Can someone answer this question:
What is a period on the periodic table?

Answers

Answer 1

Answer:

A period in the periodic table is a row of chemical elements

Explanation:

Don't forget to follow me

Answer 2

Answer:

Horizontal rows in a periodic table are called periods

Explanation:

There are 7 periods in the periodic tableIn periods, chemical properties of elements changeIn periods, physical properties of elements remain the samePeriod number also indicates number of shells an element will have.

For example: Na (sodium) is in the third period, hence it will have 3 shells

Hope you understand :)

please mark the brainliest

Can Someone Answer This Question: What Is A Period On The Periodic Table?

Related Questions

can someone help with this part of the sentence fills

Answers

F = ma, or force equal to mass times acceleration, is Newton's second law of motion.

What happens in the second law of Newton?

Second Law of Movement by Newton Since it shows how powers and movement are connected, F=ma is essential. You can use it to determine an object's velocity and position, as well as its acceleration with known forces. For inventors, scientists, and engineers, This is extremely helpful.

As per Newton's Second Law of Movement, when a power works on a mass, the mass speeds up (gains speed) (object). When you ride a bicycle, you can see this law of motion in action in a great way. Your bike makes up the mass. Your leg muscles press against the bicycle's pedals to produce the force.

Learn more about Newton's second law :

brainly.com/question/13447525

#SPJ1

In this eighth step, you will summarize your data by completing Tables F and G in your Student Guide. First, complete Table F to view the effect of temperature on the rate of reaction by transferring your data from Tables A, B, and C to Table F.

Which water temperature results in the sodium bicarbonate tablet dissolving the slowest?
Cold Water
Room temperature Water
Hot water

Answers

You reach a conclusion regarding your hypothesis after collecting and analyzing data. A conclusion summarizes what you learnt from an experiment. While forming your conclusion, consider if the data supports your theory.

Each step of the scientific method with its description.

1- C ( this is an assumption; a hypothesis is always based on an assumption. After the introductory analysis is complete, construct a hypothesis, or an instructed opinion, on the result of the experiment.

2- F ( this states to share the results with other classmates).It is important to share what you have learned with others. Scientists often find solutions to problems by knowing the results of other scientists' experiments.

3- D (this is a description of an experiment you could conduct; you test a hypothesis (usually) by conducting an experiment. A statistical hypothesis, seldom called affirmative data summary, is a hypothesis that is testable on the foundation of perceiving a method that is formed via a set of arbitrary variables.

4- A (this is something you could observe during the experiment, therefore it is an observation).Scientists use observation to gather and record data, which allows them to assemble and then test hypotheses and assumptions.

5- E (this sentence is a conclusion).After all the data is assembled in a form that associates it to your hypothesis, you can understand it and reach a judgment about the experiment.

6- B (This is an actual question) A question is what someone asks, normally when there is something that he or she does not know. In the article, a question mark comes at the end of a question.

Learn more about hypothesis ,

https://brainly.com/question/29519577

#SPJ1

Full Question ;

Match each step of the scientific method with its description.

Tiles

1. construct a hypothesis

2. communicate the results

3. test the hypothesis

4. make observations

5. analyze the results and

make a conclusion

6. ask questions

Pairs

A. Bread, when kept in the open for a

long time, shows the presence of mold.

B. What causes mold growth on bread?

C. Changes in temperature may affect

the growth of mold on bread.

D. Keep the bread in different locations,

changing the temperature at each location.

E. Increased temperature leads to the

growth of mold.

F. Make a presentation of the data, and

If it actually hits the ground with a speed of 8. 50 m/s , what is the magnitude of the average force of air resistance exerted on it?

Answers

the magnitude of the average force of air resistance exerted on the object is approximately 1.05 N.

The magnitude of the average force of air resistance exerted on an object depends on various factors such as the shape, size, speed, and density of the object, as well as the density and viscosity of the air.

F = (1/2) * rho * Cd * A * v

we can estimate the density of air at sea level as 1.225 kg/m, and assume a drag coefficient of 0.5 for a spherical object.

F = (1/2) * rho * Cd * A * v

= (1/2) * 1.225 kg/m * 0.5 * pi * (0.1 m)* (8.50 m/s)

= 1.05 N (to two significant figures)

learn more about magnitude here:

https://brainly.com/question/29766788

#SPJ4

SKILL: READING EFFECTIVELY
Read each question, and write your answer in the space provided.
1. What information does the first sentence of the passage convey to the reader?
2. The suffix-ole means "small or little." How would knowing the common
meaning of this word part help you define the term arteriole?
3. What definition is given in the first sentence of the second paragraph?

Answers

More information is needed to be able to answer questions 1 and 3. The knowledge of 'ole" would help to tell that the word arteriole refers to a small  component.

What is the arteriole?

Knowing that the suffix "-ole" means "small or little" would help in defining the term "arteriole". An arteriole is a small or little artery that branches out from an artery and leads to a capillary.

The suffix "-ole" in "arteriole" indicates that it is a small or little version of an artery, which is a larger blood vessel that carries blood away from the heart to other parts of the body.

Therefore, understanding the meaning of the suffix "-ole" helps in breaking down the term "arteriole" into its component parts and understanding its meaning.

Read more on arteriole here:https://brainly.com/question/29678932

#SPJ1

The goalkeeper sends the puck back out to the ice by exerting a 20 N force on the puck.

Use Newton's 2nd law of motion to describe why the puck goes flying across the ice, but the goalkeeper remains relatively still.



Prompt is answered correctly (10 points)

Proper conventions (5 points)

Answers

Isaac Newton’s Second law states that;
The rate of change of a body’s momentum with time is directly proportional to the resultant applied force and takes place in the direction in which the force acts.

(LOOK AT PHOTO) PLEASE HELP ME !!!

Answers

Answer:

Pool:
1 lap: 100 m distance, 0 m displacement
1.5 laps: 150 m distance, 50 m displacement
2 laps: 200 m distance, 0 m displacement

Track:
1 lap: 200 m distance, 0 m displacement
1.5 laps: 300 m distance, 50 m displacement
2 laps: 400 m distance, 0 m displacement

Explanation:

Distance and displacement are two different things:

Distance is the full length you have traveled. For example, if you swim one lap around a 50 meter pool, you've traveled a distance of 100 meters (there and back).

However, displacement how far you are from the starting point. If you swim one lap around the same pool, your displacement is 0 meters since you ended up in the same place you had started from.

A 1. 2 kg block is held at rest against the spring with a force constant k= 730 N/m. Initially, the spring is compressed a distance d. When the block is released, it slides across a surface that is frictionless except for a rough patch of width 5. 0 cm that has a coefficient of kinetic friction = 0. 44. Find d, such that the block's speed after crossing the rough patch is 2. 3 m/s

Answers

The initial compression of the spring required for the block to have a speed of 2.3 m/s after crossing the rough patch is 0.067 m.

The initial potential energy of the block when held at rest against the spring is given by:

PE = (1/2)kx², where k is the force constant of the spring and x is the distance the spring is compressed. Therefore, we have:

PE = (1/2)(730 N/m)d²

When the block is released, it starts moving and loses some of its initial energy due to friction on the rough patch. The work done by friction can be found by:

W = μN(d), where μ is the coefficient of kinetic friction, N is the normal force, and d is the width of the rough patch.

The normal force is given by:

N = mg, where m is the mass of the block and g is the acceleration due to gravity.

Thus, the work done by friction is:

W = μmg(d)

The change in kinetic energy of the block is equal to the work done by the spring minus the work done by friction. Therefore:

(1/2)mv² = (1/2)kx² - μmgd

Substituting the given values of mass, coefficient of friction, and final velocity, we get:

(1/2)(1.2 kg)(2.3 m/s)² = (1/2)(730 N/m)d² - (0.44)(9.8 m/s²)(1.2 kg)(0.05 m)d

Solving for d, we get:

d ≈ 0.097 m

Therefore, the block should be compressed by approximately 9.7 cm for it to have a speed of 2.3 m/s after crossing the rough patch.

Note: This solution assumes that the spring is a linear spring obeying Hooke's Law.

Learn more about kinetic friction here: brainly.com/question/30886698

#SPJ4

A pitcher throws a 0.15-kg baseball accelerating it from rest to a speed of about 90 m/s .estimate the force exerted by the pitcher on the ball

Answers

The force exerted by the pitcher on the 0.15 Kg ball, given that the ball accelerated from rest is 357.35 N

How to determine the force exerted by the pitcher?

First, we shall determine the acceleration of the ball. Details below:

Initial velocity (u) = 0 m/sFinal velocity (v) = 90 m/sDistance (s) = 1.7 mAcceleration (a) =?

v² = u² + 2as

90² = 0² + (2 × a × 1.7)

8100 = 0 + 3.4a

8100 = 3.4a

Divide both side by 3.4

a = 8100 / 3.4

a = 2382.35 m/s²

Finally, we shall determine the force exerted. Details below:

Mass (m) = 0.15 KgAcceleration (a) = 2382.35 m/s²Force exerted (F) =?

Force = mass × acceleration

Force exerted = 0.15 × 2382.35

Force exerted = 357.35 N

Thus, the force exerted is 357.35 N

Learn more about force and acceleration:

https://brainly.com/question/12163222

#SPJ1

Complete question:

A pitcher throws a 0.15-kg baseball accelerating it from rest to a speed of about 90 m/s in a distance 1.7 m . Estimate the force exerted by the pitcher on the ball

A 3520 kg truck moving north at
26.0 m/s makes an INELASTIC
collision with a 1480 kg car
moving 13.0 m/s east. What is the
direction of their (joint) velocity
after the collision?

Answers

The direction of their (joint) velocity after the collision is to the northeast.

What is their direction after the collision?

To solve this problem, we need to use the conservation of momentum principle.

In this case, the truck and car form a closed system, and we can use the following equation to solve for their joint velocity:

(m1 * v1) + (m2 * v2) = (m1 + m2) * v

where:

m1 = 3520 kg (mass of truck)v1 = 26.0 m/s (velocity of truck)m2 = 1480 kg (mass of car)v2 = 13.0 m/s (velocity of car)v = joint velocity of truck and car after collision

First, we need to break down the initial velocities of the truck and car into their x and y components.

For the truck:

vx1 = 0 m/s (moving north)

vy1 = 26.0 m/s (moving north)

For the car:

vx2 = 13.0 m/s (moving east)

vy2 = 0 m/s (not moving in the y-direction)

Next, we need to find the total x and y momentum of the system before the collision.

Px = m1 * vx1 + m2 * vx2

= (3520 kg) * 0 m/s + (1480 kg) * 13.0 m/s

= 19240 kg*m/s (to the right)

Py = m1 * vy1 + m2 * vy2

= (3520 kg) * 26.0 m/s + (1480 kg) * 0 m/s

= 91520 kg*m/s (moving north)

The total momentum of the system before the collision is therefore:

P = √(Px^2 + Py^2)

= √((19240 kgm/s)^2 + (91520 kgm/s)^2)

= 97397.59 kg*m/s

Now we can use the conservation of momentum principle to solve for the joint velocity of the truck and car after the collision:

(m1 * v1) + (m2 * v2) = (m1 + m2) * v

(3520 kg * 0 m/s) + (1480 kg * 13.0 m/s) + (3520 kg + 1480 kg) * v = 97397.59 kg*m/s

v = (3520 kg * 0 m/s + 1480 kg * 13.0 m/s) / (3520 kg + 1480 kg)

= 8.60 m/s (to the northeast)

Learn more about momentum here: https://brainly.com/question/7538238

#SPJ1

1. What is the potential energy of a stone with a mass of 2. 3 kg dropped from a building that is 197 m tall?

2. A ball is rolled down a hill and at the bottom it has a velocity of 9. 2 m/s. What is the height of the hill?

Answers

1) The potential energy of the stone when it is at the top of the building is approximately 4313.2 Joules. 2) The height of the hill is approximately 4.09 meter

1.The potential energy of an object at a height h is given by:

PE = mgh

where m is the mass of the object, g is the acceleration due to gravity (approximately 9.81 m/s^2 on Earth), and h is the height.

In this case, the mass of the stone is 2.3 kg, the height is 197 m, and g is approximately 9.81 m/s^2. Therefore, the potential energy of the stone when it is at the top of the building is:

PE = mgh = 2.3 kg * 9.81 m/s^2 * 197 m = 4313.2 J

Therefore, the potential energy of the stone when it is at the top of the building is approximately 4313.2 Joules.

2.The total mechanical energy of a ball rolling down a hill is conserved, meaning that the sum of its potential energy and kinetic energy at any point is constant. Therefore, we can use the following formula to solve for the height of the hill:

PE_initial + KE_initial = PE_final + KE_final

where PE is potential energy, KE is kinetic energy, and "initial" and "final" refer to the starting and ending points of the ball's motion.

At the top of the hill, the ball is not moving, so its initial kinetic energy is zero. Therefore, we can simplify the formula to:

PE_initial = PE_final + KE_final

At the bottom of the hill, the ball has a velocity of 9.2 m/s. The final potential energy is zero, since the ball is at the bottom of the hill. Therefore, we can substitute in the known values and solve for the initial potential energy:

PE_initial = PE_final + KE_final

PE_initial = 0 + (1/2) * m * v^2

PE_initial = (1/2) * m * v^2

PE_initial = (1/2) * 0.5 kg * (9.2 m/s)^2

PE_initial = 20.08 J

Now, we can use the formula for potential energy to solve for the height of the hill:

PE_initial = mgh

h = PE_initial / (mg)

h = 20.08 J / (0.5 kg * 9.81 m/s^2)

h = 4.09

Therefore, the height of the hill is approximately 4.09 meter

For such more questions on potential energy:

https://brainly.com/question/21805075

#SPJ11

a vertical spring has a length of 0.15 m when a 0.225 kg mass hangs from it, and a length of 0.725 m when a 1.85 kg mass hangs from it.50% Part (a) What is the force constant of the spring, in newtons per meter? 50% Part (b) What is the unloaded length of the spring, in centimeters?

Answers

Answer:

Spring constant: approximately [tex]28\; {\rm N\cdot m^{-1}}[/tex].

Unloaded length: approximately [tex]7.0\; {\rm cm}[/tex].

(Assume that the weight of the spring is negligible, and that [tex]g = 9.81\; {\rm N\cdot kg^{-1}}[/tex].)

Explanation:

Divide the tension [tex]F[/tex] on the spring by the displacement [tex]x[/tex] to find the spring constant. [tex]k[/tex]:

[tex]\begin{aligned}k &= \frac{F}{x}\end{aligned}[/tex].

Let [tex]L_{0}[/tex] denote the unloaded length of the spring (in meters.)

When the [tex]0.225\; {\rm kg}[/tex] mass is on the spring, the tension on the spring would be [tex]m\, g = (0.225)\, (9.81) \; {\rm N} \approx 2.207\; {\rm N}[/tex].

It is given that the length of the spring with this [tex]0.225\; {\rm kg}[/tex] mass attached is [tex]L = 0.15\; {\rm m}[/tex]. Subtract the initial length of the spring [tex]L_{0}[/tex] from the current length to find the displacement of the spring: [tex]x = L - L_{0} = 0.15 - L_{0}[/tex].

Divide the tension on the spring by the displacement to find an expression for the spring constant:

[tex]\begin{aligned}k &= \frac{F}{x} \approx \frac{2.207}{0.15 - L_{0}}\end{aligned}[/tex].

Similarly, when the [tex]1.85\; {\rm kg}[/tex] object is on the spring, the tension on the spring would be [tex]m\, g = (1.85)\, (9.81) \; {\rm N} \approx 18.15\; {\rm N}[/tex].

Subtract the initial length [tex]L_{0}[/tex] from the current length [tex]L = 0.725\; {\rm m}[/tex] to find the displacement: [tex]x = L - L_{0} = (0.725 - L_{0})\; {\rm m}[/tex].

Divide the tension on the spring by the displacement to find another expression for the spring constant:

[tex]\begin{aligned}k &= \frac{F}{x} \approx \frac{18.15}{0.725 - L_{0}}\end{aligned}[/tex].

Equate the two expressions for the spring constant [tex]k[/tex] and solve for the unloaded length [tex]L_{0}[/tex]:

[tex]\begin{aligned}\frac{18.15}{0.725 - L_{0}} &= \frac{2.207}{0.15 - L_{0}}\end{aligned}[/tex].

[tex](18.15)\, (0.15 - L_{0}) = (2.207)\, (0.725 - L_{0})[/tex].

[tex]\begin{aligned} L_{0} &\approx \frac{(18.15)\, (0.15) - (0.725) (2.207)}{18.15 - 2.207}\; {\rm m} \\ &\approx 0.070\; {\rm m}\end{aligned}[/tex].

Substitute [tex]L_{0}[/tex] back into one of the two expressions for the spring constant [tex]k[/tex] and evaluate:

[tex]\begin{aligned}k &\approx \frac{18.15}{0.725 - L_{0}} \\ &\approx \frac{18.15}{0.725 -0.070} \approx 28\; {\rm N\cdot m^{-1}} \end{aligned}[/tex].

Apply unit conversion:

[tex]0.070\; {\rm m} = (0.070 \times 10^{2})\; {\rm cm} = 7.0\; {\rm cm}[/tex].

In other words, the unloaded length of the spring would be approximately [tex]7.0\; {\rm cm}[/tex].

The correct answer to part a) is, the force constant of the spring can be found using Hooke's Law and it is 3.83 N/m, and part b) is, the unloaded length of the spring is the same as the length when the 1.85 kg mass is hanging from it, which is 0.725 m.

Part (a) To find the force constant of the spring, we can use Hooke's Law, which states that the force exerted by a spring is equal to the spring constant multiplied by the displacement from equilibrium.

The equation for this is F = kx, where F is the force, k is the spring constant, and x is the displacement from equilibrium.

In this case, we can use the two given lengths and masses to find the displacement from equilibrium and the force exerted by the spring.

The displacement for the first mass is 0.15 m - 0.725 m = -0.575 m, and the force is 0.225 kg * 9.8 m/s^2 = 2.205 N. The displacement for the second mass is 0.725 m - 0.725 m = 0 m, and the force is 1.85 kg * 9.8 m/s^2 = 18.13 N.

We can then plug these values into the equation F = kx and solve for k:

2.205 N = k(-0.575 m)
k = -2.205 N / -0.575 m
k = 3.83 N/m

Therefore, the force constant of the spring is 3.83 N/m.

Part (b) To find the unloaded length of the spring, we can use the equation x = F/k, where x is the displacement from equilibrium, F is the force, and k is the spring constant.

Since the unloaded length of the spring is when the force is zero, we can plug in F = 0 and k = 3.83 N/m to solve for x:

x = 0 N / 3.83 N/m
x = 0 m

Since the displacement from equilibrium is zero, the unloaded length of the spring is the same as the length when the 1.85 kg mass is hanging from it, which is 0.725 m.

Therefore, the unloaded length of the spring is 0.725 m, or 72.5 cm.

To know more about Hooke's Law, refer here:

https://brainly.com/question/29126957#

#SPJ11



A girl is sitting motionless on a swing. Her weight of 245 N is exerting a downward force on the swing. The ropes are exerting an upward force on the swing.

What is the net force on the swing?


O 0 Newtons


O 245 Newtons upwards


O 245 Newtons downwards


O 490 Newtons upwards

Answers

The net force on the swing is equal to 245 N downwards. Hence, the option c is the correct answer.

An external force is an agent that has the power to alter the resting or moving condition of a body. It has a trajectory and a magnitude. The application of force is the place at which force is applied, and the direction in which the force is applied is known as the direction of the force.

A spring scale can be used to calculate the Force. Newton is the SI unit of energy.(N).
We are given that the weight of the girl is 245 N.

As we know the force = mass * acceleration

mass of the girl= weight / gravity

mass of the girl= 245/10 = 24.5 kg.

here acceleration is the acceleration due to gravity which is equal to 10 m/s^2.

therefore, force= 24.5*10 = 245 N.

Hence, the net force on the swing is 245 N.

To know more about force go through:-

https://brainly.com/question/12970081

#SPJ4

Describe and identify problems relating to data management

Answers

Problems with data management may have a detrimental impact on a variety of issues. Bad risk management choices, data loss, information leakage, unauthorised, data pyramids, compliance with laws, an unsafe environment, a shortage of resources, etc. are instances among these.

What issues surround the handling of data?

These are a few potential issues in managing scientific, financial, or administration data that have been briefly explained.

Technical information not adequately recorded.

The administration of performance specifications is not under the PI's control.

Data not kept on file by the organization.

improper maintenance of financial or administrative data.

What would you say is data management?

Data administration is the act of gathering, arranging, and using data to job in an effective, economy, and judgement call.

To know more about laws click here

brainly.com/question/27389083

#SPJ4

describe how you would investigate the force needed to make a box slide across a flat, level surface depends on the weight of the box. (5 marks)

Answers

Use a rope or twine to fasten a spring scale to the box. Make sure the rope or string is parallel to the surface and the scale is perpendicular to the surface.

How much force is required to move a box across the floor?

A push force from the outside is applied to a box when it slides, and a frictional force is also applied to the box. The contact sliding motion between the object and the ground causes the frictional force.

What force is exerted when one object slides past another?

Kinetic friction is a kind of sliding friction that occurs often. Kinetic friction is a force that opposes the motion of an object sliding along a surface whenever two objects' surfaces are in contact with one another.

to know more about investigating here:

brainly.com/question/1191670

#SPJ1

write an equation for the acceleration of the two connected blocks in terms of m1, m2, and the acceleration due to gravity g.

Answers

The equation for the acceleration of the two connected blocks in terms of m1, m2, and the acceleration due to gravity is a = (m1 + m2)g/m2.

The equation shows that the acceleration of the two connected blocks is directly proportional to the total mass of the two blocks and the acceleration due to gravity. In other words, the more mass in the two blocks, the higher the acceleration.

Similarly, as the acceleration due to gravity increases, the acceleration of the two connected blocks increases. To understand this further, consider the example of two blocks, one with mass m1 and the other with mass m2, being accelerated by the same force due to gravity.

The equation shows that the acceleration of the two blocks is a = (m1 + m2)g/m2, where m1 and m2 are the masses of the two blocks and g is the acceleration due to gravity. This means that if the mass of the first block is doubled, the acceleration will double. Similarly, if the acceleration due to gravity is doubled, the acceleration of the two blocks will also double.

To know more about acceleration refer here:

https://brainly.com/question/30660316#

#SPJ11

Currently, electricity is the form of energy we use most in our daily lives. This means we are always using energy resources that can be transformed to electrical energy. You are an electrical engineer exploring different resources for producing electricity while also making sure to pick resources that are least harmful to the environment. Create a PowerPoint to include the below information:
1. What are the disadvantages of using fossil fuels for producing electricity?
2. Why do we depend so heavily on fossil fuels to produce electricity even when they cause air pollution?
3. Which energy resources seem to be the least harmful for the environment (this includes harmful to air, water, or living things)? Explain how you reached this conclusion.
4. Renewable energy resources affect the environment as well. Pick one renewable energy resource and describe how and why it affects the environment.

Answers

Answer:

1. The disadvantages of using fossil fuels for producing electricity include their contribution to air pollution and climate change, their finite supply, and the environmental damage caused by their extraction and transportation.

2. We depend heavily on fossil fuels to produce electricity because they are relatively cheap and abundant, and because our infrastructure is largely built around their use. Additionally, many people may not be aware of the negative environmental impacts of fossil fuel use or may not have access to alternative energy sources.

3. Renewable energy resources, such as solar, wind, and hydropower, are generally considered to be the least harmful to the environment because they produce little to no greenhouse gas emissions or other pollutants. Additionally, they do not require mining or drilling for fuel, and they do not produce toxic waste. However, the environmental impact of renewable energy sources can vary depending on factors such as the location of the power generation facilities and the materials used in the production of renewable energy technologies.

4. One renewable energy resource that affects the environment is hydropower. While hydropower is a clean and renewable energy source, it can have significant environmental impacts, particularly on aquatic ecosystems. The construction of dams and other hydropower facilities can alter river flows and disrupt fish migration patterns, and the flooding of large areas for reservoirs can displace communities and cause other ecological disruptions. Additionally, the decommissioning of hydropower facilities can also have environmental impacts, such as the release of sediment and other materials that have accumulated behind the dams. To mitigate these impacts, it is important to carefully consider the location and design of hydropower facilities and to prioritize ecological considerations in the planning and implementation of hydropower projects.

Hope this helps you! If not, I'm sorry! If you need more help, ask me! :]

Solve it pleaseeeeeeee

Answers

Answer:

c

Explanation:

step by step hope this helps you got this!!

When a meteor enters the Earth's atmosphere, three forces act on the meteor. Gravity and upthrust are two of these forces. Give the name of the other force. [1 mark]

Answers

Answer:

The other force acting on a meteor as it enters the Earth's atmosphere is air resistance or drag force.

Explanation:

Air resistance or drag force is the force that opposes the motion of an object as it moves through a fluid (such as air or water). When a meteor enters the Earth's atmosphere, it encounters a large amount of air resistance due to the high speed at which it is moving relative to the atmosphere.

As the meteor moves through the atmosphere, air molecules collide with the meteor, creating a resistance force that acts in the opposite direction to the meteor's motion. This force increases as the meteor's speed increases, and can cause the meteor to slow down and heat up due to friction with the surrounding air molecules.

The force of air resistance is particularly important for meteors because they are typically travelling at very high speeds relative to the atmosphere, and can experience significant heating and deceleration as they enter the denser lower atmosphere. Without air resistance, meteors would continue to travel at their original speeds and would not experience the bright trails or fireballs that are commonly associated with meteors.

What is the y component of puck 2 velocity after the collision

Answers

In this collision, momentum is conserved as there is no external force acting on the system. We can use the conservation of momentum to find the final velocity of puck 2.

The initial momentum of the system is :

pinitial = m1v1 + m2v2

where m1 and m2 are the masses of puck 1 and puck 2 respectively, and v1 and v2 are their initial velocities. Since puck 2 is initially at rest, we have:

pinitial = m1×v1

Substituting the given values, we get:

pinitial = (0.35 kg)×(2.5 m/s) = 0.875 kg m/s

After the collision, puck 1 is deflected at an angle of 30 degrees with a speed of 1.7 m/s. We can use trigonometry to find the x and y components of its final velocity:

v1x = v1cos(30) = 1.7cos(30) = 1.47 m/s v1y = v1sin(30) = 1.7sin(30) = 0.85 m/s

The final momentum of the system is:

pfinal = m1v1 + m2v2'

where v2' is the final velocity of puck 2. Since momentum is conserved, we have:

pinitial = pfinal

Substituting the given values, we get:

0.875 kg m/s = (0.35 kg)×(1.47 m/s) + (0.51 kg)×v2'

Solving for v2', we get:

v_2' = (0.875 kg m/s - 0.51 kg*(1.47 m/s)) / 0.51 kg = -0.94 m/s

Therefore, the final velocity of puck 2 is -0.94 m/s in the negative x direction (i.e., towards the left).

The complete and correct question is

Consider a collision between two pucks on a frictionless air hockey table. Puck 1 has a mass of 350 g and an initial velocity of 2.5 m/s in the +x direction. Puck 2 has a mass of 510 g and is initially at rest.

After the collision puck 1 has been deflected by 30 degrees and has a speed of 1.7 m/s. What is the speed and direction of puck 2 after the collision?

To know more about Collision and Velocity , visit :

https://brainly.com/question/17127206

#SPJ9

06 two silt spaced 0. 450mm apart are placed 75. 0 cm from a screen. What is the distance between the second and third dark line of the interference pattern on the screen when the silt are illuminated with coherent light with a wave length of 500nm

Answers

The distance between the slits, d = 0.450 mm = 0.00045 m, The distance from the screen, L = 75.0 cm = 0.75 m,The wavelength of the coherent light, λ = 500 nm = 5.00 x 10^-7 m

The distance between the central maximum and the first dark line can be found using the formula: sin θ = mλ/d, where θ is the angle between the line connecting the slits and the screen, m is the order of the dark line (m = 1 for the first dark line), and λ is the wavelength of the light. Rearranging this formula gives: sin θ = mλ/d, θ = sin^-1(mλ/d). For the second dark line, m = 2, and for the third dark line, m = 3. So we can find the angles θ2 and θ3: θ2 = sin^-1(2λ/d) = sin^-1(2 x 5.00 x 10^-7 m / 0.00045 m) ≈ 0.140 radians, θ3 = sin^-1(3λ/d) = sin^-1(3 x 5.00 x 10^-7 m / 0.00045 m) ≈ 0.234 radians. Now we can use trigonometry to find the distances between the second and third dark lines on the screen. The distance between the central maximum and the second dark line is given by: y2 = L tan θ2 ≈ 0.099 m. Similarly, the distance between the central maximum and the third dark line is given by: y3 = L tan θ3 ≈ 0.165 m. Therefore, the distance between the second and third dark lines is: y3 - y2 ≈ 0.066 m. So the distance between the second and third dark lines of the interference pattern on the screen is approximately 0.066 m.

To learn more about wavelength click the link below

brainly.com/question/4112024

#SPJ4

A gas occupies 1.56m at an atm. What would be the volume of this gas if the pressure becomes 3 atm.​

Answers

Answer:

The volume of this gas when pressure becomes 3.00 ATM is 0.52 liters 

Explanation:

Answer:

in image

Explanation:

if it helped you please mark me a brainliest♡♡

Can someone help me please.

Answers

The amount of loss in the mechanical energy of tha ball during the bounce is 7.35J (Option B)

How do i determine the amount of energy lost?We'll begin by obtaining the energy at the height of 5 m. Details below:Mass of object (m) = 0.5 KgInitial height (h₁) = 5 mAcceleration due to gravity (g) = 9.8 m/s²  Energy at 5m (E₁) = ?

E₁ = mgh₁

E₁ = 0.5 × 9.8 × 5

E₁ = 24.5 J

Next, we shall determine the energy during the bounce. Details below:

Mass of object (m) = 0.5 KgBounce height (h₂) = 3.5 mAcceleration due to gravity (g) = 9.8 m/s²  Energy during bounce (E₂) = ?

E₂ = mgh₂

E₂ = 0.5 × 9.8 × 3.5

E₂ = 17.15 J

Finally, we shall determine the loss in the amount energy during the bounce. This is shown below:

Energy at 5m (E₁) = 24.5 JEnergy during bounce (E₂) = 17.15 JLost energy (E) =?

E = E₁ - E₂

E = 24.5 - 17.15

E = 7.35J

Thus, the lost energy is 7.35J (Option B)

Learn more about energy:

https://brainly.com/question/22274239

#SPJ1

a 500 g glider hits and sticks to the 250 g glider, compressing the spring to a minimum length of 22 cm. what was the speed of the 500 g glider just before impact?

Answers

The speed of the 500 g glider just before impact was 0 m/s.

To answer this question, we need to use the equation of conservation of momentum:
Pi = Pf, where P is the momentum and i and f stand for initial and final, respectively.
We can express the momentum of each glider as m*v, where m is the mass of the glider and v is its velocity.
Therefore, m1*v1i + m2*v2i = m1*v1f + m2*v2f
Given the masses of the gliders, we can solve for v1i:
v1i = (m1*v1f + m2*v2f) / m1
Since the spring compressed to a length of 22 cm, the final velocity of both gliders will be 0 m/s, giving us the following equation:
v1i = (500 g * 0 m/s + 250 g * 0 m/s) / 500 g
v1i = 0 m/s

Therefore, the speed of the 500 g glider just before impact was 0 m/s.

Know more about speed

https://brainly.com/question/13943409

#SPJ11

a force pair is created when you push on a large crate that rests on the floor. the crate does not move when pushed. which free-body diagram correctly represents the forces acting on the crate?

Answers

The free-body diagram for the crate  shows all the forces acting on the crate like the force applied by the person pushing the crate, the force of friction between the crate and the floor, and the force of gravity acting on the crate.

The free-body diagram for the crate should show all the forces acting on the crate, including the force applied by the person pushing the crate, the force of friction between the crate and the floor, and the force of gravity acting on the crate.

Since the crate is not moving, the force applied by the person pushing the crate must be equal in magnitude and opposite in direction to the force of friction acting on the crate.

This means that the net force on the crate is zero, and the free-body diagram should reflect this.

Here is a description of the forces acting on the crate and a corresponding free-body diagram:

   Force applied by person pushing crate (to the right)    Force of friction between crate and floor (to the left)    Force of gravity acting on crate (downwards)

To learn more about the 'force':

https://brainly.com/question/12785175

#SPJ11

a fairground ride spins its occupants inside a flying saucer-shaped container. if the horizontal circular path the riders follow has a radius of 1 1 . 2 m 11.2 m, at what angular velocity will the riders be subjected to a centripetal acceleration whose magnitude is equal to 1.50 times the acceleration due to gravity? report you answer in units of revolutions/minute.

Answers

The angular velocity of the fairground ride is 29.19 revolutions/minute..

Angular velocity at which the riders are subjected to a centripetal acceleration of magnitude 1.5g when the radius is 11.2 m can be calculated as follows: Angular velocity formula:ω = v/rwhereω = angular velocity in radians/minute v = linear velocity r = radius of the circular path. The formula for centripetal acceleration is given as follows: a_c = v^2/rr = 11.2 mLet a = 1.5g = 1.5 x 9.81 m/s^2 = 14.715 m/s^2v^2/r = a_c => v^2 = a_c x rv^2 = 14.715 x 11.2v = √(14.715 x 11.2) = 10.81 m/sω = v/r = 10.81/11.2 = 0.966 rad/sThe angular velocity of the fairground ride is 0.966 rad/s. Now, converting radians/second to revolutions/minute as follows:1 revolution = 2π radiansω = 0.966 x 60/2π = 29.19 revolutions/minute. Hence, the angular velocity of the fairground ride is 29.19 revolutions/minute.

Know more about angular velocity

https://brainly.com/question/20432894

#SPJ11

if everything in the solar system is moving around, why do the perseid meteors repeat regularly around august 11th or so?

Answers

The Perseid meteors repeat regularly around August 11th or so, despite everything in the solar system moving around, because the debris that creates them follows a consistent orbit.

The orbit of the debris producing the meteor shower is consistent, and it orbits the Sun in the same manner every year. When the Earth crosses through the debris stream, the debris enters the Earth's atmosphere and burns up, producing the Perseid meteor shower.This means that even if the Earth's movement is unpredictable, as it revolves around the Sun, the Perseid meteor shower will occur around the same time every year.

Hence, it's not because of the Earth's movement or other bodies in the solar system that the Perseid meteors repeat regularly around August 11th or so, but because of the consistent orbit of the debris that creates them.

Learn more about solar system and meteor at: https://brainly.com/question/28322140

#SPJ11

What is the cat's speed v2 when she reaches the top of the incline? express your answer in meters per second to three significant figures

Answers

The 2m/s is the cat's speed v² when she reaches the tοp οf the incline.

What is velοcity ?  

The definitiοn οf velοcity is the rate at which a bοdy mοves in a particular directiοn. Velοcity is the rate at which a distance changes in relatiοn tο time. A vectοr quantity with bοth magnitude and directiοn is velοcity.

What is speed ?  

The rate οf a directiοnally changing οbject's lοcatiοn. The SI unit οf speed is created by cοmbining the fundamental units οf length and time. Meters per secοnd (m/s) is the unit οf speed in the metric system.

Therefοre, 2m/s is the cat's speed v2 when she reaches the tοp οf the incline.

Learn more about velocity from the given link.

https://brainly.com/question/80295

#SPJ1

At a rock concert, the sound intensity 1. 0 m in front of the bank of loudspeakers is 0. 10 W/m2. A fan is 30 m from the loud speakers. Her eardrums have a diameter of 8. 4 mm. How much sound energy is transferred to each eardrum in 1. 0 second

Answers

At a rock concert, the sound intensity 1. 0 m in front of the bank of loudspeakers is 0. 10 W/m2. A fan is 30 m from the loud speakers. Her eardrums have a diameter of 8. 4 mm.The sound energy transferred to each eardrum in 1.0 second is 4.36 x 10^-11 J.

The sound intensity at a distance of 30 m from the loudspeakers can be calculated using the inverse square law:

I = I₀ / (4πr²)

where I₀ is the sound intensity at a distance of 1.0 m from the loudspeakers, r is the distance from the loudspeakers, and π is the mathematical constant pi (approximately 3.14).

Substituting the given values, we get:

I = 0.10 W/m² / (4π(30 m)²) = 7.87 x 10^-7 W/m²

The sound energy transferred to each eardrum in 1.0 second can be calculated using the formula:

E = A × t × I

where A is the area of the eardrum, t is the time, and I is the sound intensity.

The area of the eardrum can be calculated using the formula for the area of a circle:

A = πr²

where r is the radius of the eardrum, which is half the diameter.

Substituting the given values, we get:

A = π(8.4 mm / 2)^2 = 5.54 x 10^-5 m²

Substituting the given values and solving for E, we get:

E = 5.54 x 10^-5 m² × 1.0 s × 7.87 x 10^-7 W/m² = 4.36 x 10^-11 J

Therefore, the sound energy transferred to each eardrum in 1.0 second is 4.36 x 10^-11 J.

For such more questions on sound energy:

brainly.com/question/18375567

#SPJ11

An object is placed in an electric field. The object is not affected by the electric field.

What can be said about the object?


1.The object has mass

2.The object does not carry a charge

3.The object carries a charge

4.The object carries a positive charge

Answers

Answer:

Explanation:

The object does not carry a charge

The car maintained distance x

Answers

Answer:

7th grade in a year and I am not going for the same as a student from a school year or so cute cat that I don't have a lot to get for it is the greatest thing I can think they are you at the end a bit too far from your home or the other one that is the only thing that is a bit more expensive and

Other Questions
Which mixture exhibits the Tyndall effect?-fog-salt water-gasoline-sterling silver The left-right reversal of an object is called (a) lateral inversion (b) lateral reflection (c) parallel inversion(d) parallel reflection Calculate the acceleration of a racecar driver who can accelerate from 0 m/s to 90 m/s in 3 seconds. why does the decimal point always have to move when you rewrite a percent as a decimal and when you rewrite a decimal as a percent? Read case - Amazon goes global. What were Amazons overall internationalization motives? forster company produced 14,000 units at an average cost of $5.90 each. the beginning inventory of finished goods was $3,422. (the average unit cost was $5.90.) forster sold 14,120 units. how many units remain in ending finished goods inventory? Which correctly reWhich correctly represents the statement, the product of 4 and a number, n, subtracted from 10? Responsespresents the statement, the product of 4 and a number, n, subtracted from 10? Responses A 50.0-g meter stick is balanced at its midpoint ( 50.0 cm ). Then, mass 1=0.200 kg and mass 2=0.300 kg are hung with light string from points at 1=20.0 cm and 2=70.0 cm, respectively, as shown in the figure. Define the counterclockwise direction to be positive.Calculate the torque 0,1 acting on the meter stick due to 1, the torque 0,2 due to 2, the torque 0,stick due to the weight of the meter stick, and the torque 0,pivot due to the pivot, all about an axis pointing out of the screen at the 0.00-cm point. the League of Nations 7. Prompt: Examine the impact the League of Nations intended to have versus what happened. 3. Evidence from the text Topic Sentence: Supporting detail 1: Supporting detail 2: Supporting detail 3: True or false: mixing aqueous solutions of na2s and mgcl2 will result in formation of a solid precipitate The "hang time" of a punt is measured to be 4.30 s .If the ball was kicked at an angle of 68.0 above the horizontal and was caught at the same level from which it was kicked, what was its initial speed?t^2=10.97 sin(68)-3.05cos(68)/4.905cos(68) t=2.216410.97/cos68 x 2.21= voI got v0=13.2513.25/1000=.0133 x 3600=47.88 kh/m(which is wrong) Solve for x and z: a+bz/a+b=c+dz/d+c if bc=ad HELP ME!!!!! THIS IS DUE TODAY( answer only question 18) A company that explores for oil in the ocean is considering two new sites, A and B. The exploration will take the entire year. The company estimates the probability of finding oil is 0. 25 at site A and 0. 36 at site B. The sites are far enough apart so that whether or not oil is found at one site, is independent of its being found at the other. Rounding your answer to two decimal places, find the probability that the company will find oil at both sites Correct only one of the sites neither of the sites Correct least one of the sites HELPPP. Create a table to represent the following situation: Gina is 5 years older than Sam. Ginas age in years is x + 5, where x is Sams age, in years 5. Briefly describe the role of businesses and governments in a mixed economy.Then, give at least one strength and one weakness of a mixed economic system. (4points) Pablo and Jacob are running a half marathon. Jacob is d=54. 9m behind Pablo, and both are running at the same speed, v0=3. 98m/s. At a particular moment, Jacob begins to accelerate forward at a constant rate of a=0. 054m/s2 A sample of 18 widgets has a mean of 34.800 and standarddeviation of 9.050. At 99% confidence, the upper limit with 3decimal places is The following are the part of the executive branch exept Gertrude is making a punch for the holiday party. For every one cup of orange juice, she uses 3 cups of fruit punch. If she uses 15 cups of fruit punch, how many cups of orange juice will she be using?