Use the graph to answer the questions
WILL MARK BRAINLIEST!!

Use The Graph To Answer The QuestionsWILL MARK BRAINLIEST!!
Use The Graph To Answer The QuestionsWILL MARK BRAINLIEST!!

Answers

Answer 1

The diagram of the Gateway Arch on the coordinate plane, analyzed using quadratic equations indicates;

1. The vertex point is (50, 630)

2. The solution point are; (20, 0), and (80, 0)

3. Vertex form; f(x) = -0.7·(x - 50)² + 630

4. Factored form; f(x) = -0.7·(x - 20)·(x - 80)

What is a quadratic equation?

A quadratic equation is an equation of the form f(x) = a·x² + b·x + c

1. The vertex obtained from the graphical diagram of the Gateway Arch indicates that the point corresponding to the vertex point is; (50, 9 × 70 = 630)

The vertex point is; (50, 630)

2. The solution are the points the curve of the Gateway intersects the x-axis, which are points where the y-axis values are zero, therefore;

The solutions are; (20, 0), and (80, 0)

3. The vertex form of a quadratic equation is; f(x) = a·(x - h)² + k

Where;

(h, k) = The coordinates of the vertex

Therefore;

(h, k) = (50, 630)

f(20) = 0 = a·(20 - 50)² + 630

a·(20 - 50)² = -630

a = -630/((20 - 50)²) = -630/900 = -7/10

a = -7/10 = -0.7

The vertex form quadratic equation is therefore; f(x) = -0.7·(x - 50)² + 630

4. The factored form of a quadratic equation is; f(x) = a·(x - r₁)·(x - r₂)

r₁ = 20, and r₂ = 80, a obtained from the vertex is; a = -0.7

The factored form is therefore; f(x) = -0.7·(x - 20)·(x - 80)

Learn more on the factored form of a quadratic equation here: https://brainly.com/question/25094938

#SPJ1


Related Questions

2À candy company claims that its jelly bean mix contains 15% blue jelly beans. Suppose that the candies are packaged at random in small bags containing about 200 jelly beans. What is the probability that a bag will contain more than 20% blue jelly beans?

Answers

We find that P(Z > 2.46) is roughly 0.007 using a calculator or a basic normal distribution table. The probability that a bag will contain more than 20% blue jellybeans is therefore approximately 0.007 or 0.7%.

Define probability?

The probability of an event is the ratio of good outcomes to all other potential outcomes. The number of successful outcomes for an experiment with 'n' outcomes can be expressed using the symbol x.

Here in the question,

We can utilise the binomial distribution formula to resolve this issue. In a bag of 200 jelly beans, let X represent the proportion of blue jelly beans. Following that, X exhibits a binomial distribution with parameters of n = 200 and p = 0.15, where p is the likelihood of drawing a blue jellybean.

The formula for determining the likelihood of finding more than 20% blue jellybeans in a bag is:

P (X > 0.2 × 200) = P (X > 40)

Since n is large (200) and p is not too near to 0 or 1, we can utilise the usual approximation to the binomial distribution. We may determine the equivalent mean and standard deviation of the normal distribution by using the mean and variance of the binomial distribution:

μ = np = 200 × 0.15 = 30

σ = √ (np(1-p)) = √ (200 × 0.15 × (1-0.15)) = 4.07

Then, we can standardize the random variable X as:

Z = (X - μ) / σ

So, we have:

P(X > 40) = P((X - μ) / σ > (40 - μ) / σ)

= P(Z > (40 - 30) / 4.07)

= P(Z > 2.46)

We find that P(Z > 2.46) is roughly 0.007 using a calculator or a basic normal distribution table. The likelihood that a bag will contain more than 20% blue jellybeans is therefore approximately 0.007 or 0.7%.

To know more about probability, visit:

https://brainly.com/question/16484393

#SPJ1

Melissa collected the data in the table.


When x = 4, what is the residual?

–3
–1
1
3

Answers

From the data in the table, we can conclude that when x = 4, then the residual will equal -1.

How to determine the residual

To determine the residual, we can begin by obtaining the difference between the given and the predicted values of y.

So, Residual = Gven value - Predicted value.

When x = 4 in the table, Given value is 9 and predicted value is 10. So, 9 - 10 = -1. So, we can say that the residual value is -1.

Learn more about residual values here:

https://brainly.com/question/30243740

#SPJ1

Answer:

The residual is the difference between the actual y-value and the predicted y-value on a regression line. Since no table or equation is provided, we cannot calculate the exact residual. However, I can explain the concept to you.

Step-by-step explanation:

In general, to calculate the residual, we would need a regression equation or a line of best fit. This equation allows us to predict the y-values for different x-values. Then, we can compare the predicted values to the actual values given in the table to find the residuals.

If you have the regression equation or the line of best fit, I can help you calculate the residual for a specific x-value.


Find the surface area and volume of the composite solid.

Answers

According to the information, the surface area of the solid is 758m² and the volume is 594m³

How to find the surface area of the solid?

To find the surface area of the solid we have to perform the following procedure:

12m * 11m = 132m²

132m² * 2 = 264m²

16m * 9m = 144m²

144m² - 18m² = 126m²

126m² * 2 = 252m²

16m * 11m = 176m²

176m² - 66m² = 110m²

3m * 11m = 33m²

33m² * 2 = 66m²

6m * 11m = 66m²

264m² + 66m² + 66m² + 110m² +252m² = 758m²

To find the volume we have to perform the following procedure:

8m * 11m * 9m = 792m³

792m³ - 198m³ = 594m³

Learn more about surface area in: https://brainly.com/question/29298005

#SPJ1

help with statistics

Answers

Statistics is a branch of mathematics that involves the collection, analysis, interpretation, presentation, and organization of data. It is used in a wide range of fields such as science, engineering, social sciences, business, economics, and more.

What is statistics?

In statistics, data is collected through various methods such as surveys, experiments, and observations. This data is then analyzed using statistical methods to extract meaningful insights, identify patterns and relationships, and make informed decisions.

Some common statistical techniques include descriptive statistics, inferential statistics, hypothesis testing, regression analysis, and probability theory. These techniques are used to help researchers and analysts to understand and draw conclusions about data, and to test whether their conclusions are statistically significant.

Statistics has many practical applications, such as market research, medical research, quality control, risk assessment, and many others. It plays a critical role in modern society, helping individuals and organizations make informed decisions based on data-driven insights.

Learn more about statistic on;

https://brainly.com/question/15525560

#SPJ1

Consider a circle whose equation is x2 + y2 – 2x – 8 = 0. Which statements are true? Select three options. The radius of the circle is 3 units. The center of the circle lies on the x-axis. The center of the circle lies on the y-axis. The standard form of the equation is (x – 1)² + y² = 3. The radius of this circle is the same as the radius of the circle whose equation is x² + y² = 9.

Answers

The true statements are:

1. The radius of the circle is 3 units

2. The standard form of the equation is (x-1)^2+y^2=3

3. The center of the circle lies on X-axis

4. The radius of this circle is the same as the radius of the circle whose equation is x^2+y^2=9

The given equation is: x^2+y^2-2x-8=0

The equation in the standard form of the circle can be written as (x-h)^2+(y-k)^2=r^2, where h= center of the circle and r= radius of the circle

The given equation in standard form can be written as

(x^2-2x+1)+y^2-9=0

(x-1)^2+y^2=3^2

Hence from the above equation, the center of the circle is at (1,0) and the radius is 3 units.

To learn more about problems on the equation of a circle refer to:

https://brainly.com/question/23799314?referrer=searchResults

Prove that
sin 2x
1+ cos2x
= tan x

Answers

The statement that (sin 2x) / (1 + cos 2x) = tan x can be proven.

How to prove the mathematical statement ?

To prove that (sin 2x) / (1 + cos 2x) = tan x, we will use trigonometric identities.

(sin 2x) / (1 + cos 2x)

(2sin x × cos x) / (1 + (cos²x - sin²x))

(2sin x × cos x) / (cos²x + 2sin x × cos x + sin²x)

We can rewrite the denominator using the Pythagorean identity sin²x + cos²x = 1:

(2sin x × cos x) / (1 + 2sin x × cos x)

(2sin x × cos x) × (1 - 2sin x × cos x) / (1 - (2sin x × cos x)²)

((2sin x × cos x) - (4sin²x × cos²x)) / (1 - 4sin²x × cos²x)

(2sin x - 4sin²x) / (1/cos²x - 4sin²x)

Since tan x = sin x / cos x, we can rewrite the expression:

(2tan x - 4tan²x) / (sec²x - 4tan²x)

(2tan x - 4tan²x) / (1 + tan²x - 4tan²x)

(2tan x - 4tan²x) / (1 - 3tan²x)

2tan x × (1 - 2tan²x) / (1 - 3tan²x)

tan x

So, we have proved that (sin 2x) / (1 + cos 2x) = tan x.

Find out more on proof at https://brainly.com/question/17029275

#SPJ1

in row 2, write the standard form equation of a circle whose diameter endpoints are shown here (-3,4) (2,1)

Answers

The standard form equation of a circle whose diameter endpoints are  (-3,4) (2,1) is [tex](x - (-0.5))^2 + (y - 2.5)^2[/tex] = 6.5

What is the general form of equation of a circle?

The general form of the equation of a circle is (x - h)² + (y - k)² = r², where (h, k) represents the center of the circle and r represents the radius. This equation is derived using the Pythagorean theorem, which states that the sum of the squares of the legs of a right triangle is equal to the square of the hypotenuse. By setting (x - h)² and (y - k)² equal to r² and then combining the two equations, we get the standard form equation of a circle.

The center of the circle lies in the middle of the diameter, so we find the midpoint of the end points:

[tex](\frac{-3+2}{2} , \frac{4+1}{2} )[/tex] = (-0.5, 2.5)

And radius of the circle is half of the diameter, which is:

[tex]\frac{\sqrt{( 2-(-3))^2 + (1-4)^2 )}}{2}[/tex] = [tex]\frac{\sqrt{26}}{2}[/tex]

Therefore, the circle equation is:

[tex](x - (-0.5))^2 + (y - 2.5)^2[/tex] = [tex](\frac{\sqrt{26} }{2} )^2[/tex] = 26/4 = 6.5

[tex](x - (-0.5))^2 + (y - 2.5)^2[/tex] = 6.5

To know more about circle equation visit:

brainly.com/question/29288238

#SPJ1

7.
Colin uses
cup of vegetable oil in each cake that he makes for his father's beker
If Colin made 8 cakes, how much oil did Colin use in all?
Mark only one oval.
I added 13:5
A. 51/3 cups
OB. 41/3 cups
OC. 51/2 cups
OD.41/2 cups
Spain
42°

Answers

The number of cups of vegetable oil used by Colin to make 8 cakes is given by A = 5 1/3 cups

What is an Equation?

Equations are mathematical statements with two algebraic expressions flanking the equals (=) sign on either side.

It demonstrates the equality of the relationship between the expressions printed on the left and right sides.

Coefficients, variables, operators, constants, terms, expressions, and the equal to sign are some of the components of an equation. The "=" sign and terms on both sides must always be present when writing an equation.

Given data,

Let the equation be represented as A

Now, the value of A is

Substituting the values in the equation, we get

Let the number of cups of vegetable oil used by Colin to make 8 cakes be represented as A

Now , the number of cups of vegetable oil used by Colin to make 1 cake is given by = ( 2/3 ) cups of oil

And , number of cups of vegetable oil used by Colin to make 8 cakes A =

A = 8 x number of cups of vegetable oil used by Colin to make 1 cake

On simplifying the equation, we get

[tex]\text{A} = 8 \times \huge \text{(} \dfrac{2}{3} \huge \text{)}= \dfrac{16}{3}[/tex]

[tex]\boxed{\bold{A = 5 \dfrac{1}{3} \ cups}}[/tex]

Therefore, the value of A is 5 1/3 cups

Hence, the number of cups of vegetable oil required is 5 1/3 cups

To learn more about equations click:

brainly.com/question/19297665

Complete question is-

Colin uses 2/3 cup of vegetable oil in each cake that he makes for his father's bakery.

If Colin made 8 cakes, how much oil did Colin use in all?

A. 5 1/3 cups

B. 7 1/3 cups

C. 8 2/3 cups

D. 16 1/3 cups​

Find the volume of this sphere.
Use 3 for TT.
-d=6in
V ≈ [?] in ³
V = πr³
Enter

Answers

If the volume formula is from the question it would 3*(6/2)^3 =27 because the radius is diameter divided by 2 but if it’s the formula I know which 4/3 pie (r)^3 it would be 4/3(3)(3)^3 =36

Answer: Spheres aren’t three-dimensional—they are two-dimensional. This is evident from the fact that in order to specify a point on a sphere, you only need two pieces of information, such as latitude and longitude.

If you include the interior of the sphere, this is instead called a closed ball, and that is three-dimensional. You can specify a point in the closed ball in all sorts of different ways; one of the most convenient would be latitude, longitude, and distance from the center. However, other than convenience, there is no reason to prefer one coordinate system over any other.

(This fact has nothing to do with spheres or closed balls—that is just a statement that is generally true. People who insist that “the three dimensions” are length, width, and height don’t know what they are talking about.)

Step-by-step explanation:

Which is the best estimate of the difference between 67/8 and 1/82

Answers

Answer:

8.36

Step-by-step explanation:

67 - 1

8. 82

= 2747 - 4

328

=2743

328

= 8.36

find the value for each variable in simplest radical form

Answers

The values are;

1. x = 6 ,y = 6√2

2. x = 9√2, y = 18

3. x = y = 9

4. x = 12, y = 12√2

5. x = y = 4√2

6. x = y =( 3√2)/2

What trigonometric ratio?

Trigonometric Ratios are defined as the values of all the trigonometric functions based on the value of the ratio of sides in a right-angled triangle.

There are some special angles , in which 45 is part of them.

sin 45 = 1/√2

cos 45 = 1/√2

tan 45 = 1

1. x = 6 ( isosceles triangle)

y = 6 × √2 = 6√2

2. x = 9√2 ( isosceles triangle)

y = 9√2 × √2 = 9×2 = 18

3. x = 9√2/√2 = 9

x = y = 9 ( isosceles triangle)

4. x = 12 ( isosceles triangle)

y = 12×√2 = 12√2

5. x = 8/√2 = 8√2/2 = 4√2

x = y = 4√2( isosceles triangle)

6. x = 3/√2 = (3√2)/2

x = y =( 3√2)/2 ( isosceles triangle)

Learn more about trigonometric ratio from

https://brainly.com/question/24349828

#SPJ1

please help me in this question​

Answers

Answer:

step by step explanation:

All you have to do is expand and reduce the expressions

then evaluate -2 being a root of the expressions

To do that you need to substitute -2 into the simplified expressions

if the result comes as zero then f(-2) is factor of f(x) according to the factor theorem.

Example 1.

simplify (-5x-2)(7x-4)-2x+3

if you substitute f(x) as f(-2)

then substitute x with -2

when you simply and evaluate the expression you will get that the expression is equal to -137

which means -2 isn't a root since the expression must be equal to 0

-2 is not a root

do the same for the other expressions

a private student loan at 4.25%, but the rate for such a loan could be 12.59%. Under the same circumstances as Self Check 2 ($10,000 principal, no interest paid while in school) and a rate of 12.59%, what would the principal be when you make your first payment 51 months later? What are some recent examples of community change that involves a clash between different cultures that helped disadvantaged communities and the populations.?

Answers

The principal when making the first payment 51 months later on a private student loan with a principal of $10,000 and a rate of 12.59% would be $15,307.13.

What is the principal?

To calculate the principal when making the first payment 51 months later on a private student loan with a principal of $10,000 and a rate of 12.59%, we first need to calculate the amount of interest that has accrued over the 51 months.

Using the formula:

Interest = Principal x Rate x Time

where Principal = $10,000,

Rate = 12.59% per year,

Time = 51/12 years (since the interest is compounded monthly):

Interest = $10,000 x 0.1259 x (51/12)

= $5,307.13

So the total amount owed after 51 months would be:

Total amount owed = Principal + Interest

= $10,000 + $5,307.13

= $15,307.13

Therefore, the principal when making the first payment 51 months later on a private student loan with a principal of $10,000 and a rate of 12.59% would be $15,307.13.

As for recent examples of community change that involves a clash between different cultures that helped disadvantaged communities and the populations, one example is the Black Lives Matter movement, which has brought attention to systemic racism and police brutality in the United States.  Another example is the #MeToo movement, which has raised awareness about sexual harassment and assault and has led to changes in workplace policies and cultural attitudes toward these issues.

Learn more about principal from

https://brainly.com/question/30163719

#SPJ1

What is the perimeter of the trapezoid?

Answers

40
use pythagoras theorem to find the diagonal side: 8^2+6^2=100 so it’s 10 then add the other sided together

A recliner is discounted by $190. If the original price is $800, estimate the sale price by first rounding each number to the nearest hundreds

Answers

all u got to do is subtract

Solve the inequality for x.
−8+ x/3>-7
Simplify your answer as much as possible.

Answers

Answer:

x > 3

Step-by-step explanation:

−8 + x/3 > -7

x/3 > 1

x > 3

We can't simplify anymore, so the answer is x > 3

Can you please help me with this.

Answers

The probability that a committee of 10 members consisting of 6 males and 4 females will be selected is 0.3633.

The total number of ways to develop the complex would be 665, 280 ways.

How to find the probability ?

To find the probability that a committee of 10 members consisting of 6 males and 4 females be selected for this committee, we need to calculate the number of possible ways to choose 6 males from the 28 males and 4 females from the 12 females.

Using combinations, we have:

Number of ways to choose 6 males = C(28, 6) = 28! / (6! x (28 - 6)!)

Number of ways to choose 4 females = C(12, 4) = 12! / (4! x (12 - 4)!)

Now, we find the probability:

Probability = (Number of ways to choose 6 males * Number of ways to choose 4 females) / Total ways to choose 10 members

Probability = (C(28, 6) x C(12, 4)) / C(40, 10)

Probability = 0.3633

How to find the number of ways ?

To find the number of different ways the complex can be developed given the basic designs, we need to consider the following:

The number of ways to arrange the remaining 5 unique designs on the 5 stands is a permutation of 11 designs taken 5 at a time:

P(11, 5) = 11! / (11 - 5)!

Total ways to develop the complex = 12 x P(11, 5)

= 12 x 55440 = 665,280 ways

Find out more on probability at https://brainly.com/question/29153607

#SPJ1

C. The table below shows the ages in years of 42 children at a birthday party. AGE(YEARS) NO OF CHIDREN 7 2x 8 3x 9 4x-1 10 X 11 X-2 (i). Find the value of x. (ii). Calculate, correct to the nearest whole number the mean age. (iii). Find the probability of selecting at random a child whose age is less than 9 years. 12 x-3 CURT​

Answers

(1) The value of X is equal to 4  (2) The mean age is 3. (3) The probability of randomly selecting  a child under the age of 9  is approximately 0.83.  

 How to calculate the average?

The formula for calculating the average of given numbers is equal to the sum of all values ​​divided by the total number of values. There are three main types of averages: mean, median, and mode. All of these techniques work slightly differently and often give slightly different typical values.

(i). Given that there are a total of 42 children on the birthday, finding the value of x:

2x + 3x (4x-1) + x + (x-2) + (x-3) = 42

11x - 6 = 42

11x = 48

x = 4

Therefore, the value of x is equal to 4.

(ii). To find the average age, we need to calculate the sum of all the ages and divide by the total number of children:

Average age = (7 x 2 + 8 x 3 + 9 x (4-1) +10 x 4 +11 x (4-2) 12 x (4-3)) / 42

 = (14 + 24 + 27 + 40 + 22 +12) / 42

 = 139/42

 = 3.31

Rounded to the nearest whole number, the average age is 3.  

(iii). The probability of randomly selecting  a child under 9 is obtained by adding  the number of children aged 7, 8 or 9 (because we want children under 9) and  dividing by the total number of children:

Number of children under 9 years  = 2x + 3x + (4x-1)

Number of children under 9 years  = 9x - 1

Number of children under 9  = 9(4)–1

Number of children under 9 years  = 35

Probability of choosing a child under 9  = number of children under 9  / total number of children

Probability of choosing a child under 9 = 35/42

The probability of choosing a child under 9 years old is ≈ 0.83

Thus, the probability of randomly selecting  a child under the age of 9  is approximately 0.83.

Learn more about mean, median, and mode here

https://brainly.com/question/30891252

#SPJ1

Problem 1: Find the Area and round to the nearest tenth.

Answers

Answer:

39.96

Step-by-step explanation:

the shape is a parallelogram ao the formula is base x height

A=10.8 x 3.7

A=39.97

Jackson had $104,292.12 in a savings account with simple interest. He had opened the
account with $80,040 exactly 3 years earlier. What was the interest rate?
Use the formula i = prt, where i is the interest earned, p is the principal (starting amount), r
is the interest rate expressed as a decimal, and t is the time in years.

Answers

Answer: Using the formula i = prt, we have:

i = (104292.12 - 80040) = 24252.12

p = 80040

t = 3

Substituting these values, we get:

24252.12 = 80040 * r * 3

Solving for r, we get:

r = 0.101 or 10.1%

Therefore, the interest rate is 10.1%.

Step-by-step explanation:

50 Points! Multiple choice algebra question. Shen is simplifying the expression (3x^4+4x^2) (x^3-2x^2-1). Which of the following shows the correct product. Photo attached. Thank you!

Answers

So, multiple choice algebra questions. the correct answer would be option D: [tex]3x^7 - 6x^6 - 11x^4 + 4x^5 - 4x^2[/tex].

To simplify the given expression [tex](3x^4+4x^2) (x^3-2x^2-1)[/tex], we can use the distributive property of multiplication to multiply each term of the first expression by each term of the second expression. This gives us:

[tex](3x^4+4x^2) (x^3-2x^2-1) \\= 3x^4(x^3) + 3x^4(-2x^2) + 3x^4(-1) + 4x^2(x^3) - 4x^2(2x^2) - 4x^2(1)[/tex]

Simplifying each term, we get:

[tex]= 3x^7 - 6x^6 - 3x^4 + 4x^5 - 8x^4 - 4x^2[/tex]

So, the correct answer would be option D: [tex]3x^7 - 6x^6 - 11x^4 + 4x^5 - 4x^2.[/tex]

To know more about distributive property visit:

https://brainly.com/question/6276874

#SPJ1

Bhavik bought 3 liters of milk and 5 loaves of bread for a total of $11. A month later, he bought 4 liters of milk and 4 44 loaves of bread at the same prices, for a total of $10. How much does a liter of milk cost, and how much does a loaf of bread cost?

Answers

The cost of a liter of milk is $2.50 and the cost of a loaf of bread is $2.50.

What is cost?

Cost is the value of goods or services measured in money or other forms of exchange. It is the amount that must be given up in exchange for something else. Costs are typically incurred in the production of goods and services, and can include both tangible and intangible elements, such as labor, materials, overhead, and financing.

The total cost for 3 liters of milk and 5 loaves of bread was $11. Therefore, the cost for 1 liter of milk was ($11 / 3) = $3.67. The cost for 1 loaf of bread was ($11 / 5)
= $2.20.
The total cost for 4 liters of milk and 4 loaves of bread was $10. Therefore, the cost for 1 liter of milk was ($10 / 4) = $2.50. The cost for 1 loaf of bread was ($10 / 4)
= $2.50.
Therefore, the cost of a liter of milk is $2.50 and the cost of a loaf of bread is $2.50.

To learn more about cost
https://brainly.com/question/2292799
#SPJ1

A Bakery sold 382 cakes in one week. this was twice as the day so the previous week. write an equation that can be used to find the number of cakes and that were sold the previous week 

Answers

Answer:

164 Cakes

Step-by-step explanation:

382 Cakes are made in Week A. This was twice the amount of Week B. 328 divided by two equals 164.

Find the Volume of this shape.

Answers

Therefore, the volume of the prism is 60 cubic feet.

What is volume?

Volume is the amount of space occupied by a three-dimensional object or the capacity of an object. It is typically measured in cubic units such as cubic meters, cubic feet, or cubic centimeters. The formula for finding the volume of a solid object depends on its shape. In general, the volume of a shape can be found by dividing it into smaller, more easily measured shapes and adding up their volumes. This is known as the method of integration in calculus, and it is used to find the volumes of irregularly shaped objects or fluids. Understanding the concept of volume is important in many fields, such as architecture, engineering, physics, and chemistry. In these fields, volume is used to determine the capacity of containers, the displacement of fluids, and the amount of materials needed for a construction project.

Here,

The volume of a prism is given by the formula:

V = Bh

where B is the area of the base and h is the height of the prism.

Substituting the given values:

V = (20 ft)(3 ft)

V = 60 cubic feet

To know more about volume,

https://brainly.com/question/28338582

#SPJ1

Can you find X? Show how did u find

Answers

Answer:

x=90°

Step-by-step explanation:

As in the angle, there is a box giving us info that x has to be 90°.

But to be sure that there is no mistake we have to do the following:

Look at all the other angles (see what kind of angles they are).Add all the angles up to 360°( in this case as the angle we are looking for is on a straight line which gives  straight line=180°).Checking and comparing the two answers.

So we are looking at the surroundings of angle x (which is on a straight line) we see that it is a right angle and look at the angle on the same line is a right angle too.

The equation right angle=90° helps us see that because there are two right angles on a 180° line (90°+90°+180°).

Therefore the answer is:

x=90°

Question 6(Multiple Choice Worth 5 points) (Statistical Measurements LC) Which of the following is a statistical question that can result in numerical data? What is the name of your favorite pizza store? How many hours this week did you spend on homework? O How many times did you go swimming this year? How many pink erasers do the students in your class have?​

Answers

The statistical question that can result in numerical data is "How many hours this week did you spend on homework?"

Identifying the statistical question that can result in numerical data?

The statistical question that can result in numerical data is "How many hours this week did you spend on homework?"

This is because the question is asking for a numerical response that can be measured and counted. The other options are not statistical questions that can result in numerical data.

"What is the name of your favorite pizza store?" is a question that asks for a categorical response, "How many times did you go swimming this year?" is a question that asks for a countable response, And "How many pink erasers do the students in your class have?" is a question that asks for a discrete numerical response.

Read more about statistical question at

https://brainly.com/question/22334957

#SPJ1

Given this equation what is the value of y at the indicated point?

Answers

Answer: y=2

Step-by-step explanation:

We're given x=1 so we can plug this in 3x - y =1 and isolate to solve for y.

[tex]3(1)-y=1\\3-y=1\\-y=-2\\y=2[/tex]

Create a Truth Table for
(A ⋀ B) → C

Answers

The truth table is given above for (A ⋀ B) → C.

What is the logical statement?

A logical statement, also known as a proposition or a statement of fact, is a declarative sentence that is either true or false, but not both. It is a statement that can be evaluated based on the available information or evidence to determine its truth value. In other words, a logical statement is a statement that can be either true or false, but not both.

To create a truth table for the logical statement (A ⋀ B) → C, we need to consider all possible combinations of truth values for propositions A, B, and C.

There are 2 possible truth values (true or false) for each proposition, so there are 2³ = 8 possible combinations.

We can organize these combinations into a table as follows:

| A | B | C | (A ⋀ B) | (A ⋀ B) → C |

|---|---|---|---------|-------------|

| T | T | T |    T    |      T      |

| T | T | F |    T    |      F      |

| T | F | T |    F    |      T      |

| T | F | F |    F    |      T      |

| F | T | T |    F    |      T      |

| F | T | F |    F    |      T      |

| F | F | T |    F    |      T      |

| F | F | F |    F    |      T      |

In this table, the column labeled (A ⋀ B) represents the truth value of the conjunction of A and B (i.e., A AND B), and the column labeled (A ⋀ B) → C represents the truth value of the conditional statement (A ⋀ B) → C.

The symbol "T" represents "true" and the symbol "F" represents "false".

Hence, The truth table is given above for (A ⋀ B) → C.

To learn more about the logical statement visit:

https://brainly.com/question/29021787

#SPJ1

2. center (5, -6), radius 4

Answers

Answer:

(x - 5)² + (y + 6)² = 16

Step-by-step explanation:

assuming you require the equation of the circle

the equation of a circle in standard form is

(x - h)² + (y - k)² = r²

where (h, k ) are the coordinates of the centre and r is the radius

here (h, k ) = (5, - 6 ) and r = 4 , then

(x - 5)² + (y - (- 6) )² = 4² , that is

(x - 5)² + (y + 6)² = 16

If f(x)={x+4 if x≤−2
-x if x>−2,
what is f(−4)?

A. -2
B. 4
C. -4
D. 0

Answers

Since -4 is less than or equal to -2, we use the first part of the definition of f(x) which is f(x) = x + 4 if x ≤ -2. Therefore,

f(-4) = (-4) + 4 = 0.

So, the answer is D. 0.

Other Questions
A survey of 7th and 8th grade student who were asked whether or not they were in favor of or against school uniforms. This two-way table shows the results. How many 7th grade students are against school uniforms? true or false: at the initial examination in the framingham study, coronary heart disease was found in 5 per 1000 men ages 30-44, and in 5 per 1000 women ages 30-44. the inference that in this age group men and women have an equal risk of getting coronary heart disease is incorrect because the data are prevalence data and not incidence data. group of answer choices true false research shows the worse market conditions are, the more likely executives of a firm are to choose union strategies. a. building b. avoidance c. bargaining d. cooperation a hacker is able to install a keylogger on a user's computer. what is the hacker attempting to do in this situation? An allosteric enzyme can exist in two states, _____ and _____.tense; responsivetense; relaxedturgid; relaxedtight; responsivetight; relaxed is it ok to keep my ac running and just stop the car's engine to save gas and keep cool while waiting for my husband? the hydration of ion: what interactions are at work in an aqueous salt solution to promote hydration? Escriba ecuaciones inicas netas balanceadas para las reacciones qu ocurren en cada uno de los casos siguientes. Identifique el o los iones espectadores de cada reaccin. (a) Cr2(SO4)3(ac) + (NH4)2CO3(ac)=(b) AgNO3(ac) + K2SO4(ac) =(c) Pb(NO3)2(ac)+KOH(ac)= La Suma delos cuadrados de dos nmeros naturales consecutivos es 181 halla dichos numeros Which IDPS activity could detect a DoS attack? a. protocol state tracking b. signature detection c. traffic monitoring d. IP packet reassembly. The city state of Venice should only be governed by merchants who understand buisness and not by catholic clergy who only understand the Bible ? explain why we call the national halothane study an observational study rather than an experiment, even though it compared the results of using different anesthetics in actual surgery.in order to be an experiment, the subjects would have to be randomly selected from the population. however, these are hospital patients who all have some disease or condition and have not been randomly selected from the population, which includes both healthy and sick people.in order to be an experiment, the treatments (choice of anesthetic) would have to be randomly assigned. instead, a patient's anesthetic is selected by his or her doctor(s).there is not enough information to say for sure, but it is safer to assume that it is only an observational study, so that we are not overconfident about the results.actually, it is an experiment and not an observational study. Your task is to implement a simplified inventory tracker system for a large retail store. You are given a price list that describes the current A small tree that is 8 feet tall casts a 4-foot shadow, while a building that is 24 feet tall casts a shadow in the same direction. Determine the length of the building's shadow. 6 feet 12 feet 18 feet 48 feet under the equipment breakdown protection coverage form, what condition will apply if the covered equipment is subject to a dangerous exposure? Four score and 7 years ago blank brought forth on this continent, a new nation, conceived in the liberty, and dedicated to the proposition that all men are created equal. now blank are engaged in a civil war, testing weather blank Nation blank or any Nation so conceived and dedicated, can long endure. we are met on a great battlefield l this. but, in large sense, blank cannot dedicate -- we cannot consecrate -- we cannot Hollow this ground. the brave men, living and dead, who struggled here, have consecrated it, far above our poor power to add or detract . the world will little note, nor long remember what we say here, but it can never forget what they did here . it is for us the living, rather, to be dedicated here to unfinish the work which blank who fought here have thus far so nobly advanced. it is rather for us to be here dedicated to the great task remaining before us -- that from these honored dead we take devotion to that cause for which they gave the least full measure of devotion -- that we are highly resolved that these dead shall not have died in vain -- that this nation, under God , shall have a new birth of freedom -- and that the government of people, by the people, for the people, shall not perish from the earth. Lenders look at a HELOC balance of less than $50,000 as if ________________.It were a credit cardIt were an assetIt were a paid mortgageIt were cash Consider the reaction described by the chemical equation shown.C2H4(g)+H2O(l)C2H5OH(l)rxn=44.2 kJUse the data from the table of thermodynamic properties to calculate the value of rxnat 25.0 C.Srxn= ? JK1Calculate rxn.Grxn= ? kJIn which direction is the reaction, as written, spontaneous at 25 Cand standard pressure?reversebothneitherforward Please help!! URGENT!! I dont understand For Kittle Co., a stronger Canadian dollar has a stronger influence on Canadian dollar ___ than it does on Canadian dollar ___ Step 2 In the previous stage, you saw that Kittle's operating structure, with low sales in Canada and high cost of materials from Canadian suppliers, was a source of significant economic exposure each quarter. Because of this, Kittle has decided to restructure it's operating structure. The largest part of the restructure involves an increase in U.S. operating expense in order to pay for efforts to increase Canadian sales, while also ordering more supplies from U.S. suppliers instead of Canadian suppliers. This restructuring also includes using more U.S. sources for financing instead of Canadian sources.