Will you ever completely remove the drug from your system? Explain your reasoning.

Will You Ever Completely Remove The Drug From Your System? Explain Your Reasoning.

Answers

Answer 1

Answer

The drug cannot be completely eliminated from one's system.

This is because the kidney removes 25% of the drug, leaving 75% at any time; the 75% of any number will give a smaller number, but never zero.

So, the amount of the drug in the body system can become extremely low, but it can never be 0.

The mathematical proof is shown under explanation.

Explanation

We are told that the kidney filters off 25% of the drug out of the system every 4 hours.

This means that 75% of the dosage of the drug remains in the person's system every 4 hours.

If one starts with A₀ of the drug and classify every 4 hour time period as n

At n = 1,

A₁ = 0.75 (A₀)

A₂ = 0.75 (A₁) = 0.75² (A₀)

Aₙ = 0.75ⁿ (A₀)

For this question, we start wit 1000 mg

A₀ = 1000 mg

We are then asked to calculate if Aₙ, the amount of drug in the system after n time periods, can ever be 0

Aₙ = 0.75ⁿ (A₀)

0 = 0.75ⁿ (1000)

To solve for n, if there's an n for when the value of Aₙ = 0, we first divide both sides by 1000

0 = 0.75ⁿ (1000)

0 = 0.75ⁿ

We then take the natural logarithms of both sides

In 0 = In (0.75ⁿ)

In (0.75ⁿ) = In 0

n (In 0.75) = In 0

But, since In 0 does not exist, it shows that there is no value of n that can make the value of Aₙ go to 0.

Hope this Helps!!!


Related Questions

Hey could someone help me out with this thank you

Answers

Karen will run more than 28

On its website a tv station displays temperature data for each hour during the past 24 hours. The data are displayed as using two different functions on a line graph. One function shows the current temperature and the other function shows the historical average. Which quantities are represented by the y-values on the line graph

Answers

, Given the question, we are asked to find which of the quantities are represented by the y-values on the line graph .

Explanation

In the question, we are told that the tv station displays temperature data using two different functions on a line graph. One of the functions shows the current temperature and the other function shows the historical average.

A function, by definition, can only have one output value(y) for any input value. In this case the input values are the time the temperature which we result in the output value of the historical average and temperature.

Therefore,

Answer

Option D

Tank B, which initially contained 80 liters of water, is being drained at a rate of 2.5 liters per minute. How many liters of water remain in the tank after 7 minutes?

Answers

Tank B originally had 80 liters of water.

Water is being drained off the tank at a rate of 2.5 liters per minute.

After 7 minutes have passed, the tank has lost 7*2.5 = 17.5 liters of water.

This means the tank still has 80 - 17.5 = 62.5 liters of water.

After 7 minutes 62.5 liters of water remain in the tank

The system of equations may be solved by hand calculation or by using the crossing-graphs method.Solve the following system using the crossing-graphs method.2x - y = 04x + 2y = 48(x, y) = (_____,_____)

Answers

The first thing you can do is graph each of the equations. To do this, you can write the equations following the form

[tex]y=mx+b[/tex]

Where m is the slope of the line and b the intersection point with the y axis. Then

[tex]\begin{gathered} 2x-y=0 \\ 2x=y \\ y=2x \\ \text{ And the other equation} \\ 4x+2y=48\text{ } \\ \text{To simplify the equation, you can divide by 2 both sides of the equation} \\ 2x+y=24 \\ y=-2x+24 \end{gathered}[/tex]

Graphing you have

The solution of the system of equations will be the point at which both lines intersect. Therefore, the solution is (6,2).

REI pays $330.30 for a 6-person tent and the markup is 35% of cost. Find the markup.

Answers

First convert 35% into decimal

35% → 0.35

To find 35% of $330.30, multiply it to its decimal

$330.30 ˣ 0.35 = $115.605

Rounding off to the nearest cent.

The markup of the tent is $115.61

Your psychology class has 45 students. You want to ask an SRS of four students from your class whether they prefer taking online or face-to-face courses. You label the students 01, 02, . . . , 45. You enter the table of random digits at this line:

78314 96529 67532 98144 28944 26687 49634 88274 20361

Your SRS contains the students labeled

A. 14, 32, 42, 44.
B. 31, 29, 44, 28.
C. 31, 29, 29, 44.
D. 31, 49, 29, 44.
E. 78, 31, 49, 65.

Answers

Answer:

Step-by-step explanation:

The answer is c! :)

Answer:

The answer is B. 31, 29, 44, 28.

Step-by-step explanation:

find the value of. abe, bec, and the minor arc ec

Answers

Answer

Angle ABE = 64°

Angle BEC = 48°

Minor arc EC = 134°

Explanation

The key to solving this is to take a look at this image below

According to the tangent-chord theorem, we know that

Tangent Chord angle ABE = (Intercepted arc BE)/2

Angle ABE = (128°/2)

Angle ABE = 64°

Tangent chord angle CED = (Intercepted arc EC)/2

68° = (Minor arc EC/2)

Multiply both sides by 2

136° = Minor arc EC

To find the Angle BEC, we need to first obtain the arc BC

The total angle around a circle is 360°

Arc BE + Arc BC + Arc EC = 360°

128° + Arc BC + 136° = 360°

Arc BC = 360° - 128° - 136°

Arc BC = 96°

Then to find the Angle BEC, the image attached below guides us

So, we can easily say that

Angle BEC = ½ (Arc BC)

Angle BEC = ½ (96°)

Angle BEC = 48°

Hope this Helps!!!

Consider functions h and k. Every x value has a relationship in k of x. What is the value of (h o k)(1)? A. 28 B. 4 C. 1 D. 0

Answers

Recall that:

[tex](f\circ g)(x)=f(g(x)).[/tex]

Therefore:

[tex](h\circ k)(1)=h(k(1)).[/tex]

From the given diagram we get that:

[tex]k(1)=3.[/tex]

Then:

[tex]h(k(1))=h(3).[/tex]

Now, from the given table we get that:

[tex]h(3)=28.[/tex]

Therefore:

[tex](h\circ k)(1)=28.[/tex]

Answer: Option A

A rectangle with an area of 20 square units is dilated by the scale factor of 3.5. find the area of the new rectangle

Answers

We are given the area of a rectangle. The area of a rectangle is the product of the length and the height. Therefore, we have:

[tex]A=lh[/tex]

If we scale the rectangle by a factor of 3.5 this means that we multiply the length and the height by 3.5, like this:

[tex]A^{\prime}=(3.5l)(3.5h)[/tex]

Solving the product:

[tex]A^{\prime}=12.25lh[/tex]

Since "lh" is the original area we have:

[tex]A^{\prime}=12.25A[/tex]

Now, we substitute the value of the original area:

[tex]A^{\prime}=12.25(20)[/tex]

Solving the operations:

[tex]A^{\prime}=245[/tex]

Therefore, the new area is 245 square units.

Find the derivativef(x) = 1 / (x - 2)

Answers

ANSWER

[tex]\frac{df}{dx}=-\frac{1}{(x-2)^2}[/tex]

EXPLANATION

We want to find the derivative of the given function:

[tex]f(x)=\frac{1}{x-2}[/tex]

First, we have to rewrite the function as follows:

[tex]f(x)=(x-2)^{-1}[/tex]

Next, make the following substitution:

[tex]a=x-2[/tex]

The function now becomes:

[tex]f(x)=a^{-1}[/tex]

Apply the chain rule of differentiation:

[tex]\frac{df}{dx}=\frac{df}{da}\cdot\frac{da}{dx}[/tex]

Therefore, we have that:

[tex]\frac{df}{da}=-1\cdot a^{-1-1}=-a^{-2}[/tex]

and:

[tex]\frac{da}{dx}=1[/tex]

Therefore, the differentiation of the function is:

[tex]\begin{gathered} \frac{df}{dx}=-a^{-2}\cdot1 \\ \Rightarrow\frac{df}{dx}=-(x-2)^{-2}\cdot1 \\ \frac{df}{dx}=-\frac{1}{(x-2)^2} \end{gathered}[/tex]

a gate that is 5 ft tall casts a shadow 9 ft long the house behind the gate cast a shadow of 54 ft how about how many feet tall is the house

Answers

In this case, we'll have to carry out several steps to find the solution.

Step 01:

Data

gate:

hg = 5 ft

shadow = 9ft

house

hh = ?

shadow = 54 ft

Step 02:

We must apply the theorem of thales.

[tex]\frac{hg}{hh}=\frac{shadow\text{ gate}}{\text{shadow house}}[/tex][tex]\frac{5ft}{hh}=\frac{9ft}{54\text{ ft}}[/tex]

hh * 9 ft = 5 ft * 54 ft

hh = (5 ft * 54 ft ) / 9 ft

hh = 270 ft ² / 9 ft = 30 ft

The answer is:

The house is 30ft tall.

how do I use a right triangle to write the following expression as an algebraic expression?

Answers

So, we want to express the following:

[tex]\sec (\sin ^{-1}(\frac{x}{\sqrt[]{x^2+81}}))[/tex]

As an algebraic expression.

If:

[tex]\begin{gathered} \sin ^{-1}(\frac{x}{\sqrt[]{x^2+81}})=\theta \\ \text{Then,} \\ \sin (\theta)=\frac{x}{\sqrt[]{x^2+81}} \end{gathered}[/tex]

We could draw the following triangle:

Remember that the secant function relations the hypotenuse of the triangle and the adjacent side of the triangle. So first, we should find the adjacent side using the pythagorean theorem:

[tex]\begin{gathered} a^2=(\sqrt[]{x^2+81})^2-x^2 \\ a^2=x^2+81-x^2 \\ a^2=81\to a=9 \end{gathered}[/tex]

Therefore, the adjacent side is 81. And, the value of:

[tex]\sec (\sin ^{-1}(\frac{x}{\sqrt[]{x^2+81}}))[/tex]

Is:

[tex]\sec (\sin ^{-1}(\frac{x}{\sqrt[]{x^2+81}}))=\frac{\sqrt[]{x^2+81}}{9}[/tex]

(blank)+(7x+24)=180
7x + (blank)+ = 180
7x =
x =

Answers

Answer:

first blank: 72°

2nd blank: 96

next line: 84

last: 12

Step-by-step explanation:

The two marked angles are called same-side interior angles or consecutive angles.

They add up to 180°

Thats how you know how to set up the equation.

72° + 7x + 24 = 180

Add the plain numbers (the 72 and 24)

7x + 96 = 180

subtract 96 from both sides.

7x = 84

Divide both sides by 7.

x = 12

Renta scored 409 points in a video game. This was 223 more points than Sadia score (s). Which equation does not represent this situation? And why?

A) 223 = 409 - s

B) s = 409 - 223

C) s = 409 + 223

D) 223 + s = 409

Answers

Answer:C

Step-by-step explanation: S is equal to a number less than 409 and if you add 223 you go over 409

Simplify the following expression.(12x-2.1)-(19x+6.9)

Answers

The given algebraic expression is

[tex](12x-2.1)-(19x+6.9)[/tex]

To simplify this expression, we need to solve those parentheses in the first place, multiplying the sign in front of each of them.

[tex]12x-2.1-19x-6.9[/tex]

Now, we reduce like terms. Remember that like terms are those who have the same variable, and those who don't have variables at all.

[tex]12x-19x-2.1-6.9=-7x-9[/tex]

Therefore, the simplest form of the given expression is[tex]-7x-9[/tex]

Solve the system of equations.y= x2 - 3x + 6y = 2x + 6

Answers

We have the following:

[tex]\begin{gathered} y=x^2-3x+6 \\ y=2x+6 \end{gathered}[/tex]

We subtract the equations:

[tex]\begin{gathered} y-y=x^2-3x+6-2x-6 \\ 0=x^2-5x \\ 0=x(x-5) \\ x=0;x=5 \end{gathered}[/tex]

for y:

[tex]\begin{gathered} y=2\cdot0+6 \\ y=6 \\ y=2\cdot5+6 \\ y=16 \end{gathered}[/tex]

therefore, the answer is:

(0,6) and (5,16), the option D.

2.3x + 8 = - 1.7x - 8 solve for x

Answers

The value of x after solving (2.3x + 8) = (-1.7x-8) is -4.

According to the question,

We have the following expression:

(2.3x + 8) = (-1.7x-8)

Now, moving -1.7x from the right hand side to the left hand side will result in the change of its sign from minus to plus:

2.3x+1.7x +8 = -8

4x+8 = -8

Now, moving 8 from the left hand side to the right hand side will also result in the change of the sign from plus to minus:

4x = -8-8

4x = -16

x = -16/4 (4 was in multiplication on the left hand side. So, it is in division on the right hand side.)

x = -4

Hence, the value of x is -4.

To know more about solving here

https://brainly.com/question/315182

#SPJ1

Which is a perfect square?583644

Answers

Solution:

A perfect square is a number that can be expressed as the product of an integer by itself or as the second exponent of an integer.

Hence,

[tex]36=6^2=6\times6[/tex]

Therefore, the perfect square is 36.

Question HelpMultiple Representations A vehicle ses 7 gallons of gasoline to travel 147 miles. The vehicle uses gasoline at a steady rate. Use pencil and paper to draw a picture that models the situation Write a table of equivalent ratiosThen use the table to find the number of gallons of gasoline the vehicle uses to travel 63 milesComplete the tableGallons Miles1231411421

Answers

We know a vehicle uses 7 gallons of gasoline to travel 147 miles.

This gives us a ratio: 147/7 = 21

The vehicle travels 21 miles per gallon of gasoline

The situation can be modeled as a line with a constant slope of 21 miles/gallon

If we use the horizontal axis for the number of gallons and the vertical axis for the miles traveled, we can draw an approximate graph

Let's give the gallons (g) some values to fill up the table:

For g=1, miles = 21

For g=2, miles = 42

For g=3, miles = 63

For g=7, miles = 147

For g=14, miles = 294

For g=21, miles = 441

The graph is shown below

f(x) = x + 4 and g(x) = x - 1Step 3 of 4: Find (f 3)(x). Simplify your answer.Answer(f)(x) =

Answers

For this problem, we are given two functions, we need to determine the composite between these two expressions.

The two functions are:

[tex]\begin{gathered} f(x)=x+4\\ \\ g(x)=x-1 \end{gathered}[/tex]

This composite is the product of the two functions, therefore we have:

[tex]\begin{gathered} (f\cdot g)(x)=(x+4)\cdot(x-1)\\ \\ (f\cdot g)(x)=x^2-x+4x-4\\ \\ (f\cdot g)(x)=x^2+3x-4 \end{gathered}[/tex]

The answer is x²+3x-4.

How to solve 11 3/7 × 7/10 =

Answers

Given:

The objective is to solve the given equation.

The given equation can be solved by,

[tex]\begin{gathered} =11(\frac{3}{7})\cdot\frac{7}{10} \\ =\frac{11\cdot3}{10} \\ =\frac{33}{10} \\ =3.3 \end{gathered}[/tex]

Hence, the value of the equation is 3.3

in health class, the students were asked what grain they prefered in their breakfast cereal. The results are shown in the table. what's the probability that a randomly chosen student in the health class listed oats as their favorite grain?A. 20%B. 25%C. 35%D. 14%

Answers

To find the probability of a randomly choosen student listing oats as its favorite grain, divide the number of students that chose oats by the total number of students and multiply the fraction by 100%.

To find the total number of students, add the numbers under each cereal:

[tex]12+14+8+6=40[/tex]

The number of students who chose oats, is 14. Then, the requested probability, is:

[tex]\frac{14}{40}\times100=35\text{ \%}[/tex]

Mikayla and Courtney both leave the internet cafe at the same time, but in opposite directions. If Courtneytravels 7 mph faster than Mikayla and after 6 hours they are 162 miles apart, how fast is each traveling?

Answers

Courtney travels at 17mph and Mikayla at 10mph

1) In this question, we need to set equations for that.

Courtney Mikayla

v +7 v speed

2) Note that we have to use this relation:

[tex]Speed\, {\times time=distance}[/tex]

So, we can write out the following:

[tex]\begin{gathered} v6+(v+7)6=162 \\ v6+6v+42=162 \\ 12v+42-42=162-42 \\ 12v=120 \\ v=10 \end{gathered}[/tex]

So we can now plug into Mikayla's speed and Courtney

Mikayla travels at 17mph and Courtney at 10mph

Ben, Claire and Devon are training for a triathalon. Today, they are practicing their swimming by swimming one mile. Ben swam 0.77 of the mile before stopping. Claire swam 3/5 of the mile and Devon swam 82% of the mile before stopping. Who swam the farthest distance? Who swam the shortest distance?

Answers

Given:

Ben, Claire, and Devon are swimming one mile.

Ben swam 0.77 of the mile before stopping.

So, the distance Ben swam = 0.77 x 1 = 0.77 mile

Claire swam 3/5 of the mile.

So, the distance Claire swam = 3/5 x 1 = 3/5 = 0.6 miles

Devon swam 82% of the mile before stopping.

So, the distance Devon swam = 82% of 1 mile = 0.82 x 1 = 0.82 miles

Arrange the distances in order from the largest to the least:

0.82, 0.77, 0.6

So, the answer will be:

The farthest distance is for Devon = 0.82 miles

The shortest distance is for Claire = 0.6 miles

helpppppppppppppppppppp

Answers

Answer: [tex]f^{-1}[/tex] = {(17, 16), (8, 3), (3, 8), (4, 4)}

Step-by-step explanation:

   To list the inverse function, we will simply switch the x- and y-values in each coordinate pair. Coordinate points are written as (x, y).

f = {(16, 17), (3, 8), (8, 3), (4, 4)}

[tex]f^{-1}[/tex]= {(17, 16), (8, 3), (3, 8), (4, 4)}

ABC is dilated by a factor of 5 produce A'B'C.What is A'C, the length of AC after the dilation? What is the measure of angle A?

Answers

We have that the scale factor is 5, then, the dilation is an enlargement.

Then, the new lengths are:

[tex]\begin{gathered} A^{\prime}C^{\prime}=5AC=5\cdot5=25 \\ A^{\prime}B^{\prime}=5AB=5\cdot4=20 \\ B^{\prime}C^{\prime}=5BC=5\cdot3=15 \end{gathered}[/tex]

therefore, A'C' =25.

Finally, the dilations don't affect the angles, therefore, angle A remains with the measure of 37°

See photo for problem

Answers

Answer:

possible outcome= {H,T}

number of possible outcome=2

obtaining a tail(T)=1

n(T)=1

P(T)=n(T)/number of possible outcome

=1/2

IF log x = 1/₂, find log (10x²)​

Answers

Answer:

2

Step-by-step explanation:

log ab = log a + log b

Similarly,

log 10x² = log 10 + log x²

log a^b = b log a

Similarly,

log 10x² = 2 log x

= 2 * 1/2

= 2/2

= 1

Note :-

The value of log 10 = 1

Hence,

log 10x²

= log 10 + log x²

= 1 + 1

= 2

The area of a rectangle is 28m^2, and the length of the rectangle is 5 meters less than three times the width. Find the dimensions of the rectangle. L:W:

Answers

The area of a rectangle is given by the formula

[tex]A=L*W[/tex]

where

A=28 m2

L=3W-5

substitute given values in the formula

[tex]\begin{gathered} 28=(3w-5)W \\ 28=3w^2-5w \\ 3w^2-5w-28=0 \end{gathered}[/tex]

Solve the quadratic equation

Using the formula

we have

a=3

b=-5

c=-28

substitute

[tex]w=\frac{-(-5)\pm\sqrt{-5^2-4(3)(-28)}}{2(3)}[/tex][tex]w=\frac{5\pm19}{6}[/tex]

The solutions for w are

w=4 and w=-2.33 ( is not a solution because is a negative number)

so

The width w=4 m

Find out the value of L

L=3w-5=3(4)-5=7 m

therefore

L=7 mW=4 m

Derrick's football team needs to raise at least $1,000 for new uniforms they have collected 480 so far which inequality represents the amount of money,m, the team still needs to raise A. m>$480 B. m<$480 C.m<$520 D.m>$520

Answers

The inequality representing the amount of money, m. Derrick's football team needs to raise is D. m>$520

What is inequality?

In mathematics, Inequality is part of equations solved with the use of the some special type of equality signs. The signs used inequality calculations are

greater thanless thangreater than or equal toless than or equal to

Given that:

Derrick's football team needs to raise at least $1,000

The team collected 480

To solve the given problem we have the inequality in the form

at least $1,000 ≡ greater than or equal to 1000

m > $1000

having collected $480 so far. The amount collected is subtracted from the $1000

m > $1000 - $480

m > $520

Read more on inequality here: https://brainly.com/question/25275758

#SPJ1

Other Questions
here are three isotopes of silicon: si-28, si-29, and si-30, with relative abundances of 92.23%, 4.67%, and 3.1%, respectively. determine the atomic mass of silicon. In carrying out the first standardization in this experiment, a student used 0.5793 g of potassium hydrogen phthalate (khp) and 24.55 ml of a naoh solution are needed to reach the equivalence point. what is the concentration (in mol/l) of the student's naoh solution? include only the numerical answer (no units). due in an hour pls help!! Two legs of a step ladder are each 4 metres long. The angle formed between the two legs is 30degrees.Make a labelled scale drawing of the ladder using the scale Icm=0.5 metres and fill in the blanksbelow. as you perform a sonographic exam, you switch from a 3.5 mhz transducer to a 7.0 mhz transducer to image a superficial structure. compared to the 3.5 mhz transducer, what will the 7.0 mhz attenuation rate and wavelength be? Can someone help me make a thesis statement on why was Anna May Wong a frontier in history? Ill mark you brainliest Need help pleaseI was bad at math in school so lwant to learn 13. if we assume that there is no fixed manufacturing overhead and the variable manufacturing overhead is $7 per direct labor-hour, what is the estimated cost of goods sold and gross margin for july? the total cost of 4800 pounds of the metal now held in inbentory is 310000 the total selling price is 862000 and the estimated costs of disposal are 13800 at what amount should the inventory of 4800 pounds be reported in the balance sheet Henry has 3 3/5 metres of rope, and Sam has a piece of rope that is 1 1/2 metresshorter. What is the total amount of rope that the boys have together? HOLLYWOOD DREAMS OF WEALTH, YOUTH, AND BEAUTY Write an equation of a line that is parallel to thegiven line. Then, write one that is perpendicular.x = -4 7. Principal = $39,300, Rate = 4.5%, Time = 6 months. What will that total principal + interest payment be rounded to the nearest dollar? o Lidhe total amount of if the probability of drawing an A or B is 9/25, what is the probability of the complementary event? The table to right gives the projections of the population of a country from 2000 to 2100.Answer parts (a) through (c). How many grams of CO are produced when 33.0 g of C reacts? Fe2O3(s)+3C(s)2Fe(s)+3CO(g) What type of energy is the sum of kinetic and potential energy in an object that is used to do work?. ANSWER ASAP!! Raise the monomial to a power: -2m^3n^2t to the power of 4 a taxpayer may exclude which of the following from their gross income?A. an allocation of income from a business structured as a partnership, based on the taxpayers percentage of ownership.B. dividend income from a mutual fund investment.C. gain from the sale of rental property.D. life insurance if paid by reason of death of the insured Solve the system of equations below using any method you learned in this unit. Show all work (even if you are using your calculator).