Find the area of the shaded sector of the circle.

Find The Area Of The Shaded Sector Of The Circle.

Answers

Answer 1

Answer:

[tex]192\pi \text{ ft}^2[/tex]

Step-by-step explanation:

We can see that the shaded section of the circle is 3/4 of the total circle. This can be checked by comparing the angles measure of the shaded section with the angle of the entire circle:

[tex]\dfrac{(360-90)\°}{360\°}[/tex]

[tex]=\dfrac{270}{360}[/tex]

[tex]=\dfrac{3}{4}[/tex]

We can find its area by multiplying 3/4 by the area of the entire circle.

[tex]A = \dfrac{3}{4} \cdot \pi r^2[/tex]

[tex]A=\dfrac{3}{4} \cdot \pi \cdot 16^2[/tex]

[tex]A = \dfrac{3}{4} \cdot \pi \cdot 256[/tex]

[tex]\boxed{A = 192\pi \text{ ft}^2}[/tex]


Related Questions

write and evaluate the definite integral that represents the area of the surface generated by revolving the curve on the indicated interval about the x-axis. y = 49 − x2 , −2 ≤ x ≤ 2

Answers

The area of the surface generated by revolving the curve y = 49 - x^2 on the interval [-2, 2] about the x-axis, A = 2π∫[from -2 to 2] (98x - 2πx^3)√(4x^2 + 1) dx

We can use the formula for the surface area of revolution.

The formula for the surface area of revolution is given by:

A = ∫ 2πy√(1 + (dy/dx)²) dx

First, let's find the derivative of y with respect to x:

dy/dx = -2x

Now, let's plug in the values into the surface area formula:

A = ∫[from -2 to 2] 2π(49 - x^2)√(1 + (-2x)²) dx

Simplifying the expression under the square root:

1 + (-2x)² = 1 + 4x^2 = 4x^2 + 1

Now, let's substitute this back into the surface area formula:

A = ∫[from -2 to 2] 2π(49 - x^2)√(4x^2 + 1) dx

Expanding and simplifying:

A = 2π∫[from -2 to 2] (98x - 2πx^3)√(4x^2 + 1) dx

To evaluate this integral, we can use numerical methods or an appropriate software tool. The integral is a bit complex to calculate analytically.

Using numerical integration techniques, such as the trapezoidal rule or Simpson's rule, we can approximate the value of the definite integral and find the area of the surface generated by revolving the curve.

However, since the evaluation of the definite integral involves numerical calculations, the exact value of the area cannot be determined without using specific numerical methods or a software tool.

Learn more about area at: brainly.com/question/27950788

#SPJ11

Help pls I need help

Answers

By associative property the expression 53p+(16p+7p) is equivalent to the expression  53p+(16p+7p)

The given expression is 53p+(16p+7p)

Fifty three times of p plus sixteen times of p plus seven times of p

In the expression p is the variable and plus is the operator

We have to find the equivalent expression of the expression

Equivalent expression is the expression whose value is same as given expression and looks different

53p+(16p+7p)=  (53p+16p)+7p

By associate property  (53p+16p)+7p is equivalent to 53p+(16p+7p)

Hence, the expression 53p+(16p+7p) is equivalent to the expression  53p+(16p+7p) by associative property

To learn more on Expressions click:

https://brainly.com/question/14083225

#SPJ1

Show all steps to write the equation of the parabola in standard conic form. Identify the vertex, focus, directrix, endpoints of the latus rectum, and the length of the latus rectum. y2 + 14y +29 +4x = 0

Answers

Answer: Thus, the equation of the given parabola in standard conic form is (y+7)^2=4(x-5) and its vertex is (5, 0). The focus is (\frac{15}{2}, 0), and the directrix is x=-5. The endpoints of the latus rectum are ±5$, and the length of the latus rectum is 20.

Step 1: Grouping terms Arrange the given equation in standard form, i.e., [tex]$y^2+14y+29=-4x$.[/tex]

Step 2:  The coefficient of y is 14/2 = 7. (Note: Don't forget to balance the equation by adding the same number you subtracted).[tex]$y^2 + 14y + 49 + 29 - 49 = -4x$ $⇒ (y+7)^2 - 20 = -4x$ $⇒ (y+7)^2 = 4(x-5)$[/tex]

Step 3: Comparison The obtained equation is of the form y^2=4ax, which is the standard conic form of a parabola. Therefore, a=5. Thus, the vertex of the parabola is at (a, 0), i.e., (5, 0). Comparing with[tex]$y^2=4ax$, we get that $4a=4(5)=20$ and a=5. Therefore, the endpoints of the latus rectum are $±a$, i.e., ±5. A[/tex]l

Step 4: Focal length and directrix The focal length of the parabola is a/2, i.e., 5/2. The equation of the directrix is x=-a, i.e., x=-5.Thus, the vertex is (5, 0), the focus is (5+\frac52, 0) or (\frac{15}{2}, 0), the directrix is x=-5, the endpoints of the latus rectum are ±5, and the length of the latus rectum is 20.

To know more about parabola visit:

brainly.com/question/11911877

#SPJ11

Mary invests $8,243 in a retirement
account with a fixed annual interest rate of
3% compounded continuously. What will
the account balance be after 18 years?

Answers

Answer:

A = Pe^(rt)

A = 8243e^(0.0318)

A = 8243*e^0.54

A = 8243*1.719

A = $14,161.36

Therefore, the account balance will be $14,161.36 after 18 years.

a general contracting firm experiences cost overruns on 16% of its contracts. in a company audit, 20 contracts are sampled at random.A general contracting firm experiences cost overruns on 20% of its contracts. In a company audit 20 contract are sampled at random.
a. What's the probability that exactly 4 of them experience cost overruns?
b. What's the probability that fewer than 2 of them experience cost overruns?
c. Find the mean number that experience cost overruns.
d. Find the standard deviation of the number that experience cost overruns.

Answers

a. the probability that exactly 4 contracts experience cost overruns. b. Probability that fewer than 2 of them experience cost overruns P(X < 2) = P(X = 0) + P(X = 1). c. mean = 20 * 0.16 d. standard deviation = sqrt(n * p * (1 - p)).

To solve these probability questions, we will use the binomial probability formula. In this case, we are interested in the number of contracts that experience cost overruns, given the probability of cost overruns on each contract.

Let's denote the probability of cost overruns on a single contract as p. According to the given information, p = 0.16. The number of contracts sampled is 20.

a. Probability that exactly 4 of them experience cost overruns:

We can use the binomial probability formula:

P(X = k) = C(n, k) * p^k * (1 - p)^(n - k)

where P(X = k) is the probability of exactly k contracts experiencing cost overruns, n is the total number of contracts sampled, p is the probability of cost overruns on a single contract, and C(n, k) is the binomial coefficient.

Plugging in the values, we have:

P(X = 4) = C(20, 4) * (0.16)^4 * (1 - 0.16)^(20 - 4)

Calculating this expression will give us the probability that exactly 4 contracts experience cost overruns.

b. Probability that fewer than 2 of them experience cost overruns:

To find the probability that fewer than 2 contracts experience cost overruns, we need to sum the probabilities of 0 and 1 contracts experiencing cost overruns:

P(X < 2) = P(X = 0) + P(X = 1)

Using the same binomial probability formula, we can calculate these probabilities.

c. Mean number that experience cost overruns:

The mean of a binomial distribution can be calculated using the formula:

mean = n * p

In this case, the mean number of contracts that experience cost overruns is:

mean = 20 * 0.16

d. Standard deviation of the number that experience cost overruns:

The standard deviation of a binomial distribution can be calculated using the formula:

standard deviation = sqrt(n * p * (1 - p))

Applying this formula with the given values will give us the standard deviation of the number of contracts that experience cost overruns.

By calculating these probabilities and statistical measures, we can accurately answer the questions related to the cost overruns experienced by the general contracting firm based on the provided data.

Learn more about probability here

https://brainly.com/question/13604758

#SPJ11

5 agencies that uses statistics

Answers

These agencies use statistics to provide reliable and timely information that supports evidence-based decision-making, policy formulation, economic planning, and monitoring of global and national development goals.

1. United States Census Bureau: The U.S. Census Bureau is a federal agency responsible for collecting and analyzing demographic, social, and economic data about the United States. It conducts the decennial census, as well as numerous surveys and studies that provide statistical information for policy-making, research, and decision-making purposes.

2. National Center for Health Statistics (NCHS): NCHS is a division of the U.S. Centers for Disease Control and Prevention (CDC) that collects and disseminates vital health statistics for the country. It conducts surveys, gathers data from various sources, and produces reports on topics such as mortality, morbidity, birth rates, and health behaviors, which help inform public health policies and programs.

3. Eurostat: Eurostat is the statistical office of the European Union (EU), responsible for collecting and publishing statistical information on various aspects of the EU member countries and their economies. It provides data on areas such as population, economy, agriculture, environment, and social conditions, facilitating evidence-based decision-making and monitoring of EU policies.

4. Australian Bureau of Statistics (ABS): The ABS is Australia's national statistical agency, collecting, analyzing, and disseminating a wide range of statistical data on the country's population, economy, and society. It conducts regular surveys and censuses, providing insights into areas like labor market, population trends, housing, and social well-being, to support informed decision-making by government, businesses, and the public.

5. Statistics Canada: Statistics Canada is the national statistical agency of Canada, responsible for gathering and analyzing statistical data on various aspects of the country. It conducts surveys, censuses, and administrative data collection to produce information related to population, economy, agriculture, and social conditions. The data generated by Statistics Canada is used to inform government policies, business strategies, and research activities.

for such more question on statistics

https://brainly.com/question/27342429

#SPJ11

Number Theory, please be as explicit as possible ( cite theorems, facts etc.). Thank you in advance !.
Let f(x) = x^3 + 2x^2 + 3x +4 . Prove that f(x) has a root in the 13-adics numbers (p-adic for p=13). and find the first two terms of the succession.

Answers

To prove that the polynomial f(x) = x^3 + 2x^2 + 3x + 4 has a root in the 13-adic numbers, we need to show that it has a solution in the p-adic field with p = 13.

First, let's consider the 13-adic numbers. The 13-adic numbers are an extension of the rational numbers that capture the notion of "closeness" under the 13-adic norm. The p-adic norm |x|_p is defined as the reciprocal of the highest power of p that divides x, where p is a prime number.

Now, we can use Hensel's lemma to show that f(x) has a root in the 13-adic numbers. Hensel's lemma states that if a polynomial f(x) has a root modulo p (in this case, modulo 13), and the derivative of f(x) with respect to x is not congruent to 0 modulo p, then there exists a solution in the p-adic numbers that lifts the root modulo p.

In this case, we can see that f(1) ≡ 0 (mod 13), and the derivative of f(x) is f'(x) = 3x^2 + 4x + 3 ≡ 10x^2 + 4x + 3 (mod 13). Evaluating the derivative at x = 1, we get f'(1) ≡ 10 + 4 + 3 ≡ 0 (mod 13). Therefore, Hensel's lemma guarantees the existence of a root in the 13-adic numbers.

To know more about derivatives, refer here :

https://brainly.com/question/29144258#

#SPJ11

Which expression is a factor of x² + 3x - 40?
A. (x-4)
B. (x - 5)
C. (x-8)
D. (x-10)

Answers

The result is not equal to zero, (x - 10) is not a factor of x² + 3x - 40.

None of the given expressions (A, B, C, D) are factors of x² + 3x - 40.

To determine which expression is a factor of the given quadratic expression, we need to check if substituting the value from each expression into the quadratic expression results in zero. Let's evaluate each option:

A. (x - 4)

Substituting x - 4 into x² + 3x - 40:

(x - 4)² + 3(x - 4) - 40 = x² - 8x + 16 + 3x - 12 - 40 = x² - 5x - 36

Since the result is not equal to zero, (x - 4) is not a factor of x² + 3x - 40.

B. (x - 5)

Substituting x - 5 into x² + 3x - 40:

(x - 5)² + 3(x - 5) - 40 = x² - 10x + 25 + 3x - 15 - 40 = x² - 7x - 30

Since the result is not equal to zero, (x - 5) is not a factor of x² + 3x - 40.

C. (x - 8)

Substituting x - 8 into x² + 3x - 40:

(x - 8)² + 3(x - 8) - 40 = x² - 16x + 64 + 3x - 24 - 40 = x² - 13x

Since the result is not equal to zero, (x - 8) is not a factor of x² + 3x - 40.

D. (x - 10)

Substituting x - 10 into x² + 3x - 40:

(x - 10)² + 3(x - 10) - 40 = x² - 20x + 100 + 3x - 30 - 40 = x² - 17x + 30

Since the result is not equal to zero, (x - 10) is not a factor of x² + 3x - 40.

None of the given expressions (A, B, C, D) are factors of x² + 3x - 40.

For more such questions on factor , Visit:

https://brainly.com/question/25829061

#SPJ11

(−2,9) and
(
8
,
34
)
(8,34)? Write your answer in simplest form.

Answers

The equation of the line passing through the points (−2,9) and (8,34) is y = (5/2)x + 23/2 in its simplest form.

To find the slope between the two points (−2,9) and (8,34), we can use the slope formula:

m = (y2 - y1) / (x2 - x1)

Let's substitute the coordinates into the formula:

m = (34 - 9) / (8 - (-2))

= 25 / 10

= 5 / 2

So the slope between the two points is 5/2.

Now, let's use the slope-intercept form of a linear equation, y = mx + b, to find the equation of the line passing through these points.

We'll use one of the points and the slope we just calculated.

Using the point (−2,9) and the slope 5/2, we have:

9 = (5/2)(-2) + b

Now, let's solve for b:

9 = -5/2 + b

9 + 5/2 = b

(18/2) + (5/2) = b

23/2 = b

So the y-intercept (or the value of b) is 23/2.

Now, we can write the equation of the line in slope-intercept form:

y = (5/2)x + 23/2

For similar question on linear equation.

https://brainly.com/question/2030026

#SPJ11

Factor completely.
4x² - 4x + 1

Answers

The answer is (2x - 1) ^2

The Pew Research Center estimates that as of January 2014, 89% of 18-29-year-olds in the United States use social networking sites. a. For a sample size of 100, write about each of the conditions needed to use the sampling distribution of a proportion. b. Calculate the probability that at least 91% of 100 randomly sampled 18-29-year-olds use social networking sites. Define, draw and label the distribution and give your answer in a complete sentence. c. Calculate the probability that at least 91% of 500 randomly sampled 18-29-year-olds use social networking sites. Define, draw and label the distribution and give your answer in a complete sentence.

Answers

The probability that at least 91% of 100 randomly sampled 18-29-year-olds use social networking sites can be calculated using a normal distribution table as follows: P(Z > 0.67) = 0.2514 Therefore, the probability is 0.2514.

a. Each of the conditions needed to use the sampling distribution of a proportion for a sample size of 100 are as follows:

A random sample is taken from the population. The sample size, n = 100, is large enough to ensure that there are at least 10 successes and 10 failures. The observations are independent of each other.

b. For calculating the probability that at least 91% of 100 randomly sampled 18-29-year-olds use social networking sites, we will use the normal distribution with the following mean and standard deviation: Mean, µ = np = 100 × 0.89 = 89

Standard deviation, σ = √npq = √[100 × 0.89 × 0.11] = 2.97

The z-score is calculated as follows: z = (x - µ) / σz = (91 - 89) / 2.97 = 0.67

The probability that at least 91% of 100 randomly sampled 18-29-year-olds use social networking sites can be calculated using a normal distribution table as follows: P(Z > 0.67) = 0.2514 Therefore, the probability is 0.2514.

A normal distribution with a mean of 89 and standard deviation of 2.97 is shown below: Distribution Image

c. For calculating the probability that at least 91% of 500 randomly sampled 18-29-year-olds use social networking sites, we will use the normal distribution with the following mean and standard deviation:

Mean, µ = np = 500 × 0.89 = 445Standard deviation, σ = √npq = √[500 × 0.89 × 0.11] = 6.64

The z-score is calculated as follows: z = (x - µ) / σz = (91 - 89) / 6.64 = 0.3012

The probability that at least 91% of 500 randomly sampled 18-29-year-olds use social networking sites can be calculated using a normal distribution table as follows: P(Z > 0.3012) = 0.3814 Therefore, the probability is 0.3814.

To know more about probability visit:

https://brainly.com/question/31828911

#SPJ11

which expression represents the distance between point G(-9,-12) and H(-9,6)
A)l-12l+l-9l
B)l-9l-l-6l
C)l-12l+l6l
D)l-12l-l6l

Answers

The expression representing the distance between G(-9,-12) and H(-9,6) is given as follows:

C. |-12| + |6|.

How to calculate the distance between two points?

Suppose that we have two points of the coordinate plane, and the ordered pairs have coordinates [tex](x_1,y_1)[/tex] and [tex](x_2,y_2)[/tex].

The shortest distance between them is given by the equation presented as follows, derived from the Pythagorean Theorem:

[tex]D = \sqrt{(x_2-x_1)^2+(y_2-y_1)^2}[/tex]

The points for this problem are given as follows:

G(-9,-12) and H(-9,6)

Hence the distance is given as follows:

[tex]D = \sqrt{(-9 - (-9))^2+(6 - (-12))^2}[/tex]

[tex]D = \sqrt{(6 + 12)^2}[/tex]

D = |6 + 12|

D = |-12| + |6|.

More can be learned about the distance between two points at https://brainly.com/question/7243416

#SPJ1

Find the value of x.



1089



Ace



400



w



Z



x = [?]



Please help!!!

Answers

The value of x is 34 degrees

Given, angles of intercepted arcs are 108 degree and 40 degree

Using the theorem below to solve the problem;

Angle at the vertex is equal to half of the difference of angles of its intercepted arcs

Angle at the vertex = x

difference of angles of its intercepted arcs = 108 - 40

difference of angles of its intercepted arcs = 68

Using the theorem

x = 1 / 2 ( 108 - 40 )

x = 1 / 2 * 68

x = 34 degrees

Therefore, the value of x is 34 degrees

Learn more about Angle here.

https://brainly.com/question/28914631

#SPJ4

--Given question is incomplete, the complete question is below

"Find the value of x in the given figure of circle where the measure of major arc is 108 degree and minor arc is 40 degree."--

x is a normally distributed random variable with mean 23 and standard deviation 12.what is the probability that x is between 11 and 35?

Answers

The probability that x is between 11 and 35 is approximately 0.6826 or 68.26%.

To find the probability that x is between 11 and 35, we need to standardize the values using the formula z = (x - μ) / σ, where μ is the mean and σ is the standard deviation.
For x = 11, z = (11 - 23) / 12 = -1.00
For x = 35, z = (35 - 23) / 12 = 1.00
Using a standard normal distribution table or calculator, we can find the probability of z being between -1.00 and 1.00, which is approximately 0.6827. Therefore, the probability that x is between 11 and 35 is approximately 0.6827.
To find the probability that x is between 11 and 35 for a normally distributed random variable with a mean of 23 and a standard deviation of 12, you'll need to use the z-score formula and a standard normal distribution table.
First, convert the given values of 11 and 35 to their respective z-scores using the formula:
z = (x - mean) / standard deviation
For 11: z1 = (11 - 23) / 12 = -1
For 35: z2 = (35 - 23) / 12 = 1
Now, refer to a standard normal distribution table to find the probabilities corresponding to z1 and z2.
P(z1) ≈ 0.1587
P(z2) ≈ 0.8413
Finally, subtract the two probabilities to find the probability that x lies between 11 and 35:
P(11 < x < 35) = P(z2) - P(z1) = 0.8413 - 0.1587 = 0.6826
So, the probability that x is between 11 and 35 is approximately 0.6826 or 68.26%.

To know more about probability visit:

https://brainly.com/question/30034780

#SPJ11

Gray LLC is considering investing in a project that will cost $130,000 and will generate $30,000 in cash flows for the next 7 years. Assuming a Discount Rate of 10%, which of the following is true?​
All of the above are true
The project’s payback period is 6 years
The project’s IRR is 13.7%
The project’s NPV is $11,275
The project’s profitability index is 0.67

Answers

Among the given options, the true statement is that the project's IRR is 13.7%. The other options are not accurate based on the information provided.

1. The payback period is the length of time it takes for the initial investment to be recovered from the project's cash flows. In this case, the payback period is not explicitly mentioned, so we cannot determine if it is 6 years or not.

2. The IRR (Internal Rate of Return) is the discount rate that makes the net present value (NPV) of the project's cash flows equal to zero. To calculate the IRR, we need to consider the initial investment and the cash flows over the project's lifespan. Given the cash flows of $30,000 for 7 years and a discount rate of 10%, we can calculate the IRR to be approximately 13.7%.

3. The NPV (Net Present Value) is the difference between the present value of cash inflows and the present value of cash outflows. To calculate the NPV, we need to discount the cash flows using the discount rate. Based on the information provided, we cannot determine if the NPV is $11,275 or not.

4. The profitability index is the ratio of the present value of cash inflows to the present value of cash outflows. It indicates the value created per unit of investment. Without the specific discounted cash flow amounts, we cannot determine if the profitability index is 0.67 or not.

Therefore, the only true statement among the given options is that the project's IRR is 13.7%.

To learn more about payback period : brainly.com/question/28304736

#SPJ11

QUESTION 7 1 POINT x²4x12 Consider the graph of the function f(x) = x² + 5x-14 What are the vertical asymptotes? List the x-values separated by commas. Do not include "=" in your answer.

Answers

The vertical asymptotes of the given function f(x) = x² + 5x-14 are x=-7 and x=2. Thus, the required answer is: Vertical asymptotes are located at x = -7 and x = 2.

Consider the graph of the function f(x) = x² + 5x-14. The question requires the vertical asymptotes of the given graph. The vertical asymptotes can be found in rational functions.

Therefore, to find the vertical asymptotes of the given function, we set the denominator, x² + 5x-14 equal to 0.x² + 5x-14 = 0

The above equation can be solved by factorization method.

We have to find two numbers such that their sum is 5 and product is 14.

Clearly, the numbers are 2 and 7.

 Hence, x² + 5x-14 = (x+7) (x-2)

By the zero-product property, (x+7) (x-2) = 0⇒ x+7=0 or x-2 = 0⇒ x=-7 or x=2 .

Therefore, the vertical asymptotes of the given function f(x) = x² + 5x-14 are x=-7 and x=2.

Thus, the required answer is: Vertical asymptotes are located at x = -7 and x = 2.

To know more about Vertical visit :

https://brainly.com/question/30523058

#SPJ11

Hey, if anyone is good at Algebra 2, please help with this problem! "The AP chemistry class is mixing 100 pints of liquid together for an experiment. Liquid A contains 10% acid, liquid B contains 40% acid, and liquid C contains 60% acid. If there are twice as many pints of liquid A than liquid B, and the total mixture contains 45% acid, find the number of pints needed for each liquid. "

Answers

The number of pints needed for each liquid is A = 25, B = 12.5, and C = 62.5.

From the data,

The AP chemistry class is mixing 100 pints of liquid together for an experiment.

Liquid A contains 10% acid, liquid B contains 40% acid, and liquid C contains 60% acid.

If there are twice as many pints of liquid A than liquid B, and the total mixture contains 45% acid

Let's first set up some equations based on the information given:

Let x be the number of pints of liquid B.

Then, the number of pints of liquid A is 2x (since there are twice as many pints of liquid A as liquid B).

The number of pints of liquid C can be found by subtracting the number of pints of A and B from the total of 100 pints:

Number of pints of liquid C = 100 - (x + 2x) = 100 - 3x

Now, set up an equation based on the acid content of the mixture:

=> (0.1)(2x) + (0.4)x + (0.6)(100 - 3x) = (0.45)(100)

Simplifying this equation, we get:

=> 0.2x + 0.4x + 60 - 1.8x = 45

=> -1.2x = -15

=> x = 12.5

So, we need 12.5 pints of liquid B,

2(12.5) = 25 pints of liquid A,

100 - (12.5 + 25) = 62.5 pints of liquid C.

Therefore,

The number of pints needed for each liquid is A = 25, B = 12.5, and C = 62.5.

Learn more about Equations at

https://brainly.com/question/29657983

#SPJ4

Write the equation of the line that passes through the points ( 9 , − 7 ) (9,−7) and ( − 5 , 3 ) (−5,3). Put your answer in fully simplified point-slope form, unless it is a vertical or horizontal line.

Answers

The equation of line is y = -5/7 x -4/7.

we have the points (9,−7) and ( − 5 , 3 ).

So, slope of line

= (3 + 7)/ (-5 -9)

= 10 / (-14)

= -5/7

and, the equation of line is

y + 7 = -5/7 (x - 9)

y+ 7 = -5/7 x + 45/7

y = -5/7 x + 45/7 - 7

y = -5/7 x -4/7

Learn more about Slope here:

https://brainly.com/question/3605446

#SPJ1

A jar contains 17 blue cubes,4 blue spheres,5 green cubes,and 16 green spheres.what is the probability of randomly selecting a blue object or a cube? Give your answer as a fraction.

Answers

Answer:

The answer would be 3/16

Step-by-step explanation: Hope this helped

Answer:

13/21. that is 0.619

Step-by-step explanation:

there are 17 + 4 + 5 + 16 = 42 things in total.

p = probabililty.

p(blue object) = (17 + 4)/ 42  

= 1/2.

p(cube) = (17 + 5) /42

= 11/21.

we have to subtract the things that are both blue and a cube:

there are 17 of those. that is p(blue and cube) = 17/42.

so our answer is (1/2) + (11/21) - (17/42)

= 13/21. that is 0.619

Question: Find the area of the region enclosed by the curves y = 2 cos (pi x/2) and y = 2 - 2x^2. The area of the enclosed region is (Type an exact answer, ...

Answers

The difference between the upper curve (y = 2 - 2x^2) and the lower curve (y = 2 cos(pi x/2)) with respect to x over the given interval Area = ∫[from -1.316 to 1.316] (2 - 2x^2 - 2 cos(pi x/2)) dx.

To find the area of the region enclosed by the curves y = 2 cos(pi x/2) and y = 2 - 2x^2, we need to determine the points of intersection between the two curves and integrate the difference between them over the common interval.

Let's start by setting the two equations equal to each other:

2 cos(pi x/2) = 2 - 2x^2.

Simplifying this equation, we get:

cos(pi x/2) = 1 - x^2.

To solve for the points of intersection, we need to find the x-values where the two curves intersect. Since the cosine function has a range between -1 and 1, we can rewrite the equation as:

1 - x^2 ≤ cos(pi x/2) ≤ 1.

Now, we solve for the values of x that satisfy this inequality. However, finding the exact analytical solution for this equation can be challenging. Therefore, we can approximate the points of intersection numerically using numerical methods or graphing technology.

By plotting the graphs of y = 2 cos(pi x/2) and y = 2 - 2x^2, we can visually determine the points of intersection. From the graph, we can observe that the two curves intersect at x-values approximately -1.316 and 1.316.

Now, we integrate the difference between the two curves over the common interval. Since the curves intersect at x = -1.316 and x = 1.316, we integrate from x = -1.316 to x = 1.316.

To calculate the area, we integrate the difference between the upper curve (y = 2 - 2x^2) and the lower curve (y = 2 cos(pi x/2)) with respect to x over the given interval:

Area = ∫[from -1.316 to 1.316] (2 - 2x^2 - 2 cos(pi x/2)) dx.

Evaluating this integral will give us the area of the enclosed region.

It's important to note that since the integral involves trigonometric functions, evaluating it analytically might be challenging. Numerical integration methods, such as Simpson's rule or the trapezoidal rule, can be used to approximate the integral and calculate the area numerically.

Overall, to find the exact area of the region enclosed by the curves y = 2 cos(pi x/2) and y = 2 - 2x^2, we need to evaluate the integral mentioned above over the common interval of intersection.

Learn more about difference here

https://brainly.com/question/17695139

#SPJ11

In a city, 1 person in 5 is left handed (a) Find the probability that in a random sample of 10 people i. exactly 3 will be left handed ii. more than half will be left handed (b) Find the mean and the standard deviation of the number of left handed people in a random sample of 25 peopl?e (c) How large must a random sample be if the probability that it contains at least one 8 marks] left handed person is to be greater than 0.95?

Answers

The exact calculations for the probabilities and sample size would require evaluating the binomial coefficients and performing the calculations.

How to find the probability in each case, the mean and standard deviation of the number of left-handed people in a random sample of 25 and the minimum sample size required for the probability of containing at least one left-handed person to be greater than 0.95?

(a) To find the probability in each case, we can use the binomial distribution formula. Let's calculate:

i. Probability of exactly 3 left-handed people in a sample of 10:

P(X = 3) = C(10, 3) * (1/5)^3 * (4/5)^7

         = (10! / (3! * 7!)) * (1/5)^3 * (4/5)^7

ii. Probability of more than half (i.e., at least 6) left-handed people in a sample of 10:

P(X > 5) = P(X = 6) + P(X = 7) + P(X = 8) + P(X = 9) + P(X = 10)

        = C(10, 6) * (1/5)^6 * (4/5)^4 + C(10, 7) * (1/5)^7 * (4/5)^3 + C(10, 8) * (1/5)^8 * (4/5)^2 + C(10, 9) * (1/5)^9 * (4/5) + C(10, 10) * (1/5)^10

(b) To find the mean and standard deviation of the number of left-handed people in a random sample of 25:

Mean (μ) = n * p = 25 * (1/5) = 5

Standard Deviation (σ) = √(n * p * q) = √(25 * (1/5) * (4/5))

(c) To find the minimum sample size required for the probability of containing at least one left-handed person to be greater than 0.95, we can use the complement of the probability:

P(at least one left-handed person) = 1 - P(no left-handed person)

Let's assume n is the sample size:

1 - (4/5)^n > 0.95

Solving this inequality will give us the minimum required sample size.

Please note that the exact calculations for the probabilities and sample size would require evaluating the binomial coefficients and performing the calculations.

Learn more about probabilities

https://brainly.com/question/29381779?referrer=searchResults

#SPJ11

The height of a flare is represented by h, given in metres. The function for the height of a flare with respect to time t, given in seconds, after the flare was fired from a boat, can be modeled by the function

h (t) = -5.25(t-4)^2 + 86

What was its height when it was fired?

What was the maximum height of the flare?

What was the time when the flare reached its maximum height?

How many seconds after it was fired did the flare hit the water?

Answers

The time when the flare reached its maximum height is approximately 8 seconds.

The given function is h(t)=-5.25(t-4)²+86.

1) h(0)=-5.25(0-4)²+86

= 2

So, the height is 2 meter when it was fired.

2) The maximum height of the flare is 86 meter.

3) Here, -5.25(t-4)²+86=0

-5.25(t-4)²=-86

(t-4)²=86/5.25

(t-4)²=16.38

t-4=√16.38

t-4=4.047

t=8.047 seconds

Therefore, the time when the flare reached its maximum height is approximately 8 seconds.

To learn more about the function visit:

https://brainly.com/question/28303908.

#SPJ1

A computer lab has three laser printers and five toner cartridges. Each machine requires one toner cartridges which lasts for an exponentially distributed amount of time with mean 6 days. When a toner cartridge is empty it is sent to a repairman who takes an exponential amount of time with mean 1 day to refill it. (a) Compute the stationary distribution. (b) How often are all three printers working

Answers

The three printers are working approximately 20/36 of the time, which can be simplified to approximately 0.5556 or 55.56%.

A continuous-time Markov chain (CTMC) model:

State 0: No printers working (0 printers are operational)

State 1: One printer working (1 printer is operational)

State 2: Two printers working (2 printers are operational)

State 3: Three printers working (all 3 printers are operational)

(a) Computing the Stationary Distribution:

To find the stationary distribution, the transition rates between the states and solve the balance equations.

Transition rates:

From State 0 to State 1: The rate at which a printer starts working is equal to the rate at which a toner cartridge is available, which is 1/6 per day . So the transition rate from State 0 to State 1 is λ_01 = 1/6.

From State 1 to State 0: The rate at which a printer stops working is equal to the rate at which a toner cartridge becomes empty. Since each printer requires one toner cartridge, and the time until it becomes empty is exponentially distributed with a mean of 6 days, the transition rate from State 1 to State 0 is μ_10 = 1/6.

From State 1 to State 2: The rate at which a second printer starts working is equal to the rate at which a toner cartridge becomes available. However, since have 5 toner cartridges and one is already in use, the rate is limited to 5/6 per day. So the transition rate from State 1 to State 2 is λ_12 = 5/6.

From State 2 to State 1: The rate at which a second printer stops working is equal to the rate at which a toner cartridge becomes empty, which is μ_21 = 1/6.

From State 2 to State 3: The rate at which a third printer starts working is equal to the rate at which a toner cartridge becomes available. Again, considering the limitation of 5 toner cartridges and two already in use, the rate is limited to 4/6 per day. So the transition rate from State 2 to State 3 is λ_23 = 4/6.

From State 3 to State 2: The rate at which a third printer stops working is equal to the rate at which a toner cartridge becomes empty, which is μ_32 = 1/6.

Balance equations:

Let π_0, π_1, π_2, and π_3 be the stationary probabilities of being in states 0, 1, 2, and 3, respectively.

The balance equations for the CTMC are as follows:

λ_01 × π_0 = μ_10 × π_1

λ_12 × π_1 = μ_21 × π_2

λ_23 × π_2 = μ_32 × π_3

π_0 + π_1 + π_2 + π_3 = 1

Solving the equations:

Substituting the transition rates into the balance equations,

(1/6) × π_0 = (1/6) ×π_1

(5/6) ×π_1 = (1/6) ×π_2

(4/6) × π_2 = (1/6) × π_3

π_0 + π_1 + π_2 + π_3 = 1

equations to find the stationary probabilities.

From the first equation,  π_1 = π_0

From the second equation, : π_2 = (5/6) ×π_1 = (5/6) × π_0

From the third equation, : π_3 = (4/6)× π_2 = (4/6) ×(5/6) × π_0

Using the fact that the probabilities should sum to 1,

π_0 + π_0 + (5/6) × π_0 + (4/6) × (5/6) × π_0 = 1

Simplifying the equation,

π_0 + π_0 + (5/6) × π_0 + (20/36) × π_0 = 1

(36/36) × π_0 = 1

π_0 = 36/36

π_0 = 1

Therefore, the stationary distribution is:

π_0 = 1

π_1 = 1

π_2 = (5/6)

π_3 = (4/6) ×(5/6) = (20/36)

(b) How often are all three printers working:

The probability of being in State 3 (all three printers working) in the stationary distribution is π_3 = (20/36).

To know more about time here

https://brainly.com/question/31732120

#SPJ4

Suppose that a new employee starts working at $7.23 per hour, and receives a 5% raise each year. After time t, in years, his hourly wage is given by the function P(1) = $7.23(1.05). a) Find the amount of time after which he will be earning $10.00 per hour. b) Find the doubling time. GEXOS After what amount of time will the employee be earning $10.00 per hour?___ years (Round to the nearest tenth of a year.
What is the doubling time? ___years (Round to the nearest tenth of a year.).

Answers

The employee will start earning $10.00 per hour after approximately 3.5 years, and the doubling time for his hourly wage will be around 14.0 years.

a) To find the time after which the employee will be earning $10.00 per hour, we can set up the equation P(t) = $10.00, where P(t) represents the hourly wage after time t. Given that the employee starts at $7.23 per hour and receives a 5% raise each year, we have the function P(1) = $7.23(1.05). It can then solve the equation P(t) = $10.00 as follows:

$7.23(1.05)^t = $10.00

(1.05)^t = $10.00/$7.23

t ln(1.05) = ln($10.00/$7.23)

t = ln($10.00/$7.23)/ln(1.05)

t ≈ 3.5

Therefore, the employee will be earning $10.00 per hour after approximately 3.5 years.

b) The doubling time refers to the time it takes for the employee's hourly wage to double. This can set up the equation P(t) = 2($7.23), where P(t) represents the hourly wage after time t. Using the same function P(1) = $7.23(1.05), to solve the equation P(t) = 2($7.23) as follows:

$7.23(1.05)^t = 2($7.23)

(1.05)^t = 2

t ln(1.05) = ln(2)

t = ln(2)/ln(1.05)

t ≈ 14.0

Therefore, the doubling time for the employee's hourly wage is approximately 14.0 years.

To learn more about wage- brainly.com/question/29178261

#SPJ11

Use a combinatorial argument to find the number of ways of seating k people in a row of n chairs if there must be at least four empty chairs between any two people, and precisely one empty chair at the end of the row (with no conditions on the chairs at the beginning of the row). Leave your answer in terms of factorials.

Answers

The number of ways of seating k people in a row of n chairs with at least four empty chairs between any two people and one empty chair at the end is given by (n-5)Ck * k! * (n-k-1)!.

To find the number of ways of seating k people in a row of n chairs with the given conditions, we can use a combinatorial argument.

First, we choose the positions for the k people to sit. Since there must be at least four empty chairs between any two people, we can select k positions from the (n-5) available chairs. This can be done in (n-5) choose k ways, which can be expressed as (n-5)Ck.

Next, we arrange the k people in the chosen positions. This can be done in k! ways.

Finally, we arrange the remaining empty chairs. Since there must be precisely one empty chair at the end of the row, we have (n-k-1) chairs remaining. These chairs can be arranged in (n-k-1)! ways.

Therefore, the total number of ways of seating k people in a row of n chairs with the given conditions is

(n-5)Ck * k! * (n-k-1)!

Leave this expression in terms of factorials.

To know more about combination:

https://brainly.com/question/30544068

#SPJ4

8. (10 points) suppose you toss a fair coin twice. let x = the number of heads you get. find the probability distribution of x.

Answers

The probability distribution of X is:

X | P(X)

0 | 1/4

1 | 1/2

2 | 1/4

When tossing a fair coin twice, we can determine the probability distribution of the random variable X, which represents the number of heads obtained. Let's calculate the probabilities for each possible value of X:

When X = 0 (no heads):

The outcomes can be TT, and the probability of getting two tails is 1/4.

When X = 1 (one head):

The outcomes can be HT or TH, and each has a probability of 1/4.

So, the probability of getting one head is 1/4 + 1/4 = 1/2.

When X = 2 (two heads):

The outcome can be HH, and the probability of getting two heads is 1/4.

Therefore, the probability distribution of X is:

X | P(X)

0 | 1/4

1 | 1/2

2 | 1/4

This distribution shows that there is a 1/4 probability of getting no heads, a 1/2 probability of getting one head, and a 1/4 probability of getting two heads when tossing a fair coin twice.

Learn more about probability distribution at https://brainly.com/question/18723417

#SPJ11


What is the probability of picking a red balloon at random
to the nearest hundredth?
** A 0.19
**B 0.18
**C 0.17
5 of 10
-D 0.16
36.53

Answers

The probability of picking a red balloon at random is,

⇒ P = 0.18

We have to given that,

Total number of balloons = 17

And, Number of red balloons = 3

Now, We get;

The probability of picking a red balloon at random is,

⇒ P = Number of Red balloons / Total number of balloons

Substitute given values, we get;

⇒ P = 3 / 17

⇒ P = 0.1786

⇒ P = 0.18

(After rounding to the nearest hundredth.)

Thus, The probability of picking a red balloon at random is,

⇒ P = 0.18

Learn more about the probability visit:

https://brainly.com/question/13604758

#SPJ1

A CPA knows from past history that the average accounts receivable for a company is $521.72 with a standard deviation of $584.64. If the auditor takes a simple random sample of 100 accounts, what is the probability that the mean of the sample is within $120 of the population mean?

Answers

To find the probability, we need to use the Central Limit Theorem, which states that for a large enough sample size, the distribution of sample means will be approximately normal. We can calculate the standard deviation of the sample mean using the formula σ / √n, where σ is the population standard deviation and n is the sample size. Then, we can convert the difference of $120 into a z-score by subtracting the population mean and dividing by the standard deviation of the sample mean. Finally, we can use the z-table or a statistical calculator to find the probability associated with the z-score.

1. Calculate the standard deviation of the sample mean:

  Standard deviation of the sample mean = σ / √n

  Standard deviation of the sample mean = $584.64 / √100

  Standard deviation of the sample mean = $58.464

2. Convert the difference of $120 into a z-score:

  z = (x - μ) / (σ / √n)

  z = ($120) / ($58.464)

  z ≈ 2.052

3. Find the probability associated with the z-score:

  Using a z-table or a statistical calculator, we can find that the probability associated with a z-score of 2.052 is approximately 0.9798.

Therefore, the probability that the mean of the sample is within $120 of the population mean is approximately 0.9798 or 97.98%.

To learn more about standard deviation : brainly.com/question/13498201

#SPJ11

In a random sample of 100 audited estate tax​ returns, it was determined that the mean amount of additional tax owed was $3444 with a standard deviation of $2504.
Construct and interpret a​ 90% confidence interval for the mean additional amount of tax owed for estate tax returns.
The lower bound is _____. (Round to the nearest dollar as​needed.)
The upper bound is ______. (Round to the nearest dollar as​needed.)
Interpret a​ 90% confidence interval for the mean additional amount of tax owed for estate tax returns. Choose the correct answer below.
A. One can be​ 90% confident that the mean additional tax owed is greater than the upper bound.
B. One can be​ 90% confident that the mean additional tax owed is less than the lower bound.
C. One can be​ 90% confident that the mean additional tax owed is between the lower and upper bounds.

Answers

The true mean additional tax owed for estate tax returns is between approximately $3056 and $3832. This means option C is the correct answer: One can be 90% confident that the mean additional tax owed is between the lower and upper bounds.

Based on a random sample of 100 audited estate tax returns, the mean amount of additional tax owed was estimated to be $3444, with a standard deviation of $2504. Using this data, a 90% confidence interval for the mean additional amount of tax owed can be calculated. The lower bound of the confidence interval is approximately $3056, and the upper bound is approximately $3832. Therefore, one can be 90% confident that the true mean additional tax owed for estate tax returns falls between these two values.

To construct the 90% confidence interval, we can use the formula:

Confidence Interval = mean ± (critical value) * (standard deviation / sqrt(sample size))

Since the sample size is large (n = 100), we can assume a normal distribution and use the z-score critical value. The critical value for a 90% confidence interval is 1.645.

Plugging in the values, we have:

Confidence Interval = $3444 ± 1.645 * ($2504 / sqrt(100))

= $3444 ± 1.645 * ($2504 / 10)

= $3444 ± 1.645 * $250.4

= $3444 ± $411.86

Calculating the lower and upper bounds:

Lower bound = $3444 - $411.86 ≈ $3056

Upper bound = $3444 + $411.86 ≈ $3832

Therefore, we can say with 90% confidence that the true mean additional tax owed for estate tax returns is between approximately $3056 and $3832. This means option C is the correct answer: One can be 90% confident that the mean additional tax owed is between the lower and upper bounds.

Learn more about Confidence Interval:

brainly.com/question/29680703

#SPJ11

A company sold a total of 150 adult and child tickets to a fundraiser. The company charged $10 for each adult ticket and $6 for each child ticket for $350. Write an equation to represent the total amount of tickets.

Answers

The two equations representing the total number of tickets sold and the total amount collected are a + c = 150 and 5a + 3c = 175 respectively.

Let's assume the number of adult tickets sold is represented by the variable 'a' and the number of child tickets sold is represented by the variable 'c'.

We know that the total number of tickets sold is 150, so we can write the equation:

a + c = 150

Additionally, we know that the total amount collected from selling adult tickets at $10 each and child tickets at $6 each is $350.

We can express this information in another equation:

10a + 6c = 350

5a + 3c = 175

Hence the two equations representing the total number of tickets sold and the total amount collected are a + c = 150 and 5a + 3c = 175.

Learn more about equations click;

https://brainly.com/question/29538993

#SPJ1

Other Questions
the man in the yellow hat" can be found in books that feature which children's literary character? What kind of poem is on Page 76 in the crossover? The third wave of immigration from Cuba to the U.S. is referred to as ______. approximately what portion of the body's total water is intracellular? A. 2/3 of the body's total waterB. 1/3 of the body's total waterC. 1/4 of the body's total water D. 1/2 of the body's total water Two people are looking at a totem pole that is 65 feet tall. When the two people are looking at the top of the totem pole, they are exactly 200 feet apart the person closest to the totem pole has an angle elevation to the top of the totem pole of 32 degrees as shown. what is the value of x rounded to the nearest hundredth The typical plantation belt yeoman in the old South aspired toa. leaving the farm and opening a shop in townb. moving up to the planter classc. the destruction of his neighbor's crops because of his envy and resentmentd. higher education for his children so they could compete against the planter's children for jobs a feature of monopolistic competition that makes it different from monopoly is the: group of answer choices downward-sloping demand curve. downward-sloping marginal revenue curve. number of firms in the industry. fact that firms in monopolistically competitive industries follow the marginal decision rule, while monopolies do not. homer boats has accounts payable days of , inventory days of , and accounts receivable days of . what is its operating cycle? The equilibrium rule, F=0 , applies to (a) objects or systems at rest. (b) objects or systems in uniform motion in a straight line.(c) both of these(d) none of these One half of an obtuse angle is 9 more than its supplement. What is the measure of the supplement? Exhaust fan ventilating capability is rated in ___.Select one:a. revolutions per minute (RPM)b. cubic feet per minute (CFM)c. louver rate of discharge (LRD)d. none of these draw the aldehyde produced from the oxidation of ch3ch2ch2c(ch3)2ch2ohch3ch2ch2c(ch3)2ch2oh . why doesn t semen enter the urinary bladder during ejaculation 23. Solve for the missing variables. The most common side effect of electroconvulsive shock therapy is ____.a. dry mouth and blurred visionb. damage to the frontal lobesc. memory lossd. high probability of broken bones during the treatment Comparisons of economic activity over time should be made using:a) nominal GDP adjusted for unemployment.b) nominal GDP per capita.c) current-dollar GDP.d) real GDP. originally depreciated on a straight-line basis over 10 years with an assumed salvage value of $12,000. on december 31, 2015, before adjusting entries had been made, the company decided to change the remaining estimated life to 4 years (including 2015) and the salvage value to $2,000. what was the depreciation expense for 2015? what is the probability that the following pair of parents will produce the indicated offspring? ttrryy x ttrryy -> ttrryy Based on the following information,Br 2(l) + 2 e- 2 Br -(aq) E = +1.09 VMg 2+(aq) + 2 e- 2 Mg(s) E = -2.37 Vwhich of the following chemical species is the strongest reducing agent?A. Mg 2+(aq)B. Mg(s)C. Br 2( l )D. Br -(aq) What were problems, challenges/threats, and decisions that queen elizabeth i faced, and how she dealt with them?