Question 12
I just want the answer :)

Given the information marked on each figure below, select all classifications that must be true.
Note that each figure is drawn like a rectangle, but you should not rely on the way the figure is drawn in determining your answers.

If necessary, you may learn what the markings on a figure indicate.

Question 12I Just Want The Answer :)Given The Information Marked On Each Figure Below, Select All Classifications

Answers

Answer 1

1. Quadrilateral.

The quadrilateral is not necessarily a parallelogram since the diagonals don't necessarily bisect each other.

2. Rectangle.

The quadrilateral is a parallelogram because there is one pair of congruent and parallel sides.The parallelogram is a rectangle because there is one right angle.

3. Parallelogram.

The quadrilateral is a parallelogram because there is one pair of congruent and parallel sides.

Related Questions

ABCD is a quadrilateral
Work out the length of BC
Give your answer correct to 1 decimal place.

Answers

Using the law of cosines, the length of BC in the given quadrilateral is: 8.1 cm.

What is the Law of Cosines?

The law of cosines that can be used to find the length of a side of a triangle with a known included angle and two sides is:

c² = a² + b² - 2 × a × b × Cos C.

Considering right triangle ABD,

BD = a

DC = b

BC = c

Use the Pythagorean theorem to find the length of BD in the quadrilateral as shown in the diagram:

BD = √(7.5² + 5²)

BD = √(7.5² + 5²)

BD = 9.0 cm

Use the law of cosines to find the length of BC:

BC² = BD² + DC² - 2 × BD × DC × Cos <BDC.

Substitute

BC² = 9.0² + 13² - 2 × 9.0 × 13 × Cos 38

BC² = 250 - 184.4

BC² = 65.6

BC = √65.6

BC = 8.1 cm

Learn more about the law of cosines on:

https://brainly.com/question/4372174

#SPJ1

2,048 rounded to the nearest tenth?

Answers

answer to the question that you have

2,048.0

2050 because

1-9 = ones place

10-99 = tenth place

100-999 = hundrends place

1000 - 999999 - thousands place

and you round to the nearest 0 if it is 5 or up and if it is 1 to 4 it stays the same

The table shows a proportional relationship.


x 12 8 24
y 3 2 6


Describe what the graph of the proportional relationship would look like.
A line passes through the point (0, 0) and continues through the point (3, 12).
A line passes through the point (0, 0) and continues through the point (2, 8).
A line passes through the point (0, 0) and continues through the point (6, 24).
A line passes through the point (0, 0) and continues through the point (12, 3).

Answers

A graph which best describes what the proportional relationship would be D. A line that passes through the point (0, 0) and continues through the point (12, 3).

What is a graph?

In Mathematics, a graph is used to graphically represent data points on both the horizontal and vertical lines of a cartesian coordinate, which are the x-axis and y-axis respectively.

Additionally, a graph which shows a proportional relationship between two variables would always have a straight line with its data points passing through the origin (0, 0).

Since the graph represents a proportional relationship we will get;

Constant of proportionality, we get;

k = 12/3 = 8/2 = 24/6

k = 4

Ratio,

24:6

= 12:3.

Therefore, A line that passes through the point (0, 0) and continues through the point (12, 3).

Read more on graphs here:

brainly.com/question/4546414

#SPJ1

5 (u - 5) + 6u = 8 solve for u and simplifly your answer as much as possible

Answers

Answer:

u = 3

Step-by-step explanation:

Step 1: Distribute 5 in u - 5

[tex]\displaystyle{5\cdot u - 5\cdot 5 +6u=8}\\\\\displaystyle{5u-25+6u=8}[/tex]

Step 2: Add like terms together (u-term)

[tex]\displaystyle{11u-25=8}[/tex]

Step 3: Add both sides by 25

[tex]\displaystyle{11u-25+25=8+25}\\\\\displaystyle{11u=33}[/tex]

Step 4: Divide both sides by 11

[tex]\displaystyle{\dfrac{11u}{11}=\dfrac{33}{11}}\\\\\displaystyle{u=3}[/tex]

Answer Check

Step 1: Substitute u = 3 in the equation

[tex]\displaystyle{5(3-5)+6(3)=8}[/tex]

Step 2: Evaluate & Simplify

[tex]\displaystyle{5(-2)+18=8}\\\\\displaystyle{-10+18=8}\\\\\displaystyle{8=8}[/tex]

Since the equation is true after substituting u = 3. Therefore, the answer is u = 3.

Please let me know if you have any questions!

same as my last two questions

Answers

The intervals to the given function are as follows:

Domain: (-∞,∞).Range: (-∞,∞).Rel. maximums: (1.366, -0.652).Rel. minimums: (-0.366, -5.848) and (2,-1).End behavior: As x -> -∞, f(x) -> ∞, and as x -> ∞, f(x) -> ∞.Inc. intervals: (-0.366, 1.366) U (2, ∞).Dec. intervals: (-∞, -0.366) U (1.366, 2).

Domain and range

Domain: Set of values of the input of the function, hence the values of x in the graph of the function.Range: Set of values of the output of the function, hence the values of y in the graph of the function.

This function is defined(values of x) for all real values and also assumes all real values(values of y), hence both the domain and the range are of the function are given by the interval (-∞,∞).

Increasing and decresing

From the graph, the function is classified as decreasing or increasing according to the direction of movement in the graph, as follows:

Decreasing: Right and down.Increasing: Right and up.

Hence the intervals are given as follows:

Increasing: (-0.366, 1.366) U (2, ∞).Decreasing: (-∞, -0.366) U (1.366, 2).

Relative maximum and relative minimum

The relative minimum is when the graph of the function changes from decreasing to increasing, hence it is at these two following points:

(-0.366, -5.848) and (2,-1).

The relative maximum is when the function changes from increasing to decreasing, hence it is at this following point:

(1.366, -0.652).

End behavior

The end behavior of the function is given by the limits of the function when x go to infinity, looking to the left and to the right of the graph of the function, hence:

Left: Moves up, hence as x -> -∞, f(x) -> ∞.Right: Moves up, hence as x -> ∞, f(x) -> ∞.

More can be learned about functions at https://brainly.com/question/28949511

#SPJ1

ASAP NEED HELP WILL GIVE BRAINLIEST

Answers

The value of the unknown angle x is 22 degrees.

How to find the angle x?

SV is a parallel to RU.

RV is a transversal line that cut across the parallel lines SV and RU.

Therefore,

x = ∠V(alternate angles)

Alternate angles are congruent.

Hence,

∠V + 44 + 5x + 4 = 180 (sum of angles in a triangle)

x + 44 + 5x + 4 = 180

x + 5x + 48  = 180

6x + 48 = 180

6x = 180 - 48

6x = 132

divide both sides by 6

x = 132  /6

x = 22 degrees

learn more on angles here: https://brainly.com/question/10254268

#SPJ1

it usually takes davin 1 3/4 hours to get to his aunt's house . due to labor day traffic this year it took 3 1/5 hours .how much longer did it take this year

Answers

It took David 1 [tex]\frac{3}{4}[/tex] hours more to reach her aunt's home due to labor day traffic.

What is unitary method?

The unitary method is a method in which you find the value of a single unit and then the value of a required number of units.

Given is Davin who needs 1 3/4 hours to get to his aunt's house. However, due to the labor day traffic this year it took him 3 1/5 years.

We have to find the difference between the time span Davin took to reach his aunt's house.

Time taken by Davin without the labor day traffic = T[N] = 1 3/4 = 7/4 hours

Time taken by Davin with the labor day traffic = T[L] = 3 1/5 = 16/5 hours

Difference in time spans = T[D] = T[L] - T[N]

T[D] = 16/5 - 7/4

T[D] = 3.2 - 1.75

T[D] = 1.45 = 1 + 0.45

T[D] = 1 [tex]\frac{3}{4}[/tex] hours  

Davin took 1 [tex]\frac{3}{4}[/tex] hours more.

Therefore, it took David 1 [tex]\frac{3}{4}[/tex] hours more to reach her aunt's home due to labor day traffic.

To solve more questions on unitary method, visit the link below-

https://brainly.com/question/13659834

#SPJ1

equationsWrite a system of equations to describe the situation below, solve using elimination, and fill inche blanks.lada gets paid at home for doing extra chores. Last week, she did 1 load of laundry and 8oads of dishes, and her parents paid her $26. The week before, she finished 3 loads ofaundry and 8 loads of dishes, earning a total of $30. How much does Jada earn forcompleting each type of chore?

Answers

In this problem, we are going to write and solve a system of equations based on a real world situation.

Last week, she did 1 load of laundry and 8 loads of dishes, and her parents paid her $26. The week before, she finished 3 loads of laundry and 8 loads of dishes, earning a total of $30.

To begin, we need to create variables for the unknown cost of each chore.

Let x represent laundry, and let y represent dishes.

From the first equation, we can write the equation:

[tex]x+8y=26[/tex]

We can write the second equation as:

[tex]3x+8y=30[/tex]

Together, we have the system:

[tex]\begin{cases}x+8y={26} \\ 3x+8y={30}\end{cases}[/tex]

Multiply the first equation by -1, then add it to the second equation:

[tex]\begin{gathered} \begin{cases}-1(x+8y={26)} \\ 3x+8y={30}\end{cases} \\ \\ \begin{cases}-x-8y={-26} \\ 3x+8y={30}\end{cases} \\ \\ (-x+3x)+(-8y+8y)=-26+30 \\ 2x=4 \end{gathered}[/tex]

We can divide the remaining equation by 2 on both sides:

[tex]\begin{gathered} \frac{2x}{2}=\frac{4}{2} \\ \\ x=2 \end{gathered}[/tex]

Lada made $2 per load of laundry.

We can use the value of x in the first equation to find the value of y. Substitute x = 2:

[tex]2+8y=26[/tex]

Subtract 2 from both sides:

[tex]8y=24[/tex]

Divide by 8 on both sides:

[tex]y=3[/tex]

Lada made $3 per load of dishes.

How much greater is 8.5 x 10^-2 than 6.6 × 10^-5 ?

Answers

Answer:

1288 times greater

Step-by-step explanation:

(8.5x10^-2)/(6.6x10^-5)

(8.5/6.6)*(10^-2/10^-5)

(1.29)*(10^3)

1288 times greater

Factorise 4x^2+13x-15​

Answers

The factors of the given quadratic equations are [tex]\frac{-13+\sqrt{409} }{8}[/tex] and [tex]\frac{-13-\sqrt{409} }{8}[/tex]

What is factorization?

When we try to write the given equation in terms of linear values from which we calculate the roots of the given equation then we say that we have factorized them. Root of a equation means a value which satisfies a equation.

We are given a quadratic equation

[tex]4x^2+13x-15[/tex]

We use quadratic formula to compute the factor of the equation

[tex]x=\frac{-b}{2a}[/tex]±[tex]\frac{\sqrt{b^2-4ac} }{2a}[/tex]

[tex]x=\frac{-13}{8}[/tex]±[tex]\frac{\sqrt{169+240} }{8}[/tex]

[tex]x=\frac{-13}{8}[/tex]±[tex]\frac{\sqrt{409} }{8}[/tex]

Therefore the factors are [tex]\frac{-13+\sqrt{409} }{8}[/tex] and [tex]\frac{-13-\sqrt{409} }{8}[/tex]

To learn more about factorization please refer

https://brainly.com/question/25829061

#SPJ13

Select the correct answer.
Function g is a transformation of the parent cosine function such that g(x) = 3 cos (x + 2) + 1. Which graph represents function g?

Answers

Option C gives the graph of Function g is a transformation of the parent cosine function such that g(x) = 3 cos(x + 2) + 1 as it the graph of cosine function.

What is cosine function?

The ratio between the adjacent side and the hypotenuse is known as the cosine function (or cos function) in triangles. One of the three primary trigonometric functions, cosine is the complement of sine (co+sine) and one of the three main trigonometric functions.

What is Graph?

A graph is a structure that resembles a set of objects in mathematics, more specifically in graph theory, in which some pairs of the objects are conceptually "related." The objects are represented by mathematical abstractions known as vertices, and each pair of connected vertices is referred to as an edge.

Choice C provides a graph of the parent cosine function is transformed into function g such that g(x) = 3 cos(x + 2) + 1 on the cosine function graph.

To know more about graph,

https://brainly.com/question/17267403?referrer=searchResults

#SPJ13

Answer:

see photo

be sure to look closely, the top curves go to 4 and the bottom goes to -2, there are 2 with this same shape but the other one does not go high enough.

Step-by-step explanation:

Plato/Edmentum

can you show how to solve this proplem

Answers

In the given figure : lines l and m are parallel and a, b are transversal

Since, the lines a and b are parallel and l act as a transversal.

Then,

[tex]\begin{gathered} \angle BAC=\angle ACb\text{ (alternate interior angles)} \\ \text{ Substitute the values} \\ 2x=46 \\ x=\frac{46}{2} \\ x=23 \end{gathered}[/tex]

x = 23

Answer : x = 23

Triangle TAB has a perimeter of 40 cmeters. Could the measures of the sides as shown actually represent the measures of the sides of the triangle? Justify your answer.

Answers

EXPLANATION

We can apply the Obtuse Triangle Theorem to check if the the measures of the sides appropiately represents the measures of the triangle:

Perimeter = 40 cm = 4x + 2x + 2 + x + 3

Adding like terms:

40 = 7x + 5

Subtracting 5 to both sides:

40 - 5 = 7x

Adding like terms:

35 = 7x

Dividing both sides by 7:

35/7 = x

Simplifying:

[tex]5=x[/tex]

Then, by the obtuse triangle theorem, the following relationship should be fulfilled.

The manager at the local auto shop has found that the probability that a car brought into the shop requires an oil change is 0.68, the probability that a car brought into the shop requires brake repair is 0.32, and the probability that a car requiresboth anoil change and brake repair is 0.11. For a car brought into the shop, determine the probability that the car will require an oil change or brake repair.The probability that the car requires an oil change or brake repair is

Answers

Remember that

P(A or B)=P(A)+P(B)-P(A and B)

In this problem, we have that

Event A and Event B are not independent

we have

P(A)=0.68

P(B)=0.32

P(A and B)=0.11

substitute

P(A or B)=0.68+0.32-0.11

P(A or B)=0.89

The answer is 0.89


Write an explicit formula for an, the nth term of the sequence
64, -16, 4,....

Answers

The formula for the given arithmetic series for the term aₙ will be aₙ=a₁+(n-1)d.

What is arithmetic series?An arithmetic series is the sum of a sequence like 2,..., where each term is calculated by adding (or subtracting) a constant from the previous one. An ordered group of numbers with a shared difference between each succeeding term is known as an arithmetic sequence. For instance, the common difference in the arithmetic series 3, 9, 15, 21, and 27 is 6.

So, the possible sequence of -64, -16, 4:

We can notice the sequence as -(4³), -(4²), 4, 4², 4³.

So, the formula for the aₙ term will be:

aₙ = a₁ + (n - 1)d

Therefore, the formula for the given arithmetic series for the term aₙ will be aₙ = a₁ + (n - 1)d.

Know more about arithmetic series here:

https://brainly.com/question/6561461

#SPJ13

The correct question is given below:

Write an explicit formula for an, the nth term of the sequence

-64, -16, 4,....

Which number line and equation show how to find the distance from -2 to 5? O O A. 1-2-(-5) 2 3 12-1-5) sing O c. 1-2-5 D. 2-5

Answers

To find the distance between two numbers on the number line, you have tu use absolute value

So, if I want to know the distance from -2 to 5, all I have to do is to substract 5 from -2 and then apply absolute value, like this:

[tex]\mleft|-2-5\mright|\text{ = }\mleft|-7\mright|\text{ = 7}[/tex]

And the number line should look like this:

given the domain {-2,2,4} what is the range for relation 3x+y=3a (-9,3,9)b (9,-3,-9)c (-3,9,15)d (0,5,7)

Answers

the relation is 3x + y = 3

so,

y = 3x - 3

the domain is the values of x

so, substitute with each value of {-2,2,4} at the last equation of y

when x = -2 , y = 3*-2 - 3 = -6 - 3 = -9

when x = 2 , y = 3 * 2 - 3 = 6 - 3 = 3

when x = 4 , y = 3 * 4 - 3 = 12 - 3 = 9

so, the range will be {-9 , 3 , 9}

The correct answer is option a. (-9,3,9)x

How to solve? Please help i will give good rating.​

Answers

Answer:

6.  Draw a vertical line that goes though points (4,7) and (4,9).  For a relation to be a function, each input has to have only one output.  The input 4 cannot have the output of 7 and 9.  This proves that this is not a function

7. The range is 91, 3, 6, 10 and 15)

Step-by-step explanation:

The range is the answer if you put in the x for range that they give you.

For example:

x ( x+ 1)/2  If I put in 1 for x, I will get

1(1+1)/2

2/2

1

When the input is 1, the output is one.  You that for each of the domains given and you will find the ranges (outputs) that I have written above.

m(x) = | x + 1 |
Graph

Answers

The value of x = 1/M-1 , x = -1/M+1

What is Graph?

The graph of a function f is the set of ordered pairs where "displaystyle f(x)=y" exists. In the common scenario when x and f(x) are real integers, these pairings represent Cartesian coordinates of points in two-dimensional space and hence constitute a subset of this plane.

M(x) = |x + 1|

|x + 1| = M(x)

x + 1 = M(x)

x + 1 = -M(x)

Adding (-x) both side

x + 1 + (- x) = M(x) + (- x)

x + 1 + (- x) = -M(x) + (- x)

x + 1 - x = M(x) - x

x + 1 - x = -M(x) - x

1 = M(x) - x

1  = -M(x) - x

M(x) - x = 1

-M(x) - x  = 1

x(M-1)  = 1

x(-M-1)  = 1

Dividing both side with (M - 1) and (-M - 1)

x(M-1)/(M - 1)   = 1/(M - 1)

x(-M-1)/(-M - 1)  = 1 /(-M - 1)

x = 1/(M - 1)

x = 1/(-M - 1)

Hence, x = 1/M-1 , x = -1/M+1

To learn more about Graph click on the link

https://brainly.com/question/4025726

#SPJ9

The image of the point (1, 1) under a translation is (0, 3). Find the coordinates of the image of the point (-4, "-1) under the same translation.

Answers

The image of the point (-4, -1) after the translation is:

(-3, 1)

How to identify the translation?

A translation:

Tᵃ'ᵇ applied to a point (x, y) gives:

Tᵃ'ᵇ(x, y) = (x + a, y + b).

In this case, we know that:

Tᵃᵇ(1, 1) = (1 + a, 1 + b) = (0, 3)

Then:

1 + a = 0

1 + b = 3

Solving these we get:

a = 1

b = 3 - 1 = 2

The translation is:

T¹'²

Applying this to the point (-4, -1) gives:

T¹'²(-4, -1) = (-4 + 1, -1 + 2) = (-3, 1)

Learn more about translations:

https://brainly.com/question/24850937

#SPJ1

Given h(t) = –16t2 + 32t + 5, what is the value of h(2)? *Type in your answer. h(2) =

Answers

The value of the function h(2) for h(t) = -16t2 + 32t + 5 is h(2) = 5

How to determine the function value?

From the question, the function definition is given as

h(t) = -16t2 + 32t + 5

First, we express the exponent in the function properly

This is represented as

h(t) = -16t² + 32t + 5

The function value to calculate is given as

h(2)

This means that we calculate h(t) when t = 2

So, we have

h(2) = -16(2)² + 32(2) + 5

Evaluate the exponents

h(2) = -16(4) + 32(2) + 5

So, we have

h(2) = 5

Hence, the function value is 5

Read more about functions at

https://brainly.com/question/28532394

#SPJ1

PLSS HELP I NEED ASAP

Answers

Answer:

m = -5

n = -2

Step-by-step explanation:

5m + 6n = -37

10m + 4n = -58 multiply first equation by -2

-2 × 5m + 6n = -37

-10m + (-12n) = 74 now add two equations up

10m - 10m + 4n - 12n = 74 - 58 add/ subtract like terms

-8n = 16 divide both sides by -8

n = -2

to find the value of m, replace n with -2 in the first equation

5m + 6*(-2) = -37

5m - 12 = -37 add 12 to both sides

5m = -25 divide both sides by 5

m = -5

Which is the better buy? 2-gallon container of laundry detergent for $23.36. or 17-cup container of laundry detergent for $20.06

Answers

we gotta know the conversion between cups and gallons

We know

1 cup (US) = 0.0625 gallons

So, 2 gallon would be 2/0.0625 = 32 cups

So, the problem in cups is:

32 cups = $23.36

17 cups = $20.06

Definitely 32 cups for 23.36 is better buy

2 gallons for $23.36 is the better buy

Note:

23.36/32 = $0.73 per cup

20.06/17 = $1.18 per cup

a train increased its prices from £663 to £895.05 how much has this increased in a percentage

Answers

Answer:

The price has increased 35%

Step-by-step explanation:

Given

Initial price = £663,New price = £895.05.

Find the percent increase

Find the amount of increase:

£895.05  - £663 = £232.05

Find the percent value of the increase over the initial price:

232.05/663 × 100% = 35%

What is 1 1/4 Divided by 10

Answers

Answer: 0.125

Step-by-step explanation:

1 1/4 is equal to 5/4

5/4 is equal to 1.25

then you would do 1.25 divided by 10

once you do that you would get your answer of 0.125!

Answer:

11/4÷10 =

11/4 ×1/10=

11/40=

0.275

Step-by-step explanation:

you can ask questions for clarification

Ten bags of oranges were sold to a family of eight.each family member ate six oranges, what fraction of the oranges were eaten?

Answers

The fraction of oranges eaten by the family is 3/5

Given,

Number of oranges in a bag = 8 oranges

Number of bags sold to a family = 10 bags

Number of members in the family = 6 members

Number oranges ate by each member of the family = 6 oranges

We have to find the fraction of the oranges eaten by the family members;

Here,

8 oranges in 1 bag and 10 bags sold.

So, total number of oranges sold = 8 x 10 = 80 oranges

Each member ate 6 oranges and there are 8 members.

So, total number of oranges eaten by them = 6 x 8 = 48 oranges

Now,

The fraction of oranges eaten by the family = 48/80 = 6/10 = 3/5

That is,

3/5th of oranges were eaten by the family.

Learn more about fraction of oranges here;

https://brainly.com/question/3352145

#SPJ1

Suppose a golf ball bounces off a wall at a point P, and that
line mis perpendicular to the wall at point P.
What is the measure of the angle of reflection?
A. 50°
B. 40°
C. 140°
D. 90°

Answers

40 degrees because reflection is is the same like a mirror

Question 2 of 10
Multiply the following complex numbers:
(4-6) (6-8)
OA. -24-68i
OB. 72 +68i
O C. -24 +68/
OD. 72-68i

Answers

-24-68i is solution of complex number.

What is the best definition of a complex number?

Complex numbers are those that are expressed as a+ib, where a, b are actual numbers, and I is a fictitious number termed a "iota."Real and imaginary components are split into two separate numbers, which are referred to as complex numbers. The foundation of more complex mathematics, like algebra, are complex numbers. They have numerous practical applications, particularly in the fields of electronics and electromagnetism.

(4-6i)(6-8i)

= 24-32i-36i+48i²

= 24 + -68i - 48

= -24-68i

Learn more about Complex numbers

brainly.com/question/20566728

#SPJ13

The complete question is -

Multiply the following complex numbers (4-6i)(6-8i)

5. Identify whether each unit measures length, volume, or weight (or mass).
1.
Mile
Cup.
Pound
Centimeter
2.
3.
4.
5.
Liter
6.
Gram
7.
Pint
8.
Yard
9. Kilogram
10. Teaspoon,
11. Milliliter

Answers

Answer:

See below

Step-by-step explanation:

Length (L), volume (V), weight(W), or mass(M)

Mile     L

Cup           V

Pound   W

Centimeter L

Liter     V

Gram   M

Pint           V

Yard   L

Kilogram   M

Teaspoon  V

Milliliter    V

1. Mile

2. Cup

3. Pound

4. Centimeter

5. Liter

6. Gram

7. Pint

8. Yard

9. Kilogram

10. Teaspoon,

11. Milliliter

Evaluate cos 150° without using a calculator.Ο Α.√32B. 2O C. -1/2OD. -32

Answers

Answer:

Explanation:

Note that:

[tex]\begin{gathered} cos(A+B)=cosAcosB-sinAsinB \\ cos(150^0)=cos(90+60) \end{gathered}[/tex]

Applying the addition formula given above to cos 150:

[tex]\begin{gathered} cos(150)=cos(90)cos(60)-sin(90)sin(60) \\ \\ cos(150)=0(\frac{1}{2})-1(\frac{\sqrt{3}}{2}) \\ \\ cos(150)=0-\frac{\sqrt{3}}{2} \\ \\ cos \end{gathered}[/tex]

Other Questions
23 4u < 11 what is the answer let f ( x ) = 6356 x + 5095 . Use interval notation. Many answers are possible. in the experiment of the preceding exercise, the subjects were randomly assigned to the different treatments. what is the most important reason for this random assignment? What are gray matter and white matter, and where are they found? Paraphrase what Juliet says in lines 116-24. Even though I'm happy to be with _______, I have no joy of what's happening ______. It is too ______ and ________. It's like ___________, which stops existing as soon as you can ________ __________. which methods correctly solve for the variable x in the equation 2/5m = 8? Why were the Ouendat important to the fur trade with Europeans?O They were the first Northwest Indigenous group to have contact with Europeans.O They traded furs with Russians on the coast of Alaska.O They began supplying furs to the French in the early 1600s.O They had land stolen from them where Fort Astoria was built. octavius wants to write the equation of a line perpendicular to y=-4x + 5 that passes through the point (8,-3). Describe the mistake octavius made and write the correct equation of the line. 3(4x+1)^2-5=25 using square root property NO LINKS!! Please help me with this problem O DESCRIPTIVE STATISTICInterpreting relative frequency-histogramsStudents at a major university in Southern California are complaining about a serious housing crunch. Many of the university's students, they complain, have tocommute too far to school because there is not enough housing near campus. The university officials' response is to perform a study. The study, reported in theschool newspaper, contains the following histogram summarizing the commute distances for a sample of 100 students at the university:Relative frequencyCommute distance (in miles)Based on the histogram, find the proportion of commute distances in the sample that are at least 16 miles. Write your answer as a decimal, and do not roundyour answer Two drops of mercury each has a charge on 5.44 nC and a voltage of 235.15 V. If the two drops are merged into one drop, what is the voltage on this drop? suppose that the antenna lengths of woodlice are approximately normally distributed with a mean of inches and a standard deviation of inches. what proportion of woodlice have antenna lengths that are more than inches? round your answer to at least four decimal places. g stock e is expected to pay a dividend of $1.78 one year from today. at that time, the price of stock e is expected to be $92. today, stock e's expected return is 8%, and it is overpriced by $6.33. calculate stock e's required return Solve for w.4w-24w=0If there is more than one solution, separate them with commas.If there is no solution, click on "No solution".W =0U08Nosolution Need help determining if h. F(x)= 3^x is even, odd or neither In planning her retirement, Liza deposits some money at 4.5% interest, with twice as much deposited at 5%. Find the amount deposited at each rate if the total annual interest income is $1595. What is meant by differemtial outcomes in regards to Diversity-validity dilema A compound conducts electricity in the solid state and does not dissolve in water. It isshiny and malleable. What type of bonding does it likely have?b. Ionicc. metallica.Covalent 3. What are your specific responsibilities for making travel arrangements? How much of the booking information takes placeonline?