If f(x) = ln [ sin2(2x)(e-2x+1) ] , then f’(x) is

I want to solve ?

If F(x) = Ln [ Sin2(2x)(e-2x+1) ] , Then F(x) Is I Want To Solve ?

Answers

Answer 1

Here we will write our function in regular form using an identity.

[tex]log(ab)=loga+logb[/tex][tex]log(a/b)=loga-logb[/tex]

Therefore, the rule of our function [tex]f(x)[/tex] will be as follows.

[tex]f(x)=ln(sin^2(2x))+ln(e^{-2x}+1)[/tex]

The derivative of the natural logarithm [tex]ln(x)[/tex] function is of the following form.

[tex](ln(x))'=\frac{x'}{x}[/tex]

It is found by dividing the derivative of the function in [tex]lnx[/tex] by the function in [tex]lnx[/tex].

For example:

[tex](ln(5x))'=\frac{(5x)'}{5x} =\frac{5}{5x} =\frac{1}{x}[/tex]

According to this information, let's take the derivative of our function.

[tex]f'(x)=\frac{2sin(4x)}{sin^2(2x)} +\frac{-\frac{2}{e^{2x}} }{e^{-2x}+1}[/tex][tex]f'(x)=4cot(2x)-\frac{2}{1+e^{2x}}[/tex]Rules:[tex]((sin2x)²)'=2.2sin(2x)cos(2x)=2sin(4x)[/tex][tex](e^x)'=x'.e^x[/tex]

Related Questions

9. If L 1 equals 120 then what is the measure of its supplement <2=

Answers

Supplementary angles are angles whose addition sums up to 180 degrees.

Therefore, if angle 1 measures 120, then its supplement which is angle 2, must mean both add up to 180.

Hence, you have

Angle 1 + Angle 2 = 180

120 + Angle 2 = 180

Subtract 120 from both sides of the equation

Angle 2 = 180 - 120

Angle 2 = 60 degrees

By definiton, two angles are complimentary angles if they both add up to 90 degrees. Hence if angle L5 equals 50 degrees, then its compliment would be derived as 90 - 50 which equals 40. The compliment of angle L5 which is 50 degrees, equals 40 degrees.

Which of the following is an equation of a line that is parallel to y = 4x - 5 and has a y-intercept of (0, 7)?

Answers

Answer:

Step-by-step explanation:

To start your equation is in the format y=mx+b.

For a line to be parallel it must have the same slope (m) so we know 4 must remain the same. x & y will not change since they represent the variables. y=4x (so far) then the point (0,7) as stated is the y intercept. 0 is the x value and 7 is the y we need to add 7 to our equation.

final equation y=4x+7

use and show all conversion factors to convert 352 inches per second to miles per hour. 352 inches divided by 1 second

Answers

Okay, here we have this:

We need to convert 352 inches per second to miles per hour. So we obtain the following:

[tex]\begin{gathered} \frac{352in}{1sc}\cdot\frac{1mile}{63360in}\cdot\frac{3600sc}{1h} \\ =\frac{20\text{miles}}{h} \end{gathered}[/tex]

Finally we obtain that 352 inches per second 20 are miles per hour.

Marcy baked 132 cookies . She is packaging boxes of eight cookies to give as a gift to he friends how many boxes will she make .

Answers

She will make 16 boxes.

To answer this question we simply have to divide the number of cookies (132) by the number of cookies that each box can contain.

Mathematically speaking:

[tex]132/8\text{ }[/tex][tex]16.5[/tex]

Since we can´t have half boxes, we have to round the number to 16.

16 boxes.

Is (6, –21) a solution to the equation y = –5x − –9?

Answers

Answer:

Explanation:

Given the equation:

[tex]y=-5x-(-9)[/tex]

When x=6:

omg i lost my tutor in the middle of math i need another one btw in fith grade not in middle school yet

Answers

[tex]\frac{6}{10}\text{/}\frac{1}{5}[/tex]

by definition the division of fractions can be found by

[tex]\frac{\frac{a}{b}}{\frac{c}{d}}=\frac{b\cdot c}{a\cdot d}[/tex]

According to this

[tex]\frac{\frac{6}{10}}{\frac{1}{5}}=\frac{6\cdot5}{10\cdot1}=\frac{30}{10}=3[/tex]

Given the definitions of f(a) and g(x) below, find the value of (19)( 1),f (x) = x2 + 3x – 11g(x) = 3a + 6

Answers

The given functions are,

[tex]\begin{gathered} f(x)=x^2+3x-11_{} \\ g(x)=3x+6 \end{gathered}[/tex]

Fog can be determined as,

[tex]\begin{gathered} \text{fog}=f(g(x)) \\ =f(3x+6) \\ =(3x+6)^2+3(3x+6)-11 \\ =9x^2+36+36x+9x+18-11 \\ =9x^2+45x+43 \end{gathered}[/tex]

The value of fog(-1) can be determined as,

[tex]\begin{gathered} \text{fog}(-1)=9(-1)^2+45(-1)+43 \\ =9-45+43 \\ =7 \end{gathered}[/tex]

Thus, the requried value is 7.

1. what is the area of the board shown on the scale drawing? explain how you found the area.2. how can Adam use the scale factor to find the area of the actual electronics board? remember, he uses a different method than Jason.3. what is the area of the actual electronics board?

Answers

Answer:

1. 1800 square cm.

2. See below

3. 45000 square cm.

Explanation:

Part 1

The dimensions of the drawing are 36cm by 50cm.

[tex]\begin{gathered} \text{The area of the board}=36\times50 \\ =1800\operatorname{cm}^2 \end{gathered}[/tex]

Part 2

Given a scale factor, k

If the area of the scale drawing is A; then we can find the area of the actual board by multiplying the area of the scale drawing by the square of k.

Part 3

[tex]\begin{gathered} \text{Area of the scale drawing}=1800\operatorname{cm}^2 \\ \text{Scale Factor,k=5} \end{gathered}[/tex]

Therefore, the area of the actual drawing will be:

[tex]\begin{gathered} 1800\times5^2 \\ =45,000\operatorname{cm}^2 \end{gathered}[/tex]

Jordan plotted the graph below to show the relationship between the temperature of his city and the number of cups of hot chocolate he sold daily:A scatter plot is shown with the title Jordans Hot Chocolate Sales. The x axis is labeled High Temperature and the y axis is labeled Cups of Hot Chocolate Sold. Data points are located at 20 and 20, 30 and 18, 40 and 20, 35 and 15, 50 and 20, 45 and 20, 60 and 14, 65 and 18, 80 and 10, 70 and 8, 40 and 2.Part A: In your own words, describe the relationship between the temperature of the city and the number of cups of hot chocolate sold. (2 points)Part B: Describe how you can make the line of best fit. Write the approximate slope and y-intercept of the line of best fit. Show your work, including the points that you use to calculate the slope and y-intercept. (3 points)

Answers

A.

Overall it has a relation that there are more sold cups when the temperature is lower. On the other hand, based on the 40 degrees part, that have to different values of two different days, we can say is not the only factor.

B.

The best lineal approach is the line created with the points at 20 and 80 degrees. First the slope:

[tex]m=\frac{y1-y2}{x1-x2}=\frac{20-10}{20-80}=\frac{10}{-60}=-\frac{1}{6}[/tex]

Now the intercept with y axis, b:

[tex]\begin{gathered} y=mx+b \\ 20=20(-\frac{1}{6})+b \\ 20+\frac{20}{6}=b=23.33=\frac{70}{3} \end{gathered}[/tex]

The final line formula is:

[tex]y=-\frac{x}{6}+\frac{70}{3}[/tex]

Use the Rational Zeros Theorem to find all the real zeros of the polynomial function. Use the zeros to factor f over the real numbers. Hint solve this problem using P and Q's and synthetic division f(x) = x^3 + 2x^2 - 5x - 6A -3, -1, 2; f(x) = (x + 3)(x + 1)(x - 2)B-1; f(x) = (x + 1)(x2 + x - 6)C-3; f(x) = (x + 3)(x2 - x - 2)D-2, 1, 3; f(x) = (x + 2)(x - 1)(x - 3)

Answers

[tex]f(x)=x^3+2x^2-5x-6[/tex]

Since all coefficients are integers, we can apply the rational zeros theorem.

The trailing coefficient is -6 with the following factors (possible values for p):

[tex]p\colon\pm1,\pm2,\pm3,\pm6[/tex]

The leading coefficient is 1, with factors:

[tex]q=\pm1[/tex]

Therefore, all the possible values of p/q are:

[tex]\frac{p}{q}\colon\pm\frac{1}{1},\pm\frac{2}{1},\pm\frac{3}{1},\pm\frac{6}{1}[/tex]

Simplifying, the possible rational roots are:

[tex]\pm1,\pm2,\pm3,\pm6[/tex]

Next, we have to check if they are roots of the polynomials by synthetic division, in which the remainder should be equal to 0.

0. Dividing ,f (x), by ,x−1,. Remainder = ,-8, ,+1, is ,NOT ,a root.

,

1. Dividing ,f (x), by x+,1,. Remainder = 0, ,-1, ,IS ,a root.

,

2. Dividing ,f (x), by x-2. Remainder = 0, ,+2, ,IS ,a root.

,

3. Dividing ,f (x), by ,x+2,. Remainder = ,4, ,-2, is ,NOT ,a root.

,

4. Dividing ,f (x), by ,x−3,. Remainder = 24,, ,+3, is ,NOT ,a root.

,

5. Dividing ,f (x), by ,x+3,. Remainder = 0,, ,-3, IS ,a root.

,

6. Dividing ,f (x), by ,x−6,. Remainder = 252,, ,+6, is ,NOT ,a root.

,

7. Dividing ,f (x), by ,x+6,. Remainder = -120,, ,-6, is ,NOT ,a root.

Actual rational roots: A. -3, -1, 2; f(x) = (x + 3)(x + 1)(x - 2)

mrs smith took her 3 kids and 3 of thejr friends to the Strawberry field. how many kids are there?

Answers

Mrs.Smith took : her 3 kids + 3 of their friends = 3 + ( 3x 3 ) = 12 kids

Answer:

There are 3 kids, and 3 friends.

3 + 3 = 6

there are a total of 6 kids.

In the diagram shown, ray CD is perpendicular to ray CE. If the measure of DCF is 115then what is the measure of ECF?

Answers

m∠FCE =25º

1) Since the measure of ∠DCF = 115º and ∠DCE = 90º then by the Angle Addition postulate we can state that

∠DCF = ∠DCE +∠FCE Plugging into that the given values

115º = 90º + ∠FCE Subtracting 90º from both sides

115-90=∠FCE

25º =∠FCE

2) Then the measure of ∠FCE is 25º

PLEASE HURRY ASAP
Determine which integer in the solution set will make the equation true.

4s − 14 = −6
S: {−1, 0, 1, 2}

Answers

The solution of the equation is s=2.

Linear Function

An equation can be represented by a linear function. The standard form for the linear equation is: y= mx+b , for example, y=7x+1. Where:

m= the slope. It can be calculated for Δy/Δx .

b= the constant term that represents the y-intercept.

For the given example: m=7and b=1.

For solving this question you should replace x for the given values ( −1, 0, 1, 2) in the equation 4s − 14 = −6. If you obtain -6, the value of s is a solution.

For s= -1 -> 4*(-1)-14= -4 -14= -20. Therefore, s=-1 is not the solution.

For s= 0 -> 4*(0)-14= 0 -14= -14. Therefore, s=0 is not the solution.

For s= 1 -> 4*(1)-14= 4 -14= -10. Therefore, s= 1 is not the solution.

For s= 2 -> 4*(2)-14= 8 -14= -6. Therefore, s=2 is the  solution.

Read more about the linear equations here:

brainly.com/question/2030026

#SPJ1

HELP PLEASEEEEE!!!!!!

Answers

The solutions of the indices are;

1)  2^7

2) 3^-4

3) 3^4

4) 2^4

What is the power?

We know that in this case, we would have to apply the laws of indices and the particular law that we are to apply in each case is dependent on the nature of the problem that have been posed. Let us recall that we are asked to ensure that we express the answer or the solution to the problem as a single power.

1) 64 * 256/128

2^6 * 2^8/2^7

2^6 + 8 - 7 = 2^7

2) 3^4/3^3 * 3^5

3^4 - (3 + 5) = 3^-4

3) 3^9/ (3^4)^1/2 * 3^3

3^9/ 3^2 * 3^3

3^9 - (2 + 3)

3^4

4) (2^3)^4 * 2^4 ÷ 32/ 2 * 64

2^12 * 2^4 ÷ 2^5/2^1 * 2^6

2^12 + 4 -5/2^1 + 6

2^16 -5/2^7

2^11/2^7

2^11 - 7

2^4

Learn more about laws of indices:https://brainly.com/question/27432311

#SPJ1

Pablo Is choosing at random from a bag of colored marbles. The probability he will choose a red marble is1/9What are the odds in favor of him choosing a redmarble?

Answers

Given:

[tex]\text{The probability to choose a red marble=}\frac{1}{9}[/tex]

The odds in favour of Pablo chosing a re marble is 1 : 8

Solve system of equations using the method of substitution. Identify wether the system represents parallel, coincident, or parallel lines.5x+2y=167.5x+3y=24

Answers

Given

5x+2y=16 ---(1)

7.5x+3y=24 ----(2)

Find

1) value of x and y

2) Type of system

Explanation

From equation (1)

[tex]\begin{gathered} 5x+2y=16 \\ 5x=16-2y \\ x=\frac{16-2y}{5} \end{gathered}[/tex]

Putting this value of x in equation 2

[tex]\begin{gathered} 7.5x+3y=24 \\ 7.5(\frac{16-2y}{5})+3y=24 \\ 1.5(16-2y)+3y=24 \\ 24-3y+3y=24 \end{gathered}[/tex]

From here we cannot find the values of x and y as 3y and -3y will cancel each other. Hence there is not a particular solution

Checking the type of system

From these equations we get

[tex]\frac{a1}{a2}=\frac{b1}{b2}=\frac{c1}{c2}[/tex]

Therefore the lines are coincident to each other

Therefore the lines have infinte solutions

Final Answer

Therefore the lines have infinte solutions

The lines are coincident to each other

A 14 m long ladder is placed against a tree. The top of the ladder reaches a point
13 m up the tree.

How far away is the base of the ladder from the base of the tree?

Give your answer in metres (m) to 1 d.p.

Answers

Answer:

Approximately 5.2 meters

Step-by-step explanation:

This formation will make a right triangle. The ground to the point in the tree is one of the legs. The base of the tree to the base of ladder is another leg and the length of the ladder is the hypotenuse. In this case, we already have the hypotenuse and one of the legs, so we need to find the value of another leg.

We can do so by using the Pythagorean Theorem which is [tex]a^2+b^2=c^2\\[/tex].

a and b represent the values of the two legs, and c is the hypotenuse. Since we already have the hypotenuse, we can change this equation a bit to find the other leg.

Let's assign the missing value, b in the theorem.

The new equation will be [tex]b^2=c^2-a^2[/tex].

We can insert the values for c and a and solve for b.

The new equation will be [tex]b^2 = 14^2-13^2[/tex].

[tex]b^2=196-169[/tex]

[tex]b^2=27[/tex]

[tex]\sqrt{b^2} =\sqrt{27}[/tex]

The square root of [tex]b^2[/tex] cancels out.

The approximate square root of 27 is 5.19 which we can round to 5.2.

Which expression is equivalent to (6 – 3x) + 9x ? 1 A. 8x + 2 B. 8x + 3 C. 10x-2 D. 10x - 6

Answers

Given to solve the expression:

[tex]\frac{1}{3}(6-3x)+9x[/tex]

step 1: Expand the bracket by multiplying each term by the factor outside

[tex]\begin{gathered} (\frac{1}{3}\times6)-(\frac{1}{3}\times3x)+9x \\ 2-x+9x \end{gathered}[/tex]

step 2: Simplify the expression obtained in step 1

[tex]\begin{gathered} 2-x+9x\text{ } \\ =2+8x \\ =8x+2 \\ \\ \text{The answer is \lbrack{}Option }A\rbrack \end{gathered}[/tex]

On a 7 question multiple-choice test, where each question has 2 answers, what would be the probability of getting at least one question wrong?Give your answer as a fraction

Answers

Solution

- This is a Binomial probability question. The formula for Binomial probability is:

[tex]\begin{gathered} P(r)=\sum\text{ }^nC_rp^rq^{n-r} \\ where, \\ n=The\text{ total number of trials} \\ r=\text{ The number of successful trials\lparen where answer is correct\rparen} \\ p=\text{ The probability of success \lparen The probability of getting a question } \\ right) \end{gathered}[/tex]

- We have been given:

[tex]\begin{gathered} n=7 \\ \text{ since there can only be two answers, it means that the} \\ \text{ probability of getting a question correct is:} \\ p=\frac{1}{2} \\ q=1-p=\frac{1}{2} \\ \\ \text{ The probability of getting at least 1 question wrong means the } \\ probability\text{ of getting 1, 2, 3, 4, 5, 6, or 7 question wrong.} \\ \\ \text{ Instead of calculating all these probabilities, we can simply say} \\ P(1)+P(2)+P(3)+P(4)+P(5)+P(6)+P(7)=1-P(0) \end{gathered}[/tex]

- Thus, we have:

[tex]\begin{gathered} P(0)=^7C_0(\frac{1}{2})^0(\frac{1}{2})^7 \\ P(0)=\frac{1}{128} \\ \\ 1-P(0)=1-\frac{1}{128}=\frac{127}{128} \end{gathered}[/tex]

Final Answer

The answer is

[tex]\frac{127}{128}[/tex]

how can you use the vertical line test and the horizontal line test to determine whether a graph represents a function and whether the graph is invertible?

Answers

In this case, we'll have to carry out several steps to find the solution.

Step 01:

Data

vertical line test = ?

horizontal line test = ?

Step 02:

vertical line test ===> function

any vertical line intersect the graph at only one point

horizontal line test ===> invertible

any horizontal line intersect the graph at only one point

graph:

horizontal line test = red

vertical line test = brown

That is the full solution.

What is the measure of ?ХvO A. 46°42°42"38°NуvO B. 42°O C. 40°O D. 38°

Answers

The value Z is denoted as the center of the circle. Therefore, arc UV and arc XY should be the same .

[tex]undefined[/tex]

Answer: A. 42°

Step-by-step explanation:

Hope this helps :)

Write the ordered pair with no spaces (x,y) of point C for j(x).

Answers

This problem is about functions.

In this case, we don't have function j(x) defined in order to find its ordered pairs.

However, assuming that function j(x) is a function of f(x), we can deduct that points C is

[tex]C(0,0)[/tex]

find the x value (6x+9)° (4x-19)°

Answers

In this problem m and n are parallel lines, and the first angle is an exteriar angle an the secon is a interior angle.

this two condition give us that the two angles are complementary anlges so the sum of them should be 180 so:

[tex]6x+9+4x-19=180[/tex]

and we can solve for x so:

[tex]\begin{gathered} 10x-10=180 \\ 10x=180+10 \\ x=\frac{190}{10} \\ x=19 \end{gathered}[/tex]

Complete the table for y=-3x + 5 and graph the resulting line. -

Answers

We fill the table as follows:

*We assign values for x and solve for y, that is:

*x = 0:

[tex]y=-3(0)+5\Rightarrow y=5[/tex]

So, the value of y when x = 0 is 5.

*x = 1:

[tex]y=-3(1)+5\Rightarrow y=2[/tex]

So, the value of y when x = 1 is 2.

*x = 2:

[tex]y=-3(2)+5\Rightarrow y=-1[/tex]

So, the value of y when x = 2 is -1.

*x = 3:

[tex]y=-3(3)+5\Rightarrow y=-4[/tex]

So, the value of y when x = 3 is -4.

***The table should look like this:

x | y

0 | 5

1 | 2

2 | -1

3 | -4

***The graph is:

How do I solve this and what is the answer

Answers

Answer:

157.5°

Explanation:

To convert from radians to degrees, multiply the angle in radians by 180/π.

Therefore, 7π/8 radians in degrees will be:

[tex]\begin{gathered} \frac{7\pi}{8}\text{ radians=}\frac{7\pi}{8}\times\frac{180}{\pi} \\ =\frac{7}{8}\times180 \\ =157.5\degree \end{gathered}[/tex]

what does this mean i dont get it please help me thanks, :)

Answers

It means that you are supposed to group The like terms together and simplify them

you will find that 2t is the liketerm with -5t and -u is a like term with -6u

As a results we have

[tex] = 2t - 5t - u - 6u \\ = - 3t - 7u[/tex]

as indicated I have shown you the answer .

good luck

how many pennies are in a dollar

Answers

Answer: 100

Step-by-step explanation:

$1 =100 pennies

select all of the following equations which represent a function?

Answers

To verify that something is a function, we use the horizontal line rule. That is, if the horizontal line passes through two points, then the graph is not a function, like this:

Then the circles and the ellipses are not functions. Then the functions in the problem would be:

1, 3 and 6.

The relation between the number of batteries (n) and the maximum height reached by the drone (h) in feet (ft) is given. Complete the table and check the correct box(es) given below.

Answers

We use the equation: h = 100(n + 2), so:

For n = 1:

[tex]h=100(1+2)=100(3)=300[/tex]

For n = 3:

[tex]h=100(3+2)=100(5)=500[/tex]

We can see that this is the correct equation. Therefore, given h we find n:

For h = 700

[tex]\begin{gathered} 700=100(n+2) \\ \frac{700}{100}=\frac{100}{100}(n+2) \\ 7=n+2 \\ 7-2=n+2-2 \\ n=5 \end{gathered}[/tex]

For h = 900

[tex]\begin{gathered} 900=100(n+2) \\ \frac{900}{100}=\frac{100}{100}(n+2) \\ 9=n+2 \\ 9-2=n+2-2 \\ n=7 \end{gathered}[/tex]

Answer:

(n): 1 3 5 7

(h): 300 500 700 900

Correct equation: h = 100(n + 2)

A train travels at 100 mph any equation can be written that compares the time with the distance to find the domain and range

Answers

ok

speed = distance / time

time = distance/speed

[tex]\text{ time = }\frac{dis\tan ce\text{ }}{speed}[/tex][tex]\text{ time = }\frac{dis\tan ce\text{ }}{100}[/tex]

or

[tex]\text{ distance = 100 x time}[/tex]

Other Questions
The sun was approaching the long mesa where it disappeared during the winter. what type of figurative language is included in this passage? hyperbole metaphor personification simile please helpcould you measure the volume of an object with a cube shape using the overflow can explain your answer. how far will you go (km) in 3 min traveling 60 km/hr? Simplify the following: (4x + 3) -2(4x - 7) - 3(x +7) Find the area of the prism in the figure shown. Solve for y.|6y + 12| = -18 True or False: Blood sugar would be lower than normal if the liver continually converted sugars into carbohydrates regardless of the amount of insulin circulating in the blood. Please can someone help solve the attached: Calculate the answers. 13. An orbiting satellite is positioned 3,105 mi above the earth (rearth = 3,959 mi) and orbits the earth once every 201.3 min. Assuming its orbit is a circle, find the distance traveled in 50.0 min. if you can tee the picture well please tell me consider the following basket of goods: 15 lollipops, 10 bars of chocolate, four jars of peanut butter, and two ice-cream cakes. suppose that in 1999, each lollipop was 10 cents, each bar of chocolate was $1.50, each jar of peanut butter was $2.50, and each ice-cream cake was $7.99. in 2018, each lollipop was 80 cents, each bar of chocolate was $3.75, each jar of peanut butter was $4.25, and each ice-cream cake was 12.99. what was the value of the basket in 2018? waste water treatment often has at least one oxidation-reduction step. in the collection of waste water, chlorine can be added to control corrosion by hydrogen sulfide to give sulfur and chloride ions. what is the balanced equation for the reaction that occurs in this step? include physical states in your answer. What resulted from this plan? george washington chose alexander hamilton to serve as the first secretary of the treasury. there were not enough funds for the federal government to create a national capital and pay its debts. the united states established a program to handle national debt and resolved a financial crisis. the new government entered into a conflict with american indian tribes along the potomac river. Sketch the graph and circle the points that are solutions. (0-0)(2,5)(-3,-5)(-3,2) Laying down my n buffer is concerned after receiving her weekly paycheck she believes that her deductions for social security,Medicare,and federal income ta withholding (fit) may be incorrect Larsen is paid a salary of 4330 she is married filling jointly and prior to this payroll check has total earnings of 140,460 what are the correct deductions for social security Medicare and fit assume a rate of 6.3% on 142,809 for social security and 1.45% for Medicare Steve stopped for a drink of water when he had completed 60% of his jog. He had traveled 3 miles. What is the total distance Steve jogged?2 miles3 miles4 miles5 miles6 miles Can someone help me with this??Write sentences correctly using pronouns, modifiers, and parallel sentence structuresWrite a two- to three-paragraph (at least 200 words) personal experience essay in which you use:all eight classes of pronouns: personal, demonstrative, relative, indefinite, intensive, reflexive, interrogative, and reciprocal. Underline and label one example of each type.at least one sentence containing parallel structure. Underline the parallel elements and identify their grammatical type.at least one sentence with an introductory modifying phrase properly related to the sentence that follows. Underline the introductory modifying phrase and identify its grammatical type. Low flow showerheads use 2 1/2 gallons of water per minute. If family members shower a total of 2 1/3 hours per week, how much water does the family use for showers each week? Write an expression that represents the problem. Then solve the problem. In 3 plays the southside football team drove 10 1/2 yards . How many yards did they average in each day? White privilege is the idea that one group in society enjoys certain unearned privileges and that group members are?.