the area of coil is 48,6 and 200 windings is
rotated clockwise in a constant in magnetic field of magnitude 2,4T
The graph below shows how the induced emf varies with the inverse of time. E 9.1 9.2 (V) 3 2 1 0 1 2 3 1 At State Faraday's law in words. Use the information in the graph to calculate the change in magnetic flux. (2) ​

Answers

Answer 1

Answer: The magnitude of the change is 27.6 Vs.

Explanation:

To calculate the change in magnetic flux, we can use the formula:

emf = -dΦ/dt

where emf is the induced emf, Φ is the magnetic flux through the coil, and t is time.

we can see that the induced emf is 0 V when the inverse of time is 0. We can also see that the maximum induced emf is 9.2 V when the inverse of time is 1. Therefore, the change in emf is:

Δemf = 9.2 V - 0 V = 9.2 V

To convert this to the change in magnetic flux, we need to rearrange the formula:

dΦ = -emf/dt

The time interval between the two points on the graph is 1/3 s (since the inverse of time is 1 at the vertical line). Therefore:

dΦ = -(9.2 V)/(1/3 s) = -27.6 Vs

Since the change in magnetic flux is negative, this means that the flux is decreasing. The magnitude of the change is 27.6 Vs.

is this correct??


Related Questions

a certain rifle bullet has a mass of 8.37 g. calculate the de broglie wavelength of the bullet traveling at 1793 miles per hour.

Answers

The de Broglie wavelength of the bullet traveling at 1793 miles per hour is approximately 9.90 x 10^-37 meters.

To calculate the de Broglie wavelength of the rifle bullet, we can use the formula:

λ = h / p

where λ is the de Broglie wavelength, h is the Planck constant (6.626 x 10^-34 J*s), and p is the momentum of the bullet. To find the momentum of the bullet, we can use the formula:

p = m * v

where m is the mass of the bullet (8.37 g = 0.00837 kg) and v is the velocity of the bullet in meters per second. First, we need to convert the velocity of the bullet from miles per hour to meters per second:

1793 miles/hour * 1609.34 meters/mile / 3600 seconds/hour = 800.1 meters/second

Now we can calculate the momentum of the bullet:

p = 0.00837 kg * 800.1 m/s = 6.703 k g m / s

Finally, we can use the momentum to calculate the de Broglie wavelength:

λ = 6.626 x 10^-34 J*s / 6.703 kg m/s = 9.90 x 10^-37 meters

Therefore, the de Broglie wavelength is approximately 9.90 x 10^-37 meters.

For more such questions on De Broglie wavelength.

https://brainly.com/question/11552854#

#SPJ11

a hair drier uses 8 a at 114 v. it is used with a transformer in england, where the line voltage is 237 v. what should be the ratio of the turns of the transformer (primary to secondary)?

Answers

To determine the ratio of turns of the transformer, we can use the principle of conservation of power, which states that power in equals power out in an ideal transformer.

The power input to the hair dryer is:

P = VI = (8 A)(114 V) = 912 W

The power output of the transformer should be the same as the input power, so we can use this equation to find the current in the secondary circuit:

P = VI = (I_s)(237 V)

where I_s is the current in the secondary circuit. Solving for I_s, we get:

I_s = P/V_s = (912 W)/(237 V) = 3.85 A

Now we can use the turns ratio equation to find the ratio of the turns in the transformer:

N_p/N_s = V_p/V_s = (114 V)/(237 V)

where N_p and N_s are the number of turns in the primary and secondary coils, respectively. Solving for N_p/N_s, we get:

N_p/N_s = 0.481

Therefore, the ratio of turns in the transformer should be approximately 0.481.

To know more about conservation of power :

https://brainly.com/question/9013890

#SPJ11

A disk of radius R = 7. 52 cm is centered at the origin and lies along the y – z plane. The disk has a surface charge density σ = 5. 88 × 10 − 6 C / m 2. Evaluate the electric field produced by this disk along the x axis at point (P = 1. 01 m, 0. 00 m). The Coulomb force constant k = 1 / ( 4 π ϵ 0 ) = 8. 99 × 10 9 N ⋅ m 2 / C 2

Answers

The electric field produced by the disk at point P along the x-axis is approximately 333.89 N/C.

Since the disk lies in the y-z plane, the electric field produced by the disk will only have an x-component, which can be calculated using the formula for the electric field produced by a charged disk:

E = σ / (2ε₀) * [1 - (z / √(R² + z²))]

At point P(1.01 m, 0.00 m), the distance from the disk along the z-axis is z = 0, so the formula reduces to:

E = σ / (2ε₀) = (5.88 × 10^-6 C/m²) / (2 * 8.85 × 10^-12 F/m) ≈ 333.89 N/C

Therefore, the electric field produced by the disk is 333.89 N/C.

To know more about electric field , here

brainly.com/question/15800304

#SPJ4

a 3.0 m long rigid beam with a mass of 100 kg is supported at each end. an 80 kg student stands 2.0 m from support 1. how much upward force does each support exert on the beam?

Answers

Answer:

[tex]752.1\; {\rm N}[/tex] from support [tex]\texttt{1}[/tex] ([tex]2.0\; {\rm m}[/tex] from the student.)

[tex]1013.7\; {\rm N}[/tex] from support [tex]\texttt{2}[/tex] ([tex]1.0\; {\rm m}[/tex] from the student.)

(Assuming that [tex]g = 9.81\; {\rm N\cdot kg^{-1}}[/tex], the beam is level with negligible height, and that the density of the beam is uniform.)

Explanation:

Weight of the beam: [tex](100\; {\rm kg})\, (9.81\; {\rm N\cdot kg^{-1}}) = 981\; {\rm N}[/tex].

Weight of the student: [tex](80\; {\rm kg})\, (9.81\; {\rm N\cdot kg^{-1}}) = 784.8\; {\rm N}[/tex].

Assuming that the beam is uniform. The center of mass of the beam will be [tex](1/2)\, (3.0\; {\rm m}) = 1.5\; {\rm m}[/tex] away from each support.

Consider support [tex]\texttt{1}[/tex] as the fulcrum:

For support [tex]\texttt{2}[/tex] (with an upward force of [tex]N_{\texttt{2}}[/tex]), the lever arm is [tex]3.0\; {\rm m}[/tex].For the center of mass of the beam ([tex]981\; {\rm N}[/tex]), the lever arm is [tex]1.5\; {\rm m}[/tex].For the weight of the student ([tex]784.8\; {\rm N}[/tex]), the lever arm is [tex]2.0\; {\rm m}[/tex].

Hence:

[tex]\begin{aligned}N_{\texttt{2}}\, (3.0) = (981)\, (1.5) + (784.8) \, (2.0) \end{aligned}[/tex].

[tex]\begin{aligned}N_{\texttt{2}} &= \frac{(981)\, (1.5) + (784.8) \, (2.0)}{3.0} \; {\rm N} = 1013.7\; {\rm N}\end{aligned}[/tex].

In other words, support [tex]\texttt{2}[/tex] would exert an upward force of [tex]1013.7\; {\rm N}[/tex] on the beam.

Similarly, consider support [tex]\texttt{2}[/tex] as the fulcrum:

For support [tex]\texttt{1}[/tex] (with an upward force of [tex]N_{\texttt{1}}[/tex]), the lever arm is [tex]3.0\; {\rm m}[/tex].For the center of mass of the beam ([tex]981\; {\rm N}[/tex]), the lever arm is [tex]1.5\; {\rm m}[/tex].For the weight of the student ([tex]784.8\; {\rm N}[/tex]), the lever arm is [tex](3.0 - 2.0)\; {\rm m} = 1.0\; {\rm m}[/tex].

Hence:

[tex]\begin{aligned}N_{\texttt{1}}\, (3.0) = (981)\, (1.5) + (784.8) \, (1.0) \end{aligned}[/tex].

[tex]\begin{aligned}N_{\texttt{1}} &= \frac{(981)\, (1.5) + (784.8) \, (1.0)}{3.0} \; {\rm N} =752.1\; {\rm N}\end{aligned}[/tex].

In other words, support [tex]\texttt{1}[/tex] would exert an upward force of [tex]752.1\; {\rm N}[/tex] on the beam.

a piece of wood is has a density of 0.600 g/cm3. when dipped in water, what fraction of the wood is submerged inside water? (give answer to 3 significant figures)

Answers

To determine the fraction of the wood submerged in water, we need to compare the density of the wood to the density of water.

The density of water is 1.000 g/cm3 at standard temperature and pressure.

If the wood has a density of 0.600 g/cm3, it is less dense than water, which means it will float on water.

To determine the fraction of the wood submerged in water, we can use the following formula:

fraction submerged = (volume submerged) / (total volume)

Since the wood floats on water, the volume of water displaced by the wood is equal to the volume of the submerged portion of the wood.

The total volume of the wood is equal to its mass divided by its density:

total volume = mass / density

We don't have the mass of the wood, but we can use any arbitrary value to determine the fraction submerged.

Let's assume the wood has a mass of 100 g.

total volume = mass / density = 100 g / 0.600 g/cm3 = 166.67 cm3

Now, let's assume that when the wood is submerged in water, it displaces 80 cm3 of water.

fraction submerged = (volume submerged) / (total volume) = 80 cm3 / 166.67 cm3 = 0.48

Therefore, approximately 48% of the wood is submerged in water.

To know more about fraction visit link :

https://brainly.com/question/31215473

#SPJ11

earth's strong magnetic field indicates that the core is made of iron because the material in the core would have to be

Answers

Earth's strong magnetic field indicates that its core is made of iron due to several factors.

Firstly, iron is a highly magnetic material that can generate a significant magnetic field when it's in motion. In the Earth's core, the liquid outer core, which consists primarily of molten iron, flows around the solid inner core, also largely composed of iron.

This motion creates a self-sustaining dynamo effect, resulting in the generation of the Earth's magnetic field.

Secondly, the Earth's density distribution supports the presence of iron in the core.

The high density of the core, measured through seismic data, can only be explained if it's composed of heavy elements such as iron, combined with some lighter elements like nickel and sulfur.

In conclusion, the presence of iron in the Earth's core is supported by the strong magnetic field and the density distribution of our planet.

The molten iron in the outer core and the solid iron in the inner core plays a crucial role in generating and maintaining the Earth's magnetic field.

For more such answers on Magnetic Field

https://brainly.com/question/2950693

#SPJ11

A nurse is caring for a client who is in labor and has an epidural anesthesia block. The client's blood pressure is 80/40 mmHg and the fetal heart rate is 140/min. Which of the followign is the priority nursing action?
A. Elevate the client's legs.
B. Monitor vital signs every 5 min.
C. Notify the provider.
D. Place the client in a lateral position.

Answers

The priority nursing action in this scenario would be to notify the provider.

An epidural anesthesia block can cause a drop in blood pressure in the mother, which can in turn affect the fetal heart rate.

A blood pressure reading of 80/40 mmHg is considered low, and can indicate hypotension.

Hypotension can lead to decreased blood flow to the placenta and fetus, which can result in fetal distress.

Therefore, it is important for the provider to be notified of the low blood pressure reading and fetal heart rate, so that appropriate interventions can be implemented to address the situation.

The provider may choose to adjust the dosage of the epidural anesthesia, administer IV fluids, or consider other measures to stabilize the mother's blood pressure and fetal well-being.

While monitoring vital signs and positioning the client can also be important interventions, they are not the priority in this scenario.

Elevating the client's legs may help to increase blood flow to the heart and improve blood pressure, and placing the client in a lateral position may also help to improve blood flow and prevent supine hypotensive syndrome.

These actions should be taken after the provider has been notified and appropriate interventions have been implemented.

To know more about  epidural anesthesia visit link :

https://brainly.com/question/14205576

#SPJ11

how fast is moving light that has traveled through transparent glass and exited on the opposite side with respect to the incoming speed?

Answers

The light that has traveled through transparent glass and exited on the opposite side will move at the same speed as it was moving before entering the glass, but it would have traveled slower while inside the glass.

The speed of light changes when it travels through a transparent medium like glass. The speed of light in vacuum or air is approximately 299,792,458 meters per second (often rounded to 3.00 x 10⁸ m/s), but it slows down when it passes through a medium like glass. The amount of slowing down depends on the refractive index of the material, which is a measure of how much the speed of light is reduced as it passes through the material.

For typical glasses, the refractive index is around 1.5, which means that the speed of light is reduced by a factor of about 1.5 when it passes through the glass. So, if the speed of light in vacuum or air is taken as 1, the speed of light in glass would be approximately 2/3 (or 0.67) of its original speed.

When the light exits the glass on the opposite side, it returns to its original speed in air or vacuum. Therefore, the light exits the glass with the same speed it had before it entered the glass, as long as it is not absorbed or scattered by the glass.

Learn more about the refractive index:

https://brainly.com/question/83184

#SPJ11

at what rate is energy being dissipated as joule heat in the resistor after an elapsed time equal to the time constant of the circuit? answer in units of w.

Answers

The rate at which energy is being dissipated as Joule heat in a resistor can be calculated using the formula [tex]P=I^2R[/tex], and after an elapsed time equal to the time constant of the circuit, the power dissipated by the resistor can be given by [tex]P=0.4I^2 \times R[/tex].

The rate at which energy is being dissipated as Joule heat in a resistor is equal to the power dissipated by the resistor, which can be calculated using the formula [tex]P=0.4I^2\times R[/tex], where P is the power dissipated in watts, I is the current flowing through the resistor in amperes, and R is the resistance of the resistor in ohms.

After an elapsed time equal to the time constant of the circuit, the current flowing through the circuit will have reached approximately 63.2% of its maximum value. This is because the time constant of a circuit is equal to the product of the resistance and the capacitance, and it represents the amount of time it takes for the current in the circuit to reach 63.2% of its maximum value.

At this point, the power dissipated by the resistor can be calculated using the formula [tex]P=0.4I^2 \times R[/tex]. Since the current is 63.2% of its maximum value, we can substitute 0.632I for I in the formula. Therefore, the power dissipated by the resistor at this point is:

P = (0.632*I)^2 * R

= [tex]P=0.4I^2 \times R[/tex]

where I is the maximum current that will flow through the circuit, and R is the resistance of the resistor in ohms.

The rate at which energy is being dissipated as Joule heat in the resistor is equal to the power dissipated by the resistor, which is given by the above equation. Therefore, the answer to the question is:

Rate of energy dissipation = [tex]P=0.4I^2 \times R[/tex] watts

where I is the maximum current that will flow through the circuit, and R is the resistance of the resistor in ohms.

To learn more about resistors

https://brainly.com/question/24297401

#SPJ4

consider example 3.9 on page 87. suppose that the dog runs at a speed of 7.0 m/s. how far does the dog travel horizontally from the edge of the dock before splashing down?

Answers

The dog travels 2.1 meters horizontally from the edge of the dock before splashing down.

When dog runs at speed 7.0m/s,how far he reached the edge of the dock before splashing down?

We know that the distance the dog travels horizontally before splashing down is equal to the product of the time in the air and the horizontal velocity of the dog.

Using the equation: distance = velocity x time

We can first solve for the time in the air.

The initial vertical velocity of the dog is zero, and we can use the equation:

distance = 1/2 x acceleration x time⁻²

to find the time it takes for the dog to fall from the edge of the dock to the water.

Assuming a gravitational acceleration of 9.8 m/s⁻², we get:

distance = 1/2 x 9.8 m/s⁻² x time⁻²

0.91 meters = 4.9 x time⁻²

time = sqrt(0.91 / 4.9) = 0.3 seconds

Now that we know the time in the air, we can find the horizontal distance traveled by the dog before splashing down.

Using the equation:

distance = velocity x time

where velocity is the horizontal velocity of the dog, which we know is 7.0 m/s, we get:

distance = 7.0 m/s x 0.3 s = 2.1 meters

The dog travels 2.1 meters horizontally from the edge of the dock before splashing down.

Learn more about Speed and splashing down

brainly.com/question/14575052

#SPJ11

which force pairs must be equal because they are action/reaction pairs?multiple select question.the upward normal force on a car and the downward push of the car on the ground.the rightward force of a pull on a box traveling at constant velocity and the leftward friction force.the upward normal force on a book at rest on the table and its downward weight.the rightward force of you pushing on a wall and the leftward force of the wall pushing on you.

Answers

Force pairs that must be equal because they are action/reaction pairs. According to Newton's Third Law of Motion, for every action, there is an equal and opposite reaction. This means that action and reaction forces are always equal in magnitude but opposite in direction.

Some examples of action/reaction force pairs include:
1. When you push a book across a table (action), the book pushes back with an equal force (reaction).
2. When a person jumps off a diving board (action), the diving board exerts an equal and opposite force on the person (reaction).
3. A person walking on the ground pushes against the ground (action), and the ground pushes back with an equal force (reaction).

In all these cases, the action/reaction force pairs are equal and opposite, illustrating Newton's Third Law of Motion.

To know more about Newton's Third Law of Motion:

https://brainly.com/question/29768600

#SPJ11

5 of 225 of 22 Items
12:41







Question
The basic concept of how a simple motor works is explained by which statement?

Answers

Answer:

The basic concept of how a simple motor works is that you put electricity into it at one end and an axle (metal rod) rotates at the other end giving you the power to drive a machine of some kind. The simple motors you see explained in science books are based on a piece of wire bent into a rectangular loop, which is suspended between the poles of a magnet. In order for a motor to run on AC, it requires two winding magnets that don’t touch. They move the motor through a phenomenon known as induction.

I hope this helps! Let me know if I'm wrong!

Explanation:

Newton's first law of motion states that an object in motion will stay in motion unless acted upon by a force.

What are two forces on earth that could change the motion of the object?

Responses

friction and gravity
friction and gravity

speed and acceleration

heat and light

direction and time

Answers

The two forces on Earth that could change the motion of an object are friction and gravity.

Friction is a force that opposes the motion of an object when it is in contact with another surface. It can cause an object to slow down or come to a stop.

Gravity is a force of attraction between two objects, and it can cause an object to accelerate toward the center of the earth or towards another massive object. The gravitational force on an object depends on its mass and the distance between it and the other object.

Speed and acceleration are not forces, but rather measures of motion. Heat and light are also not forces that can change the motion of an object, but rather forms of energy that can be transferred to an object and affect its temperature or behavior. Direction and time are not forces, but concepts related to an object's motion.

Learn More about Newton's first law of motion:

https://brainly.com/question/1222214

describe the relationship between the angle of incoming light and the percentage of light that is transmitted through the water versus the percentage of light that is reflected

Answers

The angle of incoming light plays a significant role in determining the percentage of light that is transmitted through water versus the percentage of light that is reflected. As the angle of incidence of light increases, the amount of light that is transmitted through the water decreases, while the amount of light that is reflected off the surface of the water increases.

This is due to the fact that at higher angles of incidence, the light has to travel through more water, which causes it to be absorbed and scattered more, leading to a decrease in the amount of transmitted light. Additionally, the angle of incidence also affects the polarization of the reflected light, which can impact the amount of light that is reflected.Overall, the relationship between the angle of incoming light and the percentage of light that is transmitted versus reflected is complex and depends on a variety of factors, including the properties of the water, the characteristics of the light, and the angle of incidence.

To learn more about angle of incidence please visit:

https://brainly.com/question/30048990

#SPJ11

what are the differences between the hubble space telescope and the james webb telescope?

Answers

Answer:

Their missions are different - Hubble Telescope's goal is to capture distant stars and galaxies while the James Webb telescope was always meant for long-term exposure and deep space capturingThe Hubble telescope specializes in ultraviolet wavelength - its infrared technology enables it to capture more images from older galaxies.The james webb telescope has a more profound infrared vision - James Webb has been significantly front-loaded with infrared technology to capture more light and a better span of deep space.

given the temperature readings in the topmost tube (in the system diagrammed), which would be reasonable temperatures for points 1 to 5 in the lower tube?

Answers

To help you determine the reasonable temperatures for points 1 to 5 in the lower tube, we'll need to consider the given temperature readings in the topmost tube and the temperature changes in the system.

Let's go through the steps to find the temperatures for each point.
Analyze the temperature readings in the topmost tube.
- Observe and record the temperatures at different points in the topmost tube.

Understand the heat transfer process in the system.
- Consider the direction of heat flow, such as from hot to cold regions.

Determine the temperature differences between the tubes.
- Based on the heat transfer process, estimate the temperature differences between the corresponding points in the topmost and lower tubes.

Calculate the temperatures for points 1 to 5 in the lower tube.
- Subtract the estimated temperature differences from the temperatures of the corresponding points in the topmost tube.

By following these steps, you will be able to find the reasonable temperatures for points 1 to 5 in the lower tube based on the given temperature readings in the topmost tube.

*complete question: Given the temperature readings in a topmost tube, which would be reasonable temperatures for points 1 to 5 in the lower tube?

More on temperature: https://brainly.com/question/26228909

#SPJ11

calculate the current flowing through the heater and determine how much power the heater will provide

Answers

In the below given conditions the current flowing through the heater would be 12 amps and power provided by the heater would be 1440 watts.

To calculate the current flowing through the heater and determine the power it will provide, we need to know the voltage and resistance of the heater.

Let's assume that the voltage is 120V and the resistance is 10 ohms.

Using Ohm's law, we can calculate the current as I = V/R, which gives us 12 amps.

To determine the power provided by the heater, we can use the formula P = VI, where P is the power, V is the voltage and I is the current.

Substituting the values, we get

P = 120V x 12A = 1440 watts.

Therefore, the heater will provide 1440 watts of power and the current flowing through it will be 12 amps.

It is important to note that these calculations are based on the assumptions made about the voltage and resistance of the heater. Actual measurements may vary and should be taken for accurate results.

For more such answers on Current and power

https://brainly.com/question/19266852

#SPJ11

A 500 N force is applied to a 25m/s2 object. The mass of the object is ____.

A. ) 20kg
B. ) 20 m/s
C. ) 12,500 m/s
D. ) 12,500 kg​

Answers

A 500 N force is applied to a 25m/s2 object. The mass of the object is 20kg. The correct answer is option: A.

The force applied to an object is related to its mass and acceleration through the equation:

F = ma,

where F is the force, m is the mass, and a is the acceleration. Rearranging this equation, we get:

m = F/a.

In the given problem, a force of 500 N is applied to the object, and its acceleration is 25 m/s^2.

Substituting these values in the formula, we get :

m = 500 N / 25 m/s^2 = 20 kg.

Therefore, the mass of the object is 20 kg, which is option A.

To know more about acceleration, here

brainly.com/question/12550364

#SPJ4

A 20 Kg bike accelerates at 10 m/s^2. With what force was the person pedaling

Answers

To calculate the force with which the person is pedaling, we need to use Newton's second law of motion, which states that the net force acting on an object is equal to the mass of the object times its acceleration. In this case, the net force is the force applied by the person pedaling the bike. Therefore, we have:

Net force = mass x acceleration

Substituting the given values, we get:

Net force = 20 kg x 10 m/s^2

Net force = 200 N

Therefore, the force with which the person is pedaling the bike is 200 N.

-The diagram above represents two identical pulses approaching each other in a uniform medium.
As the pulses meet and are superposed, the maximum displacement of the medium is?
- 6 cm
0 cm
6 cm
3 cm

Answers

On the basis of constructive interference, when two identical pulses go together in a homogeneous medium and the pulses meet and overlap, the maximum displacement of the medium is equal to 6 cm. So, option (c) is right.

Wave interference is the phenomenon where two waves meet while propagating in the same medium. Constructive interference is a form of interference. It takes place when two pulses meet each other and form a larger pulse. The amplitude of the resulting larger pulse is the sum of the amplitudes of the first two pulses.

This could be done at meetings of two crests or troughs. It can appear anywhere between the two interfering waves are displaced upward. But the two negative effects are also seen when they move downwards.This is shown in the image above. Since we have two identical wave pluses, they are close together in a uniform medium.

Now, Amplitude of pluse A = 3 cm

Amplitude of pluse B = 3 cm

So, the pulses meet and are superposed, the amplitude or maximum displacement of the medium is sum of amplitudes of pluses, that is 3cm + 3 cm = 6 cm. Therefore, the displacement value should be 6 cm.

For more information about Constructive interference, visit :

https://brainly.com/question/11808546

#SPJ4

Complete question:

-The diagram above represents two identical pulses approaching each other in a uniform medium.

As the pulses meet and are superposed, the maximum displacement of the medium is?

a) - 6 cm

b) 0 cm

c)6 cm

d) 3 cm

According to constructive interference, the maximum displacement of the medium when two identical pulses collide and overlap in a homogeneous medium is equal to 6 cm. Option (c) is correct, therefore.

When two waves collide while moving across the same medium, the result is known as wave interference. Interference includes constructive interference. It happens when two pulses collide and create a bigger pulse. The initial two pulses' amplitudes are added to create the larger, resultant pulse.

This could be carried out when two crests or troughs meet. It could show up anywhere where the two competing waves are displaced upward. But when they descend, the two adverse impacts are also evident.In the picture up top, this is evident. In a homogeneous medium, they are close together since we have two identical wave pluses.

The current amplitude of pluse A is 3 cm.

The pluse B's amplitude is 3 cm.

The sum of the plus amplitudes of the pulses, or 3 cm + 3 cm = 6 cm, is the amplitude or maximum displacement of the medium as the pulses collide and superimpose. So, 6 cm should be the displacement value.

learn more about Constructive interference here:

https://brainly.com/question/16098226

#SPJ11

A wire, of length L = 3. 8 mm, on a circuit board carries a current of I = 2. 54 μA in the j direction. A nearby circuit element generates a magnetic field in the vicinity of the wire of B = Bxi + Byj + Bzk, where Bx = 6. 9 G, By = 2. 6 G, and Bz = 1. 1 G. A) Calculate the i component of the magnetic force Fx, in newtons, exerted on the wire by the magnetic field due to the circuit element.

B) Calculate the k component of the magnetic force Fz, in newtons, exerted on the wire by the magnetic field due to the circuit element.

C) Calculate the magnitude of the magnetic force F, in newtons, exerted on the wire by the magnetic field due to the circuit element

Answers

The i component of the magnetic force on the wire is 1.06 × 10^-13 N. The k component of the magnetic force on the wire is 6.69 × 10^-14 N. The magnitude of the magnetic force on the wire is 1.26 × 10^-13 N.

To calculate the i component of the magnetic force, we use the formula:

F = I * L x B

where I is the current, L is the length of the wire, B is the magnetic field, and x represents the cross product.

The cross product of L and B gives a vector perpendicular to both L and B, which is in the i direction. So we only need to find the magnitude of the cross product and multiply it by I to get Fx.

|L x B| = |L| |B| sinθ

where θ is the angle between L and B. Since L is in the j direction and B has i and k components, we have:

|L x B| = L * Bz = (3.8 × 10^-3 m) * (1.1 × 10^-4 T) = 4.18 × 10^-8 N

Then, Fx = I * |L x B| = (2.54 × 10^-6 A) * (4.18 × 10^-8 N) = 1.06 × 10^-13 N

To calculate the k component of the magnetic force, we use the same formula and take the k component of the cross product:

|L x B|k = |L| |B| sin(π/2) = |L| |B| = (3.8 × 10^-3 m) * (6.9 × 10^-5 T) = 2.63 × 10^-7 N

Then, Fz = I * |L x B|k = (2.54 × 10^-6 A) * (2.63 × 10^-7 N) = 6.69 × 10^-14 N

The magnitude of the magnetic force is given by,

F = sqrt(Fx^2 + Fz^2) = sqrt((1.06 × 10^-13 N)^2 + (6.69 × 10^-14 N)^2) = 1.26 × 10^-13 N

To know more about magnetic force, here

brainly.com/question/3160109

#SPJ4

3. what are the heat transfer mechanisms involved during heat transfer in a liquid-to-liquid heat exchanger from the hot to the cold fluid?

Answers

The heat transfer mechanisms in a liquid-to-liquid heat exchanger from the hot to the cold fluid include conduction, convection, and radiation. Conduction and convection are the primary mechanisms, while radiation plays a minor role.

The heat transfer mechanisms involved during heat transfer in a liquid-to-liquid heat exchanger from the hot to the cold fluid are conduction, convection, and in some cases, radiation.

1. Conduction: This is the process of heat transfer through direct contact between the hot and cold fluids. The heat moves from the hot fluid to the cold fluid through the solid walls of the heat exchanger.

2. Convection: This mechanism occurs due to the movement of fluids in the heat exchanger. The hot fluid transfers heat to the solid walls of the heat exchanger, and the cold fluid receives the heat from the walls as it flows. The movement of fluids enhances the heat transfer rate.

3. Radiation: Although less significant in liquid-to-liquid heat exchangers, radiation is the transfer of heat through electromagnetic waves. The heat is emitted from the hot fluid and absorbed by the cold fluid without the need for direct contact or fluid movement.

Learn more about heat:

https://brainly.com/question/934320

#SPJ11

In Young's experiment, light from a red laser (wavelength 700 nm) is sent through two

slit. At the same time, monochromatic visible light with another wavelength passes through the same

apparatus. As a result, most of the pattern that appears on the screen is a mixture of two colors; however, the

center of the third bright fringe of the red light appears pure red. What are the possible wavelengths of the

second type of visible light?

Answers

In Young's experiment, the pattern that appears on the screen is a result of interference between two sets of waves that are diffracted through two slits.

The location of the bright fringes in the pattern depends on the wavelength of the light used. This means that the path difference between the waves that interfere to produce this fringe is an integer multiple of the red light's wavelength (700 nm).

ΔL = mλ_red = nλ_other

where ΔL is the path difference between the waves, m and n are integers, λ_red is the wavelength of the red light, and λ_other is the wavelength of the second type of visible light.

Solving for λ_other, we get:

λ_other = (m/n) λ_red.

To know more about Young's experiment, here

brainly.com/question/30452257

#SPJ4

satellite motion: if earth had twice its present mass but it orbited at the same distance from the sun as it does now, its orbital period would be 1 year 1,5 year 2 year 2,5 year

Answers

The orbital period of the Earth around the Sun is determined by its distance from the Sun and its mass. If the Earth had twice its present mass but orbited at the same distance from the Sun, its gravitational attraction to the Sun would be stronger, resulting in a longer orbital period. Using Kepler's third law of planetary motion, we can calculate the new orbital period as follows:

T^2 = (4π^2/G) x (r^3/m)

where T is the orbital period, G is the gravitational constant, r is the distance from the Earth to the Sun, and m is the mass of the Earth.

Plugging in the values, we get:

T^2 = (4π^2/6.6743 x 10^-11) x [(149.6 x 10^6)^3 / (2 x 5.9722 x 10^24)]
T^2 = 1.085 x 10^20
T = √(1.085 x 10^20)
T = 1.09 x 10^10 seconds

Converting this to years, we get:
T = 346 years

Therefore, if the Earth had twice its present mass but orbited at the same distance from the Sun as it does now, its orbital period would be approximately 346 years.

To know more about Kepler's third law :

https://brainly.com/question/30404084

#SPJ11

how can sonar best be used to monitor the hydrosphere

Answers

Sonar can be a useful tool for monitoring the hydrosphere, which includes all of the water on and beneath the Earth's surface.

Sonar works by emitting sound waves that bounce off objects in the water, and then measuring the time it takes for the sound waves to return to the source. By analyzing the echoes, scientists can map the seafloor, measure the depth of the water, and even identify the size and location of marine organisms.

Sonar can also be used to monitor the movements of water masses, including ocean currents, tides, and storm surges. This information is important for understanding global climate patterns and predicting the effects of natural disasters

Learn more about global climate

https://brainly.com/question/27919422

#SPJ4

starting from rest, a disk rotates about its central axis with constant angular acceleration. in 5.0 s, it rotates 50 rad. what is the instantaneous angular velocity of the disk at the end of the 20.0 s?

Answers

The instantaneous angular velocity is 20.0 s is 400 rad/s.

What is the final instantaneous angular velocity of a disk rotating about its central axis with constant angular acceleration?

Since the angular acceleration is constant, we can use the formula:

[tex]θ = 1/2 * α * t^2 + ω0 * t[/tex]

where

[tex]θ = angle rotated = 50 rad[/tex]

[tex]α = angular acceleration[/tex]

[tex]t = time = 5.0 s[/tex]

[tex]ω0 = initial angular velocity = 0 (starting from rest)[/tex]

Solving for α, we get:

[tex]α = 2 * (θ - ω0 * t) / t^2 = 2 * 50 rad / 5.0 s^2 = 20 rad/s^2[/tex]

Now, using the formula:

[tex]ω = α * t + ω0[/tex]

where

ω = instantaneous angular velocity at the end of 20.0 s (what we need to find)

[tex]α = angular acceleration = 20 rad/s^2[/tex]

[tex]t = time = 20.0 s[/tex]

[tex]ω0 = initial angular velocity = 0 (starting from rest)[/tex]

we get:

[tex]ω = 20 rad/s^2 * 20.0 s + 0 = 400 rad/s[/tex]

Therefore, the instantaneous angular velocity of the disk at the end of 20.0 s is 400 rad/s.

Learn more about angular acceleration

brainly.com/question/29428475

#SPJ11

a bicycle travels from a to b. half the time it travels with speed 20 km/h, and half the time with the speed 30 km/h. what is the average speed?

Answers

The bicycle travels from a to b. half the time it travels with speed 20 km/h, and half the time with the speed 30 km/h, therefore the average speed of the bicycle is 25 km/h.

To find the average speed of the bicycle, we need to use the formula:

Average Speed = Total Distance / Total Time

Since we don't know the distance between points A and B, we can assume it to be 'd' kilometers.

Let's say the time taken by the bicycle to travel from A to B is 't' hours.

According to the problem statement, the bicycle travels at 20 km/h for half the time and 30 km/h for the other half. This means that it covers the first half of the distance at 20 km/h and the second half at 30 km/h.

Hence, the time taken to cover the first half of the distance is (t/2) hours, and the time taken to cover the second half is also (t/2) hours.

Now, we can calculate the total time taken by the bicycle as follows:

Total Time = (t/2) + (t/2) = t hours

Next, we can calculate the total distance traveled by the bicycle as follows:

Total Distance = Distance Covered in First Half + Distance Covered in Second Half
                = (20 km/h) x (t/2) + (30 km/h) x (t/2)
                = 25t km

Substituting these values in the formula for average speed, we get:

Average Speed = Total Distance / Total Time
                   = 25t km / t hours
                   = 25 km/h

Therefore, the average speed of the bicycle is 25 km/h.

More on speed: https://brainly.com/question/15586792

#SPJ11

GUYS SOMEONE PLEASE HELP. i will give brainliest!!


You and your friends are driving home from the cottage and you want to bring back a camping trailer your parents left there. Before leaving, you have a troubling thought. What if the hitch on your car is not strong enough to pull this trailer? Your car has a Class I hitch which is rated with a pulling strength of 2000 lbs. On the side of the trailer a sticker gives the trailer's weight as 3600 lbs. You know from your driver's manual that your car has a weight of 1800 lbs. The real challenge will be getting on to the highway. The ramp to the highway begins with a stop sign and is about 140 m long on level ground. The highway traffic travels at 100 km/h. Can you safely merge into the flow of traffic? You may assume friction effects are very small.

Answers

You should not attempt to tow the camping trailer with your current car and hitch setup, as the hitch is not strong enough to handle the weight of the trailer.

How to solve

A Class I hitch is rated for a pulling strength of 2000 lbs, while the trailer's weight is 3600 lbs.

This means that the hitch is not strong enough to safely pull the trailer, which poses a significant safety risk.

However, let's assume for a moment that the hitch was strong enough and evaluate if you could safely merge into the flow of traffic.

To assess whether you can safely merge, we need to determine if your car can accelerate to the highway speed of 100 km/h (27.8 m/s) within the 140 m long ramp.

We can use the following kinematic equation to solve for acceleration:

v^2 = u^2 + 2as

Where:

v is the final velocity (100 km/h or 27.8 m/s)

u is the initial velocity (0 m/s, as you start from a stop sign)

a is the acceleration

s is the distance (140 m)

Rearranging the equation to solve for acceleration:

a = (v^2 - u^2) / (2s)

a = (27.8^2 - 0^2) / (2 * 140)

a ≈ 2.77 m/s²

Now, we need to calculate the force required to achieve this acceleration. We'll use Newton's second law:

F = m * a

The total mass of the car and the trailer is 1800 lbs (car) + 3600 lbs (trailer) = 5400 lbs. To convert this to kilograms, we multiply by 0.453592 (1 lb = 0.453592 kg):

5400 lbs * 0.453592 kg/lb ≈ 2449 kg

Now we can calculate the force required:

F = 2449 kg * 2.77 m/s² ≈ 6781 N

Now let's compare this force to the pulling strength of the hitch. The hitch can handle 2000 lbs, which is equivalent to:

2000 lbs * 4.44822 N/lb ≈ 8896 N

In this scenario, the required force to achieve the necessary acceleration (6781 N) is less than the pulling strength of the hitch (8896 N).

However, as mentioned earlier, the hitch is not strong enough to safely pull the trailer due to the trailer's weight exceeding the hitch's rated capacity.

In conclusion, you should not attempt to tow the camping trailer with your current car and hitch setup, as the hitch is not strong enough to handle the weight of the trailer.

Even if the hitch was strong enough, towing a heavy trailer would still pose other challenges and safety risks, such as stopping distance, stability, and maneuverability.

Read more about acceleration here:

https://brainly.com/question/460763

#SPJ1

What does it mean when we say our sense of motion depends on our frame of reference? Include the phrases “fixed frame” and “moving frame” in your answer.

Answers

frame of reference that is not inertial. A non-inertial frame is now defined as a frame that accelerates relative to the underlying inertial reference frame. Newton's law won't be valid.

How does the framework function?

Performance could change depending on the lighting. The Frame automatically modifies the Plasma tvs brightness and contrasting settings after analyzing the lighting conditions in the room and the light level of your content.

What distinguishes a system from a frame?

the hard architecture (bones and condyle) that serves as an animal's body's framework. skeletal system, skeleton, and systema skeletale. system: a collection of organs or bodily parts that function or are anatomically related; "the body contains a system for organs for digestion."

To know more about frame visit:

https://brainly.com/question/9708057

#SPJ1

a particle with a cahrge of 1 c is moving at 45 angle with respect to the positive x axis in teh horizontal xy-plane. the velocity of the charge is 1 m/s. a magnetic field of 1 t is directed in the negative x direction. what is the magnetic force acting on the charge?

Answers

The magnetic force acting on the charged particle is -0.707 N in the k direction and 0.707 N in the j direction.

In this problem, the charge of the particle is given as 1 C, and the velocity of the particle is 1 m/s at an angle of 45 degrees to the positive x-axis. We can break down the velocity vector into its x and y components as follows:

vx = vcos(45) = 0.707 m/s

vy = vsin(45) = 0.707 m/s

The magnetic field is given as 1 T in the negative x direction.

Substituting these values into the formula for the magnetic force, we get:

F = q * (vxi + vyj + 0k) x (-Bi)

where I, j, and k are the unit vectors in the x, y, and z directions, respectively.

Expanding the cross product, we get:

F = q*(-vxB)k + qvyB*j

Substituting the values for q, vx, vy, and B, we get:

F = (1 C) (-0.707 m/s) (1 T) k + (1 C) (0.707 m/s) *(1 T) *j

Simplifying, we get:

F = -0.707 k + 0.707 j

To know more about Charge:

https://brainly.com/question/3412043

#SPJ4

Other Questions
true or false group bonuses typically reward the performance of all employees in an organization Lenders look at a HELOC balance of less than $50,000 as if ________________.It were a credit cardIt were an assetIt were a paid mortgageIt were cash For each of the following three scenarios, state which hypothesis test you would use from among the four introduced so far: the z test, the single-sample t test, the paired-samples t test, and the independent-samples t test. (Note: In the actual studies described, the researchers did not always use one of these tests, often because the actual experiment had additional variables.) Explain your answer. (20pts) a. A study of 40 children who had survived a brain tumor revealed that the children were more likely to have behavioral and emotional difficulties than were children who had not experienced such a trauma (Upton & Eiser, 2006). Parents rated childrens difficulties, and the ratings data were compared with known means from published population norms. b. Talarico and Rubin (2003) recorded the memories of 54 students just after the terrorist attacks in the United States on September 11, 2001some memories related to the terrorist attacks on that day (called flashbulb memoriesfor their vividness and emotional content) and some everyday memories. They found that flashbulb memories were no more consistent over time than everyday memories, even though they were perceived to be more accurate. c. The HOPE VI Panel Study (Popkin & Woodley, 2002) was initiated to test a U.S. program aimed at improving troubled public housing developments. Residents of five HOPE VI developments were examined at the beginning of the study so researchers could later ascertain whether their quality of life had improved. Means at the beginning of the study were compared to known national data sources (e.g., the U.S. Census, the American Housing Survey) that had summary statistics, including means and standard deviations. let's assume you have measured the height of all psychology majors at your university. the height scores constitute a _________ with regard to psychology majors in universities throughout the world. Consider the reaction described by the chemical equation shown.C2H4(g)+H2O(l)C2H5OH(l)rxn=44.2 kJUse the data from the table of thermodynamic properties to calculate the value of rxnat 25.0 C.Srxn= ? JK1Calculate rxn.Grxn= ? kJIn which direction is the reaction, as written, spontaneous at 25 Cand standard pressure?reversebothneitherforward black colored fur is dominant over white colored fur in hamsters. a black colored hamster (bb) is mated with a purebred, white colored hamster (bb). what percentage of their offspring will have the genotype bb? Please help!! URGENT!! I dont understand what kind of spectrum does hot gas produce? emission line absorption line continuous infrared ultraviolet which of the following sql clauses is used to enforce data integrity? a. not nullable b. uniqueness c. check d. where tractable meansA. contrabandB. uncommonC. deplorableD. susceptible people with dependent personality disorder will probably be very effective employees, since they are highly motivated to please their bosses. (true or false) which study is best characterized as one of comparative genomics? investigating the relative frequencies of different transposable elements in a grasshopper species using sequencing to compare the diversity of bacteria across different parts of a stream using sequencing to assess the diversity of fungi in a soil sample investigating the relationship between the number of transposable elements and development time across different species of flies attempting to find the regulatory sequences of a cell-signaling gene in a yeast species what does a new chromatogram look like after increasing polarity of mobile phase to remove a contaminant peak For Kittle Co., a stronger Canadian dollar has a stronger influence on Canadian dollar ___ than it does on Canadian dollar ___ Step 2 In the previous stage, you saw that Kittle's operating structure, with low sales in Canada and high cost of materials from Canadian suppliers, was a source of significant economic exposure each quarter. Because of this, Kittle has decided to restructure it's operating structure. The largest part of the restructure involves an increase in U.S. operating expense in order to pay for efforts to increase Canadian sales, while also ordering more supplies from U.S. suppliers instead of Canadian suppliers. This restructuring also includes using more U.S. sources for financing instead of Canadian sources. What was one major effect of the order President Lincoln issued in thepassage?Now, therefore I, Abraham Lincoln, President of the UnitedStates, by virtue of the power in me vested as Commander-in-Chief, of the Army and Navy of the United States in timeof actual armed rebellion against the authority andgovernment of the United States... I do order and declarethat all persons held as slaves within [the Confederacy]...are, and henceforward shall be free; and that the Executivegovernment of the United States, including the military andnaval authorities thereof, will recognize and maintain thefreedom of said persons.1A. Thousands of enslaved people fled from Union territories to theWest.B. Support for the Union war effort became more popular in theSouth.C. The Confederacy lost support from potential European allies.D. Most of the border states left the Union and joined theConfederacy. 12.Which style of policing prefers to ignore or treat informally issues of concern, unless the social orpolitical order is being jeopardized?a.Crime fighterb.Social agentc.Law enforcerd.Watchman inferred the reason why the droeshout engraving and Shakespeare statue are considered unreliable a product sells for $180 per unit, and its variable costs are 55% of sales. the fixed costs are $495,000. what is the break-even point in sales dollars? davie inc. has a pre-tax cost of debt of 8.6 percent, a cost of equity of 13.4 percent, and a cost of preferred stock of 8.5 percent. the firm has 240,000 shares of common stock outstanding at a market price of $27 a share. there are 25,000 shares of preferred stock outstanding at a market price of $33 a share. the bond issue has a face value of $540,000 and a market price of 102.1 percent of face value. the company's tax rate is 34 percent. what is the firm's weighted average cost of capital? Consider the verbal phrase.Two and nineteen hundredths times a number g, plus fifty-nine hundredthsPart AEnter an expression to represent the verbal phrase. g + Part BEvaluate the expression when g = 3. 3.96 7.16 8.34 8.93