Find the area of the prism in the figure shown.

Find The Area Of The Prism In The Figure Shown.

Answers

Answer 1

TherWe are asked to determine the area of the triangular prism. To do that we will add the area of the surfaces of the prism and add them together.

we have that the front and back areas are the areas of a triangle which is given by the following formula:

[tex]A_t=\frac{bh}{2}[/tex]

Where:

[tex]\begin{gathered} b=\text{ length of the base} \\ h=\text{ height of the triangle} \end{gathered}[/tex]

In this case, we have:

[tex]\begin{gathered} b=3 \\ h=4 \end{gathered}[/tex]

Substituting the values we get:

[tex]A_t=\frac{\left(3\right)\lparen4)}{2}[/tex]

Solving the operations:

[tex]A_t=6[/tex]

Since the front and back faces are the same triangle we can multiply the result by 2:

[tex]A_t=2\times6=12[/tex]

Therefore, the areas of the front and back faces add up to 12.

Now, we determine the area of the right side. This is the area of a rectangle and is given by the following formula:

[tex]A_r=lh[/tex]

Where:

[tex]\begin{gathered} l=\text{ length of the rectangle} \\ h=\text{ height of the rectangle} \end{gathered}[/tex]

In this case, we have:

[tex]\begin{gathered} l=5 \\ h=4 \end{gathered}[/tex]

Substituting the values we get:

[tex]A_r=\left(5\right)\left(4\right)[/tex]

Solving the operation:

[tex]A_r=20[/tex]

Now, we determine the area of the left face which is also a rectangle with the following dimensions:

[tex]\begin{gathered} h=5 \\ l=5 \end{gathered}[/tex]

Substituting we get:

[tex]A_l=\left(5\right)\left(5\right)=25[/tex]

Therefore, the area of the left side is 25.

The area of the bottom face is also a rectangle with the following dimensions:

[tex]\begin{gathered} h=5 \\ l=3 \end{gathered}[/tex]

Substituting we get:

[tex]A_b=\left(5\right)\left(3\right)=15[/tex]

Now, the total surface area is the sum of the areas of each of the faces:

[tex]A=A_t+A_r+A_l+A_b[/tex]

Substituting the values we get:

[tex]A=12+20+25+15[/tex]

Solving the operations:

[tex]A=72[/tex]

Therefore, the surface area is 72.


Related Questions

Annette Michaelson will need $11,000 in 8 years to help pay for her education. Determine the lump sum, deposited today at 4.5% compounded monthly, will produce the necessary amount.

Answers

Annette Michaelson will need $11,000 in 8 years to help pay for her education. Determine the lump sum, deposited today at 4.5% compounded monthly, will produce the necessary amount.​

we know that

The compound interest formula is equal to

[tex]A=P(1+\frac{r}{n})^{nt}[/tex]

[tex]A=P(1+\frac{r}{n})^{nt}[/tex]

where

A is the Final Investment Value

P is the Principal amount of money to be invested

r is the rate of interest  in decimal

t is Number of Time Periods

n is the number of times interest is compounded per year

in this problem we have

A=11,000

t=8 years

n=12

r=4.5%=0.045

substitute in the formula above

[tex]\begin{gathered} 11,000=P(1+\frac{0.045}{12})^{(12\cdot8)} \\ 11,000=P(\frac{12.045}{12})^{(96)} \\ \\ P=7,679.61 \end{gathered}[/tex]

therefore

the answer is

$7,679.61therefore

Solve the given equation:x = -8y + 9

Answers

We have to solve the equation.

[tex]x=-8y+9[/tex]

We have 2 unknowns and one equation, so we can only express one in function of the other.

We already have x in function of y, so we will now express y in function of x:

[tex]\begin{gathered} x=-8y+9 \\ x-9=-8y+9-9 \\ \frac{x-9}{-8}=\frac{-8y}{-8} \\ \\ -\frac{x}{8}+\frac{9}{8}=y \\ \\ y=-\frac{x}{8}+\frac{9}{8} \end{gathered}[/tex]

Answer:

y = -x/8 + 9/8

A restaurant offer 7 appetizers and 10 main courses.In how main ways can a person order a two-course meal

Answers

Take into account that there are 7 chices for the first course, and there are 10 choices for the entree.

The total number of choices is given bye:

total_choices = Choices_for_first_course x choices_fro_entree

Then, by replacing the values of the previous parameters you get:

total_choices = 7 x 10 = 70

There are 70 ways a person can order a two-course meal

4x + 3x = 56. What is the value of x?

Answers

Given

The expression is given as

[tex]4x+3x=56[/tex]

Explanation

To find x, add the expression.

[tex]\begin{gathered} 7x=56 \\ x=\frac{56}{7} \end{gathered}[/tex][tex]x=8[/tex]

Answer

Hence the value of x is 8.

[tex]4x + 3x = 56\\7x = 56\\x = 56/7\\x = 8[/tex]

The answer is X=8

Use Descartes Rules of signs to complete the chart with possibilities for the nature of the roots of the following equations:A) x^3 - x^2 + 4x - 6 = 0B) x^5 - x^3 + x + 1 = 0

Answers

Given:

[tex]\begin{gathered} x^3-x^2+4x-6=0 \\ x^5-x^3+x+1 \end{gathered}[/tex]

Required:

To determine the possibilities for the nature of the roots of the given equation.

Explanation:

(A)

Mrs. Navarro has 36 students in her class, 16 boys and 20 girls.Select all ratios below that correctly describe the ratio of boys to girls in Mrs.Navarros's class.

Answers

First, we need to know the ratio of boys to girls in Mrs. Navarro's class. There are 16 boys and 20 girls. The ratio would be 16:20.

From this given, we can choose from the options which rations are equivalent to our given ratio.

8 to 10 is a ratio that is equivalent from our given. If we scale are ratio by 2, we can get 8:10.

5:4, 8:18, and 5 to 9, however, are NOT equivalent to 16:20.

4:5 is equivalent. We just need to scale 16:20 by 4, and we will get 4:5.

10:8 is another ratio that is NOT equivalent to 16:20.

*Scaling ratios are similar to finding the lowest terms of fractions.

a wall in marcus bedroom is 8 2/5 feet high and 16 2/3 feet long. of he paints 1/2 of the wall blue, how many square feet will be blue?140128 2/157064 2/15

Answers

Answer:

[tex]70[/tex]

Explanation:

What we want to answer in this question is simply, the area of the room that will be painted blue if he decides he would paint exactly have the room blue

So, we need to simply get the area of the room and divide this by half

Mathematically, the area of a rectangle is the product of its two sides

Thus, we have it that the area of the room is:

[tex]\begin{gathered} 8\frac{2}{5}\times16\frac{2}{3} \\ \frac{42}{5}\times\frac{50}{3}\text{ = 14}\times10=140ft^2 \end{gathered}[/tex]

Now, to get the area painted blue, we divide this by 2 as follows or multiply by 1/2

We have this as:

[tex]140\times\frac{1}{2}=70ft^2[/tex]

For f(x) = 2x+1 and g(x) = x² − 7, find (f+ g)(x).

Answers

Given the functions:

[tex]\begin{gathered} f(x)=2x+1 \\ \\ g(x)=x^2-7 \end{gathered}[/tex]

By definition, (f+g)(x) is equivalent to:

[tex](f+g)(x)=f(x)+g(x)[/tex]

Finally, using the expressions for f and g:

[tex]\begin{gathered} f(x)+g(x)=2x+1+x^2-7 \\ \\ \therefore(f+g)(x)=x^2+2x-6 \end{gathered}[/tex]

If f(x) = x² is vertically stretched by a factor of 18 to g(x), what is the equation of g(x)?

Answers

We need to find the equation of the new function g(x) obtained by vertically stretching the function:

[tex]f\mleft(x\mright)=x²[/tex]

Vertically stretching a function by a factor of k corresponds to multiplying the whole expression of function by k:

[tex]g(x)=k\cdot f(x)[/tex]

In this problem, we have k = 18. Thus, we obtain:

[tex]g(x)=18\cdot f(x)=18x²[/tex]

Answer: C. g(x) = 18x²

Garret’s coin bank contains500 nickels dimes and quarters. He has the same number of nickels as dimes and the total value of the coins is &72.50. How many quarters does he have?

Answers

Since he has the same number of nickels as dimes.

x = nickels

x = dimes

500 - 2x = quarters

the total value of the coins is $72.50

5x + 10x + 25(500-2x) = 7250

Solve for x

15x + 25(500) + 25(-2x) = 7250

15x + 12,500 - 50x = 7250

Combine like terms

15x - 50x = 7250 - 12500

-35x = -5250

Divide both sides of the equation by -35

-35x/-35 = -5250/-35

x = 150

150 quarters

Hello I could really use help with this problem please!

Answers

Answer:

C

[tex]A=2\pi\text{ square units; }h=2\text{ units}[/tex]

Explanation:

Given:

Volume of a cylinder (V) = 4pi cubic units

To find:

Base area(A) and height(h)

Recall that the volume of a cylinder(A) is usually given as;

[tex]\begin{gathered} V=A*h \\ \end{gathered}[/tex]

So let's go ahead and try each of the options and see which gives us 4pi on the left-hand side as we have on the right-hand side for Volume.

For option A;

We have that A = 1 and h = 2, so we'll have;

[tex]\begin{gathered} V=A*h \\ 4\pi=1*2 \\ 4\pi\ne2 \end{gathered}[/tex]

For option B;

We have A = 2pi and h = 1, so we'll have;

[tex]\begin{gathered} 4\pi=2\pi *1 \\ 4\pi\ne2\pi \end{gathered}[/tex]

For option C;

We have A = 2pi and h = 2, so we'll have;

[tex]\begin{gathered} 4\pi=2\pi *2 \\ 4\pi=4\pi \end{gathered}[/tex]

We can see from the above that option C is the right option.

Is r = 3 + 3sin θ symmetrical along the y axis?

Answers

Answer:

Yes.  r = 3 + 3sin θ is symmetrical along the y axis

Step-by-step explanation:

Original polar equation is

r = 3 + 3sinθ

If this plot is to be symmetrical about the y axis then replacing Θ with (π-θ) in the original equation should not change the equation and thereby should not change the plot

r = 3 + 3sinθ

Replace θ with π-θ:

==>  3 + 3sin(π-θ)

But sin(π-θ) = sinθ

So the equation is unchanged at 3 + 3sin(π-θ) from the original equation r = 3 + 3sinθ

Hence the equation is symmetrical along the y-axis

This can be also be clearly seen if you plot both the equations, you will see the plot does not change

Find the volume round to the nearest 10th necessary. Use three. 144 pi and a calculator to get your answers.

Answers

The diameter of the cylinder is 24 mm.

Therefore, the radius is given by:

[tex]\frac{24}{2}=12mm[/tex]

The height of the cylinder is given as 5 mm.

The formula for the volume V of a cylinder with radius r and height h is given by:

[tex]V=\pi r^2h[/tex]

Substitute r = 12mm and h = 5 mm into the formula for volume:

[tex]V=\pi\left(12\right)^2\left(5\right)\approx2261.9[/tex]

Therefore, the volume of the cylinder is approximately 2261.9 mm².

.

Solve the inequality: 3x + 4 ≤ 5
Answer in interval notation.

Answers

(-∞,1/3] will be the required option in interval notation for the given inequality 3x + 4 ≤ 5 as it's definition states "a relationship between two expressions or values that are not equal to each other".

What is inequality?

A difference between two values indicates whether one is smaller, larger, or simply not equal to the other. a ≠ b says that a is not equal to b. a < b says that a is less than b. a > b says that a is greater than b. a ≤ b means that a is less than or equal to b. a ≥ b means that a is greater than or equal to b.

What is interval notation?

When using interval notation, we first write the set's leftmost number, then a comma, and finally its rightmost number. Depending on whether those two numbers are a part of the set, we then enclose the pair in parentheses or square brackets (sometimes we use one parenthesis and one bracket!).

Here,

3x+4≤5

3x≤1

x≤1/3

(-∞,1/3]

As it's definition states "a relationship between two expressions or values that are not equal to each other" (-∞,1/3] will be the required option in interval notation for the given inequality 3x + 4 ≤ 5.

To know more about inequality,

https://brainly.com/question/28823603?referrer=searchResults

#SPJ13

5/6+1/3×5/8 i need help

Answers

We will solve as follows:

[tex]\frac{5}{6}+\frac{1}{3}\cdot\frac{5}{8}=\frac{5}{6}+\frac{5}{24}=\frac{4}{4}\cdot\frac{5}{6}+\frac{5}{24}[/tex][tex]=\frac{20}{24}+\frac{5}{24}=\frac{25}{24}[/tex]

In the following diagram, we know that line AB is congruent to line BC and angle 1 is congruent to angle 2. Which of the three theorems (ASA, SAS, or SSS) would be used to justify that triangle ABC congruent triangle CDA?

Answers

The theorem that justifies why triangle ABC is congruent to triangle CDA is the: SAS.

What is the SAS Theorem?

The SAS theorem states that if we can show that two triangles have a pair of corresponding congruent included angles, and two pairs of corresponding sides that are also congruent to each other, then we can prove that both triangles are congruent to each other.

The triangles, ABC and CDA have:

Two pair of corresponding sides that are congruent to each other, which are AB ≅ BC, and AC ≅ CA.

A pair of corresponding included angles, which is angle 1 ≅ angle 2.

Based on the above known information, we can conclude that triangle ABC is congruent to triangle CDA by SAS theorem.

Learn more about the SAS on:

https://brainly.com/question/14252518

#SPJ1

help me pleaseeeeeeeee

Answers

The value of the car after 5 years is $13,500 and the value of the car after 9 years is $10,500.

According to the question,

We have the following information:

The value of the car is given by V(x) where x is the number of years.

V(x) = -1500x + 21,000

(a) Now, to find the value of car after 5 years, we will put 5 in place of x in the given expression:

V(5) = -1500*5+21000

V(5) = -7500+21000

V(5) = $13,500

(b) Now, to find the value of car after 9 years, we will put 9 in place of x in the given expression:

V(9) = -1500*9+21000

V(9) = -10500+21000

V(9) = $10,500

(c) When V(12) = 3000 then it means that the value of the car after 12 years is $3000.

Hence, the value of car after 5 years and 9 years is $13,500 and $10,500 respectively.

To know more about value here

https://brainly.com/question/20593631

#SPJ1

The table shows the amount of water used daily to water the fairways at Fairlawn Golf Course. To the nearest tenth,determine the mean absolute deviation of the data. A. 2.3 B. 7.7 C. 10 D. 12.3

Answers

Answer:

2.3

Explanation:

The formula for calulating mean deviation is expressed as:

[tex]\frac{1}{n}\sum ^n_{i\mathop=1}|x_i-m|[/tex]

where;

m is the mean of the data set

Xi are individual values

n is the total sample space

Get the mean;

n = 7

mean = (10+12+11+15+9+8+5)/7

mean = 70/7

mean = 10

Get the mean deviation:

Mean deviation = (10-10)+(12-10)+(11-10)+(15-10)+(9-10)+(8-10)+(5-10)/7

Since the values is in modulus |xi - m| will give a positive value, hence;

Mean deviation = (0+2+1+5+1+2+5)/7

Mean deviation = 16/7

Mean deviation = 2.28

Mean deviation = 2.3 (to the nearest tenth)

you want to buy one pair of pants, one t-shirt, and several pairs of socks. the pants cost $24.95, the t-shirt cost $22.50 and the socks are $5.95 per pair. how many pairs of socks can you buy if you have $80 to spend?*for this question you have to write and inequality solve it and answer the question in words*

Answers

ANSWER

5 pairs

EXPLANATION

We have that:

- one pair of pants cost $24.95

- one t-shirt costs $22.50

- one pair of socks cost $5.95

You want to buy one pair of pants, one t-shirt and several pairs of socks and you don't want to spend more than $80.

This means that everything you spend must be less than or equal to $80.

Let the number of pairs of socks you can buy be x.

This therefore means that:

[tex]\begin{gathered} 24.95+22.50+(5.95\cdot x)\text{ }\leq80 \\ \Rightarrow\text{ }24.95\text{ + 22.50 + 5.95x }\leq80 \\ \text{Find x:} \\ 47.45\text{ + 5.95x }\leq80 \\ \Rightarrow\text{ 5.95x }\leq80\text{ - 47.45} \\ 5.95x\text{ }\leq32.55 \\ x\text{ }\leq\frac{32.55}{5.95} \\ x\leq5.47 \end{gathered}[/tex]

Because we know that the number of pairs of socks must be a whole number, we have to approximiate to whole number, which will be:

x = 5

Therefore, you can buy at most 5 pairs of socks.

If | m, find the value of x.
1
m
(5x + 9)°
84°

Answers

Answer:

15

Step-by-step explanation:

5x + 9 and 84 are alternate interior angles.

Since,

lines l and m are parallel, alternate interior angles are equal.

So,

5x + 9 = 84

Step 1 : Subtract 9 on both sides.

5x = 84 - 9

5x = 75

Step 2 : Divide 5 on both sides.

x = 75/5

x = 15

Hence,

The value of x is 15.

Find equation of line containing the given points (4,3) and (8,0) Write equation in slope-intercept form

Answers

SOLUTION

Write out the given point

[tex]\begin{gathered} (4,3) \\ \text{and } \\ (8,0) \end{gathered}[/tex]

The equation of the line passing through the point above will be obtain by following the steps

Step1: Obtain the slope of the line

[tex]\begin{gathered} \text{slope,m}=\frac{y_2-y_1}{x_2-x_1} \\ \text{Hence } \\ x_1=4,x_2=8 \\ y_1=3,y_2=0 \end{gathered}[/tex]

Substituting the values we have

[tex]\begin{gathered} \text{slope,m}=\frac{0-3}{8-4}=-\frac{3}{4} \\ \text{Hence } \\ m=-\frac{3}{4} \end{gathered}[/tex]

Step 2: Obtain the y- intercept

The y-intercept is the point where the graph touch the y, axis

[tex]\begin{gathered} \text{slope, m=-3/4} \\ y=6 \\ y-intercept=6 \end{gathered}[/tex]

Steps 3; use the slope intercept rule

[tex]\begin{gathered} y=mx+b \\ \text{Where m=-3/4,b=y-intercept} \\ \text{Then } \\ y=-\frac{3}{4}x+6 \end{gathered}[/tex]

Hence

The equation in slope intercept form is

y = - 3/4 x + 6

zoe is 1.55 meters tall. at 2 pm she measure the lenght of a tree's shadow to be 17.35 meters . she stands 12.7 meters away from the tree so that the tip of her shadow meets the tip of tye tree's shadow. find the height of yhe tree to the nearest hundredth of a meter.

Answers

the figure below to better undesrtand the problem

Applying proportion

h/17.35=1.55/(17.35-12.70)

solve for h

h=17.35*1.55/4.65

h=5.78 m

Assume that when adults with smartphones are randomly selected , 52% use them in meetings or classes. If 7 adults smartphone users are randomly selected, find the probability that exactly 4 of them use their smartphones in meetings or classes.The probability is:

Answers

From the information available;

The population is 52% and the sample size is 7. The probability that exactly 4 of them use smartphones (if 7 adults are randomly selected) would be calculated by using the formula given;

[tex]\begin{gathered} p=52\text{ \%, OR 0.52} \\ n=7 \\ p(X=x) \\ We\text{ shall now apply;} \\ p(X=4)=\frac{n!}{x!(n-x)!}\times p^x\times(1-p)^{n-x} \end{gathered}[/tex]

We shall insert the values as follows;

[tex]\begin{gathered} p(X=4)=\frac{7!}{4!(7-4)!}\times0.52^4\times(1-0.52)^{7-4} \\ =\frac{5040}{24(6)}\times0.07311616\times0.110592 \\ =35\times0.07311616\times0.110592 \\ =0.28301218 \end{gathered}[/tex]

Rounded to four decimal places, this becomes;

[tex](\text{selecting exactly 4)}=0.2830[/tex]

ANSWER:

The probability of selecting exactly 4 smartphone users is 0.2830

Make a segmented bar chart to show the relationship between age and behavior toward humans.

Answers

1) Using the data from the table, we plot the following segmented bard chart for the relationship between age and behaviour toward humans.

2) From the graph we see that for each behaviour towards humans, we have approximately the same percentage of juveniles (around 10%) and adults (around 90%), that's because the blue and green portions are proportionally the same for each bar. Based on what we see from the graph, we conclude that there is no association between age and behaviour towards humans.

Find the equation of the line that is parallel to y= 3x -2 and contains the point (2,11) Y= ?x + ?

Answers

Solution:

Given:

[tex]\begin{gathered} y=3x-2 \\ \text{Through the point (2,11)} \end{gathered}[/tex]

Two parallel lines have identical slopes.

[tex]m_1=m_2[/tex]

Hence, the slope of line 1 is gotten by comparing the equation given to the equation of a line in the slope-intercept form.

[tex]\begin{gathered} y=mx+b \\ \text{where m is the slope} \\ b\text{ is the y-intercept} \end{gathered}[/tex]

Thus,

[tex]\begin{gathered} y=mx+b \\ y=3x-2 \\ \\ \text{Comparing both equations,} \\ m_1=3 \\ \text{The slope of line 1 is 3.} \end{gathered}[/tex]

Since both lines are parallel, then the slopes are equal.

[tex]\begin{gathered} m_1=m_2=3 \\ m_2=3 \\ \text{The slope of line 2 is 3} \end{gathered}[/tex]

To get the equation of line 2 through the point (2,11), the formula below is used;

[tex]\begin{gathered} \frac{y-y_1}{x-x_1}=m \\ \\ \text{where;} \\ x_1=2 \\ y_1=11 \\ m=3 \\ \text{Hence,} \\ \frac{y-11}{x-2}=3 \\ \text{Cross multiplying,} \\ y-11=3(x-2) \\ y-11=3x-6 \\ y=3x-6+11 \\ y=3x+5 \end{gathered}[/tex]

Therefore, the equation of the line that is parallel to y = 3x - 2 passing through the point (2,11) is;

[tex]y=3x+5[/tex]

I need help please!!

Answers

[tex]\begin{gathered} (10x^2-x+1)-(9x-2)= \\ 10x^2-x+1-9x+2= \\ 10x^2-10x+3 \end{gathered}[/tex]

A company has net sales revenue of $175000 reporting period and $148000 in the next. using horizontal analysis, it has experienced a decrease of what percentage?A. 15%B. 18%C. 8%D. 12%

Answers

ANSWER:

A. 15%

STEP-BY-STEP EXPLANATION:

We can determine the percentage using the following formula:

[tex]\begin{gathered} r=\frac{\text{ fiinal value - initial value}}{\text{ initial value}}\cdot100 \\ \\ \text{ we replacing} \\ \\ r=\frac{148000-175000}{175000}\cdot100 \\ \\ r=-15.42\%=15\% \end{gathered}[/tex]

Therefore, the correct answer is A. 15%

f(x) = 3x² - 5x+20
Find f(-8)

Answers

Answer:

Substitute x = -8 into f(x).

f(-8) = 3(-8)² - 5(-8) + 20

= 3(64) + 40 + 20

= 192 + 60

= 252

I need to find the length x of KL

Answers

Answer:

3.6

Step-by-step explanation:

We're going to use length DC and ML, along with DA and MJ

[tex]\frac{DC}{ML} = \frac{5}{6}[/tex] which is 0.833333333

now for

[tex]\frac{DA}{MJ} =\frac{7}{8.4}[/tex] which is 0.833333333 (again)

as you can see since the shapes ABCD and JKLM are similar, they have a relationship which in this case is 0.833333333

and we can use this 0.833333333 to help us find the length of KL

knowing that any length for ABCD divided by JKLM is 0.833333333

we can do

[tex]\frac{CB}{LK}=0.833333333[/tex]

since we don't know what KL is, we can switch the spots and enlongate it, to become:

[tex]\frac{CB}{0.833333333} =LK[/tex]

put in the value for CB

[tex]\frac{3}{0.833333333} =LK[/tex]

and we get 3.6

The length of x of KL is...

3.6

Given the following dataset, determine the mode 6056605570546055

Answers

Answer:

5

Step-by-step explanation:

put it in order

6056605570546055

and the one that appears the most is the mode

Other Questions
Henry has 3 3/5 metres of rope, and Sam has a piece of rope that is 1 1/2 metresshorter. What is the total amount of rope that the boys have together? HOLLYWOOD DREAMS OF WEALTH, YOUTH, AND BEAUTY Write an equation of a line that is parallel to thegiven line. Then, write one that is perpendicular.x = -4 7. Principal = $39,300, Rate = 4.5%, Time = 6 months. What will that total principal + interest payment be rounded to the nearest dollar? o Lidhe total amount of if the probability of drawing an A or B is 9/25, what is the probability of the complementary event? The table to right gives the projections of the population of a country from 2000 to 2100.Answer parts (a) through (c). How many grams of CO are produced when 33.0 g of C reacts? Fe2O3(s)+3C(s)2Fe(s)+3CO(g) What type of energy is the sum of kinetic and potential energy in an object that is used to do work?. ANSWER ASAP!! Raise the monomial to a power: -2m^3n^2t to the power of 4 a taxpayer may exclude which of the following from their gross income?A. an allocation of income from a business structured as a partnership, based on the taxpayers percentage of ownership.B. dividend income from a mutual fund investment.C. gain from the sale of rental property.D. life insurance if paid by reason of death of the insured Solve the system of equations below using any method you learned in this unit. Show all work (even if you are using your calculator). Deposits are insured by the federal deposit insurance corporation up to _____________ per depositor. larry signs a note payable for $40,000. the principal of the note and interest are due in 2 years, and the note bears interest at 12% compounded annually. what is the total interest that must be repaid at the end of year 2? The distance to your brother's house is 481 miles, and the distance to Disneyland is 518 miles. If it took 13 hours to drive to your brother's house, how long would you estimate the drive to Disneyland to take? Sarah wants to take a vacation that will cost 2,562 if sarah plans to save for 9 months, then how much needs to be saved per month Why would Democratic-Republicans disagree with the Marshall Courts decision in McCulloch v Maryland? Find an equation for the perpendicular bisector of the line segment whoseendpoints are (-3, 2) and (7, 6). The segments shown below could form a triangle 6 5 8 true or false what or who caused the plague in idm-al -wardi Select all the correct answers.Look at the examples in highlighted text. Which show Clifford's problem with depression? (Choose three.) Continually, as we may express it, he faded away... "My dearest cousin, cannot you tell me... Each time, the delay seemed to be without purpose... Yet there were no tokens that his physical strength.. "This is our cousin Phoebe...