Jo borrowed $3800 for 8 months from a bank at 5.5% a. how much interest did jo pay the bank for the us of it's money?b. how much did he pay total?

Answers

Answer 1

Let's begin by listing out the given information:

Loan (p) = $3,800

Time (t) = 8 months = 8/12 year

Interest rate (r) = 5.5%

a)

We calculate it thus:

[tex]\begin{gathered} I=\frac{p\times r\times t}{100} \\ I=\frac{3800\times5.5\times\frac{8}{12}}{100}=139.33 \\ I=\text{\$}139.33 \end{gathered}[/tex]

b)

The amount paid in total is:

[tex]\begin{gathered} A=p+I \\ A=3800+139.33=3939.33 \\ A=\text{\$}3939.33 \end{gathered}[/tex]


Related Questions

Ryan bought 3 1/2 boxes of paper clips. Allan bought 1 3/4 more boxes than Ryan.

Colin bought 1 1/2 times as many boxes as Allan How many boxes did Colin buy?

Answers

Answer:

Colin bought 7 7/8 boxes

Step-by-step explanation:

Let R represent  the number of boxes bought by Ryan and A represent the number of boxes bought by Allan

R = 3 1/2

Convert to improper fraction:
3 1/2 = (3 x 2 + 1)/2 = 7/2

Allan bought 1 3/4 more boxes than Ryan

A = R + 1 3/4

Convert 1 3/4 to improper fraction:
1 3/4  7/4

So A = 7/2 + 7/4 = 14/4 + 7/4 = 21/4

Colin bought 1 1/2 times as many boxes as Allan
C = 1 1/2 x A

Convert 1 1/2 to improper fraction:

1 1/2 = 3/2

So C = 3/2 x 21/4

= 63/8 = 7 7/8 boxes

find the length of the gray arc in terms of pi

Answers

Given

a: angle

a = 60

r: radius

r = 3

Procedure

The length of an arc depends on the radius of a circle and the central angle θ

[tex]\begin{gathered} s=\theta r \\ s=\frac{1}{3}\pi\cdot3 \\ s=\pi \end{gathered}[/tex]

The answer would be s = pi

Joe has $6,500 to invest One option is to invest some of his money in an account that earns 3% simple interest and the rest in an account that earns 2% simple interest. Joe would like to make at least $200 in interest this year. The following system of equations can be used to help Joe determine how much of his money he should invest at each rate. x +y = 6500 0.03x + 0.02y ≥ 200 The mathematical solution to this system is x=7000. Explain what the solution means in terms of how much Joe should invest in each account.

Answers

Data:

[tex]\begin{gathered} x+y=6500 \\ \\ 0.03x+0,02y\ge200 \end{gathered}[/tex]

In this case;

x is the amount of money Joe should invest in first account (with 3% simple interest)

y is the amount of monet Joe should invest in second account (with 2% simple interest)

Then, if the mathematical solution for the given system is x=7000 it means that in order to get at least $200 in interest this year Joe needs to invest a bigger amount of money that he has, in the fisrt account ($7000) and in the second account y Joe shoul take a loan of $500 with 2% simple interest

[tex]\begin{gathered} x=7000 \\ x+y=6500 \\ y=6500-x_{} \\ y=6500-7000=-500 \end{gathered}[/tex]

The currency in Kuwait is the Dinar. Theexchange rate is approximately $3 forevery 1 Dinar. At this rate, how manyDinars would you get if you exchanged$54?

Answers

It is given that the exchange rate is $3 per Dinar. It is required to find how many Dinars you will get if $54 is exchanged.

Since 1 Dinar is equivalent to $3, it follows that the number of Dinars equivalent to $54 is:

[tex]\frac{54}{3}=18\text{ Dinar}[/tex]

The answer is 18 Dinar.

Find the future value in dollars of an 18 month investment of $4900 into simple interest rate account that has an annual simple interest rate of 5.5%

Answers

Answer:

$5304.25.

Explanation:

The simple interest formula is given by

[tex]A=P(1+rt)[/tex]

where

A = future value

P = princple amount

r = interest rate /100

t = time interval.

Now in our case

A = unknown

P = $4900

r = 5.5 / 100

t = 18 / 12 ( we are converting months to years. 18 months = 18 /12 years )

Putting the above values into the simple interest rate formula gives

[tex]A=4900\lbrack1+\frac{5.5}{100}\times(\frac{18}{12})\rbrack[/tex]

which simplifies to give

[tex]\boxed{A=\$5304.25.}[/tex]

Hence, the future value is $5304.25.

find the measures of GH and CH.

Answers

The length of the lines GH and CH are 16 units and 12 units.

What is a line?A line is an object in geometry that is infinitely long and has neither width nor depth nor curvature. Since lines can exist in two, three, or higher-dimensional spaces, they are one-dimensional objects. The term "line" can also be used to describe a line segment in daily life that has two points that serve as its ends. In geometry, lines are drawn with arrows at either end to indicate that they extend indefinitely. Two line points can be used to name a line (for example, AB) or just a letter, usually in lowercase (for example, line m ). The ends of a line segment are two.

So, the measure of lines GH and CH:

We know that AC ⊥ GH hence cuts GH in two equal lines.

GB = BH GB is 8 units then BH is also 8 units.GB = BH = 8 units.

But,

GH = GB + BHGH = 8 + 8GH = 16 units

We can observe that △GCH is an isosceles triangle.

GC = CHGC = CH = 12 units

Therefore, the length of the lines GH and CH is 16 units and 12 units.

Know more about lines here:

https://brainly.com/question/24644930

#SPJ13

Please help me sketch a graph for this sequence (I've already solved it): 2/3, 1, 3/2, 9/4, 27/8

Answers

ANSWER and EXPLANATION

We have that the 1 - 5th terms of the sequence are:

2/3, 1, 3/2, 9/4 and 27/8

To plot the graph of this sequence, we have:

=> on the x axis, the term number (i.e. n = 1, 2, 3, 4, 5)

=> on the y axis, the term(i.e. a(n) 2/3, 1, 3/2, 9/4, 27/8)

We will plot the graph of n versus a(n).

That is:

That is the graph.

Find the volume of each rectangular prism. Round to the tenths.

Answers

Answer:

To find the volume of the given cuboid.

Length of the cuboid = 6.8 yd

Breadth of the cuboid = 4.5 yd

Height of the cuboid = 3.4 yd

We get,

Volume of a cuboid is,

[tex]=l\times b\times h[/tex]

where l,b and h are the length, breadth and height respectively.

Substitute the values we get,

[tex]=6.8\times4.5\times3.4[/tex][tex]=104.04\text{ yd}^3[/tex]

Answer is: Volume of the cuboid is 104.04 cubic yards.

What is the most specific name for each type of special quadrilateral

Answers

From the given quadilaterals, let's determine the specific name for each based on the property marked.

• 1a. ,All four sides are marked equal.

Since all four sides are equal, we can say the specific name for the quadilateral is a Square.

A square is a quadilateral with four equal sides.

• 1b. In this quadilateral, we have one pair of parallel sides.

Given that the quadilateral is NOT drawn to scale, the quadilatral here can be said to be a Trapezoid.

A trapezoid is a quadilateral with one pair of parallel side.

• 1c. In this quadilateral, all four angles are marked as right angles.

Given that all four angles are right angles, the specific name for the quadilateral is a Rectangle.

A rectangle is a quadilateral with four interior right angles.

ANSWER:

• 1a. Square

,

• 1b. Trapezoid

,

• 1c. Rectangle.

find the coordinates of the vertex of the following parabola algebraically. write your answer as an (x,y) point..y=x²+9

Answers

Explanation:

using the parabola formula:

y = a(x-h)² + k²

vertex = (h, k)

We are given a parebola equation of: y = x²+9

comparing both equations to get the vertex:

y = y

a = 1

(x-h)² = x²

x² = (x + 0)²

(x-h)² = (x + 0)²

h = 0

+k = +9

k = 9

The vertex of the parabola as (x, y): (0, 9)

Solve for x in 2(2-x)=4(-2+x)

Answers

Given the equation:

[tex]2(2-x)=4(-2+x)[/tex]

First, we open the brackets

[tex]4-2x=-8+4x[/tex]

Next, we collect like terms. (Bring terms containing x to the left-hand side)

[tex]\begin{gathered} -2x-4x=-8-4 \\ -6x=-12 \end{gathered}[/tex]

Finally, we divide both sides by -6 (negative 6) to obtain x.

[tex]\begin{gathered} \frac{-6x}{-6}=\frac{-12}{-6} \\ x=2 \end{gathered}[/tex]

The value of x is 2.

HELP PLEASE ANWER AS SOON AS POSSIBLE ALSO PLEASE GIVE A STEP BY STEP EXPLANATION PLEASE!!

Answers

Given that f(x)=x2-4/3, f(a)=7, and f(11)=b, a+b can only be a multiple of prime numbers is 5

This calculator for finding the prime factors and the factor tree of an integer is available for use.

How is a prime factor discovered?

The simplest method for determining a number's prime factors is to keep dividing the starting number by prime factors until the result equals 1. When we divide the number 30 by its prime factors, we obtain 30/2 = 15, 15/3 = 5, and 5/5 = 1. We received the balance, thus it cannot be factored any further.

Example: 36 can be written as the product of two prime factors, 22 and 32. The prime factorization of 36 is stated to equal the equation 22 32.

TO learn more about prime factors refer to:

https://brainly.com/question/18187355

#SPJ13

Me.Hoffman has a doorstop in his classroom shaped like a triangular prism shown

Answers

- To determine the perimeter of the base, consider that the length is 5 in and the width is the same as the width of the top face of the prism, that is, 2 in. Then, the perimeters is:

P = 2l + 2w

w = 2 in

l = 5 in

P = 2(5 in) + 2(2 in)

P = 10 in + 4 in

P = 14 in

- The height of the doorstop is 1.2 in

- The area of the base is:

A = wl

A = (2 in)(5 in)

A = 10 in²

Rectangle R measures 18 in by 6 in. Rectangle S is a scaled copy of Rectangle R. Select all of themeasurement pairs that could be the dimensions of Rectangle S.24 in by 8 in9 in by 3 in2 in by 1 in6 in by 2 in3 in by 2 in

Answers

In order to find possible dimensions for the scaled rectangle, the proportion between the dimensions of the rectangles must be the same.

So first let's find this proportion for rectangle R:

[tex]\frac{18}{6}=3[/tex]

Now, let's find the proportion of the possible options of rectangle S:

[tex]\begin{gathered} \frac{24}{8}=3 \\ \\ \frac{9}{3}=3 \\ \\ \frac{2}{1}=2 \\ \\ \frac{6}{2}=3 \\ \\ \frac{3}{2}=1.5 \end{gathered}[/tex]

So the correct options are the first, second and fourth options.

Determine the largest integer value of x in the solution of the following inequality.

Answers

Answer:

From the solution the largest possible integer value of x is;

[tex]-6[/tex]

Explanation:

Given the inequality;

[tex]-x-1\ge5[/tex]

To solve, let's add 1 to both sides of the inequality;

[tex]\begin{gathered} -x-1+1\ge5+1 \\ -x\ge6 \end{gathered}[/tex]

then let us divide both sides of the inequaty by -1.

Note: since we are dividing by a negative number the inequality sign will change.

[tex]\begin{gathered} \frac{-x}{-1}\leq\frac{6}{-1} \\ x\leq-6 \end{gathered}[/tex]

Therefore, From the solution the largest possible integer value of x is;

[tex]-6[/tex]

There are four Defenders on a soccer team if this represents 20% of the players on the team which equation can be used to find the total number of players on the team

Answers

Given in the question:

a.) There are four Defenders on a soccer team.

b.) This represents 20% of the players on the team.

help meeeeeeeeee pleaseeeeeeeeeee!!!



thank youu

Answers

The required domain and the range of the given function is (0, ∞) and (-8, -2) respectively.


Given that,
A graph of the function is shown we have to determine the domain and range of the function with the help of the graph.

What is a domain?

The domain is defined as the values of the independent variable for which there is a certain value of the dependent variable exists in the range of the function.

Here,
As of the graph,
The graph describes as only the positive real number because the graph only consists of the positive x-axis, so the domain of the function is all positive real numbers. While the ordinate of the graph is describe for -8 to -2 on the negative y-axis thus the rang of the given function lies between -8 to -2.

Thus, the required domain and the range of the given function is (0, ∞) and (-8, -2) respectively.

Learn more about the domain here:

https://brainly.com/question/28135761

#SPJ1  

The distance from the earth to Pluto is 4.67x10^9 mi, If a new flying machine can travel 1.92x10^5 miles per year, how many years would it take to reach Pluto? Write your answer in standard form, rounded to the nearest year.

Answers

24333 years

Explanation

to solve this we need to use the time formula ,it says

[tex]time=\frac{distance}{speed}[/tex]

Step 1

a)given

[tex]\begin{gathered} distance=4.67*10^9\text{ miles} \\ speed=1.92*10^5\text{ }\frac{miles}{year} \end{gathered}[/tex]

b) now, replace in the formula and calculate

[tex]\begin{gathered} time=\frac{distance}{speed} \\ time=\frac{4.67*10^9}{1.92*10^5}=2.43*10^{9-5}=2.43*10^4 \\ time=2.43*10^4\approx24333\text{ years} \end{gathered}[/tex]

therefore, the answer is

24333 years

I hope this helps you

10x + 45x - 13 = 11(5x + 6)

Answers

We have to find the solution for the equation:

[tex]\begin{gathered} 10x+45x-13=11\cdot(5x+6) \\ 55x-13=11\cdot5x+11\cdot6 \\ 55x-13=55x+66 \\ 55x-55x=66+13 \\ 0\cdot x=79 \end{gathered}[/tex]

The equation has no solution, becuase there is no value of x that satisfy the equation.

I just need to know the answer quick because I have to go somewhere

Answers

From the given graph, it is seen that f(x) is not defined for x<-4. The function g(x) is not defined for x>2

But the function p(x) represents a straight line which is defined for all real x.

Hence, the function p(x) has all real numbers as its domain.

Thus, the correct option is (D)

A car can travel 28 miles per gallon of gas. How far can the car travel on 8 gallons of gas?

Answers

A car can travel 28 miles per gallon of gas. How far can the car travel on 8 gallons of gas?

Applying proportion

28/1=x/8

solve for x

x=(28)*8

x=224 miles

the answer is 224 miles

What is the slope of this line?
Enter your answer as a whole number or a fraction in simplest form in the box.

Answers

Answer:

1/4

Step-by-step explanation:

you just look at rise over run from one point to another and simplify.

6. Oliver is playing a game in which he has to choose one of two numbers (2 or 7) and then one of five vowels (a, e, i, o, or u). How many possible outcomes are there? 2 7 There are possible outcomes.

Answers

Answer

Number of possible outcomes for everything = 240 ways

Explanation

The number of possible outcomes can be calculated by taking each of these two groups.

First group contains 2 elements

Number of possible ways to pick the elements = 2! = 2 × 1 = 2 ways

Second group contains 5 elements

Number of possible ways to pick the elements = 5! = 5 × 4 × 3 × 2 × 1 = 120 ways

Number of possible outcomes for everything = 2! × 5! = 2 × 120 = 240 ways

Hope this Helps!!!

What is the slant height and surface area of the pyramid

Answers

we have that

The surface area of the pyramid is equal to the area of its square base plus the area of its four triangular faces

step 1

Find out the area of the square base

A=15^2

A=225 ft2

step 2

Find out the area of one triangular face

the area of a triangle is equal to

A=(1/2)(b)(h)

we have

b=15 ft

h ----> is the slant height

To find out the slant height, apply the Pythagorean Theorem

h^2=10^2+(15/2)^2

h^2=100+56.25

h=12.5 ft

therefore

A=(1/2)(15)(12.5)

A=93.75 ft2

step 3

The surface area is equal to

SA=225+4(93.75)

SA=600 ft2 and the slant height is 12.5 ft

How many terms are included in the expression below?x² – 3x+7A. 2B. 7o oC. 1D. 3

Answers

Answer:

Choice D: 3 terms

Explanation:

The term of a expressions constant or a variable of an equation, The variable

Identify the property of real numbers illustrated in the following equation.(-5) + (y · 7) = (y · 7) + (-5)

Answers

By definition, the commutative property of addition says that changing the order of addends does not change the sum, which is precisely what the equation is trying to show by changing the order of the sum, therefore, the property illustrated is the commutative property of addition.

Jeremy said I added 3/4+1/5 and got 4/9, does Jeremy’s answer make sense? Explain how you know without calculating the answer

Answers

If

[tex]\frac{3}{4}+\frac{1}{5}=\frac{4}{9}[/tex]

That would imply that 9 is a common multiple of 4 and 5, which is false since 9=3^2.

Additionally, 3/4 is greater than 4/9; so 3/4+1/5 has to be greater than 4/9.

What is x in x/4=1.8/5

Answers

Solution:

x/4 = 1.8/5
Multiply both sides by 4
x = 7.2/5
x = 1.44

Answer:

x = 1.44

Step-by-step explanation:

Multiply both sides by 4 to get rid of the denominator on the LHS(Left hand Side) of the equation and you get x

(x/4) x 4 = 1.8/5 x 4

x = 1.44

The table shows the temperature (y) at different altitudes (x). This is a linear relationship. Use the equation y = -0.004x + 59 to determine the temperature at an altitude of 5,000 feet. 0 Altitude (ft), x Temperature (°F),y 2,000 51 4,000 43 6,000 35 59 8,000 27 10,000 12,000 19 11 The temperature at an altitude of 5,000 feet Is OF.

Answers

EXPLANATION:

We must replace in the equation given the altitude in the variable x ; the exercise is as follows:

[tex]\begin{gathered} y=-0.004x+59 \\ y=-0.004(5,000)+59 \\ y=-0.02+59 \\ y=58.98 \\ \text{ANSWER: The temperature at an altitude of 5,000 is 58.98} \end{gathered}[/tex]

Identify the vertex and axis of symmetry of the quadratic equation. Then, sketch the graph f(x) = (x + 2)² - 1

Answers

Answer

Vertex = (-2, -1)

Axis of symmetry: x = -2

The graph of the function is presented below

Explanation

The vertex of a quadratic equation is the point where the graph of the quadratic equation changes from sloping negatively to sloping positively and vice-versa.

The axis of symmetry represents the straight line that divides the graph of the quadratic equation into two mirror parts that are similar to and are mirror images of each other. This axis of symmetry usually passes through the vertex.

To find the vertex, it is usually at the turning point where the first derivative of the quadratic equation is equal to 0.

(df/dx) = 0

f(x) = (x + 2)² - 1

f(x) = x² + 4x + 4 - 1

f(x) = x² + 4x + 3

At the vertex, (df/dx) = 0

(df/dx) = 2x + 4

2x + 4 = 0

2x = -4

Divide both sides by 2

(2x/2) = (-4/2)

x = -2

We can then obtain the corresponding y-coordinate of the vertex

f(x) = (x + 2)² - 1

f(-2) = (-2 + 2)² - 1

f(-2) = 0² - 1

f(-2) = -1

So, the vertex is given as

Vertex = (-2, -1)

Although, one can obtain the vertex from the form in which that equation is given, the general form is that

f(x) = (x - x₁)² + y₁

Comparing that with

f(x) = (x + 2)² - 1

we see that,

x₁ = -2, y₁ = -1

So, Vertex: (-2, -1)

Then, the axis of symmetry will be at the point of the vertex.

Axis of symmetry: x = -2

And for the graph, we just need to obtain a couple of points on the line to sketch that.

when x = 0

f(x) = (x + 2)² - 1

f(0) = (0 + 2)² - 1

f(0) = 4 - 1 = 3

(0, 3)

when y = 0

x = -3 and x = -1

So,

(-3, 0) and (-1, 0)

(-2, -1), (0, 3), (-3, 0) and (-1, 0)

So, with these points, we can sketch the graph.

The graph of this function is presented under answer above.

Hope this Helps!!!

Other Questions
Two legs of a step ladder are each 4 metres long. The angle formed between the two legs is 30degrees.Make a labelled scale drawing of the ladder using the scale Icm=0.5 metres and fill in the blanksbelow. as you perform a sonographic exam, you switch from a 3.5 mhz transducer to a 7.0 mhz transducer to image a superficial structure. compared to the 3.5 mhz transducer, what will the 7.0 mhz attenuation rate and wavelength be? Can someone help me make a thesis statement on why was Anna May Wong a frontier in history? Ill mark you brainliest Need help pleaseI was bad at math in school so lwant to learn 13. if we assume that there is no fixed manufacturing overhead and the variable manufacturing overhead is $7 per direct labor-hour, what is the estimated cost of goods sold and gross margin for july? the total cost of 4800 pounds of the metal now held in inbentory is 310000 the total selling price is 862000 and the estimated costs of disposal are 13800 at what amount should the inventory of 4800 pounds be reported in the balance sheet Henry has 3 3/5 metres of rope, and Sam has a piece of rope that is 1 1/2 metresshorter. What is the total amount of rope that the boys have together? HOLLYWOOD DREAMS OF WEALTH, YOUTH, AND BEAUTY Write an equation of a line that is parallel to thegiven line. Then, write one that is perpendicular.x = -4 7. Principal = $39,300, Rate = 4.5%, Time = 6 months. What will that total principal + interest payment be rounded to the nearest dollar? o Lidhe total amount of if the probability of drawing an A or B is 9/25, what is the probability of the complementary event? The table to right gives the projections of the population of a country from 2000 to 2100.Answer parts (a) through (c). How many grams of CO are produced when 33.0 g of C reacts? Fe2O3(s)+3C(s)2Fe(s)+3CO(g) What type of energy is the sum of kinetic and potential energy in an object that is used to do work?. ANSWER ASAP!! Raise the monomial to a power: -2m^3n^2t to the power of 4 a taxpayer may exclude which of the following from their gross income?A. an allocation of income from a business structured as a partnership, based on the taxpayers percentage of ownership.B. dividend income from a mutual fund investment.C. gain from the sale of rental property.D. life insurance if paid by reason of death of the insured Solve the system of equations below using any method you learned in this unit. Show all work (even if you are using your calculator). Deposits are insured by the federal deposit insurance corporation up to _____________ per depositor. larry signs a note payable for $40,000. the principal of the note and interest are due in 2 years, and the note bears interest at 12% compounded annually. what is the total interest that must be repaid at the end of year 2? The distance to your brother's house is 481 miles, and the distance to Disneyland is 518 miles. If it took 13 hours to drive to your brother's house, how long would you estimate the drive to Disneyland to take?