Which expressions are equivalent to 46 ?Choose all answers that apply:A6 + 2(b + 26)B36 +62(26)

Answers

Answer 1

hello

to solve this question, we just have to find the expression that is equal to 4b

option A

[tex]b+2(b+2b)=b+2b+4b=7b[/tex]

option a is incorrect

let's look at option B

[tex]3b+b=4b[/tex]

option B is correct

and finally option C

[tex]2(2b)=4b[/tex]

option C is correct

from the calculations above, option B and C are the right answers


Related Questions

ABCD is a quadrilateral
Work out the length of BC
Give your answer correct to 1 decimal place.

Answers

Using the law of cosines, the length of BC in the given quadrilateral is: 8.1 cm.

What is the Law of Cosines?

The law of cosines that can be used to find the length of a side of a triangle with a known included angle and two sides is:

c² = a² + b² - 2 × a × b × Cos C.

Considering right triangle ABD,

BD = a

DC = b

BC = c

Use the Pythagorean theorem to find the length of BD in the quadrilateral as shown in the diagram:

BD = √(7.5² + 5²)

BD = √(7.5² + 5²)

BD = 9.0 cm

Use the law of cosines to find the length of BC:

BC² = BD² + DC² - 2 × BD × DC × Cos <BDC.

Substitute

BC² = 9.0² + 13² - 2 × 9.0 × 13 × Cos 38

BC² = 250 - 184.4

BC² = 65.6

BC = √65.6

BC = 8.1 cm

Learn more about the law of cosines on:

https://brainly.com/question/4372174

#SPJ1

can you show how to solve this proplem

Answers

In the given figure : lines l and m are parallel and a, b are transversal

Since, the lines a and b are parallel and l act as a transversal.

Then,

[tex]\begin{gathered} \angle BAC=\angle ACb\text{ (alternate interior angles)} \\ \text{ Substitute the values} \\ 2x=46 \\ x=\frac{46}{2} \\ x=23 \end{gathered}[/tex]

x = 23

Answer : x = 23

m(x) = | x + 1 |
Graph

Answers

The value of x = 1/M-1 , x = -1/M+1

What is Graph?

The graph of a function f is the set of ordered pairs where "displaystyle f(x)=y" exists. In the common scenario when x and f(x) are real integers, these pairings represent Cartesian coordinates of points in two-dimensional space and hence constitute a subset of this plane.

M(x) = |x + 1|

|x + 1| = M(x)

x + 1 = M(x)

x + 1 = -M(x)

Adding (-x) both side

x + 1 + (- x) = M(x) + (- x)

x + 1 + (- x) = -M(x) + (- x)

x + 1 - x = M(x) - x

x + 1 - x = -M(x) - x

1 = M(x) - x

1  = -M(x) - x

M(x) - x = 1

-M(x) - x  = 1

x(M-1)  = 1

x(-M-1)  = 1

Dividing both side with (M - 1) and (-M - 1)

x(M-1)/(M - 1)   = 1/(M - 1)

x(-M-1)/(-M - 1)  = 1 /(-M - 1)

x = 1/(M - 1)

x = 1/(-M - 1)

Hence, x = 1/M-1 , x = -1/M+1

To learn more about Graph click on the link

https://brainly.com/question/4025726

#SPJ9

Which number line and equation show how to find the distance from -2 to 5? O O A. 1-2-(-5) 2 3 12-1-5) sing O c. 1-2-5 D. 2-5

Answers

To find the distance between two numbers on the number line, you have tu use absolute value

So, if I want to know the distance from -2 to 5, all I have to do is to substract 5 from -2 and then apply absolute value, like this:

[tex]\mleft|-2-5\mright|\text{ = }\mleft|-7\mright|\text{ = 7}[/tex]

And the number line should look like this:

5. Identify whether each unit measures length, volume, or weight (or mass).
1.
Mile
Cup.
Pound
Centimeter
2.
3.
4.
5.
Liter
6.
Gram
7.
Pint
8.
Yard
9. Kilogram
10. Teaspoon,
11. Milliliter

Answers

Answer:

See below

Step-by-step explanation:

Length (L), volume (V), weight(W), or mass(M)

Mile     L

Cup           V

Pound   W

Centimeter L

Liter     V

Gram   M

Pint           V

Yard   L

Kilogram   M

Teaspoon  V

Milliliter    V

1. Mile

2. Cup

3. Pound

4. Centimeter

5. Liter

6. Gram

7. Pint

8. Yard

9. Kilogram

10. Teaspoon,

11. Milliliter

2,048 rounded to the nearest tenth?

Answers

answer to the question that you have

2,048.0

2050 because

1-9 = ones place

10-99 = tenth place

100-999 = hundrends place

1000 - 999999 - thousands place

and you round to the nearest 0 if it is 5 or up and if it is 1 to 4 it stays the same

given the domain {-2,2,4} what is the range for relation 3x+y=3a (-9,3,9)b (9,-3,-9)c (-3,9,15)d (0,5,7)

Answers

the relation is 3x + y = 3

so,

y = 3x - 3

the domain is the values of x

so, substitute with each value of {-2,2,4} at the last equation of y

when x = -2 , y = 3*-2 - 3 = -6 - 3 = -9

when x = 2 , y = 3 * 2 - 3 = 6 - 3 = 3

when x = 4 , y = 3 * 4 - 3 = 12 - 3 = 9

so, the range will be {-9 , 3 , 9}

The correct answer is option a. (-9,3,9)x

You don't need to explain if you don't want.

Answers

Answer:

1

Step-by-step explanation:

The absolute value of x is the black line, therefor the absolute value of x-1 is the blue line

Hope that helps

it usually takes davin 1 3/4 hours to get to his aunt's house . due to labor day traffic this year it took 3 1/5 hours .how much longer did it take this year

Answers

It took David 1 [tex]\frac{3}{4}[/tex] hours more to reach her aunt's home due to labor day traffic.

What is unitary method?

The unitary method is a method in which you find the value of a single unit and then the value of a required number of units.

Given is Davin who needs 1 3/4 hours to get to his aunt's house. However, due to the labor day traffic this year it took him 3 1/5 years.

We have to find the difference between the time span Davin took to reach his aunt's house.

Time taken by Davin without the labor day traffic = T[N] = 1 3/4 = 7/4 hours

Time taken by Davin with the labor day traffic = T[L] = 3 1/5 = 16/5 hours

Difference in time spans = T[D] = T[L] - T[N]

T[D] = 16/5 - 7/4

T[D] = 3.2 - 1.75

T[D] = 1.45 = 1 + 0.45

T[D] = 1 [tex]\frac{3}{4}[/tex] hours  

Davin took 1 [tex]\frac{3}{4}[/tex] hours more.

Therefore, it took David 1 [tex]\frac{3}{4}[/tex] hours more to reach her aunt's home due to labor day traffic.

To solve more questions on unitary method, visit the link below-

https://brainly.com/question/13659834

#SPJ1

Select the correct answer.
Function g is a transformation of the parent cosine function such that g(x) = 3 cos (x + 2) + 1. Which graph represents function g?

Answers

Option C gives the graph of Function g is a transformation of the parent cosine function such that g(x) = 3 cos(x + 2) + 1 as it the graph of cosine function.

What is cosine function?

The ratio between the adjacent side and the hypotenuse is known as the cosine function (or cos function) in triangles. One of the three primary trigonometric functions, cosine is the complement of sine (co+sine) and one of the three main trigonometric functions.

What is Graph?

A graph is a structure that resembles a set of objects in mathematics, more specifically in graph theory, in which some pairs of the objects are conceptually "related." The objects are represented by mathematical abstractions known as vertices, and each pair of connected vertices is referred to as an edge.

Choice C provides a graph of the parent cosine function is transformed into function g such that g(x) = 3 cos(x + 2) + 1 on the cosine function graph.

To know more about graph,

https://brainly.com/question/17267403?referrer=searchResults

#SPJ13

Answer:

see photo

be sure to look closely, the top curves go to 4 and the bottom goes to -2, there are 2 with this same shape but the other one does not go high enough.

Step-by-step explanation:

Plato/Edmentum

Given h(t) = –16t2 + 32t + 5, what is the value of h(2)? *Type in your answer. h(2) =

Answers

The value of the function h(2) for h(t) = -16t2 + 32t + 5 is h(2) = 5

How to determine the function value?

From the question, the function definition is given as

h(t) = -16t2 + 32t + 5

First, we express the exponent in the function properly

This is represented as

h(t) = -16t² + 32t + 5

The function value to calculate is given as

h(2)

This means that we calculate h(t) when t = 2

So, we have

h(2) = -16(2)² + 32(2) + 5

Evaluate the exponents

h(2) = -16(4) + 32(2) + 5

So, we have

h(2) = 5

Hence, the function value is 5

Read more about functions at

https://brainly.com/question/28532394

#SPJ1

ASAP NEED HELP WILL GIVE BRAINLIEST

Answers

The value of the unknown angle x is 22 degrees.

How to find the angle x?

SV is a parallel to RU.

RV is a transversal line that cut across the parallel lines SV and RU.

Therefore,

x = ∠V(alternate angles)

Alternate angles are congruent.

Hence,

∠V + 44 + 5x + 4 = 180 (sum of angles in a triangle)

x + 44 + 5x + 4 = 180

x + 5x + 48  = 180

6x + 48 = 180

6x = 180 - 48

6x = 132

divide both sides by 6

x = 132  /6

x = 22 degrees

learn more on angles here: https://brainly.com/question/10254268

#SPJ1


Write an explicit formula for an, the nth term of the sequence
64, -16, 4,....

Answers

The formula for the given arithmetic series for the term aₙ will be aₙ=a₁+(n-1)d.

What is arithmetic series?An arithmetic series is the sum of a sequence like 2,..., where each term is calculated by adding (or subtracting) a constant from the previous one. An ordered group of numbers with a shared difference between each succeeding term is known as an arithmetic sequence. For instance, the common difference in the arithmetic series 3, 9, 15, 21, and 27 is 6.

So, the possible sequence of -64, -16, 4:

We can notice the sequence as -(4³), -(4²), 4, 4², 4³.

So, the formula for the aₙ term will be:

aₙ = a₁ + (n - 1)d

Therefore, the formula for the given arithmetic series for the term aₙ will be aₙ = a₁ + (n - 1)d.

Know more about arithmetic series here:

https://brainly.com/question/6561461

#SPJ13

The correct question is given below:

Write an explicit formula for an, the nth term of the sequence

-64, -16, 4,....

equationsWrite a system of equations to describe the situation below, solve using elimination, and fill inche blanks.lada gets paid at home for doing extra chores. Last week, she did 1 load of laundry and 8oads of dishes, and her parents paid her $26. The week before, she finished 3 loads ofaundry and 8 loads of dishes, earning a total of $30. How much does Jada earn forcompleting each type of chore?

Answers

In this problem, we are going to write and solve a system of equations based on a real world situation.

Last week, she did 1 load of laundry and 8 loads of dishes, and her parents paid her $26. The week before, she finished 3 loads of laundry and 8 loads of dishes, earning a total of $30.

To begin, we need to create variables for the unknown cost of each chore.

Let x represent laundry, and let y represent dishes.

From the first equation, we can write the equation:

[tex]x+8y=26[/tex]

We can write the second equation as:

[tex]3x+8y=30[/tex]

Together, we have the system:

[tex]\begin{cases}x+8y={26} \\ 3x+8y={30}\end{cases}[/tex]

Multiply the first equation by -1, then add it to the second equation:

[tex]\begin{gathered} \begin{cases}-1(x+8y={26)} \\ 3x+8y={30}\end{cases} \\ \\ \begin{cases}-x-8y={-26} \\ 3x+8y={30}\end{cases} \\ \\ (-x+3x)+(-8y+8y)=-26+30 \\ 2x=4 \end{gathered}[/tex]

We can divide the remaining equation by 2 on both sides:

[tex]\begin{gathered} \frac{2x}{2}=\frac{4}{2} \\ \\ x=2 \end{gathered}[/tex]

Lada made $2 per load of laundry.

We can use the value of x in the first equation to find the value of y. Substitute x = 2:

[tex]2+8y=26[/tex]

Subtract 2 from both sides:

[tex]8y=24[/tex]

Divide by 8 on both sides:

[tex]y=3[/tex]

Lada made $3 per load of dishes.

The table shows a proportional relationship.


x 12 8 24
y 3 2 6


Describe what the graph of the proportional relationship would look like.
A line passes through the point (0, 0) and continues through the point (3, 12).
A line passes through the point (0, 0) and continues through the point (2, 8).
A line passes through the point (0, 0) and continues through the point (6, 24).
A line passes through the point (0, 0) and continues through the point (12, 3).

Answers

A graph which best describes what the proportional relationship would be D. A line that passes through the point (0, 0) and continues through the point (12, 3).

What is a graph?

In Mathematics, a graph is used to graphically represent data points on both the horizontal and vertical lines of a cartesian coordinate, which are the x-axis and y-axis respectively.

Additionally, a graph which shows a proportional relationship between two variables would always have a straight line with its data points passing through the origin (0, 0).

Since the graph represents a proportional relationship we will get;

Constant of proportionality, we get;

k = 12/3 = 8/2 = 24/6

k = 4

Ratio,

24:6

= 12:3.

Therefore, A line that passes through the point (0, 0) and continues through the point (12, 3).

Read more on graphs here:

brainly.com/question/4546414

#SPJ1

Suppose a golf ball bounces off a wall at a point P, and that
line mis perpendicular to the wall at point P.
What is the measure of the angle of reflection?
A. 50°
B. 40°
C. 140°
D. 90°

Answers

40 degrees because reflection is is the same like a mirror

Tanya is training a turtle for a turtle race. For every 1/2 of an hour that the turtle is crawling, he can travel 1/20 of a mile. At what rate is the turtle crawling in miles per hour

Answers

If Tanya is training a turtle for a turtle race. For every 1/2 of an hour that the turtle is crawling, he can travel 1/20 of a mile. The  rate that  the turtle is crawling in miles per hour is:  0.2 miles /hour .

Determining the Unit rate per mile

Given data:

1/2 of an hour  =  1/20 of a mile

Now let determine the unit rate

Unit rate that the turtle is crawling is: (1/20)/(1/2)

Hence,

Unit rate  = (1/20)×(2/1)

Unit rate  = 2/20 miles/hour

Unit rate = 0.2 miles /hour

Therefore the rate is 0.2 miles per hour.

Learn more about unit rate here: https://brainly.com/question/19493296

#SPJ1

If for every 1/2 of an hour that the turtle is crawling, he can travel 1/20 of a mile. then 0.1mile/ hour is the rate at which turtle travel per hour.

What is Ratio?

A ratio is an ordered pair of numbers a and b, written a / b where b does not equal 0.

Given that,

A turtle is trained by Tanya,

For every 1/2 of an hour that the turtle is crawling, he can travel 1/20 of a mile.

We need to find at what rate the turtle is travelling per hour.

Let x be the distance travelled by turtle in hour.

1/20/1/2=x/1

Apply cross multiplication

x/2=1/20

x=2/20

x=0.1 miles / hour

Hence 0.1 miles per hour is the turtle travelling per hour.

To learn more on Ratios click:

https://brainly.com/question/1504221

#SPJ1

5 (u - 5) + 6u = 8 solve for u and simplifly your answer as much as possible

Answers

Answer:

u = 3

Step-by-step explanation:

Step 1: Distribute 5 in u - 5

[tex]\displaystyle{5\cdot u - 5\cdot 5 +6u=8}\\\\\displaystyle{5u-25+6u=8}[/tex]

Step 2: Add like terms together (u-term)

[tex]\displaystyle{11u-25=8}[/tex]

Step 3: Add both sides by 25

[tex]\displaystyle{11u-25+25=8+25}\\\\\displaystyle{11u=33}[/tex]

Step 4: Divide both sides by 11

[tex]\displaystyle{\dfrac{11u}{11}=\dfrac{33}{11}}\\\\\displaystyle{u=3}[/tex]

Answer Check

Step 1: Substitute u = 3 in the equation

[tex]\displaystyle{5(3-5)+6(3)=8}[/tex]

Step 2: Evaluate & Simplify

[tex]\displaystyle{5(-2)+18=8}\\\\\displaystyle{-10+18=8}\\\\\displaystyle{8=8}[/tex]

Since the equation is true after substituting u = 3. Therefore, the answer is u = 3.

Please let me know if you have any questions!

Triangle TAB has a perimeter of 40 cmeters. Could the measures of the sides as shown actually represent the measures of the sides of the triangle? Justify your answer.

Answers

EXPLANATION

We can apply the Obtuse Triangle Theorem to check if the the measures of the sides appropiately represents the measures of the triangle:

Perimeter = 40 cm = 4x + 2x + 2 + x + 3

Adding like terms:

40 = 7x + 5

Subtracting 5 to both sides:

40 - 5 = 7x

Adding like terms:

35 = 7x

Dividing both sides by 7:

35/7 = x

Simplifying:

[tex]5=x[/tex]

Then, by the obtuse triangle theorem, the following relationship should be fulfilled.

Find the union, AUB, for of the following pair of sets. Enter "DNE" for the empty set.A = (-∞, - 5], B = [5, ∞)

Answers

Given

Two sets A = (-∞, - 5], B = [5, ∞)

Find

union, AUB

Explanation

Union of two sets A and B is the set of all elements that are present in A or in B

so , here A = (-∞, - 5], B = [5, ∞)

then union of set A and B is given by

[tex]A\cup B=(-\infty,-5]\cup[5,\infty)[/tex]

Final Answer

Therefore., the union of A and B is (-∞, - 5] U [5, ∞)

PLSS HELP I NEED ASAP

Answers

Answer:

m = -5

n = -2

Step-by-step explanation:

5m + 6n = -37

10m + 4n = -58 multiply first equation by -2

-2 × 5m + 6n = -37

-10m + (-12n) = 74 now add two equations up

10m - 10m + 4n - 12n = 74 - 58 add/ subtract like terms

-8n = 16 divide both sides by -8

n = -2

to find the value of m, replace n with -2 in the first equation

5m + 6*(-2) = -37

5m - 12 = -37 add 12 to both sides

5m = -25 divide both sides by 5

m = -5

Factorise 4x^2+13x-15​

Answers

The factors of the given quadratic equations are [tex]\frac{-13+\sqrt{409} }{8}[/tex] and [tex]\frac{-13-\sqrt{409} }{8}[/tex]

What is factorization?

When we try to write the given equation in terms of linear values from which we calculate the roots of the given equation then we say that we have factorized them. Root of a equation means a value which satisfies a equation.

We are given a quadratic equation

[tex]4x^2+13x-15[/tex]

We use quadratic formula to compute the factor of the equation

[tex]x=\frac{-b}{2a}[/tex]±[tex]\frac{\sqrt{b^2-4ac} }{2a}[/tex]

[tex]x=\frac{-13}{8}[/tex]±[tex]\frac{\sqrt{169+240} }{8}[/tex]

[tex]x=\frac{-13}{8}[/tex]±[tex]\frac{\sqrt{409} }{8}[/tex]

Therefore the factors are [tex]\frac{-13+\sqrt{409} }{8}[/tex] and [tex]\frac{-13-\sqrt{409} }{8}[/tex]

To learn more about factorization please refer

https://brainly.com/question/25829061

#SPJ13

a train increased its prices from £663 to £895.05 how much has this increased in a percentage

Answers

Answer:

The price has increased 35%

Step-by-step explanation:

Given

Initial price = £663,New price = £895.05.

Find the percent increase

Find the amount of increase:

£895.05  - £663 = £232.05

Find the percent value of the increase over the initial price:

232.05/663 × 100% = 35%

Question 1 3 pts Isis has 4.8 m of ribbon for crafts. She wants to share it evenly with 12 friends. How many centimeters of ribbon would 5 friends get?

Answers

We will investigate the equal distribution of ribbon amoung her friends.

Isis has a ribbon for crafts for a certain length ( L ):

[tex]L\text{ = 4.8 m}[/tex]

Isis has ( n ) number of friends amoung which she wants to equally distribute the length ( L ) of her ribbon:

[tex]n\text{ = 12}[/tex]

Under the assumption of equal distribution we can divide the total length of ribbon ( L ) amoung Isis ( n ) of friends to determine what length ( l ) each friend got:

[tex]\begin{gathered} l\text{ = }\frac{L}{n} \\ \\ l\text{ = }\frac{4.8}{12} \\ \\ l\text{ = 0.4 m or 40 cm} \end{gathered}[/tex]

So each friend of Isis got a piece of 40 cm length of the ribbon. So the length of the ribbon accumulated for 5 friends would involves the direct multiplication of 5 number of friends and length of each piece ( l ):

[tex]\begin{gathered} 5\text{ friends got = 5 }\cdot\text{ l} \\ 5\text{ friends got = 5 }\cdot\text{ 40} \\ 5\text{ friends got = }200\text{ cm} \end{gathered}[/tex]

Therefore, the answer to the question is:

[tex]200\text{ cm}[/tex]

How to solve? Please help i will give good rating.​

Answers

Answer:

6.  Draw a vertical line that goes though points (4,7) and (4,9).  For a relation to be a function, each input has to have only one output.  The input 4 cannot have the output of 7 and 9.  This proves that this is not a function

7. The range is 91, 3, 6, 10 and 15)

Step-by-step explanation:

The range is the answer if you put in the x for range that they give you.

For example:

x ( x+ 1)/2  If I put in 1 for x, I will get

1(1+1)/2

2/2

1

When the input is 1, the output is one.  You that for each of the domains given and you will find the ranges (outputs) that I have written above.

The two angles pictured below are vertical angles.

Two lines intersect. The vertical angles measure eighty-four degrees and eight times x minus twelve.
What is the value of x?

Answers

The value of x in the vertical angles is 12.

What are vertically opposite angles?

When two lines intersect each other, then the opposite angles, formed due to intersection are called vertical angles or vertically opposite angles.

In other words, vertically opposite angles are angles that are opposite one another at a specific vertex and are created by two straight intersecting lines.

Vertically opposite angles are congruent.

Therefore, the vertical angles measures 84 degrees and 8x - 12.

Let's find the value of x using the principle of vertically opposite angles.

Therefore,

84 = 8x - 12

add 12 to both sides of the equation

84 + 12 = 8x - 12 + 12

96 = 8x

divide both sides by 8

x = 96 / 8

x = 12

learn more on vertically opposite angles here: https://brainly.com/question/18045519

#SPJ1

The manager at the local auto shop has found that the probability that a car brought into the shop requires an oil change is 0.68, the probability that a car brought into the shop requires brake repair is 0.32, and the probability that a car requiresboth anoil change and brake repair is 0.11. For a car brought into the shop, determine the probability that the car will require an oil change or brake repair.The probability that the car requires an oil change or brake repair is

Answers

Remember that

P(A or B)=P(A)+P(B)-P(A and B)

In this problem, we have that

Event A and Event B are not independent

we have

P(A)=0.68

P(B)=0.32

P(A and B)=0.11

substitute

P(A or B)=0.68+0.32-0.11

P(A or B)=0.89

The answer is 0.89

same as my last two questions

Answers

The intervals to the given function are as follows:

Domain: (-∞,∞).Range: (-∞,∞).Rel. maximums: (1.366, -0.652).Rel. minimums: (-0.366, -5.848) and (2,-1).End behavior: As x -> -∞, f(x) -> ∞, and as x -> ∞, f(x) -> ∞.Inc. intervals: (-0.366, 1.366) U (2, ∞).Dec. intervals: (-∞, -0.366) U (1.366, 2).

Domain and range

Domain: Set of values of the input of the function, hence the values of x in the graph of the function.Range: Set of values of the output of the function, hence the values of y in the graph of the function.

This function is defined(values of x) for all real values and also assumes all real values(values of y), hence both the domain and the range are of the function are given by the interval (-∞,∞).

Increasing and decresing

From the graph, the function is classified as decreasing or increasing according to the direction of movement in the graph, as follows:

Decreasing: Right and down.Increasing: Right and up.

Hence the intervals are given as follows:

Increasing: (-0.366, 1.366) U (2, ∞).Decreasing: (-∞, -0.366) U (1.366, 2).

Relative maximum and relative minimum

The relative minimum is when the graph of the function changes from decreasing to increasing, hence it is at these two following points:

(-0.366, -5.848) and (2,-1).

The relative maximum is when the function changes from increasing to decreasing, hence it is at this following point:

(1.366, -0.652).

End behavior

The end behavior of the function is given by the limits of the function when x go to infinity, looking to the left and to the right of the graph of the function, hence:

Left: Moves up, hence as x -> -∞, f(x) -> ∞.Right: Moves up, hence as x -> ∞, f(x) -> ∞.

More can be learned about functions at https://brainly.com/question/28949511

#SPJ1

Evaluate cos 150° without using a calculator.Ο Α.√32B. 2O C. -1/2OD. -32

Answers

Answer:

Explanation:

Note that:

[tex]\begin{gathered} cos(A+B)=cosAcosB-sinAsinB \\ cos(150^0)=cos(90+60) \end{gathered}[/tex]

Applying the addition formula given above to cos 150:

[tex]\begin{gathered} cos(150)=cos(90)cos(60)-sin(90)sin(60) \\ \\ cos(150)=0(\frac{1}{2})-1(\frac{\sqrt{3}}{2}) \\ \\ cos(150)=0-\frac{\sqrt{3}}{2} \\ \\ cos \end{gathered}[/tex]

How much greater is 8.5 x 10^-2 than 6.6 × 10^-5 ?

Answers

Answer:

1288 times greater

Step-by-step explanation:

(8.5x10^-2)/(6.6x10^-5)

(8.5/6.6)*(10^-2/10^-5)

(1.29)*(10^3)

1288 times greater

Other Questions
what is a sales return?multiple choice question.a sales return refers to merchandise that customers return to the seller after a sale.a sales return is the cash discount given for early payment of an invoice.a sales return refers to merchandise a seller acquires, but then returns to the buyer.a sales return is designed to shorten the payment period between the buyer and the seller. For the function f(x)= x^2+4x-1, what is the range of f (x) for the domain {-2,0,1}? according to government data, 51% of employed women have never been married. rounding to 4 decimal places, if 15 employed women are randomly selected: a. what is the probability that exactly 2 of them have never been married? b. that at most 2 of them have never been married? c. that at least 13 of them have been married? Find an equation of the line described. Write the equation in slope-intercept form.With slope of -2 through (0,4)the equation of the line is y=0 Determine which set of side measurements could be used to form a triangle. 12, 23, 7 10, 7, 2 8, 3, 11 5, 11, 8 all of the following would enhance recruiter effectiveness except: group of answer choices ensuring that recruiters provide applicants with timely feedback. recruiting in teams rather than individually. using realistic work perusal as part of the recruitment process. ensuring that recruiters are knowledgeable about company policies and procedures. underline and fix the dangling modifier:Fishing for trout, our boat tipped over. 4. WATER Mr. Williams pays $40 a monthfor city water, no matter how manygallons of water he uses in a givenmonth. Let x represent the number ofgallons of water used per month. Let yrepresent the monthly cost of the citywater in dollars. What is the equation ofthe line that represents this information?What is the slope of the line?+0 Dave and his friends went out to celebrate his birthday at Chill's in buda. their meal cost $86 and they left a 15% tip how much was the total bill including tip? a rectangle width is 3 1/2 inches and the lenght is 4 3/4 inches. What is the area of the rectangle? What is the area of a rectangle with vertices(-1, -4), (-1, 6), (3, 6), and (3, -4)?* 16 square units24 square unitsO 36 square units40 square units a political candidate has asked you to conduct a poll to determine what percentage of people support her. a) suppose the candidate believes that the percentage that support her is approximately 73%. if we want a 6% margin of error at a 94% confidence level, what size sample is needed? you are given a 1/5 model of a car that normally runs at 30 mph. what wind tunnel speed should you use to test the car? (assume kinematic viscosity does not change and ) the snowy tree cricket is sometimes called the temperature cricket because the frequency of it chirps varies based on the temperature. the number of chirps per minute is 148 less than 4 times the outside temperature in degrees fahrenheit. write an equation that relates the number of chirps per minute, x, and the outside temperature in degrees fahrenheit, f. whatiis the outside temperature if a snowy tree cricket chirps 100 times a day? What is the effect on the volume of a cylinder if the radius is doubled while the height is halved?A. The volume is halved.B. The volume remains the same.C. The volume is multiplied by 4.D. The volume is doubled. Find the surface area of a glazed donut with an outer diameter of 7 cm and an inner diameter of 3 cm. The donut is 2 cm tall The area of this figure 20 in. is square inches. 28 in. 30 in. 7 in. 25 in. Which is a run-on sentence?I had a vivid dream lastnight, you were in it.The map's legend indicatesthe meaning of its symbols. lipids that form membranes have what kind of structure? completely polar, which allows them to dissolve in water. polar heads and polar tails, which allows them to interact with water on both sides of the membrane. polar heads and nonpolar tails; the nonpolar tails interact with water. polar heads and nonpolar tails; the polar heads interact with water. It's in the photo, it's a bit to hard to type out.