Metallic bonding is sometimes referred to as a "sea of electrons." I sometimes picture is as cheerios (nuclei) floating around in milk (valence electrons). And while metallic bonding has the name "bond" it can be very different from Ionic and Covalent Bonds.
In complete sentences describe how Metallic bonds are alike, and how they are different from the other bond types we have studied.

Answers

Answer 1
They start from that area

Related Questions

6th grade science Major grade plz help ASAP

Answers

Answer: An organism is part of a community

What is the difference between phenol and dettol?​

Answers

Dettol is an antiseptic and disinfectant which can be applied wounds whereas phenol is corrosive and cannot be used for human application. Phenol being corrosive is limited for use as disinfectant on inanimate objects. Dettol is non-corrosive.

What type of circuit has a broken path that does NOT let current flow through it?
A : Closed circuit
B: Open circut
C : Toggle
D : Switch

Answers

Answer:

B

Explanation:

How many particles are in a 34 g sample of Al2(SO4)3?
please help!

Answers

Answer:

5.98 × 10^22 particles

Explanation:

To get the number of particles (nA) in a substance, we multiply the number of moles of the substance by Avogadro's number (6.02 × 10^23)

The mass of Al2(SO4)3 given in this question is as follows: 34grams.

To convert this mass value to moles, we use;

Mole = mass/molar mass

Molar Mass of Al2(SO4)3 = 27(2) + {(32 + 16(4) }3

= 54 + (32 + 64)3

= 54 + 288

= 342g/mol

mole (n) = 34/342

n = 0.0994mol

number of particles (nA) of Al2(SO4)3 = 0.0994 × 6.02 × 10^23

= 0.598 × 10^23

= 5.98 × 10^22 particles

____H3PO4 + ____ KOH --> ______K3PO4 + ____H2O can someone please balance that chemical equation?

Answers

Answer:

H3PO4 + 3KOH ----> K3PO4 + 3H2O

Explanation:

The valency of K element is + 1 while that of PO4 compound is -3

Hence, at least 3 K atoms are needed to combine with PO4 to form K3PO4 compound.

Hence, the revised equation will be

H3PO4 + 3KOH ----> K3PO4 + 3H2O

Now, the number of atoms and charges of each element is a given equation are equal on both the left and right hand side.

A gas has a volume of 10.0 L at 20 degree Celsius. At what temperature does the gas have a volume of 20.0 L ?

Answers

Answer:

286 K

Explanation:

From the question,

Applying Charles law,

V/T = V'/T'.................... Equation 1

Where V = Initial Volume of gas, T = Initial Temperature of gas in Kelvin, V' = Final Volume of gas, T' = Final Temperature of gas in Kelvin

Make T' the subject of the equation

T' = V'T/V.................. Equation 2

Given: V = 10.0 L, V' = 20.0 L, T = 20°C  = (20+273) = 293 K.

Substitute these values into equation 2

T' = (20×293)/10

T' = 586 K

Hence the temperature of the gas is 586 K

number 1 ............​

Answers

Answer:

I am guessing it is B. Non-metal, metals, metalloids

B. Metals, Non-Metals, Metalloids



Metals: located in the South and West of Periodic Table. Tend to give up electrons (form cations) and form simple ionic compounds with non-metal anions. Most of the 118 known elements are metals.


2. Non-Metals : located in the North and East of the Periodic Table. Tend to attract electrons (form anions) and combine with metal cations to make ionics, or share them with other non-metals and form covalent compounds . There are nineteen nonmetals, if we consider the ‘latest” two, which are not well characterized and have fleeting lifetimes.


3. Metalloids: straddle a staircase-like region between metals and non-metals. Their properties are intermediate between metals and non metals (in varying proportions). There are only seven metalloids.


So the answer is B ❤️

PLEASE HELP PLS PLS PLS
Methane, CH4(g), and oxygen gas, O2(g) react to produce carbon dioxide, CO2(g), and water H2O(g). What volume of methane is required to react with oxygen to produce 32.5 L of carbon dioxide? *
a) 65.0 L
b) 48.8 L
c) 16.3 L
d) 32.5 L

Answers

Answer:

D)

Explanation:

CH4 + 2O2 = CO2 + 2H2O

1 (L CO2)= 32.5(L CO2)

1 (CH4) = 32.5 (L CH4)

How are stoichiometric calculations performed for redox reactions?

Answers

Answer:

(b) Both Assertion and Reason are correct but Reason is not the correct explanation for Assertion

Explanation:

According to the law of conservation of mass, matter can neither be created nor be destroyed. However, it can be transformed from one form into another. During chemical reactions, atoms or ions are exchanged between reactants to form products. Thus, all the stoichiometric calculations are based on law of conservation of mass.

During redox reactions, one species is oxidized and other species is reduced. This involves electron transfer.

do weight loss Subliminals work?

Answers

Answer:

Some early research suggests that subliminal messages may influence food- and diet-related thoughts and behaviors. However, other research has found that subliminal messages with weight loss cues have no effect.

Explanation:

you have a square with a Perimeter of 16 in,, what is the Area of the square after scaling it by 5?​
inches

Answers

Answer:

f the figure is a square with a perimeter of 16 inches, then each side of the square is 4 inchest in length. Area is found by multiplying the length x the width. For a square, the length and width are the same. A = 16 sq

Explanation:

Can somebody help me pls pls pls pls pls

Answers

Answer:

1.5e + 24 I think, hope this can help

2 . how many moles are present in a 12.65g of potassium(k)?​

Answers

Answer:

0.324 mol

Explanation:

Mass of one mole or atomic mass of potassium is 39 g. Thus, number of moles in 12.65 g of potassium is 0.32 moles.

What is atomic mass?

Atomic mass of an element is the mass of one mole of that element. One mole of an element contains 6.022 × 10²³ atoms. This  number is called Avogadro number.

Potassium is 19th element n periodic table. It is an alkali metal in the first group. The atomic mass of potassium is 39 g/mol. This is the mass of one mole of potassium. The chemical symbol of potassium is K.

Given  mass of potassium = 12.65 g

atomic mass = 39 g/mol

number of moles in 12.65 g = mass/ atomic mass

no.of moles  = 12.65 /39 = 0.32 moles.

Therefore, the number of moles of 12.65 g of potassium is 0.32 moles.

Find more on atomic mass:

https://brainly.com/question/17067547

#SPJ2

1 How do I make a girl blush?
2 How do I know if I girl might like me by looking at her body language?

Answers

Answer:

1. Make Her Smile with You. Your smile is something which can turn the tables for you, if you possess a nice smile then it is no doubt a plus point for you or flirt with her.

2. She tilts her head while looking at you.

She constantly 'fixes' her hair, makeup, or clothing.

She returns your physical touches.

She stares or looks over at you a lot.

She blushes around you.

Explanation:

What is the temperature

Answers

Answer:

I think it mught be 12.9?

Answer:

the average sum of kinetic energy of all the molecules present in a body is called temperature. it's 12.9

hope it is helpful to you

help me please Iknow it's easy but I need answers asap ​

Answers

Answer:

1-if u are answering light waves question , then the answer is translucent mirror or objects

2- Oxygen

3- compass

Read the temp what is it?

Answers

About 2.4 because there are 9 lines between the numbers

How many moles of ammonia are produced due to the reaction with two moles of nitrogen?

Answers

Answer:

17.03052 mutiple by 2

34.06104grams

Y’all Someone plz help me with these problems.

Girl I will report if u troll or link

Answers

Answer:

A. 650 moles of sulphur.

B. 30 g of FeS₂

Explanation:

The balanced equation for the reaction is given below:

Fe + 2S —> FeS₂

From the balanced equation above,

1 mole of Fe reacted with 2 moles of S to produce 1 mole of FeS₂.

A. Determination of the mole of sulphur needed for the reaction.

From the balanced equation above,

2 moles of S reacted to produce 1 mole of FeS₂.

Therefore, Xmol of S will react to produce 325 moles of FeS₂ i.e

Xmol of S = 2 × 325

Xmol of S = 650 moles

Thus, 650 moles of sulphur are needed for the reaction.

B. Determination of the mass of FeS₂ produced by the reaction of 0.5 mole of sulphur.

From the balanced equation above,

2 moles of S reacted to produce 1 mole of FeS₂.

Therefore, 0.5 mole of S will react to produce = (0.5 × 1)/2 = 0.25 mole of FeS₂.

Finally, we shall determine the mass of 0.25 mole of FeS₂. This can be obtained as follow:

Mole of FeS₂ = 0.25 mole

Molar mass of FeS₂ = 56 + (32×2)

= 56 + 64

= 120 g/mol

Mass of FeS₂ =?

Mass = mole × molar mass

Mass of FeS₂ = 0.25 × 120

Mass of FeS₂ = 30 g

Thus, 30 g of FeS₂ were obtained from the reaction.

Which of the elements shown will form ions, what will be the charges of those ions, and why will they have those charges?

Answers

Answer:

the sodium and chlorine are the form of ion

Explanation:

because sodium have tendency to loose electron it become positive ion and chlorine has tendency to gain electron it becomes negative ion

How many molecules are in 8.2 moles of water,H2o​

Answers

Answer:

4.938×10^24 molecules

Explanation:

a mole is 6.023×10^23

(8.2)×(6.023×10^23)=4.938×10^24

A train with an initial velocity of 31 m/s begins accelerating at rate of 0.0705 m/s^2. If the train travels for 180.5s, how far does it travel?

Answers

Answer:

v = 43.72 m/s

Explanation:

Given that,

Initial velocity of the train, u = 31 m/s

Acceleration of the train, a = 0.0705 m/s²

Time for which the train travel, t = 180.5 s

We need to find the final velocity of the train. Let it is v.. Using first equation of kinematics to find it such that,

[tex]v=u+at\\\\v=31+0.0705\times 180.5\\\\v=43.72\ m/s[/tex]

So the final speed of the train is equal to 43.72m/s.

how atoms form chemical bond discuss in detail

Answers

Answer:

Atoms form chemical bonds to make their outer electron shells more stable. An ionic bond, where one atom essentially donates an electron to another, forms when one atom becomes stable by losing its outer electrons and the other atoms become stable (usually by filling its valence shell) by gaining the electrons.

Using the human species as an example, explain why physical appearance or morphology is NOT always useful for identifying organisms belonging to the same species.

Answers

Answer:

Get SNS

Explanation:

Do you think it is a good idea for all scientists to use the same periodic table of elements? Why or why not?

Answers

Yes because what other else can a scientist have

which system does the endocrine gland influence to fight infections

Answers

Answer:

Thymus. This gland makes white blood cells called T-lymphocytes that fight infection and are crucial as a child's immune system develops

what are the Common compounds of niobium in which it is found

(include common names and their chemical formulas)

plssss help

Answers

Explanation:

Common Compounds of Niobium Nb

[Nb+3, Nb+5]

Compound NameFormulaMolar Mass

Niobium(III) OxideNb2O3233.811

Niobium(III) SulfateNb2(SO4)3474.0006

Niobium(V) PhosphateNb3(PO4)5753.576

Niobium(V) BromideNbBr5492.4264

Niobium(V) PentoxideNb2O5265.8098

Niobium OxychlorideNbOCl3215.2648

Niobium(V) IodideNbI5727.4287

Niobium(V) PentachlorideNbCl5270.1714

Niobium(V) ThiocyanateNb(SCN)5383.3184

Niobium(III) ChlorideNbCl3199.2654

Niobium(V) Dihydrogen PhosphateNb(H2PO4)5577.84259

Niobium NitrideNbN106.9131

Niobium(III) DichromateNb2(Cr2O7)3833.77676

Niobium HydroxideNb(OH)3143.9284

Niobium(V) PerchlorateNb(ClO4)5590.15938

Niobium(V) HypochloriteNb(ClO)5350.16838

Niobium(III) HypochloriteNb(ClO)3247.26358

Niobium(V) CarbonateNb2(CO3)5485.85726

Niobium(III) TartrateNb2(C4H4O6)3630.02564

Niobium(III) ChromateNb2(CrO4)3533.79386

Niobium(V) HexafluorosilicateNb2(SiF6)5896.192356

9. Circle the atom in each pair that has the greater ionization energy.

A) Li or Be
B) Ca or Ba
C) Na or K
D) P or Ar
E) Cl or Si
F) Li or K

Answers

A: BE has more ionization energy than LI

B: CA has more ionization energy than BA.
C: NA has more ionization energy than K

D: AR has more ionization energy than P

E: CI has a more ionization energy than SI
F: LI has more ionization energy than K


If any of these are wrong feel free to correct me in the comments.

A) Be

B) Ca

C) Na

D) Ar

E) Cl

F)  Li

This question simply deals with ionization energy trends across the periodic table or down the group.

Ionization energy is the energy that is needed to remove an electron from its orbital around an atom in such a manner that it will no longer be associated with that same atom.

Now, from studies, it has been found that Ionization energy decreases down a group but it tends to increase as we go from the left to right going across the periodic table.

A) Li(Lithium) and Be(Berrylium) belong to the same period which is period 2 on the periodic table. Berrylium comes after berrylium in that period and as such from the rule earlier, berrylium will have the greater ionization energy.

B) Ca(Calcium) and Ba(Barium) belong to the same group 2 in the periodic table with barium further down the group. Thus, from the trend, Ca(Calcium) will have the greater ionization energy.

C) Na(Sodium) and K(Potassium) belong to the same group 1 in the periodic table with potassium further down the group. Thus, from the trend, Na(Sodium) will have the greater ionization energy.

D) P(Phosphorus) and Ar(Argon) belong to the same period which is period 3 on the periodic table. Argon comes after Phosphorus in that period and as such from the rule earlier, argon will have the greater ionization energy.

E) Cl(Chlorine) and Si(Silicon) belong to the same period which is period 3 on the periodic table. Cl(Chlorine) comes after Si(Silicon) in that period and as such from the rule earlier, Cl(Chlorine) will have the greater ionization energy.

F) Li(Lithium) and K(Potassium) belong to the same group 1 in the periodic table with potassium further down the group. Thus, from the trend,  Li(Lithium) will have the greater ionization energy.

Read more at: brainly.in/question/13610645

Which of the following phases of matter has a fixed volume but not a fixed shape?
A Liquid B Gas C Solid D Plasma

Answers

Answer:

C. solid

Explanation:

Solid is a hard and not able to flow; not like a liquid or gas. Having no holes; not hollow. Something that is not liquid and gas. Solid has fixed volume but not a fixed shape.

The liquid is something that flows freely; a substance that is not solid or gas.

Gas is a substance that neither liquid nor solid, e.g. air.

Plasma is an electrically neutral ionized gas in an electric discharge; distinctly different from solids and liquids and normal gases.

Therefore, the correct answer is C. solid.

Answer:

A. Liquid

Explanation:

the guy above me is wrong

How many milliliters of 0.20 M NaOH must be added to 75 mL of 0.050 M HCl to make a neutral solution?

Answers

Answer:

this should help

Explanation:

Other Questions
Jims father is older than 40 but younger than 50 An ideal gas in a sealed container has an initial volume of 2.80 L. At constant pressure, it is cooled to 18.00 C, where itsfinal volume is 1.75 L. What was the initial temperature?Ti ='c Unit 8 7th grade math In ABC, the measure of the largest angle is 16 less than 4 times the smallest angle. The measure of the middle angle is 7 more than half the measure of the largest angle. What is the measure of the middle angle? Please give me the correct responses.Only answer if you're very good at science/biology.Please don't put links to websites or else I'll report you.Scientists believe Polar Bears have evolved from a group of Brown Bears that became an isolated population during a time when the Earth's climate began cooling down.What are some adaptations that make Polar Bears different from Brown Bears and what do you think caused the adaptations to occur? A number x is rounded to 1 decimal place and its 3.7write down the error interval for x This is the ultimate source of our energy -2y + x +3How many terms are in the expression SHORT ANSWERS:Q.1 List some causes of poor software quality?Q.2 List and explain the types of software testing?Q.3 List the steps to identify the highest priority actions? Q.4. Explain the importance of software quality? A proton travels through uniform magnetic and electric fields. The magnetic field is in the negative x direction and has a magnitude of 2.48 mT. At one instant the velocity of the proton is in the positive y direction and has a magnitude of 1840 m/s. At that instant, what is the magnitude of the net force acting on the proton if the electric field is (a) in the positive z direction and has a magnitude of 5.19 V/m, (b) in the negative z direction and has a magnitude of 5.19 V/m, and (c) in the positive x direction and has a magnitude of 5.19 V/m How many moles of Hydrogen fluoride are formed from 10 moles of fluorine? Can some one wright me a short poem, Then do this Write your breakdown here!Make sure to include these things:What does the poem mean?Are there literal meaning, abstract meanings, or both?What is the theme? Match each type of event with its probability. Unlikely event, 10greater than 0 and less than 0.50.5greater than 0.5 and less than 1Neither likely nor unlikely event likely event A clothing store is having a oneday sale offering 20% off allmerchandise. If Claudia spends$99.84 on the day of the sale,excluding sales tax, what would thepurchase have cost her at full price? 8. Which statement best summarizes the situational irony of thepassage?O A. The daughter is the first to realize there is something wrong with her father.OB. The narrator is a wolf, not human, and the husband is a werewolf.C. The narrator and her family are humans, not wolves.D. The narrator is killed by those whom she loves. PLEASE HELP 3x +2 for x=5Help me Determine the center and radius of the following circle equation:x^2+y^2+12x-10y+12=0 ANYONE IM RUNNING OUT OF TIME!!!!! do yall like/listen to clairo? 10. Using the DNA Code below, create mRNA and the tRNA codes:ACG ACG G C ATTAC AG GTA ACG CC