John recently purchased $4,106.00 worth of a stock that is expected to grow in value by 8% each year for the next ten years.Assuming this growth forecast holds, which function will show the value of John's stock in tyears?A(t) = 1.08(54,106)A(O) = 54,106(1.1)A(0) = 54,106(1.08)A(t) = $4,106(1.08)

Answers

Answer 1

The exponential growth formula:

[tex]A(t)=A_0(1+r)^t[/tex]

Given:

[tex]\begin{gathered} A_0=\text{ \$4106} \\ t=10yrs \\ r=8\%=\frac{8}{100}=0.08 \end{gathered}[/tex]

Therefore,

[tex]A(t)=4106(1+0.08)^t=4106(1.08)^t[/tex]

Hence, the answer is

[tex]A(t)=\text{ \$}4106(1.08)^t[/tex]


Related Questions

how can you use the vertical line test and the horizontal line test to determine whether a graph represents a function and whether the graph is invertible?

Answers

In this case, we'll have to carry out several steps to find the solution.

Step 01:

Data

vertical line test = ?

horizontal line test = ?

Step 02:

vertical line test ===> function

any vertical line intersect the graph at only one point

horizontal line test ===> invertible

any horizontal line intersect the graph at only one point

graph:

horizontal line test = red

vertical line test = brown

That is the full solution.

omg i lost my tutor in the middle of math i need another one btw in fith grade not in middle school yet

Answers

[tex]\frac{6}{10}\text{/}\frac{1}{5}[/tex]

by definition the division of fractions can be found by

[tex]\frac{\frac{a}{b}}{\frac{c}{d}}=\frac{b\cdot c}{a\cdot d}[/tex]

According to this

[tex]\frac{\frac{6}{10}}{\frac{1}{5}}=\frac{6\cdot5}{10\cdot1}=\frac{30}{10}=3[/tex]

Substitute the given values into the given formula and alone the unknown variable if necessary round to one decimal place

Answers

Answer:

c = 15

Explanation:

The perimter, P = 37

The side lengths of the triangle are:

a = 10, b = 12, c = ?

The perimeter of the triangle is given by the formula:

P = a + b + c

Substitute a = 10, b = 12, and P = 37 into the formula P = a + b + c and solve for c

37 = 10 + 12 + c

37 = 22 + c

c = 37 - 22

c = 15

use and show all conversion factors to convert 352 inches per second to miles per hour. 352 inches divided by 1 second

Answers

Okay, here we have this:

We need to convert 352 inches per second to miles per hour. So we obtain the following:

[tex]\begin{gathered} \frac{352in}{1sc}\cdot\frac{1mile}{63360in}\cdot\frac{3600sc}{1h} \\ =\frac{20\text{miles}}{h} \end{gathered}[/tex]

Finally we obtain that 352 inches per second 20 are miles per hour.

Which of the following is an equation of a line that is parallel to y = 4x - 5 and has a y-intercept of (0, 7)?

Answers

Answer:

Step-by-step explanation:

To start your equation is in the format y=mx+b.

For a line to be parallel it must have the same slope (m) so we know 4 must remain the same. x & y will not change since they represent the variables. y=4x (so far) then the point (0,7) as stated is the y intercept. 0 is the x value and 7 is the y we need to add 7 to our equation.

final equation y=4x+7

9. If L 1 equals 120 then what is the measure of its supplement <2=

Answers

Supplementary angles are angles whose addition sums up to 180 degrees.

Therefore, if angle 1 measures 120, then its supplement which is angle 2, must mean both add up to 180.

Hence, you have

Angle 1 + Angle 2 = 180

120 + Angle 2 = 180

Subtract 120 from both sides of the equation

Angle 2 = 180 - 120

Angle 2 = 60 degrees

By definiton, two angles are complimentary angles if they both add up to 90 degrees. Hence if angle L5 equals 50 degrees, then its compliment would be derived as 90 - 50 which equals 40. The compliment of angle L5 which is 50 degrees, equals 40 degrees.

PLEASE HURRY ASAP
Determine which integer in the solution set will make the equation true.

4s − 14 = −6
S: {−1, 0, 1, 2}

Answers

The solution of the equation is s=2.

Linear Function

An equation can be represented by a linear function. The standard form for the linear equation is: y= mx+b , for example, y=7x+1. Where:

m= the slope. It can be calculated for Δy/Δx .

b= the constant term that represents the y-intercept.

For the given example: m=7and b=1.

For solving this question you should replace x for the given values ( −1, 0, 1, 2) in the equation 4s − 14 = −6. If you obtain -6, the value of s is a solution.

For s= -1 -> 4*(-1)-14= -4 -14= -20. Therefore, s=-1 is not the solution.

For s= 0 -> 4*(0)-14= 0 -14= -14. Therefore, s=0 is not the solution.

For s= 1 -> 4*(1)-14= 4 -14= -10. Therefore, s= 1 is not the solution.

For s= 2 -> 4*(2)-14= 8 -14= -6. Therefore, s=2 is the  solution.

Read more about the linear equations here:

brainly.com/question/2030026

#SPJ1

mrs smith took her 3 kids and 3 of thejr friends to the Strawberry field. how many kids are there?

Answers

Mrs.Smith took : her 3 kids + 3 of their friends = 3 + ( 3x 3 ) = 12 kids

Answer:

There are 3 kids, and 3 friends.

3 + 3 = 6

there are a total of 6 kids.

how many pennies are in a dollar

Answers

Answer: 100

Step-by-step explanation:

$1 =100 pennies

A 14 m long ladder is placed against a tree. The top of the ladder reaches a point
13 m up the tree.

How far away is the base of the ladder from the base of the tree?

Give your answer in metres (m) to 1 d.p.

Answers

Answer:

Approximately 5.2 meters

Step-by-step explanation:

This formation will make a right triangle. The ground to the point in the tree is one of the legs. The base of the tree to the base of ladder is another leg and the length of the ladder is the hypotenuse. In this case, we already have the hypotenuse and one of the legs, so we need to find the value of another leg.

We can do so by using the Pythagorean Theorem which is [tex]a^2+b^2=c^2\\[/tex].

a and b represent the values of the two legs, and c is the hypotenuse. Since we already have the hypotenuse, we can change this equation a bit to find the other leg.

Let's assign the missing value, b in the theorem.

The new equation will be [tex]b^2=c^2-a^2[/tex].

We can insert the values for c and a and solve for b.

The new equation will be [tex]b^2 = 14^2-13^2[/tex].

[tex]b^2=196-169[/tex]

[tex]b^2=27[/tex]

[tex]\sqrt{b^2} =\sqrt{27}[/tex]

The square root of [tex]b^2[/tex] cancels out.

The approximate square root of 27 is 5.19 which we can round to 5.2.

How do I solve this and what is the answer

Answers

Answer:

157.5°

Explanation:

To convert from radians to degrees, multiply the angle in radians by 180/π.

Therefore, 7π/8 radians in degrees will be:

[tex]\begin{gathered} \frac{7\pi}{8}\text{ radians=}\frac{7\pi}{8}\times\frac{180}{\pi} \\ =\frac{7}{8}\times180 \\ =157.5\degree \end{gathered}[/tex]

Marcy baked 132 cookies . She is packaging boxes of eight cookies to give as a gift to he friends how many boxes will she make .

Answers

She will make 16 boxes.

To answer this question we simply have to divide the number of cookies (132) by the number of cookies that each box can contain.

Mathematically speaking:

[tex]132/8\text{ }[/tex][tex]16.5[/tex]

Since we can´t have half boxes, we have to round the number to 16.

16 boxes.

Which expression is equivalent to (6 – 3x) + 9x ? 1 A. 8x + 2 B. 8x + 3 C. 10x-2 D. 10x - 6

Answers

Given to solve the expression:

[tex]\frac{1}{3}(6-3x)+9x[/tex]

step 1: Expand the bracket by multiplying each term by the factor outside

[tex]\begin{gathered} (\frac{1}{3}\times6)-(\frac{1}{3}\times3x)+9x \\ 2-x+9x \end{gathered}[/tex]

step 2: Simplify the expression obtained in step 1

[tex]\begin{gathered} 2-x+9x\text{ } \\ =2+8x \\ =8x+2 \\ \\ \text{The answer is \lbrack{}Option }A\rbrack \end{gathered}[/tex]

On a 7 question multiple-choice test, where each question has 2 answers, what would be the probability of getting at least one question wrong?Give your answer as a fraction

Answers

Solution

- This is a Binomial probability question. The formula for Binomial probability is:

[tex]\begin{gathered} P(r)=\sum\text{ }^nC_rp^rq^{n-r} \\ where, \\ n=The\text{ total number of trials} \\ r=\text{ The number of successful trials\lparen where answer is correct\rparen} \\ p=\text{ The probability of success \lparen The probability of getting a question } \\ right) \end{gathered}[/tex]

- We have been given:

[tex]\begin{gathered} n=7 \\ \text{ since there can only be two answers, it means that the} \\ \text{ probability of getting a question correct is:} \\ p=\frac{1}{2} \\ q=1-p=\frac{1}{2} \\ \\ \text{ The probability of getting at least 1 question wrong means the } \\ probability\text{ of getting 1, 2, 3, 4, 5, 6, or 7 question wrong.} \\ \\ \text{ Instead of calculating all these probabilities, we can simply say} \\ P(1)+P(2)+P(3)+P(4)+P(5)+P(6)+P(7)=1-P(0) \end{gathered}[/tex]

- Thus, we have:

[tex]\begin{gathered} P(0)=^7C_0(\frac{1}{2})^0(\frac{1}{2})^7 \\ P(0)=\frac{1}{128} \\ \\ 1-P(0)=1-\frac{1}{128}=\frac{127}{128} \end{gathered}[/tex]

Final Answer

The answer is

[tex]\frac{127}{128}[/tex]

Solve system of equations using the method of substitution. Identify wether the system represents parallel, coincident, or parallel lines.5x+2y=167.5x+3y=24

Answers

Given

5x+2y=16 ---(1)

7.5x+3y=24 ----(2)

Find

1) value of x and y

2) Type of system

Explanation

From equation (1)

[tex]\begin{gathered} 5x+2y=16 \\ 5x=16-2y \\ x=\frac{16-2y}{5} \end{gathered}[/tex]

Putting this value of x in equation 2

[tex]\begin{gathered} 7.5x+3y=24 \\ 7.5(\frac{16-2y}{5})+3y=24 \\ 1.5(16-2y)+3y=24 \\ 24-3y+3y=24 \end{gathered}[/tex]

From here we cannot find the values of x and y as 3y and -3y will cancel each other. Hence there is not a particular solution

Checking the type of system

From these equations we get

[tex]\frac{a1}{a2}=\frac{b1}{b2}=\frac{c1}{c2}[/tex]

Therefore the lines are coincident to each other

Therefore the lines have infinte solutions

Final Answer

Therefore the lines have infinte solutions

The lines are coincident to each other

In the diagram shown, ray CD is perpendicular to ray CE. If the measure of DCF is 115then what is the measure of ECF?

Answers

m∠FCE =25º

1) Since the measure of ∠DCF = 115º and ∠DCE = 90º then by the Angle Addition postulate we can state that

∠DCF = ∠DCE +∠FCE Plugging into that the given values

115º = 90º + ∠FCE Subtracting 90º from both sides

115-90=∠FCE

25º =∠FCE

2) Then the measure of ∠FCE is 25º

Pablo Is choosing at random from a bag of colored marbles. The probability he will choose a red marble is1/9What are the odds in favor of him choosing a redmarble?

Answers

Given:

[tex]\text{The probability to choose a red marble=}\frac{1}{9}[/tex]

The odds in favour of Pablo chosing a re marble is 1 : 8

select all of the following equations which represent a function?

Answers

To verify that something is a function, we use the horizontal line rule. That is, if the horizontal line passes through two points, then the graph is not a function, like this:

Then the circles and the ellipses are not functions. Then the functions in the problem would be:

1, 3 and 6.

A train travels at 100 mph any equation can be written that compares the time with the distance to find the domain and range

Answers

ok

speed = distance / time

time = distance/speed

[tex]\text{ time = }\frac{dis\tan ce\text{ }}{speed}[/tex][tex]\text{ time = }\frac{dis\tan ce\text{ }}{100}[/tex]

or

[tex]\text{ distance = 100 x time}[/tex]

Jordan plotted the graph below to show the relationship between the temperature of his city and the number of cups of hot chocolate he sold daily:A scatter plot is shown with the title Jordans Hot Chocolate Sales. The x axis is labeled High Temperature and the y axis is labeled Cups of Hot Chocolate Sold. Data points are located at 20 and 20, 30 and 18, 40 and 20, 35 and 15, 50 and 20, 45 and 20, 60 and 14, 65 and 18, 80 and 10, 70 and 8, 40 and 2.Part A: In your own words, describe the relationship between the temperature of the city and the number of cups of hot chocolate sold. (2 points)Part B: Describe how you can make the line of best fit. Write the approximate slope and y-intercept of the line of best fit. Show your work, including the points that you use to calculate the slope and y-intercept. (3 points)

Answers

A.

Overall it has a relation that there are more sold cups when the temperature is lower. On the other hand, based on the 40 degrees part, that have to different values of two different days, we can say is not the only factor.

B.

The best lineal approach is the line created with the points at 20 and 80 degrees. First the slope:

[tex]m=\frac{y1-y2}{x1-x2}=\frac{20-10}{20-80}=\frac{10}{-60}=-\frac{1}{6}[/tex]

Now the intercept with y axis, b:

[tex]\begin{gathered} y=mx+b \\ 20=20(-\frac{1}{6})+b \\ 20+\frac{20}{6}=b=23.33=\frac{70}{3} \end{gathered}[/tex]

The final line formula is:

[tex]y=-\frac{x}{6}+\frac{70}{3}[/tex]

Use the Rational Zeros Theorem to find all the real zeros of the polynomial function. Use the zeros to factor f over the real numbers. Hint solve this problem using P and Q's and synthetic division f(x) = x^3 + 2x^2 - 5x - 6A -3, -1, 2; f(x) = (x + 3)(x + 1)(x - 2)B-1; f(x) = (x + 1)(x2 + x - 6)C-3; f(x) = (x + 3)(x2 - x - 2)D-2, 1, 3; f(x) = (x + 2)(x - 1)(x - 3)

Answers

[tex]f(x)=x^3+2x^2-5x-6[/tex]

Since all coefficients are integers, we can apply the rational zeros theorem.

The trailing coefficient is -6 with the following factors (possible values for p):

[tex]p\colon\pm1,\pm2,\pm3,\pm6[/tex]

The leading coefficient is 1, with factors:

[tex]q=\pm1[/tex]

Therefore, all the possible values of p/q are:

[tex]\frac{p}{q}\colon\pm\frac{1}{1},\pm\frac{2}{1},\pm\frac{3}{1},\pm\frac{6}{1}[/tex]

Simplifying, the possible rational roots are:

[tex]\pm1,\pm2,\pm3,\pm6[/tex]

Next, we have to check if they are roots of the polynomials by synthetic division, in which the remainder should be equal to 0.

0. Dividing ,f (x), by ,x−1,. Remainder = ,-8, ,+1, is ,NOT ,a root.

,

1. Dividing ,f (x), by x+,1,. Remainder = 0, ,-1, ,IS ,a root.

,

2. Dividing ,f (x), by x-2. Remainder = 0, ,+2, ,IS ,a root.

,

3. Dividing ,f (x), by ,x+2,. Remainder = ,4, ,-2, is ,NOT ,a root.

,

4. Dividing ,f (x), by ,x−3,. Remainder = 24,, ,+3, is ,NOT ,a root.

,

5. Dividing ,f (x), by ,x+3,. Remainder = 0,, ,-3, IS ,a root.

,

6. Dividing ,f (x), by ,x−6,. Remainder = 252,, ,+6, is ,NOT ,a root.

,

7. Dividing ,f (x), by ,x+6,. Remainder = -120,, ,-6, is ,NOT ,a root.

Actual rational roots: A. -3, -1, 2; f(x) = (x + 3)(x + 1)(x - 2)

1. what is the area of the board shown on the scale drawing? explain how you found the area.2. how can Adam use the scale factor to find the area of the actual electronics board? remember, he uses a different method than Jason.3. what is the area of the actual electronics board?

Answers

Answer:

1. 1800 square cm.

2. See below

3. 45000 square cm.

Explanation:

Part 1

The dimensions of the drawing are 36cm by 50cm.

[tex]\begin{gathered} \text{The area of the board}=36\times50 \\ =1800\operatorname{cm}^2 \end{gathered}[/tex]

Part 2

Given a scale factor, k

If the area of the scale drawing is A; then we can find the area of the actual board by multiplying the area of the scale drawing by the square of k.

Part 3

[tex]\begin{gathered} \text{Area of the scale drawing}=1800\operatorname{cm}^2 \\ \text{Scale Factor,k=5} \end{gathered}[/tex]

Therefore, the area of the actual drawing will be:

[tex]\begin{gathered} 1800\times5^2 \\ =45,000\operatorname{cm}^2 \end{gathered}[/tex]

Write the ordered pair with no spaces (x,y) of point C for j(x).

Answers

This problem is about functions.

In this case, we don't have function j(x) defined in order to find its ordered pairs.

However, assuming that function j(x) is a function of f(x), we can deduct that points C is

[tex]C(0,0)[/tex]

find the x value (6x+9)° (4x-19)°

Answers

In this problem m and n are parallel lines, and the first angle is an exteriar angle an the secon is a interior angle.

this two condition give us that the two angles are complementary anlges so the sum of them should be 180 so:

[tex]6x+9+4x-19=180[/tex]

and we can solve for x so:

[tex]\begin{gathered} 10x-10=180 \\ 10x=180+10 \\ x=\frac{190}{10} \\ x=19 \end{gathered}[/tex]

The relation between the number of batteries (n) and the maximum height reached by the drone (h) in feet (ft) is given. Complete the table and check the correct box(es) given below.

Answers

We use the equation: h = 100(n + 2), so:

For n = 1:

[tex]h=100(1+2)=100(3)=300[/tex]

For n = 3:

[tex]h=100(3+2)=100(5)=500[/tex]

We can see that this is the correct equation. Therefore, given h we find n:

For h = 700

[tex]\begin{gathered} 700=100(n+2) \\ \frac{700}{100}=\frac{100}{100}(n+2) \\ 7=n+2 \\ 7-2=n+2-2 \\ n=5 \end{gathered}[/tex]

For h = 900

[tex]\begin{gathered} 900=100(n+2) \\ \frac{900}{100}=\frac{100}{100}(n+2) \\ 9=n+2 \\ 9-2=n+2-2 \\ n=7 \end{gathered}[/tex]

Answer:

(n): 1 3 5 7

(h): 300 500 700 900

Correct equation: h = 100(n + 2)

Is (6, –21) a solution to the equation y = –5x − –9?

Answers

Answer:

Explanation:

Given the equation:

[tex]y=-5x-(-9)[/tex]

When x=6:

Complete the table for y=-3x + 5 and graph the resulting line. -

Answers

We fill the table as follows:

*We assign values for x and solve for y, that is:

*x = 0:

[tex]y=-3(0)+5\Rightarrow y=5[/tex]

So, the value of y when x = 0 is 5.

*x = 1:

[tex]y=-3(1)+5\Rightarrow y=2[/tex]

So, the value of y when x = 1 is 2.

*x = 2:

[tex]y=-3(2)+5\Rightarrow y=-1[/tex]

So, the value of y when x = 2 is -1.

*x = 3:

[tex]y=-3(3)+5\Rightarrow y=-4[/tex]

So, the value of y when x = 3 is -4.

***The table should look like this:

x | y

0 | 5

1 | 2

2 | -1

3 | -4

***The graph is:

HELP PLEASEEEEE!!!!!!

Answers

The solutions of the indices are;

1)  2^7

2) 3^-4

3) 3^4

4) 2^4

What is the power?

We know that in this case, we would have to apply the laws of indices and the particular law that we are to apply in each case is dependent on the nature of the problem that have been posed. Let us recall that we are asked to ensure that we express the answer or the solution to the problem as a single power.

1) 64 * 256/128

2^6 * 2^8/2^7

2^6 + 8 - 7 = 2^7

2) 3^4/3^3 * 3^5

3^4 - (3 + 5) = 3^-4

3) 3^9/ (3^4)^1/2 * 3^3

3^9/ 3^2 * 3^3

3^9 - (2 + 3)

3^4

4) (2^3)^4 * 2^4 ÷ 32/ 2 * 64

2^12 * 2^4 ÷ 2^5/2^1 * 2^6

2^12 + 4 -5/2^1 + 6

2^16 -5/2^7

2^11/2^7

2^11 - 7

2^4

Learn more about laws of indices:https://brainly.com/question/27432311

#SPJ1

Given the definitions of f(a) and g(x) below, find the value of (19)( 1),f (x) = x2 + 3x – 11g(x) = 3a + 6

Answers

The given functions are,

[tex]\begin{gathered} f(x)=x^2+3x-11_{} \\ g(x)=3x+6 \end{gathered}[/tex]

Fog can be determined as,

[tex]\begin{gathered} \text{fog}=f(g(x)) \\ =f(3x+6) \\ =(3x+6)^2+3(3x+6)-11 \\ =9x^2+36+36x+9x+18-11 \\ =9x^2+45x+43 \end{gathered}[/tex]

The value of fog(-1) can be determined as,

[tex]\begin{gathered} \text{fog}(-1)=9(-1)^2+45(-1)+43 \\ =9-45+43 \\ =7 \end{gathered}[/tex]

Thus, the requried value is 7.

What is the measure of ?ХvO A. 46°42°42"38°NуvO B. 42°O C. 40°O D. 38°

Answers

The value Z is denoted as the center of the circle. Therefore, arc UV and arc XY should be the same .

[tex]undefined[/tex]

Answer: A. 42°

Step-by-step explanation:

Hope this helps :)

Other Questions
How can you tell from looking at a nuclear reaction that fusion has taken place? (1 point)O The total number of protons and neutrons will increase.O The nucleus with the largest mass will be on the left side of the equation.The nucleus with the largest mass number will be on the right side of theequation.O The total number of protons and neutrons will remain constant. Saving space is not an ideal reason for cropping a photo to be used in technical communication. What is a better reason?. Evaluate the expression when a=3 and b=6. b2-4a the beginning inventory consisted of 12,000 units, 30 percent complete and the ending inventory consisted of 9,600 units, 40 percent complete. there were 26,400 units started during the period. determine the equivalent units of conversion in process using the weighted average method. the wind velocity on the upstream side of a wind turbine is 5.2 m/s. if the turbine extracts 31% of the available kinetic energy, what is the wind velocity on the downstream side of the turbine in m/s? please include one decimal place in your answer. 2.) On the first night of a concert, Fish Ticket Outlet collected $67,200 on the sale of 1600 lawnseats and 2400 reserved seats. On the second night, the outlet collected $73,200 by selling2000 lawn seats and 2400 reserved seats. Solve the system of equations to determine the costof each type of seat. Vitamins a and d are unlikely to cause toxicities unless taken in amounts ___________ times greater than the dri. A rectangular field of corn is averaging 125 bu/acre. The field measures 1080 yd by 924 yd. How many bushels of corn will there be? suppose that you need to build as many chairs as possible. each chair requires one seat, one back, and four legs. if you have 12 seats, 15 backs, and 44 legs, which of the chair components limits the number of chairs you can make? legs seats backs how many chairs can you make with the 12 seats, 15 backs, and 44 legs? what chair components will be leftover after making as many chairs as possible? seats and backs legs and backs seats and legs The top-selling Red and Voss tire is rated 60000 miles, which means nothing. In fact, the distance the tires can run until wear-out is a normally distributed random variable with a mean of 72000 miles and a standard deviation of 7000 miles.A. What is the probability that the tire wears out before 60000 miles?Probability = What is the probability that a tire lasts more than 80000 miles? Probability= Find f(x) g(x) if f(x) = x2 7 and g(x) = x2 + 3x + 7 An object has a position function x(t) = 5t m. (a) What is the velocity as a function of time? (b) Graph the position function and the velocity function. Drag each tile to the correct box.Based on the context in these excerpts from Ernest Hemingway's "In Another Country," choose the word that most closely matches the meaning of each bolded word. what is the equation of the line perpendicular to y = 1/2x+1 that contains the point ( - 2 ,1) Industries like cattle ranching, mining, and even farming, though they began small, often ended up being operated by large corporations with access to vast amounts of capital.TrueFalse Paula measured the auditorium and made a scale drawing. The stage, which is 56 feet long in real life, is 84 inches long in the drawing. What scale did Paula use?3 inches= ? feet PLEASE HELP ME. SERIOUSLY. I HAVE 30 MINUTES LEFT.Let D be the dilation with center O and scale factor r>0 so that Dilation (P) = P' andDilation (Q) = Q'.233.8If |OQ|= 10 units, 10Q'] = 15 units, and IP'Q'] = 11.2 units, determine |PQ|. Round youranswer to the tenths place, if necessary.incase you cant see, he right side is P, and below it is P1 Please help if someone knows the answer will mark brainiest!!!A "foil" is a character whose attributes contrast with and therefore accentuate the main character's attributes. In "The Invalid's Story" the storm is a foil to the narrator in that A. Both the storm and the narrator were visibly enraged throughout the story. B. The "bitter storm raged" on while the narrator presented himself as controlled and collected. C. the storm was subtle while the narrator was visibly enraged. Find 8 3/4 1 2/7. Write the answer in simplest form. If I have 10.0g of Mg, what is my theoretical yield of MgCl2