

To find the osculating plane and normal plane of the curve x = sin 2t, y = t, z = cos 2t at the point (0, π, 1), we need to follow these steps:

Find the first and second derivatives of the curve with respect to t.Evaluate the derivatives at t = π to get the velocity, acceleration, and curvature vectors at the point (0, π, 1).Use the velocity and acceleration vectors to find the normal vector of the osculating plane.Use the normal vector and the point (0, π, 1) to find the equation of the osculating plane.Use the curvature vector to find the normal vector of the normal plane.Use the normal vector and the point (0, π, 1) to find the equation of the normal plane.

Step 1: Find the first and second derivatives of the curve with respect to t.

x' = 2cos2t

y' = 1

z' = -2sin2t

x'' = -4sin2t

y'' = 0

z'' = -4cos2t

Step 2: Evaluate the derivatives at t = π.

x'(π) = 2cos2π = 2

y'(π) = 1

z'(π) = -2sin2π = 0

x''(π) = -4sin2π = 0

y''(π) = 0

z''(π) = -4cos2π = -4

So the velocity vector at the point (0, π, 1) is v = ⟨2, 1, 0⟩, the acceleration vector is a = ⟨0, 0, -4⟩, and the curvature vector is κv = ⟨0, 4, 0⟩.

Step 3: Use the velocity and acceleration vectors to find the normal vector of the osculating plane.

The normal vector of the osculating plane is given by the cross product of the velocity and acceleration vectors:

n = v × a = ⟨2, 1, 0⟩ × ⟨0, 0, -4⟩ = ⟨4, 0, 0⟩

Step 4: Use the normal vector and the point (0, π, 1) to find the equation of the osculating plane.

The equation of the osculating plane is given by:

4(x - 0) + 0(y - π) + 0(z - 1) = 0

Simplifying, we get:

4x - 4 = 0

So the equation of the osculating plane is 4x = 4, or equivalently, x = 1.

Step 5: Use the curvature vector to find the normal vector of the normal plane.

The normal vector of the normal plane is given by the curvature vector:

n' = κv = ⟨0, 4, 0⟩

Step 6: Use the normal vector and the point (0, π, 1) to find the equation of the normal plane.

The equation of the normal plane is given by:

0(x - 0) + 4(y - π) + 0(z - 1) = 0

Simplifying, we get:

4y - 4π = 0

So, the equation of the normal plane is 4y = 4π, or equivalently, y = π.

Learn more about derivatives on:

https://brainly.com/question/23819325

#SPJ1

find the area and perimeter of each figure below. ​

Answers

Answer:

finding the perimeter, you sumthe distance all round that is 7+7.5+17.8+6=38.3

38.3 is the perimeter

50pts!!!!

Many investors use interest-only loans to buy shares or property. For such loans the principal stays constant and only the interest is paid back each month.


She buys an investment property for $300 000 and borrows the full amount at 7% p.a. simple interest. She rents out the property at $1500 per month and pays $3000 per year in rates and other costs to keep the property.


Find the amount of interest she needs to pay back every month.


Find her yearly income from rent.



By considering the other costs in keeping the property, calculate her overall loss in a year.



she hopes that the property’s value will increase enough to cover any loss she is making. By what percentage of the original price will the property need to increase in value per year?

Answers

Step-by-step explanation:

to find the interest she needs to pay back every month, we need to use this formula:

I = PRT/12

in this case the principle is $300,000, the rate is 7% p.a. and the amount of time is 1 year, if we substitute in our values we:

I = (300,000)(7)(1)/12 = $17,500 in interest every month

to find her yearly income from rent, we have to multiply the monthly rent by 12

1500 × 12 = $18,000

to calculate her loss percentage in a year, we have to subtract 18,000 from 3000 which is 15,000

she said that she hopes the property's value will increase to cover the loss she made.

to cover the loss of $15000 per year, the property needs to increase in value by at least $15000. the percentage increases value can be written as

Percentage increase = (difference in increase/Original price) × 100

so

percentage increase = (15000/300000) × 100 = 5%

so the property needs to increase in value by at least 5% per year to cover the loss.

Final answer:

The woman needs to pay $1750 monthly as interest. Her yearly income from the rent is $18,000. After considering all other costs, she is at a loss of $6000 per year, so the property needs to increase in value by 2% per year to cover this loss.

Explanation:First, let's calculate the monthly interest she needs to pay. 7% of $300,000 is $21,000 for a year. To find the monthly interest, we divide this by 12, resulting in $1750.Her yearly income from rent is $1500 multiplied by 12, giving us $18,000.To calculate her overall loss, we add the yearly interest and the costs to keep the property, then subtract the yearly rent income. So, $21,000 + $3000 - $18,000 = $6000 loss per year.Lastly, to find out by what percentage the property value needs to increase, we divide the loss by the original price and multiply by 100, giving us 2% increase per year.Learn more about Interest and Profit Calculation here:

https://brainly.com/question/32651816

#SPJ2

Help please i dont know

Answers

The histogram should be modified as follows:

The bin from 6 to 15 should be increased by 2.The bin from 16 to 25 should be increased by one.The bin from 26 to 35 should be increased by one.The bin from 46 to 55 should be increased by one.

What is shown by an histogram?

A histogram is a type of graphical representation that displays the distribution of a dataset. It is a bar graph-like chart where the data is divided into intervals, called "bins", which are represented by adjacent rectangular bars of varying heights.

Then the height of the histogram gives the number of observations into each data interval.

Hence the histogram should be modified as follows:

The bin from 6 to 15 should be increased by 2. -> two measures of 12.The bin from 16 to 25 should be increased by one. -> measure of 16.The bin from 26 to 35 should be increased by one. -> measure of 26.The bin from 46 to 55 should be increased by one. -> measure of 48.

More can be learned about histograms at https://brainly.com/question/25983327

#SPJ1

A drawer contains 10 blue pens, 12 black pens, and 3 red pens. Without looking, Mr. Lopez is going to take one pen from the drawer, use it, and then put it back into the drawer. Then he is going to take another pen from the drawer to use. What is the probability of Mr. Lopez taking a red pen first and then taking a blue pen?

Answers

Answer: 4.8%

Step-by-step explanation: the total amount of pens in the drawer is (10+12+3)  = 25

the amount of red pens in the drawer is 3

the probability of picking out a red pen from the drawer = 3/25

the amount of blue pens in the drawer is 10

the probability of picking out a red pen from the drawer = 10/25

the probability of picking out a red pen then a blue pen afterwards = (10/25 x 3/25) = 4.8%

(a) What is the value of x? Show your work.
(b) What is the measure of angle C? Show your work.

Answers

In triangle ABC

a) The value of x = 29⁰

b) The angle c equal to 93⁰

What is a triangle?

A triangle is a closed plane figure that is formed by connecting three line segments, also known as sides, at their endpoints. The three endpoints, or vertices, where the sides of the triangle meet are not collinear. Triangles are important in mathematics and geometry because they are the simplest polygon that can exist in two-dimensional space.

According to the given information

In a triangle, the sum of all interior angles is always 180 degrees. Therefore, we can use this fact to find the value of x and angle c.

We know that:

angle a = 35⁰

angle b = 52⁰

angle c = 3(x+2)⁰

Using the fact that the sum of all interior angles in a triangle is 180 degrees, we can write:

angle a + angle b + angle c = 180

Substituting the values we know, we get:

35 + 52 + 3(x+2) = 180

Simplifying the equation, we get:

87 + 3x + 6 = 180

3x + 93 = 180

3x = 87

x = 29

Therefore, x = 29⁰

To find angle c, we can substitute the value of x into the equation we were given for angle c:

angle c = 3(x+2)

angle c = 3(29+2)

angle c = 3(31)

angle c = 93

Therefore, angle c is equal to 93⁰.

To know more about interior angles visit:

brainly.com/question/12834063

#SPJ1

Choose scales for the coordinate plane shown so that you can graph the points J (5, 50), K(3, 50), L (4, -40), M (-2, 40), and N (-5, -10). on the x-axis use a scale of ____ units for each grid square. on the y-axis use a scale of ____ units of each grid square. complete the explanation for using these scales for each axis. the x-coordinates range from ____ to ____, and the y-coordinates range from ____ to ____.

Answers

On the x-axis use a scale of 2 units for each grid square. on the y-axis use a scale of 10 units of each grid square. The x-coordinates range from -5 to 5. y-coordinates range from -40 to 50.

What is coordinate plane?

In mathematics, points and functions are represented and graphed on the coordinate plane, commonly known as the Cartesian plane. The x-axis and y-axis are two perpendicular number lines that meet at the origin to form the plane (0,0).

On the coordinate plane, points are denoted by ordered pairs (x, y), where x denotes the point's separation from the y-axis and y denotes its separation from the x-axis.

For the given coordinates the range of x and y coordinates are:

x-coordinates range from -5 to 5

y-coordinates range from -40 to 50.

Thus, we use a scale of 2 on the x-axis and 10 units on the y axis.

Learn more about coordinate plane here:

https://brainly.com/question/24134413

#SPJ1

Solve for x.


A. 7
B. 4
C. 3
D. 5

Answers

The correct option -D. 5;  Thus, the value of x for the given external secant segment and the tangent on the circle is found as:x = 5.

Explain about the secant of circle:

A line that precisely intersects a circle at two points is said to be a secant.

The size of the angle created when two tangents, two secants, or two tangents cross outside of a circle is equal to one-half a positive difference between the sizes of the intercepted arcs.

Using the Theorem:

The square of a length of tangent is equal the the product of such external secant segment and the overall length of the secant if one secant and one tangent both drawn to a circle from a single exterior point:

4(4 + x) = 6²

16 + 4x = 36

4x = 36 - 16

4x = 20

x = 20/4

x = 5

Thus, the value of x for the given external secant segment and the tangent on the circle is found as:x = 5.

know more about the secant of circle:

https://brainly.com/question/25871159

#SPJ1

7. Can the following be the lengths of the sides of a triangle?
a. 20 cm, 40 cm, 50 cm
b. 20 cm, 40 cm, 60 cm
c. 41 cm, 250 mm, 12 cm​

Answers

Answer:

B

Step-by-step explanation:

THE TWO SMALLER SIDES = THE LARGER SIDE HENCE ITS A TRIANGLE

complete the equatiotin 3 over 4 x 6 =
PLEASE HELP

Answers

Answer:

1/8

Step-by-step explanation:

If "over" refers to (4 * 6) as a whole,

[tex]\frac{3}{4*6}\\\\=\frac{3}{24}\\\\=\frac{1}{8}[/tex]

If "over" refers to division,

[tex]3 \div 4 \times 6\\= 0.75 \times 6\\= 4.5[/tex]

I would suppose it's the first one, so, ignore the second one if you haven't learnt BODMAS yet.

Hope this helps and be sure to mark this as brainliest! :)

Chloe claims that Point A=−6 and Point B=1 . Which of the following statements provide support for Chloe's claim? Select ALL that apply. A A<0 because A is to the left of zero B A>0 because A is to the left of zero C A 0 because B is to the left of zero F B>0 because B is to the right of zero

Answers

The statements that provide support for Chloe's claim are A<0 because A is to the left of zero, B>0 because B is to the right of zero. So correct option is A and F.

Describe Comparison Algebra?

Comparison algebra is a branch of algebra that deals with inequalities and comparisons between different quantities or expressions. In comparison algebra, the goal is to determine the relationships between different expressions or quantities, such as whether one expression is greater than, less than, or equal to another expression.

Comparison algebra involves the use of comparison symbols, such as "<" (less than), ">" (greater than), and "=" (equal to), to express these relationships. For example, if we have two expressions, A and B, we can use the "<" symbol to express the relationship that A is less than B, as in A < B.

In comparison algebra, we can also manipulate inequalities and equations in similar ways as we do with regular algebraic expressions. For instance, we can add, subtract, multiply, or divide both sides of an inequality or equation by the same number or expression, while maintaining the inequality's direction.

The statements that provide support for Chloe's claim are:

A. A<0 because A is to the left of zero.

F. B>0 because B is to the right of zero.

Statement A supports Chloe's claim because Point A is to the left of zero on the number line, which means its value is negative. Statement F also supports Chloe's claim because Point B is to the right of zero on the number line, which means its value is positive.

To know more about expression visit:

https://brainly.com/question/6321768

#SPJ9

The expression 12x +8 is equivalent to the expression a(bc+c), where b and c are constants and have no common factors. A student wrote the answer as 2 (6x+4). Which statement best explains whether the students answer is correct or incorrect

Answers

The student's is incorrect because the greatest common factor of 12 and 8 is 2z, so the correct expression is 2x (6x+4).

What is expression?

Expression is the communication of emotion or ideas through words, art, music, or other forms of communication. It is the way in which a person or artist conveys their thoughts and feelings in a creative and meaningful way. Expression can be seen in the form of art, writing, music, dance, and other creative outlets. Expression is a powerful tool that can be used to communicate a message or to evoke a feeling in the audience. Expression can be used to inspire, educate, motivate, and even to heal. Expression is a way to connect people and cultures, and a way to share stories and experiences. It is a way to express oneself in a meaningful and powerful way.

This is because 12z+8 can be written as 2z(6x+4), where the greatest common factor of 12 and 8 (2z) is factored out.

To learn more about expression
https://brainly.com/question/1859113
#SPJ1

Complete Question:
The expression 12z+8 is equivalent to the expression a (bx + c), where b and c are constants and have no common factors. A student wrote the answer as 2 (6x+4).

Which statement best explains whether the student's answer is correct or incorrect?

OA. The student's answer is incorrect because the greatest common factor of 12 and 8 is 2z, so the correct expression is 2x (6x+4).

OB. The student's answer is incorrect because the greatest common factor of 12 and 8 is 4z, so the correct expression is 4z (3x+2).

C. The student's answer is incorrect because the greatest common factor of 12 and 8 is 4, so the correct expression is 4 (3x+2).

OD. The student's answer is incorrect because the greatest common factor of 12 and 8 is 8, so the correct expression is 8 (4x+1).

Problem 7: Find the surface area and round to the nearest tenth.

Answers

Answer:

1629.24m

Step-by-step explanation:

starting with the easy ones

1) Rectangle 1:

Surface area of rectangle=Length x width

SAR= 24x21

= 504m

2) Rectangle 2:

SAR= 19x21

=399

3) Rectangle 3

SAR= 21x8

=168

4) Rectangle 4:

SAR= 21x11

=231

*because the top and bottom are trapeziums the formular for it is

A=1/2(a+b)h

although those trapeziums don't have h(Height)

it needs to be broken down into two triangles and a rectangle. to find the height*

5) side/height of triangle A:

formula: C squared= a squared + b squared

in this case we already have C and A. meaning we have to rearrange the formula to:

x = c^2 - a^2

x = 8^2 - 2.5^2

x = sqrt 57.75

x = 7.61

6) Trapezium

SA= 1/2(a+b)h

SA= 1/2(19+24)7.61

=163.62

7) add all surface area together

which should equal 1629.24m

I need help solving this thank you

Answers

The negation is the fourth option.

6 + 3 ≠ 9 or 6 - 3 ≠ 9

How to write the negation?

The negation of an equation is an inequality such that we just change the equal sign, by the "≠" sign.

Here we start with the two equations.

6 + 3 = 9 or 6 - 3 = 9

Just change the equal signs for different signs:

6 + 3 ≠ 9 or 6 - 3 ≠ 9

That is the negation, fourth option.

Learn more about inequalities at:

https://brainly.com/question/24372553

#SPJ1

I need help

A population of bacteria is growing according to the equation p(t)=800e^0.14t Estimate when the population will exceed 1151.

t= ---------

Answers

Answer: t=2.59

Step-by-step explanation:

This is a matter of clearing out the equation

set 1151=800e^0.14t

1151/800=e^0.14t

ln(1151/800)/0.14=t

t=2.59

Will mark brainliest if answer is correct

Answers

Answer:

[tex]3( {2}^{2} ) - {2}^{2} + 4 = 12[/tex]

[tex] {2}^{3} + b( {2}^{2} ) + 43(2) - 126 = 4b - 204[/tex]

[tex]4b - 32 = 12[/tex]

[tex]4b = 44[/tex]

[tex]b = 11[/tex]

For this value of b, these graphs will intersect at (2, 12). Please use your graphing calculator to confirm that this is the only point of intersection.

Other Questions
explain why we call the national halothane study an observational study rather than an experiment, even though it compared the results of using different anesthetics in actual surgery.in order to be an experiment, the subjects would have to be randomly selected from the population. however, these are hospital patients who all have some disease or condition and have not been randomly selected from the population, which includes both healthy and sick people.in order to be an experiment, the treatments (choice of anesthetic) would have to be randomly assigned. instead, a patient's anesthetic is selected by his or her doctor(s).there is not enough information to say for sure, but it is safer to assume that it is only an observational study, so that we are not overconfident about the results.actually, it is an experiment and not an observational study. Your task is to implement a simplified inventory tracker system for a large retail store. You are given a price list that describes the current A small tree that is 8 feet tall casts a 4-foot shadow, while a building that is 24 feet tall casts a shadow in the same direction. Determine the length of the building's shadow. 6 feet 12 feet 18 feet 48 feet under the equipment breakdown protection coverage form, what condition will apply if the covered equipment is subject to a dangerous exposure? Four score and 7 years ago blank brought forth on this continent, a new nation, conceived in the liberty, and dedicated to the proposition that all men are created equal. now blank are engaged in a civil war, testing weather blank Nation blank or any Nation so conceived and dedicated, can long endure. we are met on a great battlefield l this. but, in large sense, blank cannot dedicate -- we cannot consecrate -- we cannot Hollow this ground. the brave men, living and dead, who struggled here, have consecrated it, far above our poor power to add or detract . the world will little note, nor long remember what we say here, but it can never forget what they did here . it is for us the living, rather, to be dedicated here to unfinish the work which blank who fought here have thus far so nobly advanced. it is rather for us to be here dedicated to the great task remaining before us -- that from these honored dead we take devotion to that cause for which they gave the least full measure of devotion -- that we are highly resolved that these dead shall not have died in vain -- that this nation, under God , shall have a new birth of freedom -- and that the government of people, by the people, for the people, shall not perish from the earth. Lenders look at a HELOC balance of less than $50,000 as if ________________.It were a credit cardIt were an assetIt were a paid mortgageIt were cash Consider the reaction described by the chemical equation shown.C2H4(g)+H2O(l)C2H5OH(l)rxn=44.2 kJUse the data from the table of thermodynamic properties to calculate the value of rxnat 25.0 C.Srxn= ? JK1Calculate rxn.Grxn= ? kJIn which direction is the reaction, as written, spontaneous at 25 Cand standard pressure?reversebothneitherforward Please help!! URGENT!! I dont understand For Kittle Co., a stronger Canadian dollar has a stronger influence on Canadian dollar ___ than it does on Canadian dollar ___ Step 2 In the previous stage, you saw that Kittle's operating structure, with low sales in Canada and high cost of materials from Canadian suppliers, was a source of significant economic exposure each quarter. Because of this, Kittle has decided to restructure it's operating structure. The largest part of the restructure involves an increase in U.S. operating expense in order to pay for efforts to increase Canadian sales, while also ordering more supplies from U.S. suppliers instead of Canadian suppliers. This restructuring also includes using more U.S. sources for financing instead of Canadian sources. inferred the reason why the droeshout engraving and Shakespeare statue are considered unreliable davie inc. has a pre-tax cost of debt of 8.6 percent, a cost of equity of 13.4 percent, and a cost of preferred stock of 8.5 percent. the firm has 240,000 shares of common stock outstanding at a market price of $27 a share. there are 25,000 shares of preferred stock outstanding at a market price of $33 a share. the bond issue has a face value of $540,000 and a market price of 102.1 percent of face value. the company's tax rate is 34 percent. what is the firm's weighted average cost of capital? Select the verb : Gregory Eddie had planted an apple tree in the yard. Problem 9-34 Risk, Return, and Their Relationship (LG9-3, LG9-4) Consider the following annual returns of Molson Coors and International Paper: Year 1 Year 2 Year 3 Year 4 Molson Coors 17.88 - 8.7 38.0 International Paper 4.8% -17.8 -0.5 26.9 -11.4 - 7.5 Year 5 16.5 Compute each stock's average return, standard deviation, and coefficient of variation. (Round your answers to 2 decimal places.) Molson Coors 11.22 % Average return Standard deviation International Paper 0.40% % % Coefficient of variation Which stock appears better? O International Paper O Molson Coors the commander and his staff must work to clearly display objectives and end states by phase, demonstrating explicitly their incorporation of what elements of design? (select all that apply.) At the start of 1996, the annual interest rate was 8 percent in the United States and 4.8 percent in Japan. The exchange rate was 108 yen per dollar at the time. Mr. Jorus, who is the manager of a Bermuda-based hedge fund, thought that the substantial interest advantage associated with investing in the United States relative to investing in Japan was not likely to be offset by the decline of the dollar against the yen. He thus concluded that it might be a good idea to borrow in Japan and invest in the United States. At the start of 1996, in fact, he borrowed \1,000 million for one year and invested in the United States. At the end of 1996, the exchange rate became 118 yen per dollar. How much profit did Mr. Jorus make in dollar terms? Answer is complete but not entirely correct. Profit $ 143,576,944 HELP ME PLS1. If the diameter of a circle is segment AB where Point A is located at (-3, 6), and Point B located at (-8,-1), what is the diameter of the circle? 221467474 What key component within the changing culture of readiness refers to leaders presenting information necessary for deployability determinations in a manner that truly depicts unit readiness Urgent, please help! You bought 1,000 shares of Altona Ltd 5 years ago. Over the years you have attended the annual general meetings and carefully read through Altona Ltds financial statements. While you have been generally satisfied with the amount of annual dividends, recently you have become a little concerned with declining share prices. You became particularly alarmed when media published several photos showing Altona managements Hawaiian management retreats. Taking into consideration the management behaviour critically discuss the relationship between a corporations shareholders and management. Analyse the problems and costs related to this relationship and explain with example how a company may structure management compensation to mitigate such costs. What is the purpose of the European Union?